20333 lines
968 KiB
JavaScript
Executable File
20333 lines
968 KiB
JavaScript
Executable File
/*!
|
|
FullCalendar Scheduler v5.11.5
|
|
Docs & License: https://fullcalendar.io/scheduler
|
|
(c) 2022 Adam Shaw
|
|
*/
|
|
var FullCalendar = (function (exports) {
|
|
'use strict';
|
|
|
|
/*! *****************************************************************************
|
|
Copyright (c) Microsoft Corporation.
|
|
|
|
Permission to use, copy, modify, and/or distribute this software for any
|
|
purpose with or without fee is hereby granted.
|
|
|
|
THE SOFTWARE IS PROVIDED "AS IS" AND THE AUTHOR DISCLAIMS ALL WARRANTIES WITH
|
|
REGARD TO THIS SOFTWARE INCLUDING ALL IMPLIED WARRANTIES OF MERCHANTABILITY
|
|
AND FITNESS. IN NO EVENT SHALL THE AUTHOR BE LIABLE FOR ANY SPECIAL, DIRECT,
|
|
INDIRECT, OR CONSEQUENTIAL DAMAGES OR ANY DAMAGES WHATSOEVER RESULTING FROM
|
|
LOSS OF USE, DATA OR PROFITS, WHETHER IN AN ACTION OF CONTRACT, NEGLIGENCE OR
|
|
OTHER TORTIOUS ACTION, ARISING OUT OF OR IN CONNECTION WITH THE USE OR
|
|
PERFORMANCE OF THIS SOFTWARE.
|
|
***************************************************************************** */
|
|
/* global Reflect, Promise */
|
|
|
|
var extendStatics = function(d, b) {
|
|
extendStatics = Object.setPrototypeOf ||
|
|
({ __proto__: [] } instanceof Array && function (d, b) { d.__proto__ = b; }) ||
|
|
function (d, b) { for (var p in b) if (Object.prototype.hasOwnProperty.call(b, p)) d[p] = b[p]; };
|
|
return extendStatics(d, b);
|
|
};
|
|
|
|
function __extends(d, b) {
|
|
if (typeof b !== "function" && b !== null)
|
|
throw new TypeError("Class extends value " + String(b) + " is not a constructor or null");
|
|
extendStatics(d, b);
|
|
function __() { this.constructor = d; }
|
|
d.prototype = b === null ? Object.create(b) : (__.prototype = b.prototype, new __());
|
|
}
|
|
|
|
var __assign = function() {
|
|
__assign = Object.assign || function __assign(t) {
|
|
for (var s, i = 1, n = arguments.length; i < n; i++) {
|
|
s = arguments[i];
|
|
for (var p in s) if (Object.prototype.hasOwnProperty.call(s, p)) t[p] = s[p];
|
|
}
|
|
return t;
|
|
};
|
|
return __assign.apply(this, arguments);
|
|
};
|
|
|
|
function __spreadArray(to, from, pack) {
|
|
if (pack || arguments.length === 2) for (var i = 0, l = from.length, ar; i < l; i++) {
|
|
if (ar || !(i in from)) {
|
|
if (!ar) ar = Array.prototype.slice.call(from, 0, i);
|
|
ar[i] = from[i];
|
|
}
|
|
}
|
|
return to.concat(ar || from);
|
|
}
|
|
|
|
var n,l$1,u$1,t,r$1,o,f$1,e$1,c$1={},s=[],a$1=/acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;function h(n,l){for(var u in l)n[u]=l[u];return n}function v$1(n){var l=n.parentNode;l&&l.removeChild(n);}function y(l,u,i){var t,r,o,f={};for(o in u)"key"==o?t=u[o]:"ref"==o?r=u[o]:f[o]=u[o];if(arguments.length>2&&(f.children=arguments.length>3?n.call(arguments,2):i),"function"==typeof l&&null!=l.defaultProps)for(o in l.defaultProps)void 0===f[o]&&(f[o]=l.defaultProps[o]);return p(l,f,t,r,null)}function p(n,i,t,r,o){var f={type:n,props:i,key:t,ref:r,__k:null,__:null,__b:0,__e:null,__d:void 0,__c:null,__h:null,constructor:void 0,__v:null==o?++u$1:o};return null==o&&null!=l$1.vnode&&l$1.vnode(f),f}function d(){return {current:null}}function _(n){return n.children}function k$1(n,l,u,i,t){var r;for(r in u)"children"===r||"key"===r||r in l||g$2(n,r,null,u[r],i);for(r in l)t&&"function"!=typeof l[r]||"children"===r||"key"===r||"value"===r||"checked"===r||u[r]===l[r]||g$2(n,r,l[r],u[r],i);}function b$1(n,l,u){"-"===l[0]?n.setProperty(l,null==u?"":u):n[l]=null==u?"":"number"!=typeof u||a$1.test(l)?u:u+"px";}function g$2(n,l,u,i,t){var r;n:if("style"===l)if("string"==typeof u)n.style.cssText=u;else {if("string"==typeof i&&(n.style.cssText=i=""),i)for(l in i)u&&l in u||b$1(n.style,l,"");if(u)for(l in u)i&&u[l]===i[l]||b$1(n.style,l,u[l]);}else if("o"===l[0]&&"n"===l[1])r=l!==(l=l.replace(/Capture$/,"")),l=l.toLowerCase()in n?l.toLowerCase().slice(2):l.slice(2),n.l||(n.l={}),n.l[l+r]=u,u?i||n.addEventListener(l,r?w$2:m$1,r):n.removeEventListener(l,r?w$2:m$1,r);else if("dangerouslySetInnerHTML"!==l){if(t)l=l.replace(/xlink(H|:h)/,"h").replace(/sName$/,"s");else if("width"!==l&&"height"!==l&&"href"!==l&&"list"!==l&&"form"!==l&&"tabIndex"!==l&&"download"!==l&&l in n)try{n[l]=null==u?"":u;break n}catch(n){}"function"==typeof u||(null==u||!1===u&&-1==l.indexOf("-")?n.removeAttribute(l):n.setAttribute(l,u));}}function m$1(n){t=!0;try{return this.l[n.type+!1](l$1.event?l$1.event(n):n)}finally{t=!1;}}function w$2(n){t=!0;try{return this.l[n.type+!0](l$1.event?l$1.event(n):n)}finally{t=!1;}}function x$1(n,l){this.props=n,this.context=l;}function A(n,l){if(null==l)return n.__?A(n.__,n.__.__k.indexOf(n)+1):null;for(var u;l<n.__k.length;l++)if(null!=(u=n.__k[l])&&null!=u.__e)return u.__e;return "function"==typeof n.type?A(n):null}function P$1(n){var l,u;if(null!=(n=n.__)&&null!=n.__c){for(n.__e=n.__c.base=null,l=0;l<n.__k.length;l++)if(null!=(u=n.__k[l])&&null!=u.__e){n.__e=n.__c.base=u.__e;break}return P$1(n)}}function C$1(n){t?setTimeout(n):f$1(n);}function T$1(n){(!n.__d&&(n.__d=!0)&&r$1.push(n)&&!$$1.__r++||o!==l$1.debounceRendering)&&((o=l$1.debounceRendering)||C$1)($$1);}function $$1(){var n,l,u,i,t,o,f,e;for(r$1.sort(function(n,l){return n.__v.__b-l.__v.__b});n=r$1.shift();)n.__d&&(l=r$1.length,i=void 0,t=void 0,f=(o=(u=n).__v).__e,(e=u.__P)&&(i=[],(t=h({},o)).__v=o.__v+1,M(e,o,t,u.__n,void 0!==e.ownerSVGElement,null!=o.__h?[f]:null,i,null==f?A(o):f,o.__h),N(i,o),o.__e!=f&&P$1(o)),r$1.length>l&&r$1.sort(function(n,l){return n.__v.__b-l.__v.__b}));$$1.__r=0;}function H$1(n,l,u,i,t,r,o,f,e,a){var h,v,y,d,k,b,g,m=i&&i.__k||s,w=m.length;for(u.__k=[],h=0;h<l.length;h++)if(null!=(d=u.__k[h]=null==(d=l[h])||"boolean"==typeof d?null:"string"==typeof d||"number"==typeof d||"bigint"==typeof d?p(null,d,null,null,d):Array.isArray(d)?p(_,{children:d},null,null,null):d.__b>0?p(d.type,d.props,d.key,d.ref?d.ref:null,d.__v):d)){if(d.__=u,d.__b=u.__b+1,null===(y=m[h])||y&&d.key==y.key&&d.type===y.type)m[h]=void 0;else for(v=0;v<w;v++){if((y=m[v])&&d.key==y.key&&d.type===y.type){m[v]=void 0;break}y=null;}M(n,d,y=y||c$1,t,r,o,f,e,a),k=d.__e,(v=d.ref)&&y.ref!=v&&(g||(g=[]),y.ref&&g.push(y.ref,null,d),g.push(v,d.__c||k,d)),null!=k?(null==b&&(b=k),"function"==typeof d.type&&d.__k===y.__k?d.__d=e=I$1(d,e,n):e=z$1(n,d,y,m,k,e),"function"==typeof u.type&&(u.__d=e)):e&&y.__e==e&&e.parentNode!=n&&(e=A(y));}for(u.__e=b,h=w;h--;)null!=m[h]&&("function"==typeof u.type&&null!=m[h].__e&&m[h].__e==u.__d&&(u.__d=L$1(i).nextSibling),q(m[h],m[h]));if(g)for(h=0;h<g.length;h++)S(g[h],g[++h],g[++h]);}function I$1(n,l,u){for(var i,t=n.__k,r=0;t&&r<t.length;r++)(i=t[r])&&(i.__=n,l="function"==typeof i.type?I$1(i,l,u):z$1(u,i,i,t,i.__e,l));return l}function j$2(n,l){return l=l||[],null==n||"boolean"==typeof n||(Array.isArray(n)?n.some(function(n){j$2(n,l);}):l.push(n)),l}function z$1(n,l,u,i,t,r){var o,f,e;if(void 0!==l.__d)o=l.__d,l.__d=void 0;else if(null==u||t!=r||null==t.parentNode)n:if(null==r||r.parentNode!==n)n.appendChild(t),o=null;else {for(f=r,e=0;(f=f.nextSibling)&&e<i.length;e+=1)if(f==t)break n;n.insertBefore(t,r),o=r;}return void 0!==o?o:t.nextSibling}function L$1(n){var l,u,i;if(null==n.type||"string"==typeof n.type)return n.__e;if(n.__k)for(l=n.__k.length-1;l>=0;l--)if((u=n.__k[l])&&(i=L$1(u)))return i;return null}function M(n,u,i,t,r,o,f,e,c){var s,a,v,y,p,d,k,b,g,m,w,A,P,C,T,$=u.type;if(void 0!==u.constructor)return null;null!=i.__h&&(c=i.__h,e=u.__e=i.__e,u.__h=null,o=[e]),(s=l$1.__b)&&s(u);try{n:if("function"==typeof $){if(b=u.props,g=(s=$.contextType)&&t[s.__c],m=s?g?g.props.value:s.__:t,i.__c?k=(a=u.__c=i.__c).__=a.__E:("prototype"in $&&$.prototype.render?u.__c=a=new $(b,m):(u.__c=a=new x$1(b,m),a.constructor=$,a.render=B$1),g&&g.sub(a),a.props=b,a.state||(a.state={}),a.context=m,a.__n=t,v=a.__d=!0,a.__h=[],a._sb=[]),null==a.__s&&(a.__s=a.state),null!=$.getDerivedStateFromProps&&(a.__s==a.state&&(a.__s=h({},a.__s)),h(a.__s,$.getDerivedStateFromProps(b,a.__s))),y=a.props,p=a.state,a.__v=u,v)null==$.getDerivedStateFromProps&&null!=a.componentWillMount&&a.componentWillMount(),null!=a.componentDidMount&&a.__h.push(a.componentDidMount);else {if(null==$.getDerivedStateFromProps&&b!==y&&null!=a.componentWillReceiveProps&&a.componentWillReceiveProps(b,m),!a.__e&&null!=a.shouldComponentUpdate&&!1===a.shouldComponentUpdate(b,a.__s,m)||u.__v===i.__v){for(u.__v!==i.__v&&(a.props=b,a.state=a.__s,a.__d=!1),u.__e=i.__e,u.__k=i.__k,u.__k.forEach(function(n){n&&(n.__=u);}),w=0;w<a._sb.length;w++)a.__h.push(a._sb[w]);a._sb=[],a.__h.length&&f.push(a);break n}null!=a.componentWillUpdate&&a.componentWillUpdate(b,a.__s,m),null!=a.componentDidUpdate&&a.__h.push(function(){a.componentDidUpdate(y,p,d);});}if(a.context=m,a.props=b,a.__P=n,A=l$1.__r,P=0,"prototype"in $&&$.prototype.render){for(a.state=a.__s,a.__d=!1,A&&A(u),s=a.render(a.props,a.state,a.context),C=0;C<a._sb.length;C++)a.__h.push(a._sb[C]);a._sb=[];}else do{a.__d=!1,A&&A(u),s=a.render(a.props,a.state,a.context),a.state=a.__s;}while(a.__d&&++P<25);a.state=a.__s,null!=a.getChildContext&&(t=h(h({},t),a.getChildContext())),v||null==a.getSnapshotBeforeUpdate||(d=a.getSnapshotBeforeUpdate(y,p)),T=null!=s&&s.type===_&&null==s.key?s.props.children:s,H$1(n,Array.isArray(T)?T:[T],u,i,t,r,o,f,e,c),a.base=u.__e,u.__h=null,a.__h.length&&f.push(a),k&&(a.__E=a.__=null),a.__e=!1;}else null==o&&u.__v===i.__v?(u.__k=i.__k,u.__e=i.__e):u.__e=O(i.__e,u,i,t,r,o,f,c);(s=l$1.diffed)&&s(u);}catch(n){u.__v=null,(c||null!=o)&&(u.__e=e,u.__h=!!c,o[o.indexOf(e)]=null),l$1.__e(n,u,i);}}function N(n,u){l$1.__c&&l$1.__c(u,n),n.some(function(u){try{n=u.__h,u.__h=[],n.some(function(n){n.call(u);});}catch(n){l$1.__e(n,u.__v);}});}function O(l,u,i,t,r,o,f,e){var s,a,h,y=i.props,p=u.props,d=u.type,_=0;if("svg"===d&&(r=!0),null!=o)for(;_<o.length;_++)if((s=o[_])&&"setAttribute"in s==!!d&&(d?s.localName===d:3===s.nodeType)){l=s,o[_]=null;break}if(null==l){if(null===d)return document.createTextNode(p);l=r?document.createElementNS("http://www.w3.org/2000/svg",d):document.createElement(d,p.is&&p),o=null,e=!1;}if(null===d)y===p||e&&l.data===p||(l.data=p);else {if(o=o&&n.call(l.childNodes),a=(y=i.props||c$1).dangerouslySetInnerHTML,h=p.dangerouslySetInnerHTML,!e){if(null!=o)for(y={},_=0;_<l.attributes.length;_++)y[l.attributes[_].name]=l.attributes[_].value;(h||a)&&(h&&(a&&h.__html==a.__html||h.__html===l.innerHTML)||(l.innerHTML=h&&h.__html||""));}if(k$1(l,p,y,r,e),h)u.__k=[];else if(_=u.props.children,H$1(l,Array.isArray(_)?_:[_],u,i,t,r&&"foreignObject"!==d,o,f,o?o[0]:i.__k&&A(i,0),e),null!=o)for(_=o.length;_--;)null!=o[_]&&v$1(o[_]);e||("value"in p&&void 0!==(_=p.value)&&(_!==l.value||"progress"===d&&!_||"option"===d&&_!==y.value)&&g$2(l,"value",_,y.value,!1),"checked"in p&&void 0!==(_=p.checked)&&_!==l.checked&&g$2(l,"checked",_,y.checked,!1));}return l}function S(n,u,i){try{"function"==typeof n?n(u):n.current=u;}catch(n){l$1.__e(n,i);}}function q(n,u,i){var t,r;if(l$1.unmount&&l$1.unmount(n),(t=n.ref)&&(t.current&&t.current!==n.__e||S(t,null,u)),null!=(t=n.__c)){if(t.componentWillUnmount)try{t.componentWillUnmount();}catch(n){l$1.__e(n,u);}t.base=t.__P=null,n.__c=void 0;}if(t=n.__k)for(r=0;r<t.length;r++)t[r]&&q(t[r],u,i||"function"!=typeof n.type);i||null==n.__e||v$1(n.__e),n.__=n.__e=n.__d=void 0;}function B$1(n,l,u){return this.constructor(n,u)}function D$1(u,i,t){var r,o,f;l$1.__&&l$1.__(u,i),o=(r="function"==typeof t)?null:t&&t.__k||i.__k,f=[],M(i,u=(!r&&t||i).__k=y(_,null,[u]),o||c$1,c$1,void 0!==i.ownerSVGElement,!r&&t?[t]:o?null:i.firstChild?n.call(i.childNodes):null,f,!r&&t?t:o?o.__e:i.firstChild,r),N(f,u);}function G$1(n,l){var u={__c:l="__cC"+e$1++,__:n,Consumer:function(n,l){return n.children(l)},Provider:function(n){var u,i;return this.getChildContext||(u=[],(i={})[l]=this,this.getChildContext=function(){return i},this.shouldComponentUpdate=function(n){this.props.value!==n.value&&u.some(function(n){n.__e=!0,T$1(n);});},this.sub=function(n){u.push(n);var l=n.componentWillUnmount;n.componentWillUnmount=function(){u.splice(u.indexOf(n),1),l&&l.call(n);};}),n.children}};return u.Provider.__=u.Consumer.contextType=u}n=s.slice,l$1={__e:function(n,l,u,i){for(var t,r,o;l=l.__;)if((t=l.__c)&&!t.__)try{if((r=t.constructor)&&null!=r.getDerivedStateFromError&&(t.setState(r.getDerivedStateFromError(n)),o=t.__d),null!=t.componentDidCatch&&(t.componentDidCatch(n,i||{}),o=t.__d),o)return t.__E=t}catch(l){n=l;}throw n}},u$1=0,t=!1,x$1.prototype.setState=function(n,l){var u;u=null!=this.__s&&this.__s!==this.state?this.__s:this.__s=h({},this.state),"function"==typeof n&&(n=n(h({},u),this.props)),n&&h(u,n),null!=n&&this.__v&&(l&&this._sb.push(l),T$1(this));},x$1.prototype.forceUpdate=function(n){this.__v&&(this.__e=!0,n&&this.__h.push(n),T$1(this));},x$1.prototype.render=_,r$1=[],f$1="function"==typeof Promise?Promise.prototype.then.bind(Promise.resolve()):setTimeout,$$1.__r=0,e$1=0;
|
|
|
|
var r,u,i,f=[],c=[],e=l$1.__b,a=l$1.__r,v=l$1.diffed,l=l$1.__c,m=l$1.unmount;function b(){for(var t;t=f.shift();)if(t.__P&&t.__H)try{t.__H.__h.forEach(k),t.__H.__h.forEach(w$1),t.__H.__h=[];}catch(r){t.__H.__h=[],l$1.__e(r,t.__v);}}l$1.__b=function(n){r=null,e&&e(n);},l$1.__r=function(n){a&&a(n);var i=(r=n.__c).__H;i&&(u===r?(i.__h=[],r.__h=[],i.__.forEach(function(n){n.__N&&(n.__=n.__N),n.__V=c,n.__N=n.i=void 0;})):(i.__h.forEach(k),i.__h.forEach(w$1),i.__h=[])),u=r;},l$1.diffed=function(t){v&&v(t);var o=t.__c;o&&o.__H&&(o.__H.__h.length&&(1!==f.push(o)&&i===l$1.requestAnimationFrame||((i=l$1.requestAnimationFrame)||j$1)(b)),o.__H.__.forEach(function(n){n.i&&(n.__H=n.i),n.__V!==c&&(n.__=n.__V),n.i=void 0,n.__V=c;})),u=r=null;},l$1.__c=function(t,r){r.some(function(t){try{t.__h.forEach(k),t.__h=t.__h.filter(function(n){return !n.__||w$1(n)});}catch(u){r.some(function(n){n.__h&&(n.__h=[]);}),r=[],l$1.__e(u,t.__v);}}),l&&l(t,r);},l$1.unmount=function(t){m&&m(t);var r,u=t.__c;u&&u.__H&&(u.__H.__.forEach(function(n){try{k(n);}catch(n){r=n;}}),u.__H=void 0,r&&l$1.__e(r,u.__v));};var g$1="function"==typeof requestAnimationFrame;function j$1(n){var t,r=function(){clearTimeout(u),g$1&&cancelAnimationFrame(t),setTimeout(n);},u=setTimeout(r,100);g$1&&(t=requestAnimationFrame(r));}function k(n){var t=r,u=n.__c;"function"==typeof u&&(n.__c=void 0,u()),r=t;}function w$1(n){var t=r;n.__c=n.__(),r=t;}
|
|
|
|
function g(n,t){for(var e in t)n[e]=t[e];return n}function C(n,t){for(var e in n)if("__source"!==e&&!(e in t))return !0;for(var r in t)if("__source"!==r&&n[r]!==t[r])return !0;return !1}function w(n){this.props=n;}(w.prototype=new x$1).isPureReactComponent=!0,w.prototype.shouldComponentUpdate=function(n,t){return C(this.props,n)||C(this.state,t)};var x=l$1.__b;l$1.__b=function(n){n.type&&n.type.__f&&n.ref&&(n.props.ref=n.ref,n.ref=null),x&&x(n);};var T=l$1.__e;l$1.__e=function(n,t,e,r){if(n.then)for(var u,o=t;o=o.__;)if((u=o.__c)&&u.__c)return null==t.__e&&(t.__e=e.__e,t.__k=e.__k),u.__c(n,t);T(n,t,e,r);};var I=l$1.unmount;function L(n,t,e){return n&&(n.__c&&n.__c.__H&&(n.__c.__H.__.forEach(function(n){"function"==typeof n.__c&&n.__c();}),n.__c.__H=null),null!=(n=g({},n)).__c&&(n.__c.__P===e&&(n.__c.__P=t),n.__c=null),n.__k=n.__k&&n.__k.map(function(n){return L(n,t,e)})),n}function U(n,t,e){return n&&(n.__v=null,n.__k=n.__k&&n.__k.map(function(n){return U(n,t,e)}),n.__c&&n.__c.__P===t&&(n.__e&&e.insertBefore(n.__e,n.__d),n.__c.__e=!0,n.__c.__P=e)),n}function D(){this.__u=0,this.t=null,this.__b=null;}function F(n){var t=n.__.__c;return t&&t.__a&&t.__a(n)}function V(){this.u=null,this.o=null;}l$1.unmount=function(n){var t=n.__c;t&&t.__R&&t.__R(),t&&!0===n.__h&&(n.type=null),I&&I(n);},(D.prototype=new x$1).__c=function(n,t){var e=t.__c,r=this;null==r.t&&(r.t=[]),r.t.push(e);var u=F(r.__v),o=!1,i=function(){o||(o=!0,e.__R=null,u?u(l):l());};e.__R=i;var l=function(){if(!--r.__u){if(r.state.__a){var n=r.state.__a;r.__v.__k[0]=U(n,n.__c.__P,n.__c.__O);}var t;for(r.setState({__a:r.__b=null});t=r.t.pop();)t.forceUpdate();}},c=!0===t.__h;r.__u++||c||r.setState({__a:r.__b=r.__v.__k[0]}),n.then(i,i);},D.prototype.componentWillUnmount=function(){this.t=[];},D.prototype.render=function(n,e){if(this.__b){if(this.__v.__k){var r=document.createElement("div"),o=this.__v.__k[0].__c;this.__v.__k[0]=L(this.__b,r,o.__O=o.__P);}this.__b=null;}var i=e.__a&&y(_,null,n.fallback);return i&&(i.__h=null),[y(_,null,e.__a?null:n.children),i]};var W=function(n,t,e){if(++e[1]===e[0]&&n.o.delete(t),n.props.revealOrder&&("t"!==n.props.revealOrder[0]||!n.o.size))for(e=n.u;e;){for(;e.length>3;)e.pop()();if(e[1]<e[0])break;n.u=e=e[2];}};function P(n){return this.getChildContext=function(){return n.context},n.children}function $(n){var e=this,r=n.i;e.componentWillUnmount=function(){D$1(null,e.l),e.l=null,e.i=null;},e.i&&e.i!==r&&e.componentWillUnmount(),n.__v?(e.l||(e.i=r,e.l={nodeType:1,parentNode:r,childNodes:[],appendChild:function(n){this.childNodes.push(n),e.i.appendChild(n);},insertBefore:function(n,t){this.childNodes.push(n),e.i.appendChild(n);},removeChild:function(n){this.childNodes.splice(this.childNodes.indexOf(n)>>>1,1),e.i.removeChild(n);}}),D$1(y(P,{context:e.context},n.__v),e.l)):e.l&&e.componentWillUnmount();}function j(n,e){var r=y($,{__v:n,i:e});return r.containerInfo=e,r}(V.prototype=new x$1).__a=function(n){var t=this,e=F(t.__v),r=t.o.get(n);return r[0]++,function(u){var o=function(){t.props.revealOrder?(r.push(u),W(t,n,r)):u();};e?e(o):o();}},V.prototype.render=function(n){this.u=null,this.o=new Map;var t=j$2(n.children);n.revealOrder&&"b"===n.revealOrder[0]&&t.reverse();for(var e=t.length;e--;)this.o.set(t[e],this.u=[1,0,this.u]);return n.children},V.prototype.componentDidUpdate=V.prototype.componentDidMount=function(){var n=this;this.o.forEach(function(t,e){W(n,e,t);});};var z="undefined"!=typeof Symbol&&Symbol.for&&Symbol.for("react.element")||60103,B=/^(?:accent|alignment|arabic|baseline|cap|clip(?!PathU)|color|dominant|fill|flood|font|glyph(?!R)|horiz|image|letter|lighting|marker(?!H|W|U)|overline|paint|pointer|shape|stop|strikethrough|stroke|text(?!L)|transform|underline|unicode|units|v|vector|vert|word|writing|x(?!C))[A-Z]/,H="undefined"!=typeof document,Z=function(n){return ("undefined"!=typeof Symbol&&"symbol"==typeof Symbol()?/fil|che|rad/i:/fil|che|ra/i).test(n)};x$1.prototype.isReactComponent={},["componentWillMount","componentWillReceiveProps","componentWillUpdate"].forEach(function(t){Object.defineProperty(x$1.prototype,t,{configurable:!0,get:function(){return this["UNSAFE_"+t]},set:function(n){Object.defineProperty(this,t,{configurable:!0,writable:!0,value:n});}});});var G=l$1.event;function J(){}function K(){return this.cancelBubble}function Q(){return this.defaultPrevented}l$1.event=function(n){return G&&(n=G(n)),n.persist=J,n.isPropagationStopped=K,n.isDefaultPrevented=Q,n.nativeEvent=n};var nn={configurable:!0,get:function(){return this.class}},tn=l$1.vnode;l$1.vnode=function(n){var t=n.type,e=n.props,u=e;if("string"==typeof t){var o=-1===t.indexOf("-");for(var i in u={},e){var l=e[i];H&&"children"===i&&"noscript"===t||"value"===i&&"defaultValue"in e&&null==l||("defaultValue"===i&&"value"in e&&null==e.value?i="value":"download"===i&&!0===l?l="":/ondoubleclick/i.test(i)?i="ondblclick":/^onchange(textarea|input)/i.test(i+t)&&!Z(e.type)?i="oninput":/^onfocus$/i.test(i)?i="onfocusin":/^onblur$/i.test(i)?i="onfocusout":/^on(Ani|Tra|Tou|BeforeInp|Compo)/.test(i)?i=i.toLowerCase():o&&B.test(i)?i=i.replace(/[A-Z0-9]/g,"-$&").toLowerCase():null===l&&(l=void 0),/^oninput$/i.test(i)&&(i=i.toLowerCase(),u[i]&&(i="oninputCapture")),u[i]=l);}"select"==t&&u.multiple&&Array.isArray(u.value)&&(u.value=j$2(e.children).forEach(function(n){n.props.selected=-1!=u.value.indexOf(n.props.value);})),"select"==t&&null!=u.defaultValue&&(u.value=j$2(e.children).forEach(function(n){n.props.selected=u.multiple?-1!=u.defaultValue.indexOf(n.props.value):u.defaultValue==n.props.value;})),n.props=u,e.class!=e.className&&(nn.enumerable="className"in e,null!=e.className&&(u.class=e.className),Object.defineProperty(u,"className",nn));}n.$$typeof=z,tn&&tn(n);};var en=l$1.__r;l$1.__r=function(n){en&&en(n);};
|
|
|
|
var globalObj = typeof globalThis !== 'undefined' ? globalThis : window; // // TODO: streamline when killing IE11 support
|
|
if (globalObj.FullCalendarVDom) {
|
|
console.warn('FullCalendar VDOM already loaded');
|
|
}
|
|
else {
|
|
globalObj.FullCalendarVDom = {
|
|
Component: x$1,
|
|
createElement: y,
|
|
render: D$1,
|
|
createRef: d,
|
|
Fragment: _,
|
|
createContext: createContext$1,
|
|
createPortal: j,
|
|
flushSync: flushSync$1,
|
|
unmountComponentAtNode: unmountComponentAtNode$1,
|
|
};
|
|
}
|
|
// HACKS...
|
|
// TODO: lock version
|
|
// TODO: link gh issues
|
|
function flushSync$1(runBeforeFlush) {
|
|
runBeforeFlush();
|
|
var oldDebounceRendering = l$1.debounceRendering; // orig
|
|
var callbackQ = [];
|
|
function execCallbackSync(callback) {
|
|
callbackQ.push(callback);
|
|
}
|
|
l$1.debounceRendering = execCallbackSync;
|
|
D$1(y(FakeComponent, {}), document.createElement('div'));
|
|
while (callbackQ.length) {
|
|
callbackQ.shift()();
|
|
}
|
|
l$1.debounceRendering = oldDebounceRendering;
|
|
}
|
|
var FakeComponent = /** @class */ (function (_super) {
|
|
__extends(FakeComponent, _super);
|
|
function FakeComponent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
FakeComponent.prototype.render = function () { return y('div', {}); };
|
|
FakeComponent.prototype.componentDidMount = function () { this.setState({}); };
|
|
return FakeComponent;
|
|
}(x$1));
|
|
function createContext$1(defaultValue) {
|
|
var ContextType = G$1(defaultValue);
|
|
var origProvider = ContextType.Provider;
|
|
ContextType.Provider = function () {
|
|
var _this = this;
|
|
var isNew = !this.getChildContext;
|
|
var children = origProvider.apply(this, arguments); // eslint-disable-line prefer-rest-params
|
|
if (isNew) {
|
|
var subs_1 = [];
|
|
this.shouldComponentUpdate = function (_props) {
|
|
if (_this.props.value !== _props.value) {
|
|
subs_1.forEach(function (c) {
|
|
c.context = _props.value;
|
|
c.forceUpdate();
|
|
});
|
|
}
|
|
};
|
|
this.sub = function (c) {
|
|
subs_1.push(c);
|
|
var old = c.componentWillUnmount;
|
|
c.componentWillUnmount = function () {
|
|
subs_1.splice(subs_1.indexOf(c), 1);
|
|
old && old.call(c);
|
|
};
|
|
};
|
|
}
|
|
return children;
|
|
};
|
|
return ContextType;
|
|
}
|
|
function unmountComponentAtNode$1(node) {
|
|
D$1(null, node);
|
|
}
|
|
|
|
// no public types yet. when there are, export from:
|
|
// import {} from './api-type-deps'
|
|
var EventSourceApi = /** @class */ (function () {
|
|
function EventSourceApi(context, internalEventSource) {
|
|
this.context = context;
|
|
this.internalEventSource = internalEventSource;
|
|
}
|
|
EventSourceApi.prototype.remove = function () {
|
|
this.context.dispatch({
|
|
type: 'REMOVE_EVENT_SOURCE',
|
|
sourceId: this.internalEventSource.sourceId,
|
|
});
|
|
};
|
|
EventSourceApi.prototype.refetch = function () {
|
|
this.context.dispatch({
|
|
type: 'FETCH_EVENT_SOURCES',
|
|
sourceIds: [this.internalEventSource.sourceId],
|
|
isRefetch: true,
|
|
});
|
|
};
|
|
Object.defineProperty(EventSourceApi.prototype, "id", {
|
|
get: function () {
|
|
return this.internalEventSource.publicId;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventSourceApi.prototype, "url", {
|
|
get: function () {
|
|
return this.internalEventSource.meta.url;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventSourceApi.prototype, "format", {
|
|
get: function () {
|
|
return this.internalEventSource.meta.format; // TODO: bad. not guaranteed
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
return EventSourceApi;
|
|
}());
|
|
|
|
function removeElement(el) {
|
|
if (el.parentNode) {
|
|
el.parentNode.removeChild(el);
|
|
}
|
|
}
|
|
// Querying
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
function elementClosest(el, selector) {
|
|
if (el.closest) {
|
|
return el.closest(selector);
|
|
// really bad fallback for IE
|
|
// from https://developer.mozilla.org/en-US/docs/Web/API/Element/closest
|
|
}
|
|
if (!document.documentElement.contains(el)) {
|
|
return null;
|
|
}
|
|
do {
|
|
if (elementMatches(el, selector)) {
|
|
return el;
|
|
}
|
|
el = (el.parentElement || el.parentNode);
|
|
} while (el !== null && el.nodeType === 1);
|
|
return null;
|
|
}
|
|
function elementMatches(el, selector) {
|
|
var method = el.matches || el.matchesSelector || el.msMatchesSelector;
|
|
return method.call(el, selector);
|
|
}
|
|
// accepts multiple subject els
|
|
// returns a real array. good for methods like forEach
|
|
// TODO: accept the document
|
|
function findElements(container, selector) {
|
|
var containers = container instanceof HTMLElement ? [container] : container;
|
|
var allMatches = [];
|
|
for (var i = 0; i < containers.length; i += 1) {
|
|
var matches = containers[i].querySelectorAll(selector);
|
|
for (var j = 0; j < matches.length; j += 1) {
|
|
allMatches.push(matches[j]);
|
|
}
|
|
}
|
|
return allMatches;
|
|
}
|
|
// accepts multiple subject els
|
|
// only queries direct child elements // TODO: rename to findDirectChildren!
|
|
function findDirectChildren(parent, selector) {
|
|
var parents = parent instanceof HTMLElement ? [parent] : parent;
|
|
var allMatches = [];
|
|
for (var i = 0; i < parents.length; i += 1) {
|
|
var childNodes = parents[i].children; // only ever elements
|
|
for (var j = 0; j < childNodes.length; j += 1) {
|
|
var childNode = childNodes[j];
|
|
if (!selector || elementMatches(childNode, selector)) {
|
|
allMatches.push(childNode);
|
|
}
|
|
}
|
|
}
|
|
return allMatches;
|
|
}
|
|
// Style
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
var PIXEL_PROP_RE = /(top|left|right|bottom|width|height)$/i;
|
|
function applyStyle(el, props) {
|
|
for (var propName in props) {
|
|
applyStyleProp(el, propName, props[propName]);
|
|
}
|
|
}
|
|
function applyStyleProp(el, name, val) {
|
|
if (val == null) {
|
|
el.style[name] = '';
|
|
}
|
|
else if (typeof val === 'number' && PIXEL_PROP_RE.test(name)) {
|
|
el.style[name] = val + "px";
|
|
}
|
|
else {
|
|
el.style[name] = val;
|
|
}
|
|
}
|
|
// Event Handling
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
// if intercepting bubbled events at the document/window/body level,
|
|
// and want to see originating element (the 'target'), use this util instead
|
|
// of `ev.target` because it goes within web-component boundaries.
|
|
function getEventTargetViaRoot(ev) {
|
|
var _a, _b;
|
|
return (_b = (_a = ev.composedPath) === null || _a === void 0 ? void 0 : _a.call(ev)[0]) !== null && _b !== void 0 ? _b : ev.target;
|
|
}
|
|
// Shadow DOM consuderations
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
function getElRoot(el) {
|
|
return el.getRootNode ? el.getRootNode() : document;
|
|
}
|
|
// Unique ID for DOM attribute
|
|
var guid$1 = 0;
|
|
function getUniqueDomId() {
|
|
guid$1 += 1;
|
|
return 'fc-dom-' + guid$1;
|
|
}
|
|
|
|
// Stops a mouse/touch event from doing it's native browser action
|
|
function preventDefault(ev) {
|
|
ev.preventDefault();
|
|
}
|
|
// Event Delegation
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
function buildDelegationHandler(selector, handler) {
|
|
return function (ev) {
|
|
var matchedChild = elementClosest(ev.target, selector);
|
|
if (matchedChild) {
|
|
handler.call(matchedChild, ev, matchedChild);
|
|
}
|
|
};
|
|
}
|
|
function listenBySelector(container, eventType, selector, handler) {
|
|
var attachedHandler = buildDelegationHandler(selector, handler);
|
|
container.addEventListener(eventType, attachedHandler);
|
|
return function () {
|
|
container.removeEventListener(eventType, attachedHandler);
|
|
};
|
|
}
|
|
function listenToHoverBySelector(container, selector, onMouseEnter, onMouseLeave) {
|
|
var currentMatchedChild;
|
|
return listenBySelector(container, 'mouseover', selector, function (mouseOverEv, matchedChild) {
|
|
if (matchedChild !== currentMatchedChild) {
|
|
currentMatchedChild = matchedChild;
|
|
onMouseEnter(mouseOverEv, matchedChild);
|
|
var realOnMouseLeave_1 = function (mouseLeaveEv) {
|
|
currentMatchedChild = null;
|
|
onMouseLeave(mouseLeaveEv, matchedChild);
|
|
matchedChild.removeEventListener('mouseleave', realOnMouseLeave_1);
|
|
};
|
|
// listen to the next mouseleave, and then unattach
|
|
matchedChild.addEventListener('mouseleave', realOnMouseLeave_1);
|
|
}
|
|
});
|
|
}
|
|
// Animation
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
var transitionEventNames = [
|
|
'webkitTransitionEnd',
|
|
'otransitionend',
|
|
'oTransitionEnd',
|
|
'msTransitionEnd',
|
|
'transitionend',
|
|
];
|
|
// triggered only when the next single subsequent transition finishes
|
|
function whenTransitionDone(el, callback) {
|
|
var realCallback = function (ev) {
|
|
callback(ev);
|
|
transitionEventNames.forEach(function (eventName) {
|
|
el.removeEventListener(eventName, realCallback);
|
|
});
|
|
};
|
|
transitionEventNames.forEach(function (eventName) {
|
|
el.addEventListener(eventName, realCallback); // cross-browser way to determine when the transition finishes
|
|
});
|
|
}
|
|
// ARIA workarounds
|
|
// ----------------------------------------------------------------------------------------------------------------
|
|
function createAriaClickAttrs(handler) {
|
|
return __assign({ onClick: handler }, createAriaKeyboardAttrs(handler));
|
|
}
|
|
function createAriaKeyboardAttrs(handler) {
|
|
return {
|
|
tabIndex: 0,
|
|
onKeyDown: function (ev) {
|
|
if (ev.key === 'Enter' || ev.key === ' ') {
|
|
handler(ev);
|
|
ev.preventDefault(); // if space, don't scroll down page
|
|
}
|
|
},
|
|
};
|
|
}
|
|
|
|
var guidNumber = 0;
|
|
function guid() {
|
|
guidNumber += 1;
|
|
return String(guidNumber);
|
|
}
|
|
/* FullCalendar-specific DOM Utilities
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
// Make the mouse cursor express that an event is not allowed in the current area
|
|
function disableCursor() {
|
|
document.body.classList.add('fc-not-allowed');
|
|
}
|
|
// Returns the mouse cursor to its original look
|
|
function enableCursor() {
|
|
document.body.classList.remove('fc-not-allowed');
|
|
}
|
|
/* Selection
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
function preventSelection(el) {
|
|
el.classList.add('fc-unselectable');
|
|
el.addEventListener('selectstart', preventDefault);
|
|
}
|
|
function allowSelection(el) {
|
|
el.classList.remove('fc-unselectable');
|
|
el.removeEventListener('selectstart', preventDefault);
|
|
}
|
|
/* Context Menu
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
function preventContextMenu(el) {
|
|
el.addEventListener('contextmenu', preventDefault);
|
|
}
|
|
function allowContextMenu(el) {
|
|
el.removeEventListener('contextmenu', preventDefault);
|
|
}
|
|
function parseFieldSpecs(input) {
|
|
var specs = [];
|
|
var tokens = [];
|
|
var i;
|
|
var token;
|
|
if (typeof input === 'string') {
|
|
tokens = input.split(/\s*,\s*/);
|
|
}
|
|
else if (typeof input === 'function') {
|
|
tokens = [input];
|
|
}
|
|
else if (Array.isArray(input)) {
|
|
tokens = input;
|
|
}
|
|
for (i = 0; i < tokens.length; i += 1) {
|
|
token = tokens[i];
|
|
if (typeof token === 'string') {
|
|
specs.push(token.charAt(0) === '-' ?
|
|
{ field: token.substring(1), order: -1 } :
|
|
{ field: token, order: 1 });
|
|
}
|
|
else if (typeof token === 'function') {
|
|
specs.push({ func: token });
|
|
}
|
|
}
|
|
return specs;
|
|
}
|
|
function compareByFieldSpecs(obj0, obj1, fieldSpecs) {
|
|
var i;
|
|
var cmp;
|
|
for (i = 0; i < fieldSpecs.length; i += 1) {
|
|
cmp = compareByFieldSpec(obj0, obj1, fieldSpecs[i]);
|
|
if (cmp) {
|
|
return cmp;
|
|
}
|
|
}
|
|
return 0;
|
|
}
|
|
function compareByFieldSpec(obj0, obj1, fieldSpec) {
|
|
if (fieldSpec.func) {
|
|
return fieldSpec.func(obj0, obj1);
|
|
}
|
|
return flexibleCompare(obj0[fieldSpec.field], obj1[fieldSpec.field])
|
|
* (fieldSpec.order || 1);
|
|
}
|
|
function flexibleCompare(a, b) {
|
|
if (!a && !b) {
|
|
return 0;
|
|
}
|
|
if (b == null) {
|
|
return -1;
|
|
}
|
|
if (a == null) {
|
|
return 1;
|
|
}
|
|
if (typeof a === 'string' || typeof b === 'string') {
|
|
return String(a).localeCompare(String(b));
|
|
}
|
|
return a - b;
|
|
}
|
|
/* String Utilities
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
function padStart(val, len) {
|
|
var s = String(val);
|
|
return '000'.substr(0, len - s.length) + s;
|
|
}
|
|
function formatWithOrdinals(formatter, args, fallbackText) {
|
|
if (typeof formatter === 'function') {
|
|
return formatter.apply(void 0, args);
|
|
}
|
|
if (typeof formatter === 'string') { // non-blank string
|
|
return args.reduce(function (str, arg, index) { return (str.replace('$' + index, arg || '')); }, formatter);
|
|
}
|
|
return fallbackText;
|
|
}
|
|
/* Number Utilities
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
function compareNumbers(a, b) {
|
|
return a - b;
|
|
}
|
|
function isInt(n) {
|
|
return n % 1 === 0;
|
|
}
|
|
/* FC-specific DOM dimension stuff
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
function computeSmallestCellWidth(cellEl) {
|
|
var allWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-frame');
|
|
var contentWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-cushion');
|
|
if (!allWidthEl) {
|
|
throw new Error('needs fc-scrollgrid-shrink-frame className'); // TODO: use const
|
|
}
|
|
if (!contentWidthEl) {
|
|
throw new Error('needs fc-scrollgrid-shrink-cushion className');
|
|
}
|
|
return cellEl.getBoundingClientRect().width - allWidthEl.getBoundingClientRect().width + // the cell padding+border
|
|
contentWidthEl.getBoundingClientRect().width;
|
|
}
|
|
|
|
var DAY_IDS = ['sun', 'mon', 'tue', 'wed', 'thu', 'fri', 'sat'];
|
|
// Adding
|
|
function addWeeks(m, n) {
|
|
var a = dateToUtcArray(m);
|
|
a[2] += n * 7;
|
|
return arrayToUtcDate(a);
|
|
}
|
|
function addDays(m, n) {
|
|
var a = dateToUtcArray(m);
|
|
a[2] += n;
|
|
return arrayToUtcDate(a);
|
|
}
|
|
function addMs(m, n) {
|
|
var a = dateToUtcArray(m);
|
|
a[6] += n;
|
|
return arrayToUtcDate(a);
|
|
}
|
|
// Diffing (all return floats)
|
|
// TODO: why not use ranges?
|
|
function diffWeeks(m0, m1) {
|
|
return diffDays(m0, m1) / 7;
|
|
}
|
|
function diffDays(m0, m1) {
|
|
return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60 * 24);
|
|
}
|
|
function diffHours(m0, m1) {
|
|
return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60);
|
|
}
|
|
function diffMinutes(m0, m1) {
|
|
return (m1.valueOf() - m0.valueOf()) / (1000 * 60);
|
|
}
|
|
function diffSeconds(m0, m1) {
|
|
return (m1.valueOf() - m0.valueOf()) / 1000;
|
|
}
|
|
function diffDayAndTime(m0, m1) {
|
|
var m0day = startOfDay(m0);
|
|
var m1day = startOfDay(m1);
|
|
return {
|
|
years: 0,
|
|
months: 0,
|
|
days: Math.round(diffDays(m0day, m1day)),
|
|
milliseconds: (m1.valueOf() - m1day.valueOf()) - (m0.valueOf() - m0day.valueOf()),
|
|
};
|
|
}
|
|
// Diffing Whole Units
|
|
function diffWholeWeeks(m0, m1) {
|
|
var d = diffWholeDays(m0, m1);
|
|
if (d !== null && d % 7 === 0) {
|
|
return d / 7;
|
|
}
|
|
return null;
|
|
}
|
|
function diffWholeDays(m0, m1) {
|
|
if (timeAsMs(m0) === timeAsMs(m1)) {
|
|
return Math.round(diffDays(m0, m1));
|
|
}
|
|
return null;
|
|
}
|
|
// Start-Of
|
|
function startOfDay(m) {
|
|
return arrayToUtcDate([
|
|
m.getUTCFullYear(),
|
|
m.getUTCMonth(),
|
|
m.getUTCDate(),
|
|
]);
|
|
}
|
|
function startOfHour(m) {
|
|
return arrayToUtcDate([
|
|
m.getUTCFullYear(),
|
|
m.getUTCMonth(),
|
|
m.getUTCDate(),
|
|
m.getUTCHours(),
|
|
]);
|
|
}
|
|
function startOfMinute(m) {
|
|
return arrayToUtcDate([
|
|
m.getUTCFullYear(),
|
|
m.getUTCMonth(),
|
|
m.getUTCDate(),
|
|
m.getUTCHours(),
|
|
m.getUTCMinutes(),
|
|
]);
|
|
}
|
|
function startOfSecond(m) {
|
|
return arrayToUtcDate([
|
|
m.getUTCFullYear(),
|
|
m.getUTCMonth(),
|
|
m.getUTCDate(),
|
|
m.getUTCHours(),
|
|
m.getUTCMinutes(),
|
|
m.getUTCSeconds(),
|
|
]);
|
|
}
|
|
// Week Computation
|
|
function weekOfYear(marker, dow, doy) {
|
|
var y = marker.getUTCFullYear();
|
|
var w = weekOfGivenYear(marker, y, dow, doy);
|
|
if (w < 1) {
|
|
return weekOfGivenYear(marker, y - 1, dow, doy);
|
|
}
|
|
var nextW = weekOfGivenYear(marker, y + 1, dow, doy);
|
|
if (nextW >= 1) {
|
|
return Math.min(w, nextW);
|
|
}
|
|
return w;
|
|
}
|
|
function weekOfGivenYear(marker, year, dow, doy) {
|
|
var firstWeekStart = arrayToUtcDate([year, 0, 1 + firstWeekOffset(year, dow, doy)]);
|
|
var dayStart = startOfDay(marker);
|
|
var days = Math.round(diffDays(firstWeekStart, dayStart));
|
|
return Math.floor(days / 7) + 1; // zero-indexed
|
|
}
|
|
// start-of-first-week - start-of-year
|
|
function firstWeekOffset(year, dow, doy) {
|
|
// first-week day -- which january is always in the first week (4 for iso, 1 for other)
|
|
var fwd = 7 + dow - doy;
|
|
// first-week day local weekday -- which local weekday is fwd
|
|
var fwdlw = (7 + arrayToUtcDate([year, 0, fwd]).getUTCDay() - dow) % 7;
|
|
return -fwdlw + fwd - 1;
|
|
}
|
|
// Array Conversion
|
|
function dateToLocalArray(date) {
|
|
return [
|
|
date.getFullYear(),
|
|
date.getMonth(),
|
|
date.getDate(),
|
|
date.getHours(),
|
|
date.getMinutes(),
|
|
date.getSeconds(),
|
|
date.getMilliseconds(),
|
|
];
|
|
}
|
|
function arrayToLocalDate(a) {
|
|
return new Date(a[0], a[1] || 0, a[2] == null ? 1 : a[2], // day of month
|
|
a[3] || 0, a[4] || 0, a[5] || 0);
|
|
}
|
|
function dateToUtcArray(date) {
|
|
return [
|
|
date.getUTCFullYear(),
|
|
date.getUTCMonth(),
|
|
date.getUTCDate(),
|
|
date.getUTCHours(),
|
|
date.getUTCMinutes(),
|
|
date.getUTCSeconds(),
|
|
date.getUTCMilliseconds(),
|
|
];
|
|
}
|
|
function arrayToUtcDate(a) {
|
|
// according to web standards (and Safari), a month index is required.
|
|
// massage if only given a year.
|
|
if (a.length === 1) {
|
|
a = a.concat([0]);
|
|
}
|
|
return new Date(Date.UTC.apply(Date, a));
|
|
}
|
|
// Other Utils
|
|
function isValidDate$1(m) {
|
|
return !isNaN(m.valueOf());
|
|
}
|
|
function timeAsMs(m) {
|
|
return m.getUTCHours() * 1000 * 60 * 60 +
|
|
m.getUTCMinutes() * 1000 * 60 +
|
|
m.getUTCSeconds() * 1000 +
|
|
m.getUTCMilliseconds();
|
|
}
|
|
|
|
function createEventInstance(defId, range, forcedStartTzo, forcedEndTzo) {
|
|
return {
|
|
instanceId: guid(),
|
|
defId: defId,
|
|
range: range,
|
|
forcedStartTzo: forcedStartTzo == null ? null : forcedStartTzo,
|
|
forcedEndTzo: forcedEndTzo == null ? null : forcedEndTzo,
|
|
};
|
|
}
|
|
|
|
var hasOwnProperty = Object.prototype.hasOwnProperty;
|
|
// Merges an array of objects into a single object.
|
|
// The second argument allows for an array of property names who's object values will be merged together.
|
|
function mergeProps(propObjs, complexPropsMap) {
|
|
var dest = {};
|
|
if (complexPropsMap) {
|
|
for (var name_1 in complexPropsMap) {
|
|
var complexObjs = [];
|
|
// collect the trailing object values, stopping when a non-object is discovered
|
|
for (var i = propObjs.length - 1; i >= 0; i -= 1) {
|
|
var val = propObjs[i][name_1];
|
|
if (typeof val === 'object' && val) { // non-null object
|
|
complexObjs.unshift(val);
|
|
}
|
|
else if (val !== undefined) {
|
|
dest[name_1] = val; // if there were no objects, this value will be used
|
|
break;
|
|
}
|
|
}
|
|
// if the trailing values were objects, use the merged value
|
|
if (complexObjs.length) {
|
|
dest[name_1] = mergeProps(complexObjs);
|
|
}
|
|
}
|
|
}
|
|
// copy values into the destination, going from last to first
|
|
for (var i = propObjs.length - 1; i >= 0; i -= 1) {
|
|
var props = propObjs[i];
|
|
for (var name_2 in props) {
|
|
if (!(name_2 in dest)) { // if already assigned by previous props or complex props, don't reassign
|
|
dest[name_2] = props[name_2];
|
|
}
|
|
}
|
|
}
|
|
return dest;
|
|
}
|
|
function filterHash(hash, func) {
|
|
var filtered = {};
|
|
for (var key in hash) {
|
|
if (func(hash[key], key)) {
|
|
filtered[key] = hash[key];
|
|
}
|
|
}
|
|
return filtered;
|
|
}
|
|
function mapHash(hash, func) {
|
|
var newHash = {};
|
|
for (var key in hash) {
|
|
newHash[key] = func(hash[key], key);
|
|
}
|
|
return newHash;
|
|
}
|
|
function arrayToHash(a) {
|
|
var hash = {};
|
|
for (var _i = 0, a_1 = a; _i < a_1.length; _i++) {
|
|
var item = a_1[_i];
|
|
hash[item] = true;
|
|
}
|
|
return hash;
|
|
}
|
|
function buildHashFromArray(a, func) {
|
|
var hash = {};
|
|
for (var i = 0; i < a.length; i += 1) {
|
|
var tuple = func(a[i], i);
|
|
hash[tuple[0]] = tuple[1];
|
|
}
|
|
return hash;
|
|
}
|
|
function hashValuesToArray(obj) {
|
|
var a = [];
|
|
for (var key in obj) {
|
|
a.push(obj[key]);
|
|
}
|
|
return a;
|
|
}
|
|
function isPropsEqual(obj0, obj1) {
|
|
if (obj0 === obj1) {
|
|
return true;
|
|
}
|
|
for (var key in obj0) {
|
|
if (hasOwnProperty.call(obj0, key)) {
|
|
if (!(key in obj1)) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
for (var key in obj1) {
|
|
if (hasOwnProperty.call(obj1, key)) {
|
|
if (obj0[key] !== obj1[key]) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
function getUnequalProps(obj0, obj1) {
|
|
var keys = [];
|
|
for (var key in obj0) {
|
|
if (hasOwnProperty.call(obj0, key)) {
|
|
if (!(key in obj1)) {
|
|
keys.push(key);
|
|
}
|
|
}
|
|
}
|
|
for (var key in obj1) {
|
|
if (hasOwnProperty.call(obj1, key)) {
|
|
if (obj0[key] !== obj1[key]) {
|
|
keys.push(key);
|
|
}
|
|
}
|
|
}
|
|
return keys;
|
|
}
|
|
function compareObjs(oldProps, newProps, equalityFuncs) {
|
|
if (equalityFuncs === void 0) { equalityFuncs = {}; }
|
|
if (oldProps === newProps) {
|
|
return true;
|
|
}
|
|
for (var key in newProps) {
|
|
if (key in oldProps && isObjValsEqual(oldProps[key], newProps[key], equalityFuncs[key])) ;
|
|
else {
|
|
return false;
|
|
}
|
|
}
|
|
// check for props that were omitted in the new
|
|
for (var key in oldProps) {
|
|
if (!(key in newProps)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
/*
|
|
assumed "true" equality for handler names like "onReceiveSomething"
|
|
*/
|
|
function isObjValsEqual(val0, val1, comparator) {
|
|
if (val0 === val1 || comparator === true) {
|
|
return true;
|
|
}
|
|
if (comparator) {
|
|
return comparator(val0, val1);
|
|
}
|
|
return false;
|
|
}
|
|
function collectFromHash(hash, startIndex, endIndex, step) {
|
|
if (startIndex === void 0) { startIndex = 0; }
|
|
if (step === void 0) { step = 1; }
|
|
var res = [];
|
|
if (endIndex == null) {
|
|
endIndex = Object.keys(hash).length;
|
|
}
|
|
for (var i = startIndex; i < endIndex; i += step) {
|
|
var val = hash[i];
|
|
if (val !== undefined) { // will disregard undefined for sparse arrays
|
|
res.push(val);
|
|
}
|
|
}
|
|
return res;
|
|
}
|
|
|
|
function parseRecurring(refined, defaultAllDay, dateEnv, recurringTypes) {
|
|
for (var i = 0; i < recurringTypes.length; i += 1) {
|
|
var parsed = recurringTypes[i].parse(refined, dateEnv);
|
|
if (parsed) {
|
|
var allDay = refined.allDay;
|
|
if (allDay == null) {
|
|
allDay = defaultAllDay;
|
|
if (allDay == null) {
|
|
allDay = parsed.allDayGuess;
|
|
if (allDay == null) {
|
|
allDay = false;
|
|
}
|
|
}
|
|
}
|
|
return {
|
|
allDay: allDay,
|
|
duration: parsed.duration,
|
|
typeData: parsed.typeData,
|
|
typeId: i,
|
|
};
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function expandRecurring(eventStore, framingRange, context) {
|
|
var dateEnv = context.dateEnv, pluginHooks = context.pluginHooks, options = context.options;
|
|
var defs = eventStore.defs, instances = eventStore.instances;
|
|
// remove existing recurring instances
|
|
// TODO: bad. always expand events as a second step
|
|
instances = filterHash(instances, function (instance) { return !defs[instance.defId].recurringDef; });
|
|
for (var defId in defs) {
|
|
var def = defs[defId];
|
|
if (def.recurringDef) {
|
|
var duration = def.recurringDef.duration;
|
|
if (!duration) {
|
|
duration = def.allDay ?
|
|
options.defaultAllDayEventDuration :
|
|
options.defaultTimedEventDuration;
|
|
}
|
|
var starts = expandRecurringRanges(def, duration, framingRange, dateEnv, pluginHooks.recurringTypes);
|
|
for (var _i = 0, starts_1 = starts; _i < starts_1.length; _i++) {
|
|
var start = starts_1[_i];
|
|
var instance = createEventInstance(defId, {
|
|
start: start,
|
|
end: dateEnv.add(start, duration),
|
|
});
|
|
instances[instance.instanceId] = instance;
|
|
}
|
|
}
|
|
}
|
|
return { defs: defs, instances: instances };
|
|
}
|
|
/*
|
|
Event MUST have a recurringDef
|
|
*/
|
|
function expandRecurringRanges(eventDef, duration, framingRange, dateEnv, recurringTypes) {
|
|
var typeDef = recurringTypes[eventDef.recurringDef.typeId];
|
|
var markers = typeDef.expand(eventDef.recurringDef.typeData, {
|
|
start: dateEnv.subtract(framingRange.start, duration),
|
|
end: framingRange.end,
|
|
}, dateEnv);
|
|
// the recurrence plugins don't guarantee that all-day events are start-of-day, so we have to
|
|
if (eventDef.allDay) {
|
|
markers = markers.map(startOfDay);
|
|
}
|
|
return markers;
|
|
}
|
|
|
|
var INTERNAL_UNITS = ['years', 'months', 'days', 'milliseconds'];
|
|
var PARSE_RE = /^(-?)(?:(\d+)\.)?(\d+):(\d\d)(?::(\d\d)(?:\.(\d\d\d))?)?/;
|
|
// Parsing and Creation
|
|
function createDuration(input, unit) {
|
|
var _a;
|
|
if (typeof input === 'string') {
|
|
return parseString(input);
|
|
}
|
|
if (typeof input === 'object' && input) { // non-null object
|
|
return parseObject(input);
|
|
}
|
|
if (typeof input === 'number') {
|
|
return parseObject((_a = {}, _a[unit || 'milliseconds'] = input, _a));
|
|
}
|
|
return null;
|
|
}
|
|
function parseString(s) {
|
|
var m = PARSE_RE.exec(s);
|
|
if (m) {
|
|
var sign = m[1] ? -1 : 1;
|
|
return {
|
|
years: 0,
|
|
months: 0,
|
|
days: sign * (m[2] ? parseInt(m[2], 10) : 0),
|
|
milliseconds: sign * ((m[3] ? parseInt(m[3], 10) : 0) * 60 * 60 * 1000 + // hours
|
|
(m[4] ? parseInt(m[4], 10) : 0) * 60 * 1000 + // minutes
|
|
(m[5] ? parseInt(m[5], 10) : 0) * 1000 + // seconds
|
|
(m[6] ? parseInt(m[6], 10) : 0) // ms
|
|
),
|
|
};
|
|
}
|
|
return null;
|
|
}
|
|
function parseObject(obj) {
|
|
var duration = {
|
|
years: obj.years || obj.year || 0,
|
|
months: obj.months || obj.month || 0,
|
|
days: obj.days || obj.day || 0,
|
|
milliseconds: (obj.hours || obj.hour || 0) * 60 * 60 * 1000 + // hours
|
|
(obj.minutes || obj.minute || 0) * 60 * 1000 + // minutes
|
|
(obj.seconds || obj.second || 0) * 1000 + // seconds
|
|
(obj.milliseconds || obj.millisecond || obj.ms || 0), // ms
|
|
};
|
|
var weeks = obj.weeks || obj.week;
|
|
if (weeks) {
|
|
duration.days += weeks * 7;
|
|
duration.specifiedWeeks = true;
|
|
}
|
|
return duration;
|
|
}
|
|
// Equality
|
|
function durationsEqual(d0, d1) {
|
|
return d0.years === d1.years &&
|
|
d0.months === d1.months &&
|
|
d0.days === d1.days &&
|
|
d0.milliseconds === d1.milliseconds;
|
|
}
|
|
function asCleanDays(dur) {
|
|
if (!dur.years && !dur.months && !dur.milliseconds) {
|
|
return dur.days;
|
|
}
|
|
return 0;
|
|
}
|
|
// Simple Math
|
|
function addDurations(d0, d1) {
|
|
return {
|
|
years: d0.years + d1.years,
|
|
months: d0.months + d1.months,
|
|
days: d0.days + d1.days,
|
|
milliseconds: d0.milliseconds + d1.milliseconds,
|
|
};
|
|
}
|
|
function subtractDurations(d1, d0) {
|
|
return {
|
|
years: d1.years - d0.years,
|
|
months: d1.months - d0.months,
|
|
days: d1.days - d0.days,
|
|
milliseconds: d1.milliseconds - d0.milliseconds,
|
|
};
|
|
}
|
|
function multiplyDuration(d, n) {
|
|
return {
|
|
years: d.years * n,
|
|
months: d.months * n,
|
|
days: d.days * n,
|
|
milliseconds: d.milliseconds * n,
|
|
};
|
|
}
|
|
// Conversions
|
|
// "Rough" because they are based on average-case Gregorian months/years
|
|
function asRoughYears(dur) {
|
|
return asRoughDays(dur) / 365;
|
|
}
|
|
function asRoughMonths(dur) {
|
|
return asRoughDays(dur) / 30;
|
|
}
|
|
function asRoughDays(dur) {
|
|
return asRoughMs(dur) / 864e5;
|
|
}
|
|
function asRoughMinutes(dur) {
|
|
return asRoughMs(dur) / (1000 * 60);
|
|
}
|
|
function asRoughSeconds(dur) {
|
|
return asRoughMs(dur) / 1000;
|
|
}
|
|
function asRoughMs(dur) {
|
|
return dur.years * (365 * 864e5) +
|
|
dur.months * (30 * 864e5) +
|
|
dur.days * 864e5 +
|
|
dur.milliseconds;
|
|
}
|
|
// Advanced Math
|
|
function wholeDivideDurations(numerator, denominator) {
|
|
var res = null;
|
|
for (var i = 0; i < INTERNAL_UNITS.length; i += 1) {
|
|
var unit = INTERNAL_UNITS[i];
|
|
if (denominator[unit]) {
|
|
var localRes = numerator[unit] / denominator[unit];
|
|
if (!isInt(localRes) || (res !== null && res !== localRes)) {
|
|
return null;
|
|
}
|
|
res = localRes;
|
|
}
|
|
else if (numerator[unit]) {
|
|
// needs to divide by something but can't!
|
|
return null;
|
|
}
|
|
}
|
|
return res;
|
|
}
|
|
function greatestDurationDenominator(dur) {
|
|
var ms = dur.milliseconds;
|
|
if (ms) {
|
|
if (ms % 1000 !== 0) {
|
|
return { unit: 'millisecond', value: ms };
|
|
}
|
|
if (ms % (1000 * 60) !== 0) {
|
|
return { unit: 'second', value: ms / 1000 };
|
|
}
|
|
if (ms % (1000 * 60 * 60) !== 0) {
|
|
return { unit: 'minute', value: ms / (1000 * 60) };
|
|
}
|
|
if (ms) {
|
|
return { unit: 'hour', value: ms / (1000 * 60 * 60) };
|
|
}
|
|
}
|
|
if (dur.days) {
|
|
if (dur.specifiedWeeks && dur.days % 7 === 0) {
|
|
return { unit: 'week', value: dur.days / 7 };
|
|
}
|
|
return { unit: 'day', value: dur.days };
|
|
}
|
|
if (dur.months) {
|
|
return { unit: 'month', value: dur.months };
|
|
}
|
|
if (dur.years) {
|
|
return { unit: 'year', value: dur.years };
|
|
}
|
|
return { unit: 'millisecond', value: 0 };
|
|
}
|
|
|
|
// timeZoneOffset is in minutes
|
|
function buildIsoString(marker, timeZoneOffset, stripZeroTime) {
|
|
if (stripZeroTime === void 0) { stripZeroTime = false; }
|
|
var s = marker.toISOString();
|
|
s = s.replace('.000', '');
|
|
if (stripZeroTime) {
|
|
s = s.replace('T00:00:00Z', '');
|
|
}
|
|
if (s.length > 10) { // time part wasn't stripped, can add timezone info
|
|
if (timeZoneOffset == null) {
|
|
s = s.replace('Z', '');
|
|
}
|
|
else if (timeZoneOffset !== 0) {
|
|
s = s.replace('Z', formatTimeZoneOffset(timeZoneOffset, true));
|
|
}
|
|
// otherwise, its UTC-0 and we want to keep the Z
|
|
}
|
|
return s;
|
|
}
|
|
// formats the date, but with no time part
|
|
// TODO: somehow merge with buildIsoString and stripZeroTime
|
|
// TODO: rename. omit "string"
|
|
function formatDayString(marker) {
|
|
return marker.toISOString().replace(/T.*$/, '');
|
|
}
|
|
// TODO: use Date::toISOString and use everything after the T?
|
|
function formatIsoTimeString(marker) {
|
|
return padStart(marker.getUTCHours(), 2) + ':' +
|
|
padStart(marker.getUTCMinutes(), 2) + ':' +
|
|
padStart(marker.getUTCSeconds(), 2);
|
|
}
|
|
function formatTimeZoneOffset(minutes, doIso) {
|
|
if (doIso === void 0) { doIso = false; }
|
|
var sign = minutes < 0 ? '-' : '+';
|
|
var abs = Math.abs(minutes);
|
|
var hours = Math.floor(abs / 60);
|
|
var mins = Math.round(abs % 60);
|
|
if (doIso) {
|
|
return sign + padStart(hours, 2) + ":" + padStart(mins, 2);
|
|
}
|
|
return "GMT" + sign + hours + (mins ? ":" + padStart(mins, 2) : '');
|
|
}
|
|
|
|
// TODO: new util arrayify?
|
|
function removeExact(array, exactVal) {
|
|
var removeCnt = 0;
|
|
var i = 0;
|
|
while (i < array.length) {
|
|
if (array[i] === exactVal) {
|
|
array.splice(i, 1);
|
|
removeCnt += 1;
|
|
}
|
|
else {
|
|
i += 1;
|
|
}
|
|
}
|
|
return removeCnt;
|
|
}
|
|
function isArraysEqual(a0, a1, equalityFunc) {
|
|
if (a0 === a1) {
|
|
return true;
|
|
}
|
|
var len = a0.length;
|
|
var i;
|
|
if (len !== a1.length) { // not array? or not same length?
|
|
return false;
|
|
}
|
|
for (i = 0; i < len; i += 1) {
|
|
if (!(equalityFunc ? equalityFunc(a0[i], a1[i]) : a0[i] === a1[i])) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
|
|
function memoize(workerFunc, resEquality, teardownFunc) {
|
|
var currentArgs;
|
|
var currentRes;
|
|
return function () {
|
|
var newArgs = [];
|
|
for (var _i = 0; _i < arguments.length; _i++) {
|
|
newArgs[_i] = arguments[_i];
|
|
}
|
|
if (!currentArgs) {
|
|
currentRes = workerFunc.apply(this, newArgs);
|
|
}
|
|
else if (!isArraysEqual(currentArgs, newArgs)) {
|
|
if (teardownFunc) {
|
|
teardownFunc(currentRes);
|
|
}
|
|
var res = workerFunc.apply(this, newArgs);
|
|
if (!resEquality || !resEquality(res, currentRes)) {
|
|
currentRes = res;
|
|
}
|
|
}
|
|
currentArgs = newArgs;
|
|
return currentRes;
|
|
};
|
|
}
|
|
function memoizeObjArg(workerFunc, resEquality, teardownFunc) {
|
|
var _this = this;
|
|
var currentArg;
|
|
var currentRes;
|
|
return function (newArg) {
|
|
if (!currentArg) {
|
|
currentRes = workerFunc.call(_this, newArg);
|
|
}
|
|
else if (!isPropsEqual(currentArg, newArg)) {
|
|
if (teardownFunc) {
|
|
teardownFunc(currentRes);
|
|
}
|
|
var res = workerFunc.call(_this, newArg);
|
|
if (!resEquality || !resEquality(res, currentRes)) {
|
|
currentRes = res;
|
|
}
|
|
}
|
|
currentArg = newArg;
|
|
return currentRes;
|
|
};
|
|
}
|
|
function memoizeArraylike(// used at all?
|
|
workerFunc, resEquality, teardownFunc) {
|
|
var _this = this;
|
|
var currentArgSets = [];
|
|
var currentResults = [];
|
|
return function (newArgSets) {
|
|
var currentLen = currentArgSets.length;
|
|
var newLen = newArgSets.length;
|
|
var i = 0;
|
|
for (; i < currentLen; i += 1) {
|
|
if (!newArgSets[i]) { // one of the old sets no longer exists
|
|
if (teardownFunc) {
|
|
teardownFunc(currentResults[i]);
|
|
}
|
|
}
|
|
else if (!isArraysEqual(currentArgSets[i], newArgSets[i])) {
|
|
if (teardownFunc) {
|
|
teardownFunc(currentResults[i]);
|
|
}
|
|
var res = workerFunc.apply(_this, newArgSets[i]);
|
|
if (!resEquality || !resEquality(res, currentResults[i])) {
|
|
currentResults[i] = res;
|
|
}
|
|
}
|
|
}
|
|
for (; i < newLen; i += 1) {
|
|
currentResults[i] = workerFunc.apply(_this, newArgSets[i]);
|
|
}
|
|
currentArgSets = newArgSets;
|
|
currentResults.splice(newLen); // remove excess
|
|
return currentResults;
|
|
};
|
|
}
|
|
function memoizeHashlike(workerFunc, resEquality, teardownFunc) {
|
|
var _this = this;
|
|
var currentArgHash = {};
|
|
var currentResHash = {};
|
|
return function (newArgHash) {
|
|
var newResHash = {};
|
|
for (var key in newArgHash) {
|
|
if (!currentResHash[key]) {
|
|
newResHash[key] = workerFunc.apply(_this, newArgHash[key]);
|
|
}
|
|
else if (!isArraysEqual(currentArgHash[key], newArgHash[key])) {
|
|
if (teardownFunc) {
|
|
teardownFunc(currentResHash[key]);
|
|
}
|
|
var res = workerFunc.apply(_this, newArgHash[key]);
|
|
newResHash[key] = (resEquality && resEquality(res, currentResHash[key]))
|
|
? currentResHash[key]
|
|
: res;
|
|
}
|
|
else {
|
|
newResHash[key] = currentResHash[key];
|
|
}
|
|
}
|
|
currentArgHash = newArgHash;
|
|
currentResHash = newResHash;
|
|
return newResHash;
|
|
};
|
|
}
|
|
|
|
var EXTENDED_SETTINGS_AND_SEVERITIES = {
|
|
week: 3,
|
|
separator: 0,
|
|
omitZeroMinute: 0,
|
|
meridiem: 0,
|
|
omitCommas: 0,
|
|
};
|
|
var STANDARD_DATE_PROP_SEVERITIES = {
|
|
timeZoneName: 7,
|
|
era: 6,
|
|
year: 5,
|
|
month: 4,
|
|
day: 2,
|
|
weekday: 2,
|
|
hour: 1,
|
|
minute: 1,
|
|
second: 1,
|
|
};
|
|
var MERIDIEM_RE = /\s*([ap])\.?m\.?/i; // eats up leading spaces too
|
|
var COMMA_RE = /,/g; // we need re for globalness
|
|
var MULTI_SPACE_RE = /\s+/g;
|
|
var LTR_RE = /\u200e/g; // control character
|
|
var UTC_RE = /UTC|GMT/;
|
|
var NativeFormatter = /** @class */ (function () {
|
|
function NativeFormatter(formatSettings) {
|
|
var standardDateProps = {};
|
|
var extendedSettings = {};
|
|
var severity = 0;
|
|
for (var name_1 in formatSettings) {
|
|
if (name_1 in EXTENDED_SETTINGS_AND_SEVERITIES) {
|
|
extendedSettings[name_1] = formatSettings[name_1];
|
|
severity = Math.max(EXTENDED_SETTINGS_AND_SEVERITIES[name_1], severity);
|
|
}
|
|
else {
|
|
standardDateProps[name_1] = formatSettings[name_1];
|
|
if (name_1 in STANDARD_DATE_PROP_SEVERITIES) { // TODO: what about hour12? no severity
|
|
severity = Math.max(STANDARD_DATE_PROP_SEVERITIES[name_1], severity);
|
|
}
|
|
}
|
|
}
|
|
this.standardDateProps = standardDateProps;
|
|
this.extendedSettings = extendedSettings;
|
|
this.severity = severity;
|
|
this.buildFormattingFunc = memoize(buildFormattingFunc);
|
|
}
|
|
NativeFormatter.prototype.format = function (date, context) {
|
|
return this.buildFormattingFunc(this.standardDateProps, this.extendedSettings, context)(date);
|
|
};
|
|
NativeFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
|
|
var _a = this, standardDateProps = _a.standardDateProps, extendedSettings = _a.extendedSettings;
|
|
var diffSeverity = computeMarkerDiffSeverity(start.marker, end.marker, context.calendarSystem);
|
|
if (!diffSeverity) {
|
|
return this.format(start, context);
|
|
}
|
|
var biggestUnitForPartial = diffSeverity;
|
|
if (biggestUnitForPartial > 1 && // the two dates are different in a way that's larger scale than time
|
|
(standardDateProps.year === 'numeric' || standardDateProps.year === '2-digit') &&
|
|
(standardDateProps.month === 'numeric' || standardDateProps.month === '2-digit') &&
|
|
(standardDateProps.day === 'numeric' || standardDateProps.day === '2-digit')) {
|
|
biggestUnitForPartial = 1; // make it look like the dates are only different in terms of time
|
|
}
|
|
var full0 = this.format(start, context);
|
|
var full1 = this.format(end, context);
|
|
if (full0 === full1) {
|
|
return full0;
|
|
}
|
|
var partialDateProps = computePartialFormattingOptions(standardDateProps, biggestUnitForPartial);
|
|
var partialFormattingFunc = buildFormattingFunc(partialDateProps, extendedSettings, context);
|
|
var partial0 = partialFormattingFunc(start);
|
|
var partial1 = partialFormattingFunc(end);
|
|
var insertion = findCommonInsertion(full0, partial0, full1, partial1);
|
|
var separator = extendedSettings.separator || betterDefaultSeparator || context.defaultSeparator || '';
|
|
if (insertion) {
|
|
return insertion.before + partial0 + separator + partial1 + insertion.after;
|
|
}
|
|
return full0 + separator + full1;
|
|
};
|
|
NativeFormatter.prototype.getLargestUnit = function () {
|
|
switch (this.severity) {
|
|
case 7:
|
|
case 6:
|
|
case 5:
|
|
return 'year';
|
|
case 4:
|
|
return 'month';
|
|
case 3:
|
|
return 'week';
|
|
case 2:
|
|
return 'day';
|
|
default:
|
|
return 'time'; // really?
|
|
}
|
|
};
|
|
return NativeFormatter;
|
|
}());
|
|
function buildFormattingFunc(standardDateProps, extendedSettings, context) {
|
|
var standardDatePropCnt = Object.keys(standardDateProps).length;
|
|
if (standardDatePropCnt === 1 && standardDateProps.timeZoneName === 'short') {
|
|
return function (date) { return (formatTimeZoneOffset(date.timeZoneOffset)); };
|
|
}
|
|
if (standardDatePropCnt === 0 && extendedSettings.week) {
|
|
return function (date) { return (formatWeekNumber(context.computeWeekNumber(date.marker), context.weekText, context.weekTextLong, context.locale, extendedSettings.week)); };
|
|
}
|
|
return buildNativeFormattingFunc(standardDateProps, extendedSettings, context);
|
|
}
|
|
function buildNativeFormattingFunc(standardDateProps, extendedSettings, context) {
|
|
standardDateProps = __assign({}, standardDateProps); // copy
|
|
extendedSettings = __assign({}, extendedSettings); // copy
|
|
sanitizeSettings(standardDateProps, extendedSettings);
|
|
standardDateProps.timeZone = 'UTC'; // we leverage the only guaranteed timeZone for our UTC markers
|
|
var normalFormat = new Intl.DateTimeFormat(context.locale.codes, standardDateProps);
|
|
var zeroFormat; // needed?
|
|
if (extendedSettings.omitZeroMinute) {
|
|
var zeroProps = __assign({}, standardDateProps);
|
|
delete zeroProps.minute; // seconds and ms were already considered in sanitizeSettings
|
|
zeroFormat = new Intl.DateTimeFormat(context.locale.codes, zeroProps);
|
|
}
|
|
return function (date) {
|
|
var marker = date.marker;
|
|
var format;
|
|
if (zeroFormat && !marker.getUTCMinutes()) {
|
|
format = zeroFormat;
|
|
}
|
|
else {
|
|
format = normalFormat;
|
|
}
|
|
var s = format.format(marker);
|
|
return postProcess(s, date, standardDateProps, extendedSettings, context);
|
|
};
|
|
}
|
|
function sanitizeSettings(standardDateProps, extendedSettings) {
|
|
// deal with a browser inconsistency where formatting the timezone
|
|
// requires that the hour/minute be present.
|
|
if (standardDateProps.timeZoneName) {
|
|
if (!standardDateProps.hour) {
|
|
standardDateProps.hour = '2-digit';
|
|
}
|
|
if (!standardDateProps.minute) {
|
|
standardDateProps.minute = '2-digit';
|
|
}
|
|
}
|
|
// only support short timezone names
|
|
if (standardDateProps.timeZoneName === 'long') {
|
|
standardDateProps.timeZoneName = 'short';
|
|
}
|
|
// if requesting to display seconds, MUST display minutes
|
|
if (extendedSettings.omitZeroMinute && (standardDateProps.second || standardDateProps.millisecond)) {
|
|
delete extendedSettings.omitZeroMinute;
|
|
}
|
|
}
|
|
function postProcess(s, date, standardDateProps, extendedSettings, context) {
|
|
s = s.replace(LTR_RE, ''); // remove left-to-right control chars. do first. good for other regexes
|
|
if (standardDateProps.timeZoneName === 'short') {
|
|
s = injectTzoStr(s, (context.timeZone === 'UTC' || date.timeZoneOffset == null) ?
|
|
'UTC' : // important to normalize for IE, which does "GMT"
|
|
formatTimeZoneOffset(date.timeZoneOffset));
|
|
}
|
|
if (extendedSettings.omitCommas) {
|
|
s = s.replace(COMMA_RE, '').trim();
|
|
}
|
|
if (extendedSettings.omitZeroMinute) {
|
|
s = s.replace(':00', ''); // zeroFormat doesn't always achieve this
|
|
}
|
|
// ^ do anything that might create adjacent spaces before this point,
|
|
// because MERIDIEM_RE likes to eat up loading spaces
|
|
if (extendedSettings.meridiem === false) {
|
|
s = s.replace(MERIDIEM_RE, '').trim();
|
|
}
|
|
else if (extendedSettings.meridiem === 'narrow') { // a/p
|
|
s = s.replace(MERIDIEM_RE, function (m0, m1) { return m1.toLocaleLowerCase(); });
|
|
}
|
|
else if (extendedSettings.meridiem === 'short') { // am/pm
|
|
s = s.replace(MERIDIEM_RE, function (m0, m1) { return m1.toLocaleLowerCase() + "m"; });
|
|
}
|
|
else if (extendedSettings.meridiem === 'lowercase') { // other meridiem transformers already converted to lowercase
|
|
s = s.replace(MERIDIEM_RE, function (m0) { return m0.toLocaleLowerCase(); });
|
|
}
|
|
s = s.replace(MULTI_SPACE_RE, ' ');
|
|
s = s.trim();
|
|
return s;
|
|
}
|
|
function injectTzoStr(s, tzoStr) {
|
|
var replaced = false;
|
|
s = s.replace(UTC_RE, function () {
|
|
replaced = true;
|
|
return tzoStr;
|
|
});
|
|
// IE11 doesn't include UTC/GMT in the original string, so append to end
|
|
if (!replaced) {
|
|
s += " " + tzoStr;
|
|
}
|
|
return s;
|
|
}
|
|
function formatWeekNumber(num, weekText, weekTextLong, locale, display) {
|
|
var parts = [];
|
|
if (display === 'long') {
|
|
parts.push(weekTextLong);
|
|
}
|
|
else if (display === 'short' || display === 'narrow') {
|
|
parts.push(weekText);
|
|
}
|
|
if (display === 'long' || display === 'short') {
|
|
parts.push(' ');
|
|
}
|
|
parts.push(locale.simpleNumberFormat.format(num));
|
|
if (locale.options.direction === 'rtl') { // TODO: use control characters instead?
|
|
parts.reverse();
|
|
}
|
|
return parts.join('');
|
|
}
|
|
// Range Formatting Utils
|
|
// 0 = exactly the same
|
|
// 1 = different by time
|
|
// and bigger
|
|
function computeMarkerDiffSeverity(d0, d1, ca) {
|
|
if (ca.getMarkerYear(d0) !== ca.getMarkerYear(d1)) {
|
|
return 5;
|
|
}
|
|
if (ca.getMarkerMonth(d0) !== ca.getMarkerMonth(d1)) {
|
|
return 4;
|
|
}
|
|
if (ca.getMarkerDay(d0) !== ca.getMarkerDay(d1)) {
|
|
return 2;
|
|
}
|
|
if (timeAsMs(d0) !== timeAsMs(d1)) {
|
|
return 1;
|
|
}
|
|
return 0;
|
|
}
|
|
function computePartialFormattingOptions(options, biggestUnit) {
|
|
var partialOptions = {};
|
|
for (var name_2 in options) {
|
|
if (!(name_2 in STANDARD_DATE_PROP_SEVERITIES) || // not a date part prop (like timeZone)
|
|
STANDARD_DATE_PROP_SEVERITIES[name_2] <= biggestUnit) {
|
|
partialOptions[name_2] = options[name_2];
|
|
}
|
|
}
|
|
return partialOptions;
|
|
}
|
|
function findCommonInsertion(full0, partial0, full1, partial1) {
|
|
var i0 = 0;
|
|
while (i0 < full0.length) {
|
|
var found0 = full0.indexOf(partial0, i0);
|
|
if (found0 === -1) {
|
|
break;
|
|
}
|
|
var before0 = full0.substr(0, found0);
|
|
i0 = found0 + partial0.length;
|
|
var after0 = full0.substr(i0);
|
|
var i1 = 0;
|
|
while (i1 < full1.length) {
|
|
var found1 = full1.indexOf(partial1, i1);
|
|
if (found1 === -1) {
|
|
break;
|
|
}
|
|
var before1 = full1.substr(0, found1);
|
|
i1 = found1 + partial1.length;
|
|
var after1 = full1.substr(i1);
|
|
if (before0 === before1 && after0 === after1) {
|
|
return {
|
|
before: before0,
|
|
after: after0,
|
|
};
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
|
|
function expandZonedMarker(dateInfo, calendarSystem) {
|
|
var a = calendarSystem.markerToArray(dateInfo.marker);
|
|
return {
|
|
marker: dateInfo.marker,
|
|
timeZoneOffset: dateInfo.timeZoneOffset,
|
|
array: a,
|
|
year: a[0],
|
|
month: a[1],
|
|
day: a[2],
|
|
hour: a[3],
|
|
minute: a[4],
|
|
second: a[5],
|
|
millisecond: a[6],
|
|
};
|
|
}
|
|
|
|
function createVerboseFormattingArg(start, end, context, betterDefaultSeparator) {
|
|
var startInfo = expandZonedMarker(start, context.calendarSystem);
|
|
var endInfo = end ? expandZonedMarker(end, context.calendarSystem) : null;
|
|
return {
|
|
date: startInfo,
|
|
start: startInfo,
|
|
end: endInfo,
|
|
timeZone: context.timeZone,
|
|
localeCodes: context.locale.codes,
|
|
defaultSeparator: betterDefaultSeparator || context.defaultSeparator,
|
|
};
|
|
}
|
|
|
|
/*
|
|
TODO: fix the terminology of "formatter" vs "formatting func"
|
|
*/
|
|
/*
|
|
At the time of instantiation, this object does not know which cmd-formatting system it will use.
|
|
It receives this at the time of formatting, as a setting.
|
|
*/
|
|
var CmdFormatter = /** @class */ (function () {
|
|
function CmdFormatter(cmdStr) {
|
|
this.cmdStr = cmdStr;
|
|
}
|
|
CmdFormatter.prototype.format = function (date, context, betterDefaultSeparator) {
|
|
return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
|
|
};
|
|
CmdFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
|
|
return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
|
|
};
|
|
return CmdFormatter;
|
|
}());
|
|
|
|
var FuncFormatter = /** @class */ (function () {
|
|
function FuncFormatter(func) {
|
|
this.func = func;
|
|
}
|
|
FuncFormatter.prototype.format = function (date, context, betterDefaultSeparator) {
|
|
return this.func(createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
|
|
};
|
|
FuncFormatter.prototype.formatRange = function (start, end, context, betterDefaultSeparator) {
|
|
return this.func(createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
|
|
};
|
|
return FuncFormatter;
|
|
}());
|
|
|
|
function createFormatter(input) {
|
|
if (typeof input === 'object' && input) { // non-null object
|
|
return new NativeFormatter(input);
|
|
}
|
|
if (typeof input === 'string') {
|
|
return new CmdFormatter(input);
|
|
}
|
|
if (typeof input === 'function') {
|
|
return new FuncFormatter(input);
|
|
}
|
|
return null;
|
|
}
|
|
|
|
// base options
|
|
// ------------
|
|
var BASE_OPTION_REFINERS = {
|
|
navLinkDayClick: identity,
|
|
navLinkWeekClick: identity,
|
|
duration: createDuration,
|
|
bootstrapFontAwesome: identity,
|
|
buttonIcons: identity,
|
|
customButtons: identity,
|
|
defaultAllDayEventDuration: createDuration,
|
|
defaultTimedEventDuration: createDuration,
|
|
nextDayThreshold: createDuration,
|
|
scrollTime: createDuration,
|
|
scrollTimeReset: Boolean,
|
|
slotMinTime: createDuration,
|
|
slotMaxTime: createDuration,
|
|
dayPopoverFormat: createFormatter,
|
|
slotDuration: createDuration,
|
|
snapDuration: createDuration,
|
|
headerToolbar: identity,
|
|
footerToolbar: identity,
|
|
defaultRangeSeparator: String,
|
|
titleRangeSeparator: String,
|
|
forceEventDuration: Boolean,
|
|
dayHeaders: Boolean,
|
|
dayHeaderFormat: createFormatter,
|
|
dayHeaderClassNames: identity,
|
|
dayHeaderContent: identity,
|
|
dayHeaderDidMount: identity,
|
|
dayHeaderWillUnmount: identity,
|
|
dayCellClassNames: identity,
|
|
dayCellContent: identity,
|
|
dayCellDidMount: identity,
|
|
dayCellWillUnmount: identity,
|
|
initialView: String,
|
|
aspectRatio: Number,
|
|
weekends: Boolean,
|
|
weekNumberCalculation: identity,
|
|
weekNumbers: Boolean,
|
|
weekNumberClassNames: identity,
|
|
weekNumberContent: identity,
|
|
weekNumberDidMount: identity,
|
|
weekNumberWillUnmount: identity,
|
|
editable: Boolean,
|
|
viewClassNames: identity,
|
|
viewDidMount: identity,
|
|
viewWillUnmount: identity,
|
|
nowIndicator: Boolean,
|
|
nowIndicatorClassNames: identity,
|
|
nowIndicatorContent: identity,
|
|
nowIndicatorDidMount: identity,
|
|
nowIndicatorWillUnmount: identity,
|
|
showNonCurrentDates: Boolean,
|
|
lazyFetching: Boolean,
|
|
startParam: String,
|
|
endParam: String,
|
|
timeZoneParam: String,
|
|
timeZone: String,
|
|
locales: identity,
|
|
locale: identity,
|
|
themeSystem: String,
|
|
dragRevertDuration: Number,
|
|
dragScroll: Boolean,
|
|
allDayMaintainDuration: Boolean,
|
|
unselectAuto: Boolean,
|
|
dropAccept: identity,
|
|
eventOrder: parseFieldSpecs,
|
|
eventOrderStrict: Boolean,
|
|
handleWindowResize: Boolean,
|
|
windowResizeDelay: Number,
|
|
longPressDelay: Number,
|
|
eventDragMinDistance: Number,
|
|
expandRows: Boolean,
|
|
height: identity,
|
|
contentHeight: identity,
|
|
direction: String,
|
|
weekNumberFormat: createFormatter,
|
|
eventResizableFromStart: Boolean,
|
|
displayEventTime: Boolean,
|
|
displayEventEnd: Boolean,
|
|
weekText: String,
|
|
weekTextLong: String,
|
|
progressiveEventRendering: Boolean,
|
|
businessHours: identity,
|
|
initialDate: identity,
|
|
now: identity,
|
|
eventDataTransform: identity,
|
|
stickyHeaderDates: identity,
|
|
stickyFooterScrollbar: identity,
|
|
viewHeight: identity,
|
|
defaultAllDay: Boolean,
|
|
eventSourceFailure: identity,
|
|
eventSourceSuccess: identity,
|
|
eventDisplay: String,
|
|
eventStartEditable: Boolean,
|
|
eventDurationEditable: Boolean,
|
|
eventOverlap: identity,
|
|
eventConstraint: identity,
|
|
eventAllow: identity,
|
|
eventBackgroundColor: String,
|
|
eventBorderColor: String,
|
|
eventTextColor: String,
|
|
eventColor: String,
|
|
eventClassNames: identity,
|
|
eventContent: identity,
|
|
eventDidMount: identity,
|
|
eventWillUnmount: identity,
|
|
selectConstraint: identity,
|
|
selectOverlap: identity,
|
|
selectAllow: identity,
|
|
droppable: Boolean,
|
|
unselectCancel: String,
|
|
slotLabelFormat: identity,
|
|
slotLaneClassNames: identity,
|
|
slotLaneContent: identity,
|
|
slotLaneDidMount: identity,
|
|
slotLaneWillUnmount: identity,
|
|
slotLabelClassNames: identity,
|
|
slotLabelContent: identity,
|
|
slotLabelDidMount: identity,
|
|
slotLabelWillUnmount: identity,
|
|
dayMaxEvents: identity,
|
|
dayMaxEventRows: identity,
|
|
dayMinWidth: Number,
|
|
slotLabelInterval: createDuration,
|
|
allDayText: String,
|
|
allDayClassNames: identity,
|
|
allDayContent: identity,
|
|
allDayDidMount: identity,
|
|
allDayWillUnmount: identity,
|
|
slotMinWidth: Number,
|
|
navLinks: Boolean,
|
|
eventTimeFormat: createFormatter,
|
|
rerenderDelay: Number,
|
|
moreLinkText: identity,
|
|
moreLinkHint: identity,
|
|
selectMinDistance: Number,
|
|
selectable: Boolean,
|
|
selectLongPressDelay: Number,
|
|
eventLongPressDelay: Number,
|
|
selectMirror: Boolean,
|
|
eventMaxStack: Number,
|
|
eventMinHeight: Number,
|
|
eventMinWidth: Number,
|
|
eventShortHeight: Number,
|
|
slotEventOverlap: Boolean,
|
|
plugins: identity,
|
|
firstDay: Number,
|
|
dayCount: Number,
|
|
dateAlignment: String,
|
|
dateIncrement: createDuration,
|
|
hiddenDays: identity,
|
|
monthMode: Boolean,
|
|
fixedWeekCount: Boolean,
|
|
validRange: identity,
|
|
visibleRange: identity,
|
|
titleFormat: identity,
|
|
eventInteractive: Boolean,
|
|
// only used by list-view, but languages define the value, so we need it in base options
|
|
noEventsText: String,
|
|
viewHint: identity,
|
|
navLinkHint: identity,
|
|
closeHint: String,
|
|
timeHint: String,
|
|
eventHint: String,
|
|
moreLinkClick: identity,
|
|
moreLinkClassNames: identity,
|
|
moreLinkContent: identity,
|
|
moreLinkDidMount: identity,
|
|
moreLinkWillUnmount: identity,
|
|
};
|
|
// do NOT give a type here. need `typeof BASE_OPTION_DEFAULTS` to give real results.
|
|
// raw values.
|
|
var BASE_OPTION_DEFAULTS = {
|
|
eventDisplay: 'auto',
|
|
defaultRangeSeparator: ' - ',
|
|
titleRangeSeparator: ' \u2013 ',
|
|
defaultTimedEventDuration: '01:00:00',
|
|
defaultAllDayEventDuration: { day: 1 },
|
|
forceEventDuration: false,
|
|
nextDayThreshold: '00:00:00',
|
|
dayHeaders: true,
|
|
initialView: '',
|
|
aspectRatio: 1.35,
|
|
headerToolbar: {
|
|
start: 'title',
|
|
center: '',
|
|
end: 'today prev,next',
|
|
},
|
|
weekends: true,
|
|
weekNumbers: false,
|
|
weekNumberCalculation: 'local',
|
|
editable: false,
|
|
nowIndicator: false,
|
|
scrollTime: '06:00:00',
|
|
scrollTimeReset: true,
|
|
slotMinTime: '00:00:00',
|
|
slotMaxTime: '24:00:00',
|
|
showNonCurrentDates: true,
|
|
lazyFetching: true,
|
|
startParam: 'start',
|
|
endParam: 'end',
|
|
timeZoneParam: 'timeZone',
|
|
timeZone: 'local',
|
|
locales: [],
|
|
locale: '',
|
|
themeSystem: 'standard',
|
|
dragRevertDuration: 500,
|
|
dragScroll: true,
|
|
allDayMaintainDuration: false,
|
|
unselectAuto: true,
|
|
dropAccept: '*',
|
|
eventOrder: 'start,-duration,allDay,title',
|
|
dayPopoverFormat: { month: 'long', day: 'numeric', year: 'numeric' },
|
|
handleWindowResize: true,
|
|
windowResizeDelay: 100,
|
|
longPressDelay: 1000,
|
|
eventDragMinDistance: 5,
|
|
expandRows: false,
|
|
navLinks: false,
|
|
selectable: false,
|
|
eventMinHeight: 15,
|
|
eventMinWidth: 30,
|
|
eventShortHeight: 30,
|
|
};
|
|
// calendar listeners
|
|
// ------------------
|
|
var CALENDAR_LISTENER_REFINERS = {
|
|
datesSet: identity,
|
|
eventsSet: identity,
|
|
eventAdd: identity,
|
|
eventChange: identity,
|
|
eventRemove: identity,
|
|
windowResize: identity,
|
|
eventClick: identity,
|
|
eventMouseEnter: identity,
|
|
eventMouseLeave: identity,
|
|
select: identity,
|
|
unselect: identity,
|
|
loading: identity,
|
|
// internal
|
|
_unmount: identity,
|
|
_beforeprint: identity,
|
|
_afterprint: identity,
|
|
_noEventDrop: identity,
|
|
_noEventResize: identity,
|
|
_resize: identity,
|
|
_scrollRequest: identity,
|
|
};
|
|
// calendar-specific options
|
|
// -------------------------
|
|
var CALENDAR_OPTION_REFINERS = {
|
|
buttonText: identity,
|
|
buttonHints: identity,
|
|
views: identity,
|
|
plugins: identity,
|
|
initialEvents: identity,
|
|
events: identity,
|
|
eventSources: identity,
|
|
};
|
|
var COMPLEX_OPTION_COMPARATORS = {
|
|
headerToolbar: isMaybeObjectsEqual,
|
|
footerToolbar: isMaybeObjectsEqual,
|
|
buttonText: isMaybeObjectsEqual,
|
|
buttonHints: isMaybeObjectsEqual,
|
|
buttonIcons: isMaybeObjectsEqual,
|
|
dateIncrement: isMaybeObjectsEqual,
|
|
};
|
|
function isMaybeObjectsEqual(a, b) {
|
|
if (typeof a === 'object' && typeof b === 'object' && a && b) { // both non-null objects
|
|
return isPropsEqual(a, b);
|
|
}
|
|
return a === b;
|
|
}
|
|
// view-specific options
|
|
// ---------------------
|
|
var VIEW_OPTION_REFINERS = {
|
|
type: String,
|
|
component: identity,
|
|
buttonText: String,
|
|
buttonTextKey: String,
|
|
dateProfileGeneratorClass: identity,
|
|
usesMinMaxTime: Boolean,
|
|
classNames: identity,
|
|
content: identity,
|
|
didMount: identity,
|
|
willUnmount: identity,
|
|
};
|
|
// util funcs
|
|
// ----------------------------------------------------------------------------------------------------
|
|
function mergeRawOptions(optionSets) {
|
|
return mergeProps(optionSets, COMPLEX_OPTION_COMPARATORS);
|
|
}
|
|
function refineProps(input, refiners) {
|
|
var refined = {};
|
|
var extra = {};
|
|
for (var propName in refiners) {
|
|
if (propName in input) {
|
|
refined[propName] = refiners[propName](input[propName]);
|
|
}
|
|
}
|
|
for (var propName in input) {
|
|
if (!(propName in refiners)) {
|
|
extra[propName] = input[propName];
|
|
}
|
|
}
|
|
return { refined: refined, extra: extra };
|
|
}
|
|
function identity(raw) {
|
|
return raw;
|
|
}
|
|
|
|
function parseEvents(rawEvents, eventSource, context, allowOpenRange) {
|
|
var eventStore = createEmptyEventStore();
|
|
var eventRefiners = buildEventRefiners(context);
|
|
for (var _i = 0, rawEvents_1 = rawEvents; _i < rawEvents_1.length; _i++) {
|
|
var rawEvent = rawEvents_1[_i];
|
|
var tuple = parseEvent(rawEvent, eventSource, context, allowOpenRange, eventRefiners);
|
|
if (tuple) {
|
|
eventTupleToStore(tuple, eventStore);
|
|
}
|
|
}
|
|
return eventStore;
|
|
}
|
|
function eventTupleToStore(tuple, eventStore) {
|
|
if (eventStore === void 0) { eventStore = createEmptyEventStore(); }
|
|
eventStore.defs[tuple.def.defId] = tuple.def;
|
|
if (tuple.instance) {
|
|
eventStore.instances[tuple.instance.instanceId] = tuple.instance;
|
|
}
|
|
return eventStore;
|
|
}
|
|
// retrieves events that have the same groupId as the instance specified by `instanceId`
|
|
// or they are the same as the instance.
|
|
// why might instanceId not be in the store? an event from another calendar?
|
|
function getRelevantEvents(eventStore, instanceId) {
|
|
var instance = eventStore.instances[instanceId];
|
|
if (instance) {
|
|
var def_1 = eventStore.defs[instance.defId];
|
|
// get events/instances with same group
|
|
var newStore = filterEventStoreDefs(eventStore, function (lookDef) { return isEventDefsGrouped(def_1, lookDef); });
|
|
// add the original
|
|
// TODO: wish we could use eventTupleToStore or something like it
|
|
newStore.defs[def_1.defId] = def_1;
|
|
newStore.instances[instance.instanceId] = instance;
|
|
return newStore;
|
|
}
|
|
return createEmptyEventStore();
|
|
}
|
|
function isEventDefsGrouped(def0, def1) {
|
|
return Boolean(def0.groupId && def0.groupId === def1.groupId);
|
|
}
|
|
function createEmptyEventStore() {
|
|
return { defs: {}, instances: {} };
|
|
}
|
|
function mergeEventStores(store0, store1) {
|
|
return {
|
|
defs: __assign(__assign({}, store0.defs), store1.defs),
|
|
instances: __assign(__assign({}, store0.instances), store1.instances),
|
|
};
|
|
}
|
|
function filterEventStoreDefs(eventStore, filterFunc) {
|
|
var defs = filterHash(eventStore.defs, filterFunc);
|
|
var instances = filterHash(eventStore.instances, function (instance) { return (defs[instance.defId] // still exists?
|
|
); });
|
|
return { defs: defs, instances: instances };
|
|
}
|
|
function excludeSubEventStore(master, sub) {
|
|
var defs = master.defs, instances = master.instances;
|
|
var filteredDefs = {};
|
|
var filteredInstances = {};
|
|
for (var defId in defs) {
|
|
if (!sub.defs[defId]) { // not explicitly excluded
|
|
filteredDefs[defId] = defs[defId];
|
|
}
|
|
}
|
|
for (var instanceId in instances) {
|
|
if (!sub.instances[instanceId] && // not explicitly excluded
|
|
filteredDefs[instances[instanceId].defId] // def wasn't filtered away
|
|
) {
|
|
filteredInstances[instanceId] = instances[instanceId];
|
|
}
|
|
}
|
|
return {
|
|
defs: filteredDefs,
|
|
instances: filteredInstances,
|
|
};
|
|
}
|
|
|
|
function normalizeConstraint(input, context) {
|
|
if (Array.isArray(input)) {
|
|
return parseEvents(input, null, context, true); // allowOpenRange=true
|
|
}
|
|
if (typeof input === 'object' && input) { // non-null object
|
|
return parseEvents([input], null, context, true); // allowOpenRange=true
|
|
}
|
|
if (input != null) {
|
|
return String(input);
|
|
}
|
|
return null;
|
|
}
|
|
|
|
function parseClassNames(raw) {
|
|
if (Array.isArray(raw)) {
|
|
return raw;
|
|
}
|
|
if (typeof raw === 'string') {
|
|
return raw.split(/\s+/);
|
|
}
|
|
return [];
|
|
}
|
|
|
|
// TODO: better called "EventSettings" or "EventConfig"
|
|
// TODO: move this file into structs
|
|
// TODO: separate constraint/overlap/allow, because selection uses only that, not other props
|
|
var EVENT_UI_REFINERS = {
|
|
display: String,
|
|
editable: Boolean,
|
|
startEditable: Boolean,
|
|
durationEditable: Boolean,
|
|
constraint: identity,
|
|
overlap: identity,
|
|
allow: identity,
|
|
className: parseClassNames,
|
|
classNames: parseClassNames,
|
|
color: String,
|
|
backgroundColor: String,
|
|
borderColor: String,
|
|
textColor: String,
|
|
};
|
|
var EMPTY_EVENT_UI = {
|
|
display: null,
|
|
startEditable: null,
|
|
durationEditable: null,
|
|
constraints: [],
|
|
overlap: null,
|
|
allows: [],
|
|
backgroundColor: '',
|
|
borderColor: '',
|
|
textColor: '',
|
|
classNames: [],
|
|
};
|
|
function createEventUi(refined, context) {
|
|
var constraint = normalizeConstraint(refined.constraint, context);
|
|
return {
|
|
display: refined.display || null,
|
|
startEditable: refined.startEditable != null ? refined.startEditable : refined.editable,
|
|
durationEditable: refined.durationEditable != null ? refined.durationEditable : refined.editable,
|
|
constraints: constraint != null ? [constraint] : [],
|
|
overlap: refined.overlap != null ? refined.overlap : null,
|
|
allows: refined.allow != null ? [refined.allow] : [],
|
|
backgroundColor: refined.backgroundColor || refined.color || '',
|
|
borderColor: refined.borderColor || refined.color || '',
|
|
textColor: refined.textColor || '',
|
|
classNames: (refined.className || []).concat(refined.classNames || []), // join singular and plural
|
|
};
|
|
}
|
|
// TODO: prevent against problems with <2 args!
|
|
function combineEventUis(uis) {
|
|
return uis.reduce(combineTwoEventUis, EMPTY_EVENT_UI);
|
|
}
|
|
function combineTwoEventUis(item0, item1) {
|
|
return {
|
|
display: item1.display != null ? item1.display : item0.display,
|
|
startEditable: item1.startEditable != null ? item1.startEditable : item0.startEditable,
|
|
durationEditable: item1.durationEditable != null ? item1.durationEditable : item0.durationEditable,
|
|
constraints: item0.constraints.concat(item1.constraints),
|
|
overlap: typeof item1.overlap === 'boolean' ? item1.overlap : item0.overlap,
|
|
allows: item0.allows.concat(item1.allows),
|
|
backgroundColor: item1.backgroundColor || item0.backgroundColor,
|
|
borderColor: item1.borderColor || item0.borderColor,
|
|
textColor: item1.textColor || item0.textColor,
|
|
classNames: item0.classNames.concat(item1.classNames),
|
|
};
|
|
}
|
|
|
|
var EVENT_NON_DATE_REFINERS = {
|
|
id: String,
|
|
groupId: String,
|
|
title: String,
|
|
url: String,
|
|
interactive: Boolean,
|
|
};
|
|
var EVENT_DATE_REFINERS = {
|
|
start: identity,
|
|
end: identity,
|
|
date: identity,
|
|
allDay: Boolean,
|
|
};
|
|
var EVENT_REFINERS$1 = __assign(__assign(__assign({}, EVENT_NON_DATE_REFINERS), EVENT_DATE_REFINERS), { extendedProps: identity });
|
|
function parseEvent(raw, eventSource, context, allowOpenRange, refiners) {
|
|
if (refiners === void 0) { refiners = buildEventRefiners(context); }
|
|
var _a = refineEventDef(raw, context, refiners), refined = _a.refined, extra = _a.extra;
|
|
var defaultAllDay = computeIsDefaultAllDay(eventSource, context);
|
|
var recurringRes = parseRecurring(refined, defaultAllDay, context.dateEnv, context.pluginHooks.recurringTypes);
|
|
if (recurringRes) {
|
|
var def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', recurringRes.allDay, Boolean(recurringRes.duration), context);
|
|
def.recurringDef = {
|
|
typeId: recurringRes.typeId,
|
|
typeData: recurringRes.typeData,
|
|
duration: recurringRes.duration,
|
|
};
|
|
return { def: def, instance: null };
|
|
}
|
|
var singleRes = parseSingle(refined, defaultAllDay, context, allowOpenRange);
|
|
if (singleRes) {
|
|
var def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', singleRes.allDay, singleRes.hasEnd, context);
|
|
var instance = createEventInstance(def.defId, singleRes.range, singleRes.forcedStartTzo, singleRes.forcedEndTzo);
|
|
return { def: def, instance: instance };
|
|
}
|
|
return null;
|
|
}
|
|
function refineEventDef(raw, context, refiners) {
|
|
if (refiners === void 0) { refiners = buildEventRefiners(context); }
|
|
return refineProps(raw, refiners);
|
|
}
|
|
function buildEventRefiners(context) {
|
|
return __assign(__assign(__assign({}, EVENT_UI_REFINERS), EVENT_REFINERS$1), context.pluginHooks.eventRefiners);
|
|
}
|
|
/*
|
|
Will NOT populate extendedProps with the leftover properties.
|
|
Will NOT populate date-related props.
|
|
*/
|
|
function parseEventDef(refined, extra, sourceId, allDay, hasEnd, context) {
|
|
var def = {
|
|
title: refined.title || '',
|
|
groupId: refined.groupId || '',
|
|
publicId: refined.id || '',
|
|
url: refined.url || '',
|
|
recurringDef: null,
|
|
defId: guid(),
|
|
sourceId: sourceId,
|
|
allDay: allDay,
|
|
hasEnd: hasEnd,
|
|
interactive: refined.interactive,
|
|
ui: createEventUi(refined, context),
|
|
extendedProps: __assign(__assign({}, (refined.extendedProps || {})), extra),
|
|
};
|
|
for (var _i = 0, _a = context.pluginHooks.eventDefMemberAdders; _i < _a.length; _i++) {
|
|
var memberAdder = _a[_i];
|
|
__assign(def, memberAdder(refined));
|
|
}
|
|
// help out EventApi from having user modify props
|
|
Object.freeze(def.ui.classNames);
|
|
Object.freeze(def.extendedProps);
|
|
return def;
|
|
}
|
|
function parseSingle(refined, defaultAllDay, context, allowOpenRange) {
|
|
var allDay = refined.allDay;
|
|
var startMeta;
|
|
var startMarker = null;
|
|
var hasEnd = false;
|
|
var endMeta;
|
|
var endMarker = null;
|
|
var startInput = refined.start != null ? refined.start : refined.date;
|
|
startMeta = context.dateEnv.createMarkerMeta(startInput);
|
|
if (startMeta) {
|
|
startMarker = startMeta.marker;
|
|
}
|
|
else if (!allowOpenRange) {
|
|
return null;
|
|
}
|
|
if (refined.end != null) {
|
|
endMeta = context.dateEnv.createMarkerMeta(refined.end);
|
|
}
|
|
if (allDay == null) {
|
|
if (defaultAllDay != null) {
|
|
allDay = defaultAllDay;
|
|
}
|
|
else {
|
|
// fall back to the date props LAST
|
|
allDay = (!startMeta || startMeta.isTimeUnspecified) &&
|
|
(!endMeta || endMeta.isTimeUnspecified);
|
|
}
|
|
}
|
|
if (allDay && startMarker) {
|
|
startMarker = startOfDay(startMarker);
|
|
}
|
|
if (endMeta) {
|
|
endMarker = endMeta.marker;
|
|
if (allDay) {
|
|
endMarker = startOfDay(endMarker);
|
|
}
|
|
if (startMarker && endMarker <= startMarker) {
|
|
endMarker = null;
|
|
}
|
|
}
|
|
if (endMarker) {
|
|
hasEnd = true;
|
|
}
|
|
else if (!allowOpenRange) {
|
|
hasEnd = context.options.forceEventDuration || false;
|
|
endMarker = context.dateEnv.add(startMarker, allDay ?
|
|
context.options.defaultAllDayEventDuration :
|
|
context.options.defaultTimedEventDuration);
|
|
}
|
|
return {
|
|
allDay: allDay,
|
|
hasEnd: hasEnd,
|
|
range: { start: startMarker, end: endMarker },
|
|
forcedStartTzo: startMeta ? startMeta.forcedTzo : null,
|
|
forcedEndTzo: endMeta ? endMeta.forcedTzo : null,
|
|
};
|
|
}
|
|
function computeIsDefaultAllDay(eventSource, context) {
|
|
var res = null;
|
|
if (eventSource) {
|
|
res = eventSource.defaultAllDay;
|
|
}
|
|
if (res == null) {
|
|
res = context.options.defaultAllDay;
|
|
}
|
|
return res;
|
|
}
|
|
|
|
/* Date stuff that doesn't belong in datelib core
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
// given a timed range, computes an all-day range that has the same exact duration,
|
|
// but whose start time is aligned with the start of the day.
|
|
function computeAlignedDayRange(timedRange) {
|
|
var dayCnt = Math.floor(diffDays(timedRange.start, timedRange.end)) || 1;
|
|
var start = startOfDay(timedRange.start);
|
|
var end = addDays(start, dayCnt);
|
|
return { start: start, end: end };
|
|
}
|
|
// given a timed range, computes an all-day range based on how for the end date bleeds into the next day
|
|
// TODO: give nextDayThreshold a default arg
|
|
function computeVisibleDayRange(timedRange, nextDayThreshold) {
|
|
if (nextDayThreshold === void 0) { nextDayThreshold = createDuration(0); }
|
|
var startDay = null;
|
|
var endDay = null;
|
|
if (timedRange.end) {
|
|
endDay = startOfDay(timedRange.end);
|
|
var endTimeMS = timedRange.end.valueOf() - endDay.valueOf(); // # of milliseconds into `endDay`
|
|
// If the end time is actually inclusively part of the next day and is equal to or
|
|
// beyond the next day threshold, adjust the end to be the exclusive end of `endDay`.
|
|
// Otherwise, leaving it as inclusive will cause it to exclude `endDay`.
|
|
if (endTimeMS && endTimeMS >= asRoughMs(nextDayThreshold)) {
|
|
endDay = addDays(endDay, 1);
|
|
}
|
|
}
|
|
if (timedRange.start) {
|
|
startDay = startOfDay(timedRange.start); // the beginning of the day the range starts
|
|
// If end is within `startDay` but not past nextDayThreshold, assign the default duration of one day.
|
|
if (endDay && endDay <= startDay) {
|
|
endDay = addDays(startDay, 1);
|
|
}
|
|
}
|
|
return { start: startDay, end: endDay };
|
|
}
|
|
// spans from one day into another?
|
|
function isMultiDayRange(range) {
|
|
var visibleRange = computeVisibleDayRange(range);
|
|
return diffDays(visibleRange.start, visibleRange.end) > 1;
|
|
}
|
|
function diffDates(date0, date1, dateEnv, largeUnit) {
|
|
if (largeUnit === 'year') {
|
|
return createDuration(dateEnv.diffWholeYears(date0, date1), 'year');
|
|
}
|
|
if (largeUnit === 'month') {
|
|
return createDuration(dateEnv.diffWholeMonths(date0, date1), 'month');
|
|
}
|
|
return diffDayAndTime(date0, date1); // returns a duration
|
|
}
|
|
|
|
function parseRange(input, dateEnv) {
|
|
var start = null;
|
|
var end = null;
|
|
if (input.start) {
|
|
start = dateEnv.createMarker(input.start);
|
|
}
|
|
if (input.end) {
|
|
end = dateEnv.createMarker(input.end);
|
|
}
|
|
if (!start && !end) {
|
|
return null;
|
|
}
|
|
if (start && end && end < start) {
|
|
return null;
|
|
}
|
|
return { start: start, end: end };
|
|
}
|
|
// SIDE-EFFECT: will mutate ranges.
|
|
// Will return a new array result.
|
|
function invertRanges(ranges, constraintRange) {
|
|
var invertedRanges = [];
|
|
var start = constraintRange.start; // the end of the previous range. the start of the new range
|
|
var i;
|
|
var dateRange;
|
|
// ranges need to be in order. required for our date-walking algorithm
|
|
ranges.sort(compareRanges);
|
|
for (i = 0; i < ranges.length; i += 1) {
|
|
dateRange = ranges[i];
|
|
// add the span of time before the event (if there is any)
|
|
if (dateRange.start > start) { // compare millisecond time (skip any ambig logic)
|
|
invertedRanges.push({ start: start, end: dateRange.start });
|
|
}
|
|
if (dateRange.end > start) {
|
|
start = dateRange.end;
|
|
}
|
|
}
|
|
// add the span of time after the last event (if there is any)
|
|
if (start < constraintRange.end) { // compare millisecond time (skip any ambig logic)
|
|
invertedRanges.push({ start: start, end: constraintRange.end });
|
|
}
|
|
return invertedRanges;
|
|
}
|
|
function compareRanges(range0, range1) {
|
|
return range0.start.valueOf() - range1.start.valueOf(); // earlier ranges go first
|
|
}
|
|
function intersectRanges(range0, range1) {
|
|
var start = range0.start, end = range0.end;
|
|
var newRange = null;
|
|
if (range1.start !== null) {
|
|
if (start === null) {
|
|
start = range1.start;
|
|
}
|
|
else {
|
|
start = new Date(Math.max(start.valueOf(), range1.start.valueOf()));
|
|
}
|
|
}
|
|
if (range1.end != null) {
|
|
if (end === null) {
|
|
end = range1.end;
|
|
}
|
|
else {
|
|
end = new Date(Math.min(end.valueOf(), range1.end.valueOf()));
|
|
}
|
|
}
|
|
if (start === null || end === null || start < end) {
|
|
newRange = { start: start, end: end };
|
|
}
|
|
return newRange;
|
|
}
|
|
function rangesEqual(range0, range1) {
|
|
return (range0.start === null ? null : range0.start.valueOf()) === (range1.start === null ? null : range1.start.valueOf()) &&
|
|
(range0.end === null ? null : range0.end.valueOf()) === (range1.end === null ? null : range1.end.valueOf());
|
|
}
|
|
function rangesIntersect(range0, range1) {
|
|
return (range0.end === null || range1.start === null || range0.end > range1.start) &&
|
|
(range0.start === null || range1.end === null || range0.start < range1.end);
|
|
}
|
|
function rangeContainsRange(outerRange, innerRange) {
|
|
return (outerRange.start === null || (innerRange.start !== null && innerRange.start >= outerRange.start)) &&
|
|
(outerRange.end === null || (innerRange.end !== null && innerRange.end <= outerRange.end));
|
|
}
|
|
function rangeContainsMarker(range, date) {
|
|
return (range.start === null || date >= range.start) &&
|
|
(range.end === null || date < range.end);
|
|
}
|
|
// If the given date is not within the given range, move it inside.
|
|
// (If it's past the end, make it one millisecond before the end).
|
|
function constrainMarkerToRange(date, range) {
|
|
if (range.start != null && date < range.start) {
|
|
return range.start;
|
|
}
|
|
if (range.end != null && date >= range.end) {
|
|
return new Date(range.end.valueOf() - 1);
|
|
}
|
|
return date;
|
|
}
|
|
|
|
/*
|
|
Specifying nextDayThreshold signals that all-day ranges should be sliced.
|
|
*/
|
|
function sliceEventStore(eventStore, eventUiBases, framingRange, nextDayThreshold) {
|
|
var inverseBgByGroupId = {};
|
|
var inverseBgByDefId = {};
|
|
var defByGroupId = {};
|
|
var bgRanges = [];
|
|
var fgRanges = [];
|
|
var eventUis = compileEventUis(eventStore.defs, eventUiBases);
|
|
for (var defId in eventStore.defs) {
|
|
var def = eventStore.defs[defId];
|
|
var ui = eventUis[def.defId];
|
|
if (ui.display === 'inverse-background') {
|
|
if (def.groupId) {
|
|
inverseBgByGroupId[def.groupId] = [];
|
|
if (!defByGroupId[def.groupId]) {
|
|
defByGroupId[def.groupId] = def;
|
|
}
|
|
}
|
|
else {
|
|
inverseBgByDefId[defId] = [];
|
|
}
|
|
}
|
|
}
|
|
for (var instanceId in eventStore.instances) {
|
|
var instance = eventStore.instances[instanceId];
|
|
var def = eventStore.defs[instance.defId];
|
|
var ui = eventUis[def.defId];
|
|
var origRange = instance.range;
|
|
var normalRange = (!def.allDay && nextDayThreshold) ?
|
|
computeVisibleDayRange(origRange, nextDayThreshold) :
|
|
origRange;
|
|
var slicedRange = intersectRanges(normalRange, framingRange);
|
|
if (slicedRange) {
|
|
if (ui.display === 'inverse-background') {
|
|
if (def.groupId) {
|
|
inverseBgByGroupId[def.groupId].push(slicedRange);
|
|
}
|
|
else {
|
|
inverseBgByDefId[instance.defId].push(slicedRange);
|
|
}
|
|
}
|
|
else if (ui.display !== 'none') {
|
|
(ui.display === 'background' ? bgRanges : fgRanges).push({
|
|
def: def,
|
|
ui: ui,
|
|
instance: instance,
|
|
range: slicedRange,
|
|
isStart: normalRange.start && normalRange.start.valueOf() === slicedRange.start.valueOf(),
|
|
isEnd: normalRange.end && normalRange.end.valueOf() === slicedRange.end.valueOf(),
|
|
});
|
|
}
|
|
}
|
|
}
|
|
for (var groupId in inverseBgByGroupId) { // BY GROUP
|
|
var ranges = inverseBgByGroupId[groupId];
|
|
var invertedRanges = invertRanges(ranges, framingRange);
|
|
for (var _i = 0, invertedRanges_1 = invertedRanges; _i < invertedRanges_1.length; _i++) {
|
|
var invertedRange = invertedRanges_1[_i];
|
|
var def = defByGroupId[groupId];
|
|
var ui = eventUis[def.defId];
|
|
bgRanges.push({
|
|
def: def,
|
|
ui: ui,
|
|
instance: null,
|
|
range: invertedRange,
|
|
isStart: false,
|
|
isEnd: false,
|
|
});
|
|
}
|
|
}
|
|
for (var defId in inverseBgByDefId) {
|
|
var ranges = inverseBgByDefId[defId];
|
|
var invertedRanges = invertRanges(ranges, framingRange);
|
|
for (var _a = 0, invertedRanges_2 = invertedRanges; _a < invertedRanges_2.length; _a++) {
|
|
var invertedRange = invertedRanges_2[_a];
|
|
bgRanges.push({
|
|
def: eventStore.defs[defId],
|
|
ui: eventUis[defId],
|
|
instance: null,
|
|
range: invertedRange,
|
|
isStart: false,
|
|
isEnd: false,
|
|
});
|
|
}
|
|
}
|
|
return { bg: bgRanges, fg: fgRanges };
|
|
}
|
|
function hasBgRendering(def) {
|
|
return def.ui.display === 'background' || def.ui.display === 'inverse-background';
|
|
}
|
|
function setElSeg(el, seg) {
|
|
el.fcSeg = seg;
|
|
}
|
|
function getElSeg(el) {
|
|
return el.fcSeg ||
|
|
el.parentNode.fcSeg || // for the harness
|
|
null;
|
|
}
|
|
// event ui computation
|
|
function compileEventUis(eventDefs, eventUiBases) {
|
|
return mapHash(eventDefs, function (eventDef) { return compileEventUi(eventDef, eventUiBases); });
|
|
}
|
|
function compileEventUi(eventDef, eventUiBases) {
|
|
var uis = [];
|
|
if (eventUiBases['']) {
|
|
uis.push(eventUiBases['']);
|
|
}
|
|
if (eventUiBases[eventDef.defId]) {
|
|
uis.push(eventUiBases[eventDef.defId]);
|
|
}
|
|
uis.push(eventDef.ui);
|
|
return combineEventUis(uis);
|
|
}
|
|
function sortEventSegs(segs, eventOrderSpecs) {
|
|
var objs = segs.map(buildSegCompareObj);
|
|
objs.sort(function (obj0, obj1) { return compareByFieldSpecs(obj0, obj1, eventOrderSpecs); });
|
|
return objs.map(function (c) { return c._seg; });
|
|
}
|
|
// returns a object with all primitive props that can be compared
|
|
function buildSegCompareObj(seg) {
|
|
var eventRange = seg.eventRange;
|
|
var eventDef = eventRange.def;
|
|
var range = eventRange.instance ? eventRange.instance.range : eventRange.range;
|
|
var start = range.start ? range.start.valueOf() : 0; // TODO: better support for open-range events
|
|
var end = range.end ? range.end.valueOf() : 0; // "
|
|
return __assign(__assign(__assign({}, eventDef.extendedProps), eventDef), { id: eventDef.publicId, start: start,
|
|
end: end, duration: end - start, allDay: Number(eventDef.allDay), _seg: seg });
|
|
}
|
|
function computeSegDraggable(seg, context) {
|
|
var pluginHooks = context.pluginHooks;
|
|
var transformers = pluginHooks.isDraggableTransformers;
|
|
var _a = seg.eventRange, def = _a.def, ui = _a.ui;
|
|
var val = ui.startEditable;
|
|
for (var _i = 0, transformers_1 = transformers; _i < transformers_1.length; _i++) {
|
|
var transformer = transformers_1[_i];
|
|
val = transformer(val, def, ui, context);
|
|
}
|
|
return val;
|
|
}
|
|
function computeSegStartResizable(seg, context) {
|
|
return seg.isStart && seg.eventRange.ui.durationEditable && context.options.eventResizableFromStart;
|
|
}
|
|
function computeSegEndResizable(seg, context) {
|
|
return seg.isEnd && seg.eventRange.ui.durationEditable;
|
|
}
|
|
function buildSegTimeText(seg, timeFormat, context, defaultDisplayEventTime, // defaults to true
|
|
defaultDisplayEventEnd, // defaults to true
|
|
startOverride, endOverride) {
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var displayEventTime = options.displayEventTime, displayEventEnd = options.displayEventEnd;
|
|
var eventDef = seg.eventRange.def;
|
|
var eventInstance = seg.eventRange.instance;
|
|
if (displayEventTime == null) {
|
|
displayEventTime = defaultDisplayEventTime !== false;
|
|
}
|
|
if (displayEventEnd == null) {
|
|
displayEventEnd = defaultDisplayEventEnd !== false;
|
|
}
|
|
var wholeEventStart = eventInstance.range.start;
|
|
var wholeEventEnd = eventInstance.range.end;
|
|
var segStart = startOverride || seg.start || seg.eventRange.range.start;
|
|
var segEnd = endOverride || seg.end || seg.eventRange.range.end;
|
|
var isStartDay = startOfDay(wholeEventStart).valueOf() === startOfDay(segStart).valueOf();
|
|
var isEndDay = startOfDay(addMs(wholeEventEnd, -1)).valueOf() === startOfDay(addMs(segEnd, -1)).valueOf();
|
|
if (displayEventTime && !eventDef.allDay && (isStartDay || isEndDay)) {
|
|
segStart = isStartDay ? wholeEventStart : segStart;
|
|
segEnd = isEndDay ? wholeEventEnd : segEnd;
|
|
if (displayEventEnd && eventDef.hasEnd) {
|
|
return dateEnv.formatRange(segStart, segEnd, timeFormat, {
|
|
forcedStartTzo: startOverride ? null : eventInstance.forcedStartTzo,
|
|
forcedEndTzo: endOverride ? null : eventInstance.forcedEndTzo,
|
|
});
|
|
}
|
|
return dateEnv.format(segStart, timeFormat, {
|
|
forcedTzo: startOverride ? null : eventInstance.forcedStartTzo, // nooooo, same
|
|
});
|
|
}
|
|
return '';
|
|
}
|
|
function getSegMeta(seg, todayRange, nowDate) {
|
|
var segRange = seg.eventRange.range;
|
|
return {
|
|
isPast: segRange.end < (nowDate || todayRange.start),
|
|
isFuture: segRange.start >= (nowDate || todayRange.end),
|
|
isToday: todayRange && rangeContainsMarker(todayRange, segRange.start),
|
|
};
|
|
}
|
|
function getEventClassNames(props) {
|
|
var classNames = ['fc-event'];
|
|
if (props.isMirror) {
|
|
classNames.push('fc-event-mirror');
|
|
}
|
|
if (props.isDraggable) {
|
|
classNames.push('fc-event-draggable');
|
|
}
|
|
if (props.isStartResizable || props.isEndResizable) {
|
|
classNames.push('fc-event-resizable');
|
|
}
|
|
if (props.isDragging) {
|
|
classNames.push('fc-event-dragging');
|
|
}
|
|
if (props.isResizing) {
|
|
classNames.push('fc-event-resizing');
|
|
}
|
|
if (props.isSelected) {
|
|
classNames.push('fc-event-selected');
|
|
}
|
|
if (props.isStart) {
|
|
classNames.push('fc-event-start');
|
|
}
|
|
if (props.isEnd) {
|
|
classNames.push('fc-event-end');
|
|
}
|
|
if (props.isPast) {
|
|
classNames.push('fc-event-past');
|
|
}
|
|
if (props.isToday) {
|
|
classNames.push('fc-event-today');
|
|
}
|
|
if (props.isFuture) {
|
|
classNames.push('fc-event-future');
|
|
}
|
|
return classNames;
|
|
}
|
|
function buildEventRangeKey(eventRange) {
|
|
return eventRange.instance
|
|
? eventRange.instance.instanceId
|
|
: eventRange.def.defId + ":" + eventRange.range.start.toISOString();
|
|
// inverse-background events don't have specific instances. TODO: better solution
|
|
}
|
|
function getSegAnchorAttrs(seg, context) {
|
|
var _a = seg.eventRange, def = _a.def, instance = _a.instance;
|
|
var url = def.url;
|
|
if (url) {
|
|
return { href: url };
|
|
}
|
|
var emitter = context.emitter, options = context.options;
|
|
var eventInteractive = options.eventInteractive;
|
|
if (eventInteractive == null) {
|
|
eventInteractive = def.interactive;
|
|
if (eventInteractive == null) {
|
|
eventInteractive = Boolean(emitter.hasHandlers('eventClick'));
|
|
}
|
|
}
|
|
// mock what happens in EventClicking
|
|
if (eventInteractive) {
|
|
// only attach keyboard-related handlers because click handler is already done in EventClicking
|
|
return createAriaKeyboardAttrs(function (ev) {
|
|
emitter.trigger('eventClick', {
|
|
el: ev.target,
|
|
event: new EventApi(context, def, instance),
|
|
jsEvent: ev,
|
|
view: context.viewApi,
|
|
});
|
|
});
|
|
}
|
|
return {};
|
|
}
|
|
|
|
var STANDARD_PROPS = {
|
|
start: identity,
|
|
end: identity,
|
|
allDay: Boolean,
|
|
};
|
|
function parseDateSpan(raw, dateEnv, defaultDuration) {
|
|
var span = parseOpenDateSpan(raw, dateEnv);
|
|
var range = span.range;
|
|
if (!range.start) {
|
|
return null;
|
|
}
|
|
if (!range.end) {
|
|
if (defaultDuration == null) {
|
|
return null;
|
|
}
|
|
range.end = dateEnv.add(range.start, defaultDuration);
|
|
}
|
|
return span;
|
|
}
|
|
/*
|
|
TODO: somehow combine with parseRange?
|
|
Will return null if the start/end props were present but parsed invalidly.
|
|
*/
|
|
function parseOpenDateSpan(raw, dateEnv) {
|
|
var _a = refineProps(raw, STANDARD_PROPS), standardProps = _a.refined, extra = _a.extra;
|
|
var startMeta = standardProps.start ? dateEnv.createMarkerMeta(standardProps.start) : null;
|
|
var endMeta = standardProps.end ? dateEnv.createMarkerMeta(standardProps.end) : null;
|
|
var allDay = standardProps.allDay;
|
|
if (allDay == null) {
|
|
allDay = (startMeta && startMeta.isTimeUnspecified) &&
|
|
(!endMeta || endMeta.isTimeUnspecified);
|
|
}
|
|
return __assign({ range: {
|
|
start: startMeta ? startMeta.marker : null,
|
|
end: endMeta ? endMeta.marker : null,
|
|
}, allDay: allDay }, extra);
|
|
}
|
|
function isDateSpansEqual(span0, span1) {
|
|
return rangesEqual(span0.range, span1.range) &&
|
|
span0.allDay === span1.allDay &&
|
|
isSpanPropsEqual(span0, span1);
|
|
}
|
|
// the NON-DATE-RELATED props
|
|
function isSpanPropsEqual(span0, span1) {
|
|
for (var propName in span1) {
|
|
if (propName !== 'range' && propName !== 'allDay') {
|
|
if (span0[propName] !== span1[propName]) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
// are there any props that span0 has that span1 DOESN'T have?
|
|
// both have range/allDay, so no need to special-case.
|
|
for (var propName in span0) {
|
|
if (!(propName in span1)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
function buildDateSpanApi(span, dateEnv) {
|
|
return __assign(__assign({}, buildRangeApi(span.range, dateEnv, span.allDay)), { allDay: span.allDay });
|
|
}
|
|
function buildRangeApiWithTimeZone(range, dateEnv, omitTime) {
|
|
return __assign(__assign({}, buildRangeApi(range, dateEnv, omitTime)), { timeZone: dateEnv.timeZone });
|
|
}
|
|
function buildRangeApi(range, dateEnv, omitTime) {
|
|
return {
|
|
start: dateEnv.toDate(range.start),
|
|
end: dateEnv.toDate(range.end),
|
|
startStr: dateEnv.formatIso(range.start, { omitTime: omitTime }),
|
|
endStr: dateEnv.formatIso(range.end, { omitTime: omitTime }),
|
|
};
|
|
}
|
|
function fabricateEventRange(dateSpan, eventUiBases, context) {
|
|
var res = refineEventDef({ editable: false }, context);
|
|
var def = parseEventDef(res.refined, res.extra, '', // sourceId
|
|
dateSpan.allDay, true, // hasEnd
|
|
context);
|
|
return {
|
|
def: def,
|
|
ui: compileEventUi(def, eventUiBases),
|
|
instance: createEventInstance(def.defId, dateSpan.range),
|
|
range: dateSpan.range,
|
|
isStart: true,
|
|
isEnd: true,
|
|
};
|
|
}
|
|
|
|
function triggerDateSelect(selection, pev, context) {
|
|
context.emitter.trigger('select', __assign(__assign({}, buildDateSpanApiWithContext(selection, context)), { jsEvent: pev ? pev.origEvent : null, view: context.viewApi || context.calendarApi.view }));
|
|
}
|
|
function triggerDateUnselect(pev, context) {
|
|
context.emitter.trigger('unselect', {
|
|
jsEvent: pev ? pev.origEvent : null,
|
|
view: context.viewApi || context.calendarApi.view,
|
|
});
|
|
}
|
|
function buildDateSpanApiWithContext(dateSpan, context) {
|
|
var props = {};
|
|
for (var _i = 0, _a = context.pluginHooks.dateSpanTransforms; _i < _a.length; _i++) {
|
|
var transform = _a[_i];
|
|
__assign(props, transform(dateSpan, context));
|
|
}
|
|
__assign(props, buildDateSpanApi(dateSpan, context.dateEnv));
|
|
return props;
|
|
}
|
|
// Given an event's allDay status and start date, return what its fallback end date should be.
|
|
// TODO: rename to computeDefaultEventEnd
|
|
function getDefaultEventEnd(allDay, marker, context) {
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var end = marker;
|
|
if (allDay) {
|
|
end = startOfDay(end);
|
|
end = dateEnv.add(end, options.defaultAllDayEventDuration);
|
|
}
|
|
else {
|
|
end = dateEnv.add(end, options.defaultTimedEventDuration);
|
|
}
|
|
return end;
|
|
}
|
|
|
|
// applies the mutation to ALL defs/instances within the event store
|
|
function applyMutationToEventStore(eventStore, eventConfigBase, mutation, context) {
|
|
var eventConfigs = compileEventUis(eventStore.defs, eventConfigBase);
|
|
var dest = createEmptyEventStore();
|
|
for (var defId in eventStore.defs) {
|
|
var def = eventStore.defs[defId];
|
|
dest.defs[defId] = applyMutationToEventDef(def, eventConfigs[defId], mutation, context);
|
|
}
|
|
for (var instanceId in eventStore.instances) {
|
|
var instance = eventStore.instances[instanceId];
|
|
var def = dest.defs[instance.defId]; // important to grab the newly modified def
|
|
dest.instances[instanceId] = applyMutationToEventInstance(instance, def, eventConfigs[instance.defId], mutation, context);
|
|
}
|
|
return dest;
|
|
}
|
|
function applyMutationToEventDef(eventDef, eventConfig, mutation, context) {
|
|
var standardProps = mutation.standardProps || {};
|
|
// if hasEnd has not been specified, guess a good value based on deltas.
|
|
// if duration will change, there's no way the default duration will persist,
|
|
// and thus, we need to mark the event as having a real end
|
|
if (standardProps.hasEnd == null &&
|
|
eventConfig.durationEditable &&
|
|
(mutation.startDelta || mutation.endDelta)) {
|
|
standardProps.hasEnd = true; // TODO: is this mutation okay?
|
|
}
|
|
var copy = __assign(__assign(__assign({}, eventDef), standardProps), { ui: __assign(__assign({}, eventDef.ui), standardProps.ui) });
|
|
if (mutation.extendedProps) {
|
|
copy.extendedProps = __assign(__assign({}, copy.extendedProps), mutation.extendedProps);
|
|
}
|
|
for (var _i = 0, _a = context.pluginHooks.eventDefMutationAppliers; _i < _a.length; _i++) {
|
|
var applier = _a[_i];
|
|
applier(copy, mutation, context);
|
|
}
|
|
if (!copy.hasEnd && context.options.forceEventDuration) {
|
|
copy.hasEnd = true;
|
|
}
|
|
return copy;
|
|
}
|
|
function applyMutationToEventInstance(eventInstance, eventDef, // must first be modified by applyMutationToEventDef
|
|
eventConfig, mutation, context) {
|
|
var dateEnv = context.dateEnv;
|
|
var forceAllDay = mutation.standardProps && mutation.standardProps.allDay === true;
|
|
var clearEnd = mutation.standardProps && mutation.standardProps.hasEnd === false;
|
|
var copy = __assign({}, eventInstance);
|
|
if (forceAllDay) {
|
|
copy.range = computeAlignedDayRange(copy.range);
|
|
}
|
|
if (mutation.datesDelta && eventConfig.startEditable) {
|
|
copy.range = {
|
|
start: dateEnv.add(copy.range.start, mutation.datesDelta),
|
|
end: dateEnv.add(copy.range.end, mutation.datesDelta),
|
|
};
|
|
}
|
|
if (mutation.startDelta && eventConfig.durationEditable) {
|
|
copy.range = {
|
|
start: dateEnv.add(copy.range.start, mutation.startDelta),
|
|
end: copy.range.end,
|
|
};
|
|
}
|
|
if (mutation.endDelta && eventConfig.durationEditable) {
|
|
copy.range = {
|
|
start: copy.range.start,
|
|
end: dateEnv.add(copy.range.end, mutation.endDelta),
|
|
};
|
|
}
|
|
if (clearEnd) {
|
|
copy.range = {
|
|
start: copy.range.start,
|
|
end: getDefaultEventEnd(eventDef.allDay, copy.range.start, context),
|
|
};
|
|
}
|
|
// in case event was all-day but the supplied deltas were not
|
|
// better util for this?
|
|
if (eventDef.allDay) {
|
|
copy.range = {
|
|
start: startOfDay(copy.range.start),
|
|
end: startOfDay(copy.range.end),
|
|
};
|
|
}
|
|
// handle invalid durations
|
|
if (copy.range.end < copy.range.start) {
|
|
copy.range.end = getDefaultEventEnd(eventDef.allDay, copy.range.start, context);
|
|
}
|
|
return copy;
|
|
}
|
|
|
|
// no public types yet. when there are, export from:
|
|
// import {} from './api-type-deps'
|
|
var ViewApi = /** @class */ (function () {
|
|
function ViewApi(type, getCurrentData, dateEnv) {
|
|
this.type = type;
|
|
this.getCurrentData = getCurrentData;
|
|
this.dateEnv = dateEnv;
|
|
}
|
|
Object.defineProperty(ViewApi.prototype, "calendar", {
|
|
get: function () {
|
|
return this.getCurrentData().calendarApi;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ViewApi.prototype, "title", {
|
|
get: function () {
|
|
return this.getCurrentData().viewTitle;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ViewApi.prototype, "activeStart", {
|
|
get: function () {
|
|
return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.start);
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ViewApi.prototype, "activeEnd", {
|
|
get: function () {
|
|
return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.end);
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ViewApi.prototype, "currentStart", {
|
|
get: function () {
|
|
return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.start);
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ViewApi.prototype, "currentEnd", {
|
|
get: function () {
|
|
return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.end);
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
ViewApi.prototype.getOption = function (name) {
|
|
return this.getCurrentData().options[name]; // are the view-specific options
|
|
};
|
|
return ViewApi;
|
|
}());
|
|
|
|
var EVENT_SOURCE_REFINERS$1 = {
|
|
id: String,
|
|
defaultAllDay: Boolean,
|
|
url: String,
|
|
format: String,
|
|
events: identity,
|
|
eventDataTransform: identity,
|
|
// for any network-related sources
|
|
success: identity,
|
|
failure: identity,
|
|
};
|
|
function parseEventSource(raw, context, refiners) {
|
|
if (refiners === void 0) { refiners = buildEventSourceRefiners(context); }
|
|
var rawObj;
|
|
if (typeof raw === 'string') {
|
|
rawObj = { url: raw };
|
|
}
|
|
else if (typeof raw === 'function' || Array.isArray(raw)) {
|
|
rawObj = { events: raw };
|
|
}
|
|
else if (typeof raw === 'object' && raw) { // not null
|
|
rawObj = raw;
|
|
}
|
|
if (rawObj) {
|
|
var _a = refineProps(rawObj, refiners), refined = _a.refined, extra = _a.extra;
|
|
var metaRes = buildEventSourceMeta(refined, context);
|
|
if (metaRes) {
|
|
return {
|
|
_raw: raw,
|
|
isFetching: false,
|
|
latestFetchId: '',
|
|
fetchRange: null,
|
|
defaultAllDay: refined.defaultAllDay,
|
|
eventDataTransform: refined.eventDataTransform,
|
|
success: refined.success,
|
|
failure: refined.failure,
|
|
publicId: refined.id || '',
|
|
sourceId: guid(),
|
|
sourceDefId: metaRes.sourceDefId,
|
|
meta: metaRes.meta,
|
|
ui: createEventUi(refined, context),
|
|
extendedProps: extra,
|
|
};
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function buildEventSourceRefiners(context) {
|
|
return __assign(__assign(__assign({}, EVENT_UI_REFINERS), EVENT_SOURCE_REFINERS$1), context.pluginHooks.eventSourceRefiners);
|
|
}
|
|
function buildEventSourceMeta(raw, context) {
|
|
var defs = context.pluginHooks.eventSourceDefs;
|
|
for (var i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
|
|
var def = defs[i];
|
|
var meta = def.parseMeta(raw);
|
|
if (meta) {
|
|
return { sourceDefId: i, meta: meta };
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
|
|
function reduceCurrentDate(currentDate, action) {
|
|
switch (action.type) {
|
|
case 'CHANGE_DATE':
|
|
return action.dateMarker;
|
|
default:
|
|
return currentDate;
|
|
}
|
|
}
|
|
function getInitialDate(options, dateEnv) {
|
|
var initialDateInput = options.initialDate;
|
|
// compute the initial ambig-timezone date
|
|
if (initialDateInput != null) {
|
|
return dateEnv.createMarker(initialDateInput);
|
|
}
|
|
return getNow(options.now, dateEnv); // getNow already returns unzoned
|
|
}
|
|
function getNow(nowInput, dateEnv) {
|
|
if (typeof nowInput === 'function') {
|
|
nowInput = nowInput();
|
|
}
|
|
if (nowInput == null) {
|
|
return dateEnv.createNowMarker();
|
|
}
|
|
return dateEnv.createMarker(nowInput);
|
|
}
|
|
|
|
var CalendarApi = /** @class */ (function () {
|
|
function CalendarApi() {
|
|
}
|
|
CalendarApi.prototype.getCurrentData = function () {
|
|
return this.currentDataManager.getCurrentData();
|
|
};
|
|
CalendarApi.prototype.dispatch = function (action) {
|
|
return this.currentDataManager.dispatch(action);
|
|
};
|
|
Object.defineProperty(CalendarApi.prototype, "view", {
|
|
get: function () { return this.getCurrentData().viewApi; } // for public API
|
|
,
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
CalendarApi.prototype.batchRendering = function (callback) {
|
|
callback();
|
|
};
|
|
CalendarApi.prototype.updateSize = function () {
|
|
this.trigger('_resize', true);
|
|
};
|
|
// Options
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.setOption = function (name, val) {
|
|
this.dispatch({
|
|
type: 'SET_OPTION',
|
|
optionName: name,
|
|
rawOptionValue: val,
|
|
});
|
|
};
|
|
CalendarApi.prototype.getOption = function (name) {
|
|
return this.currentDataManager.currentCalendarOptionsInput[name];
|
|
};
|
|
CalendarApi.prototype.getAvailableLocaleCodes = function () {
|
|
return Object.keys(this.getCurrentData().availableRawLocales);
|
|
};
|
|
// Trigger
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.on = function (handlerName, handler) {
|
|
var currentDataManager = this.currentDataManager;
|
|
if (currentDataManager.currentCalendarOptionsRefiners[handlerName]) {
|
|
currentDataManager.emitter.on(handlerName, handler);
|
|
}
|
|
else {
|
|
console.warn("Unknown listener name '" + handlerName + "'");
|
|
}
|
|
};
|
|
CalendarApi.prototype.off = function (handlerName, handler) {
|
|
this.currentDataManager.emitter.off(handlerName, handler);
|
|
};
|
|
// not meant for public use
|
|
CalendarApi.prototype.trigger = function (handlerName) {
|
|
var _a;
|
|
var args = [];
|
|
for (var _i = 1; _i < arguments.length; _i++) {
|
|
args[_i - 1] = arguments[_i];
|
|
}
|
|
(_a = this.currentDataManager.emitter).trigger.apply(_a, __spreadArray([handlerName], args));
|
|
};
|
|
// View
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.changeView = function (viewType, dateOrRange) {
|
|
var _this = this;
|
|
this.batchRendering(function () {
|
|
_this.unselect();
|
|
if (dateOrRange) {
|
|
if (dateOrRange.start && dateOrRange.end) { // a range
|
|
_this.dispatch({
|
|
type: 'CHANGE_VIEW_TYPE',
|
|
viewType: viewType,
|
|
});
|
|
_this.dispatch({
|
|
type: 'SET_OPTION',
|
|
optionName: 'visibleRange',
|
|
rawOptionValue: dateOrRange,
|
|
});
|
|
}
|
|
else {
|
|
var dateEnv = _this.getCurrentData().dateEnv;
|
|
_this.dispatch({
|
|
type: 'CHANGE_VIEW_TYPE',
|
|
viewType: viewType,
|
|
dateMarker: dateEnv.createMarker(dateOrRange),
|
|
});
|
|
}
|
|
}
|
|
else {
|
|
_this.dispatch({
|
|
type: 'CHANGE_VIEW_TYPE',
|
|
viewType: viewType,
|
|
});
|
|
}
|
|
});
|
|
};
|
|
// Forces navigation to a view for the given date.
|
|
// `viewType` can be a specific view name or a generic one like "week" or "day".
|
|
// needs to change
|
|
CalendarApi.prototype.zoomTo = function (dateMarker, viewType) {
|
|
var state = this.getCurrentData();
|
|
var spec;
|
|
viewType = viewType || 'day'; // day is default zoom
|
|
spec = state.viewSpecs[viewType] || this.getUnitViewSpec(viewType);
|
|
this.unselect();
|
|
if (spec) {
|
|
this.dispatch({
|
|
type: 'CHANGE_VIEW_TYPE',
|
|
viewType: spec.type,
|
|
dateMarker: dateMarker,
|
|
});
|
|
}
|
|
else {
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: dateMarker,
|
|
});
|
|
}
|
|
};
|
|
// Given a duration singular unit, like "week" or "day", finds a matching view spec.
|
|
// Preference is given to views that have corresponding buttons.
|
|
CalendarApi.prototype.getUnitViewSpec = function (unit) {
|
|
var _a = this.getCurrentData(), viewSpecs = _a.viewSpecs, toolbarConfig = _a.toolbarConfig;
|
|
var viewTypes = [].concat(toolbarConfig.header ? toolbarConfig.header.viewsWithButtons : [], toolbarConfig.footer ? toolbarConfig.footer.viewsWithButtons : []);
|
|
var i;
|
|
var spec;
|
|
for (var viewType in viewSpecs) {
|
|
viewTypes.push(viewType);
|
|
}
|
|
for (i = 0; i < viewTypes.length; i += 1) {
|
|
spec = viewSpecs[viewTypes[i]];
|
|
if (spec) {
|
|
if (spec.singleUnit === unit) {
|
|
return spec;
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
// Current Date
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.prev = function () {
|
|
this.unselect();
|
|
this.dispatch({ type: 'PREV' });
|
|
};
|
|
CalendarApi.prototype.next = function () {
|
|
this.unselect();
|
|
this.dispatch({ type: 'NEXT' });
|
|
};
|
|
CalendarApi.prototype.prevYear = function () {
|
|
var state = this.getCurrentData();
|
|
this.unselect();
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: state.dateEnv.addYears(state.currentDate, -1),
|
|
});
|
|
};
|
|
CalendarApi.prototype.nextYear = function () {
|
|
var state = this.getCurrentData();
|
|
this.unselect();
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: state.dateEnv.addYears(state.currentDate, 1),
|
|
});
|
|
};
|
|
CalendarApi.prototype.today = function () {
|
|
var state = this.getCurrentData();
|
|
this.unselect();
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: getNow(state.calendarOptions.now, state.dateEnv),
|
|
});
|
|
};
|
|
CalendarApi.prototype.gotoDate = function (zonedDateInput) {
|
|
var state = this.getCurrentData();
|
|
this.unselect();
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: state.dateEnv.createMarker(zonedDateInput),
|
|
});
|
|
};
|
|
CalendarApi.prototype.incrementDate = function (deltaInput) {
|
|
var state = this.getCurrentData();
|
|
var delta = createDuration(deltaInput);
|
|
if (delta) { // else, warn about invalid input?
|
|
this.unselect();
|
|
this.dispatch({
|
|
type: 'CHANGE_DATE',
|
|
dateMarker: state.dateEnv.add(state.currentDate, delta),
|
|
});
|
|
}
|
|
};
|
|
// for external API
|
|
CalendarApi.prototype.getDate = function () {
|
|
var state = this.getCurrentData();
|
|
return state.dateEnv.toDate(state.currentDate);
|
|
};
|
|
// Date Formatting Utils
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.formatDate = function (d, formatter) {
|
|
var dateEnv = this.getCurrentData().dateEnv;
|
|
return dateEnv.format(dateEnv.createMarker(d), createFormatter(formatter));
|
|
};
|
|
// `settings` is for formatter AND isEndExclusive
|
|
CalendarApi.prototype.formatRange = function (d0, d1, settings) {
|
|
var dateEnv = this.getCurrentData().dateEnv;
|
|
return dateEnv.formatRange(dateEnv.createMarker(d0), dateEnv.createMarker(d1), createFormatter(settings), settings);
|
|
};
|
|
CalendarApi.prototype.formatIso = function (d, omitTime) {
|
|
var dateEnv = this.getCurrentData().dateEnv;
|
|
return dateEnv.formatIso(dateEnv.createMarker(d), { omitTime: omitTime });
|
|
};
|
|
// Date Selection / Event Selection / DayClick
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
// this public method receives start/end dates in any format, with any timezone
|
|
// NOTE: args were changed from v3
|
|
CalendarApi.prototype.select = function (dateOrObj, endDate) {
|
|
var selectionInput;
|
|
if (endDate == null) {
|
|
if (dateOrObj.start != null) {
|
|
selectionInput = dateOrObj;
|
|
}
|
|
else {
|
|
selectionInput = {
|
|
start: dateOrObj,
|
|
end: null,
|
|
};
|
|
}
|
|
}
|
|
else {
|
|
selectionInput = {
|
|
start: dateOrObj,
|
|
end: endDate,
|
|
};
|
|
}
|
|
var state = this.getCurrentData();
|
|
var selection = parseDateSpan(selectionInput, state.dateEnv, createDuration({ days: 1 }));
|
|
if (selection) { // throw parse error otherwise?
|
|
this.dispatch({ type: 'SELECT_DATES', selection: selection });
|
|
triggerDateSelect(selection, null, state);
|
|
}
|
|
};
|
|
// public method
|
|
CalendarApi.prototype.unselect = function (pev) {
|
|
var state = this.getCurrentData();
|
|
if (state.dateSelection) {
|
|
this.dispatch({ type: 'UNSELECT_DATES' });
|
|
triggerDateUnselect(pev, state);
|
|
}
|
|
};
|
|
// Public Events API
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.addEvent = function (eventInput, sourceInput) {
|
|
if (eventInput instanceof EventApi) {
|
|
var def = eventInput._def;
|
|
var instance = eventInput._instance;
|
|
var currentData = this.getCurrentData();
|
|
// not already present? don't want to add an old snapshot
|
|
if (!currentData.eventStore.defs[def.defId]) {
|
|
this.dispatch({
|
|
type: 'ADD_EVENTS',
|
|
eventStore: eventTupleToStore({ def: def, instance: instance }), // TODO: better util for two args?
|
|
});
|
|
this.triggerEventAdd(eventInput);
|
|
}
|
|
return eventInput;
|
|
}
|
|
var state = this.getCurrentData();
|
|
var eventSource;
|
|
if (sourceInput instanceof EventSourceApi) {
|
|
eventSource = sourceInput.internalEventSource;
|
|
}
|
|
else if (typeof sourceInput === 'boolean') {
|
|
if (sourceInput) { // true. part of the first event source
|
|
eventSource = hashValuesToArray(state.eventSources)[0];
|
|
}
|
|
}
|
|
else if (sourceInput != null) { // an ID. accepts a number too
|
|
var sourceApi = this.getEventSourceById(sourceInput); // TODO: use an internal function
|
|
if (!sourceApi) {
|
|
console.warn("Could not find an event source with ID \"" + sourceInput + "\""); // TODO: test
|
|
return null;
|
|
}
|
|
eventSource = sourceApi.internalEventSource;
|
|
}
|
|
var tuple = parseEvent(eventInput, eventSource, state, false);
|
|
if (tuple) {
|
|
var newEventApi = new EventApi(state, tuple.def, tuple.def.recurringDef ? null : tuple.instance);
|
|
this.dispatch({
|
|
type: 'ADD_EVENTS',
|
|
eventStore: eventTupleToStore(tuple),
|
|
});
|
|
this.triggerEventAdd(newEventApi);
|
|
return newEventApi;
|
|
}
|
|
return null;
|
|
};
|
|
CalendarApi.prototype.triggerEventAdd = function (eventApi) {
|
|
var _this = this;
|
|
var emitter = this.getCurrentData().emitter;
|
|
emitter.trigger('eventAdd', {
|
|
event: eventApi,
|
|
relatedEvents: [],
|
|
revert: function () {
|
|
_this.dispatch({
|
|
type: 'REMOVE_EVENTS',
|
|
eventStore: eventApiToStore(eventApi),
|
|
});
|
|
},
|
|
});
|
|
};
|
|
// TODO: optimize
|
|
CalendarApi.prototype.getEventById = function (id) {
|
|
var state = this.getCurrentData();
|
|
var _a = state.eventStore, defs = _a.defs, instances = _a.instances;
|
|
id = String(id);
|
|
for (var defId in defs) {
|
|
var def = defs[defId];
|
|
if (def.publicId === id) {
|
|
if (def.recurringDef) {
|
|
return new EventApi(state, def, null);
|
|
}
|
|
for (var instanceId in instances) {
|
|
var instance = instances[instanceId];
|
|
if (instance.defId === def.defId) {
|
|
return new EventApi(state, def, instance);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
CalendarApi.prototype.getEvents = function () {
|
|
var currentData = this.getCurrentData();
|
|
return buildEventApis(currentData.eventStore, currentData);
|
|
};
|
|
CalendarApi.prototype.removeAllEvents = function () {
|
|
this.dispatch({ type: 'REMOVE_ALL_EVENTS' });
|
|
};
|
|
// Public Event Sources API
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.getEventSources = function () {
|
|
var state = this.getCurrentData();
|
|
var sourceHash = state.eventSources;
|
|
var sourceApis = [];
|
|
for (var internalId in sourceHash) {
|
|
sourceApis.push(new EventSourceApi(state, sourceHash[internalId]));
|
|
}
|
|
return sourceApis;
|
|
};
|
|
CalendarApi.prototype.getEventSourceById = function (id) {
|
|
var state = this.getCurrentData();
|
|
var sourceHash = state.eventSources;
|
|
id = String(id);
|
|
for (var sourceId in sourceHash) {
|
|
if (sourceHash[sourceId].publicId === id) {
|
|
return new EventSourceApi(state, sourceHash[sourceId]);
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
CalendarApi.prototype.addEventSource = function (sourceInput) {
|
|
var state = this.getCurrentData();
|
|
if (sourceInput instanceof EventSourceApi) {
|
|
// not already present? don't want to add an old snapshot
|
|
if (!state.eventSources[sourceInput.internalEventSource.sourceId]) {
|
|
this.dispatch({
|
|
type: 'ADD_EVENT_SOURCES',
|
|
sources: [sourceInput.internalEventSource],
|
|
});
|
|
}
|
|
return sourceInput;
|
|
}
|
|
var eventSource = parseEventSource(sourceInput, state);
|
|
if (eventSource) { // TODO: error otherwise?
|
|
this.dispatch({ type: 'ADD_EVENT_SOURCES', sources: [eventSource] });
|
|
return new EventSourceApi(state, eventSource);
|
|
}
|
|
return null;
|
|
};
|
|
CalendarApi.prototype.removeAllEventSources = function () {
|
|
this.dispatch({ type: 'REMOVE_ALL_EVENT_SOURCES' });
|
|
};
|
|
CalendarApi.prototype.refetchEvents = function () {
|
|
this.dispatch({ type: 'FETCH_EVENT_SOURCES', isRefetch: true });
|
|
};
|
|
// Scroll
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
CalendarApi.prototype.scrollToTime = function (timeInput) {
|
|
var time = createDuration(timeInput);
|
|
if (time) {
|
|
this.trigger('_scrollRequest', { time: time });
|
|
}
|
|
};
|
|
return CalendarApi;
|
|
}());
|
|
|
|
var EventApi = /** @class */ (function () {
|
|
// instance will be null if expressing a recurring event that has no current instances,
|
|
// OR if trying to validate an incoming external event that has no dates assigned
|
|
function EventApi(context, def, instance) {
|
|
this._context = context;
|
|
this._def = def;
|
|
this._instance = instance || null;
|
|
}
|
|
/*
|
|
TODO: make event struct more responsible for this
|
|
*/
|
|
EventApi.prototype.setProp = function (name, val) {
|
|
var _a, _b;
|
|
if (name in EVENT_DATE_REFINERS) {
|
|
console.warn('Could not set date-related prop \'name\'. Use one of the date-related methods instead.');
|
|
// TODO: make proper aliasing system?
|
|
}
|
|
else if (name === 'id') {
|
|
val = EVENT_NON_DATE_REFINERS[name](val);
|
|
this.mutate({
|
|
standardProps: { publicId: val }, // hardcoded internal name
|
|
});
|
|
}
|
|
else if (name in EVENT_NON_DATE_REFINERS) {
|
|
val = EVENT_NON_DATE_REFINERS[name](val);
|
|
this.mutate({
|
|
standardProps: (_a = {}, _a[name] = val, _a),
|
|
});
|
|
}
|
|
else if (name in EVENT_UI_REFINERS) {
|
|
var ui = EVENT_UI_REFINERS[name](val);
|
|
if (name === 'color') {
|
|
ui = { backgroundColor: val, borderColor: val };
|
|
}
|
|
else if (name === 'editable') {
|
|
ui = { startEditable: val, durationEditable: val };
|
|
}
|
|
else {
|
|
ui = (_b = {}, _b[name] = val, _b);
|
|
}
|
|
this.mutate({
|
|
standardProps: { ui: ui },
|
|
});
|
|
}
|
|
else {
|
|
console.warn("Could not set prop '" + name + "'. Use setExtendedProp instead.");
|
|
}
|
|
};
|
|
EventApi.prototype.setExtendedProp = function (name, val) {
|
|
var _a;
|
|
this.mutate({
|
|
extendedProps: (_a = {}, _a[name] = val, _a),
|
|
});
|
|
};
|
|
EventApi.prototype.setStart = function (startInput, options) {
|
|
if (options === void 0) { options = {}; }
|
|
var dateEnv = this._context.dateEnv;
|
|
var start = dateEnv.createMarker(startInput);
|
|
if (start && this._instance) { // TODO: warning if parsed bad
|
|
var instanceRange = this._instance.range;
|
|
var startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity); // what if parsed bad!?
|
|
if (options.maintainDuration) {
|
|
this.mutate({ datesDelta: startDelta });
|
|
}
|
|
else {
|
|
this.mutate({ startDelta: startDelta });
|
|
}
|
|
}
|
|
};
|
|
EventApi.prototype.setEnd = function (endInput, options) {
|
|
if (options === void 0) { options = {}; }
|
|
var dateEnv = this._context.dateEnv;
|
|
var end;
|
|
if (endInput != null) {
|
|
end = dateEnv.createMarker(endInput);
|
|
if (!end) {
|
|
return; // TODO: warning if parsed bad
|
|
}
|
|
}
|
|
if (this._instance) {
|
|
if (end) {
|
|
var endDelta = diffDates(this._instance.range.end, end, dateEnv, options.granularity);
|
|
this.mutate({ endDelta: endDelta });
|
|
}
|
|
else {
|
|
this.mutate({ standardProps: { hasEnd: false } });
|
|
}
|
|
}
|
|
};
|
|
EventApi.prototype.setDates = function (startInput, endInput, options) {
|
|
if (options === void 0) { options = {}; }
|
|
var dateEnv = this._context.dateEnv;
|
|
var standardProps = { allDay: options.allDay };
|
|
var start = dateEnv.createMarker(startInput);
|
|
var end;
|
|
if (!start) {
|
|
return; // TODO: warning if parsed bad
|
|
}
|
|
if (endInput != null) {
|
|
end = dateEnv.createMarker(endInput);
|
|
if (!end) { // TODO: warning if parsed bad
|
|
return;
|
|
}
|
|
}
|
|
if (this._instance) {
|
|
var instanceRange = this._instance.range;
|
|
// when computing the diff for an event being converted to all-day,
|
|
// compute diff off of the all-day values the way event-mutation does.
|
|
if (options.allDay === true) {
|
|
instanceRange = computeAlignedDayRange(instanceRange);
|
|
}
|
|
var startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity);
|
|
if (end) {
|
|
var endDelta = diffDates(instanceRange.end, end, dateEnv, options.granularity);
|
|
if (durationsEqual(startDelta, endDelta)) {
|
|
this.mutate({ datesDelta: startDelta, standardProps: standardProps });
|
|
}
|
|
else {
|
|
this.mutate({ startDelta: startDelta, endDelta: endDelta, standardProps: standardProps });
|
|
}
|
|
}
|
|
else { // means "clear the end"
|
|
standardProps.hasEnd = false;
|
|
this.mutate({ datesDelta: startDelta, standardProps: standardProps });
|
|
}
|
|
}
|
|
};
|
|
EventApi.prototype.moveStart = function (deltaInput) {
|
|
var delta = createDuration(deltaInput);
|
|
if (delta) { // TODO: warning if parsed bad
|
|
this.mutate({ startDelta: delta });
|
|
}
|
|
};
|
|
EventApi.prototype.moveEnd = function (deltaInput) {
|
|
var delta = createDuration(deltaInput);
|
|
if (delta) { // TODO: warning if parsed bad
|
|
this.mutate({ endDelta: delta });
|
|
}
|
|
};
|
|
EventApi.prototype.moveDates = function (deltaInput) {
|
|
var delta = createDuration(deltaInput);
|
|
if (delta) { // TODO: warning if parsed bad
|
|
this.mutate({ datesDelta: delta });
|
|
}
|
|
};
|
|
EventApi.prototype.setAllDay = function (allDay, options) {
|
|
if (options === void 0) { options = {}; }
|
|
var standardProps = { allDay: allDay };
|
|
var maintainDuration = options.maintainDuration;
|
|
if (maintainDuration == null) {
|
|
maintainDuration = this._context.options.allDayMaintainDuration;
|
|
}
|
|
if (this._def.allDay !== allDay) {
|
|
standardProps.hasEnd = maintainDuration;
|
|
}
|
|
this.mutate({ standardProps: standardProps });
|
|
};
|
|
EventApi.prototype.formatRange = function (formatInput) {
|
|
var dateEnv = this._context.dateEnv;
|
|
var instance = this._instance;
|
|
var formatter = createFormatter(formatInput);
|
|
if (this._def.hasEnd) {
|
|
return dateEnv.formatRange(instance.range.start, instance.range.end, formatter, {
|
|
forcedStartTzo: instance.forcedStartTzo,
|
|
forcedEndTzo: instance.forcedEndTzo,
|
|
});
|
|
}
|
|
return dateEnv.format(instance.range.start, formatter, {
|
|
forcedTzo: instance.forcedStartTzo,
|
|
});
|
|
};
|
|
EventApi.prototype.mutate = function (mutation) {
|
|
var instance = this._instance;
|
|
if (instance) {
|
|
var def = this._def;
|
|
var context_1 = this._context;
|
|
var eventStore_1 = context_1.getCurrentData().eventStore;
|
|
var relevantEvents = getRelevantEvents(eventStore_1, instance.instanceId);
|
|
var eventConfigBase = {
|
|
'': {
|
|
display: '',
|
|
startEditable: true,
|
|
durationEditable: true,
|
|
constraints: [],
|
|
overlap: null,
|
|
allows: [],
|
|
backgroundColor: '',
|
|
borderColor: '',
|
|
textColor: '',
|
|
classNames: [],
|
|
},
|
|
};
|
|
relevantEvents = applyMutationToEventStore(relevantEvents, eventConfigBase, mutation, context_1);
|
|
var oldEvent = new EventApi(context_1, def, instance); // snapshot
|
|
this._def = relevantEvents.defs[def.defId];
|
|
this._instance = relevantEvents.instances[instance.instanceId];
|
|
context_1.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: relevantEvents,
|
|
});
|
|
context_1.emitter.trigger('eventChange', {
|
|
oldEvent: oldEvent,
|
|
event: this,
|
|
relatedEvents: buildEventApis(relevantEvents, context_1, instance),
|
|
revert: function () {
|
|
context_1.dispatch({
|
|
type: 'RESET_EVENTS',
|
|
eventStore: eventStore_1,
|
|
});
|
|
},
|
|
});
|
|
}
|
|
};
|
|
EventApi.prototype.remove = function () {
|
|
var context = this._context;
|
|
var asStore = eventApiToStore(this);
|
|
context.dispatch({
|
|
type: 'REMOVE_EVENTS',
|
|
eventStore: asStore,
|
|
});
|
|
context.emitter.trigger('eventRemove', {
|
|
event: this,
|
|
relatedEvents: [],
|
|
revert: function () {
|
|
context.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: asStore,
|
|
});
|
|
},
|
|
});
|
|
};
|
|
Object.defineProperty(EventApi.prototype, "source", {
|
|
get: function () {
|
|
var sourceId = this._def.sourceId;
|
|
if (sourceId) {
|
|
return new EventSourceApi(this._context, this._context.getCurrentData().eventSources[sourceId]);
|
|
}
|
|
return null;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "start", {
|
|
get: function () {
|
|
return this._instance ?
|
|
this._context.dateEnv.toDate(this._instance.range.start) :
|
|
null;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "end", {
|
|
get: function () {
|
|
return (this._instance && this._def.hasEnd) ?
|
|
this._context.dateEnv.toDate(this._instance.range.end) :
|
|
null;
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "startStr", {
|
|
get: function () {
|
|
var instance = this._instance;
|
|
if (instance) {
|
|
return this._context.dateEnv.formatIso(instance.range.start, {
|
|
omitTime: this._def.allDay,
|
|
forcedTzo: instance.forcedStartTzo,
|
|
});
|
|
}
|
|
return '';
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "endStr", {
|
|
get: function () {
|
|
var instance = this._instance;
|
|
if (instance && this._def.hasEnd) {
|
|
return this._context.dateEnv.formatIso(instance.range.end, {
|
|
omitTime: this._def.allDay,
|
|
forcedTzo: instance.forcedEndTzo,
|
|
});
|
|
}
|
|
return '';
|
|
},
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "id", {
|
|
// computable props that all access the def
|
|
// TODO: find a TypeScript-compatible way to do this at scale
|
|
get: function () { return this._def.publicId; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "groupId", {
|
|
get: function () { return this._def.groupId; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "allDay", {
|
|
get: function () { return this._def.allDay; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "title", {
|
|
get: function () { return this._def.title; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "url", {
|
|
get: function () { return this._def.url; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "display", {
|
|
get: function () { return this._def.ui.display || 'auto'; } // bad. just normalize the type earlier
|
|
,
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "startEditable", {
|
|
get: function () { return this._def.ui.startEditable; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "durationEditable", {
|
|
get: function () { return this._def.ui.durationEditable; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "constraint", {
|
|
get: function () { return this._def.ui.constraints[0] || null; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "overlap", {
|
|
get: function () { return this._def.ui.overlap; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "allow", {
|
|
get: function () { return this._def.ui.allows[0] || null; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "backgroundColor", {
|
|
get: function () { return this._def.ui.backgroundColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "borderColor", {
|
|
get: function () { return this._def.ui.borderColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "textColor", {
|
|
get: function () { return this._def.ui.textColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "classNames", {
|
|
// NOTE: user can't modify these because Object.freeze was called in event-def parsing
|
|
get: function () { return this._def.ui.classNames; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(EventApi.prototype, "extendedProps", {
|
|
get: function () { return this._def.extendedProps; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
EventApi.prototype.toPlainObject = function (settings) {
|
|
if (settings === void 0) { settings = {}; }
|
|
var def = this._def;
|
|
var ui = def.ui;
|
|
var _a = this, startStr = _a.startStr, endStr = _a.endStr;
|
|
var res = {};
|
|
if (def.title) {
|
|
res.title = def.title;
|
|
}
|
|
if (startStr) {
|
|
res.start = startStr;
|
|
}
|
|
if (endStr) {
|
|
res.end = endStr;
|
|
}
|
|
if (def.publicId) {
|
|
res.id = def.publicId;
|
|
}
|
|
if (def.groupId) {
|
|
res.groupId = def.groupId;
|
|
}
|
|
if (def.url) {
|
|
res.url = def.url;
|
|
}
|
|
if (ui.display && ui.display !== 'auto') {
|
|
res.display = ui.display;
|
|
}
|
|
// TODO: what about recurring-event properties???
|
|
// TODO: include startEditable/durationEditable/constraint/overlap/allow
|
|
if (settings.collapseColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
|
|
res.color = ui.backgroundColor;
|
|
}
|
|
else {
|
|
if (ui.backgroundColor) {
|
|
res.backgroundColor = ui.backgroundColor;
|
|
}
|
|
if (ui.borderColor) {
|
|
res.borderColor = ui.borderColor;
|
|
}
|
|
}
|
|
if (ui.textColor) {
|
|
res.textColor = ui.textColor;
|
|
}
|
|
if (ui.classNames.length) {
|
|
res.classNames = ui.classNames;
|
|
}
|
|
if (Object.keys(def.extendedProps).length) {
|
|
if (settings.collapseExtendedProps) {
|
|
__assign(res, def.extendedProps);
|
|
}
|
|
else {
|
|
res.extendedProps = def.extendedProps;
|
|
}
|
|
}
|
|
return res;
|
|
};
|
|
EventApi.prototype.toJSON = function () {
|
|
return this.toPlainObject();
|
|
};
|
|
return EventApi;
|
|
}());
|
|
function eventApiToStore(eventApi) {
|
|
var _a, _b;
|
|
var def = eventApi._def;
|
|
var instance = eventApi._instance;
|
|
return {
|
|
defs: (_a = {}, _a[def.defId] = def, _a),
|
|
instances: instance
|
|
? (_b = {}, _b[instance.instanceId] = instance, _b) : {},
|
|
};
|
|
}
|
|
function buildEventApis(eventStore, context, excludeInstance) {
|
|
var defs = eventStore.defs, instances = eventStore.instances;
|
|
var eventApis = [];
|
|
var excludeInstanceId = excludeInstance ? excludeInstance.instanceId : '';
|
|
for (var id in instances) {
|
|
var instance = instances[id];
|
|
var def = defs[instance.defId];
|
|
if (instance.instanceId !== excludeInstanceId) {
|
|
eventApis.push(new EventApi(context, def, instance));
|
|
}
|
|
}
|
|
return eventApis;
|
|
}
|
|
|
|
var calendarSystemClassMap = {};
|
|
function registerCalendarSystem(name, theClass) {
|
|
calendarSystemClassMap[name] = theClass;
|
|
}
|
|
function createCalendarSystem(name) {
|
|
return new calendarSystemClassMap[name]();
|
|
}
|
|
var GregorianCalendarSystem = /** @class */ (function () {
|
|
function GregorianCalendarSystem() {
|
|
}
|
|
GregorianCalendarSystem.prototype.getMarkerYear = function (d) {
|
|
return d.getUTCFullYear();
|
|
};
|
|
GregorianCalendarSystem.prototype.getMarkerMonth = function (d) {
|
|
return d.getUTCMonth();
|
|
};
|
|
GregorianCalendarSystem.prototype.getMarkerDay = function (d) {
|
|
return d.getUTCDate();
|
|
};
|
|
GregorianCalendarSystem.prototype.arrayToMarker = function (arr) {
|
|
return arrayToUtcDate(arr);
|
|
};
|
|
GregorianCalendarSystem.prototype.markerToArray = function (marker) {
|
|
return dateToUtcArray(marker);
|
|
};
|
|
return GregorianCalendarSystem;
|
|
}());
|
|
registerCalendarSystem('gregory', GregorianCalendarSystem);
|
|
|
|
var ISO_RE = /^\s*(\d{4})(-?(\d{2})(-?(\d{2})([T ](\d{2}):?(\d{2})(:?(\d{2})(\.(\d+))?)?(Z|(([-+])(\d{2})(:?(\d{2}))?))?)?)?)?$/;
|
|
function parse(str) {
|
|
var m = ISO_RE.exec(str);
|
|
if (m) {
|
|
var marker = new Date(Date.UTC(Number(m[1]), m[3] ? Number(m[3]) - 1 : 0, Number(m[5] || 1), Number(m[7] || 0), Number(m[8] || 0), Number(m[10] || 0), m[12] ? Number("0." + m[12]) * 1000 : 0));
|
|
if (isValidDate$1(marker)) {
|
|
var timeZoneOffset = null;
|
|
if (m[13]) {
|
|
timeZoneOffset = (m[15] === '-' ? -1 : 1) * (Number(m[16] || 0) * 60 +
|
|
Number(m[18] || 0));
|
|
}
|
|
return {
|
|
marker: marker,
|
|
isTimeUnspecified: !m[6],
|
|
timeZoneOffset: timeZoneOffset,
|
|
};
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
|
|
var DateEnv = /** @class */ (function () {
|
|
function DateEnv(settings) {
|
|
var timeZone = this.timeZone = settings.timeZone;
|
|
var isNamedTimeZone = timeZone !== 'local' && timeZone !== 'UTC';
|
|
if (settings.namedTimeZoneImpl && isNamedTimeZone) {
|
|
this.namedTimeZoneImpl = new settings.namedTimeZoneImpl(timeZone);
|
|
}
|
|
this.canComputeOffset = Boolean(!isNamedTimeZone || this.namedTimeZoneImpl);
|
|
this.calendarSystem = createCalendarSystem(settings.calendarSystem);
|
|
this.locale = settings.locale;
|
|
this.weekDow = settings.locale.week.dow;
|
|
this.weekDoy = settings.locale.week.doy;
|
|
if (settings.weekNumberCalculation === 'ISO') {
|
|
this.weekDow = 1;
|
|
this.weekDoy = 4;
|
|
}
|
|
if (typeof settings.firstDay === 'number') {
|
|
this.weekDow = settings.firstDay;
|
|
}
|
|
if (typeof settings.weekNumberCalculation === 'function') {
|
|
this.weekNumberFunc = settings.weekNumberCalculation;
|
|
}
|
|
this.weekText = settings.weekText != null ? settings.weekText : settings.locale.options.weekText;
|
|
this.weekTextLong = (settings.weekTextLong != null ? settings.weekTextLong : settings.locale.options.weekTextLong) || this.weekText;
|
|
this.cmdFormatter = settings.cmdFormatter;
|
|
this.defaultSeparator = settings.defaultSeparator;
|
|
}
|
|
// Creating / Parsing
|
|
DateEnv.prototype.createMarker = function (input) {
|
|
var meta = this.createMarkerMeta(input);
|
|
if (meta === null) {
|
|
return null;
|
|
}
|
|
return meta.marker;
|
|
};
|
|
DateEnv.prototype.createNowMarker = function () {
|
|
if (this.canComputeOffset) {
|
|
return this.timestampToMarker(new Date().valueOf());
|
|
}
|
|
// if we can't compute the current date val for a timezone,
|
|
// better to give the current local date vals than UTC
|
|
return arrayToUtcDate(dateToLocalArray(new Date()));
|
|
};
|
|
DateEnv.prototype.createMarkerMeta = function (input) {
|
|
if (typeof input === 'string') {
|
|
return this.parse(input);
|
|
}
|
|
var marker = null;
|
|
if (typeof input === 'number') {
|
|
marker = this.timestampToMarker(input);
|
|
}
|
|
else if (input instanceof Date) {
|
|
input = input.valueOf();
|
|
if (!isNaN(input)) {
|
|
marker = this.timestampToMarker(input);
|
|
}
|
|
}
|
|
else if (Array.isArray(input)) {
|
|
marker = arrayToUtcDate(input);
|
|
}
|
|
if (marker === null || !isValidDate$1(marker)) {
|
|
return null;
|
|
}
|
|
return { marker: marker, isTimeUnspecified: false, forcedTzo: null };
|
|
};
|
|
DateEnv.prototype.parse = function (s) {
|
|
var parts = parse(s);
|
|
if (parts === null) {
|
|
return null;
|
|
}
|
|
var marker = parts.marker;
|
|
var forcedTzo = null;
|
|
if (parts.timeZoneOffset !== null) {
|
|
if (this.canComputeOffset) {
|
|
marker = this.timestampToMarker(marker.valueOf() - parts.timeZoneOffset * 60 * 1000);
|
|
}
|
|
else {
|
|
forcedTzo = parts.timeZoneOffset;
|
|
}
|
|
}
|
|
return { marker: marker, isTimeUnspecified: parts.isTimeUnspecified, forcedTzo: forcedTzo };
|
|
};
|
|
// Accessors
|
|
DateEnv.prototype.getYear = function (marker) {
|
|
return this.calendarSystem.getMarkerYear(marker);
|
|
};
|
|
DateEnv.prototype.getMonth = function (marker) {
|
|
return this.calendarSystem.getMarkerMonth(marker);
|
|
};
|
|
// Adding / Subtracting
|
|
DateEnv.prototype.add = function (marker, dur) {
|
|
var a = this.calendarSystem.markerToArray(marker);
|
|
a[0] += dur.years;
|
|
a[1] += dur.months;
|
|
a[2] += dur.days;
|
|
a[6] += dur.milliseconds;
|
|
return this.calendarSystem.arrayToMarker(a);
|
|
};
|
|
DateEnv.prototype.subtract = function (marker, dur) {
|
|
var a = this.calendarSystem.markerToArray(marker);
|
|
a[0] -= dur.years;
|
|
a[1] -= dur.months;
|
|
a[2] -= dur.days;
|
|
a[6] -= dur.milliseconds;
|
|
return this.calendarSystem.arrayToMarker(a);
|
|
};
|
|
DateEnv.prototype.addYears = function (marker, n) {
|
|
var a = this.calendarSystem.markerToArray(marker);
|
|
a[0] += n;
|
|
return this.calendarSystem.arrayToMarker(a);
|
|
};
|
|
DateEnv.prototype.addMonths = function (marker, n) {
|
|
var a = this.calendarSystem.markerToArray(marker);
|
|
a[1] += n;
|
|
return this.calendarSystem.arrayToMarker(a);
|
|
};
|
|
// Diffing Whole Units
|
|
DateEnv.prototype.diffWholeYears = function (m0, m1) {
|
|
var calendarSystem = this.calendarSystem;
|
|
if (timeAsMs(m0) === timeAsMs(m1) &&
|
|
calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1) &&
|
|
calendarSystem.getMarkerMonth(m0) === calendarSystem.getMarkerMonth(m1)) {
|
|
return calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0);
|
|
}
|
|
return null;
|
|
};
|
|
DateEnv.prototype.diffWholeMonths = function (m0, m1) {
|
|
var calendarSystem = this.calendarSystem;
|
|
if (timeAsMs(m0) === timeAsMs(m1) &&
|
|
calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1)) {
|
|
return (calendarSystem.getMarkerMonth(m1) - calendarSystem.getMarkerMonth(m0)) +
|
|
(calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0)) * 12;
|
|
}
|
|
return null;
|
|
};
|
|
// Range / Duration
|
|
DateEnv.prototype.greatestWholeUnit = function (m0, m1) {
|
|
var n = this.diffWholeYears(m0, m1);
|
|
if (n !== null) {
|
|
return { unit: 'year', value: n };
|
|
}
|
|
n = this.diffWholeMonths(m0, m1);
|
|
if (n !== null) {
|
|
return { unit: 'month', value: n };
|
|
}
|
|
n = diffWholeWeeks(m0, m1);
|
|
if (n !== null) {
|
|
return { unit: 'week', value: n };
|
|
}
|
|
n = diffWholeDays(m0, m1);
|
|
if (n !== null) {
|
|
return { unit: 'day', value: n };
|
|
}
|
|
n = diffHours(m0, m1);
|
|
if (isInt(n)) {
|
|
return { unit: 'hour', value: n };
|
|
}
|
|
n = diffMinutes(m0, m1);
|
|
if (isInt(n)) {
|
|
return { unit: 'minute', value: n };
|
|
}
|
|
n = diffSeconds(m0, m1);
|
|
if (isInt(n)) {
|
|
return { unit: 'second', value: n };
|
|
}
|
|
return { unit: 'millisecond', value: m1.valueOf() - m0.valueOf() };
|
|
};
|
|
DateEnv.prototype.countDurationsBetween = function (m0, m1, d) {
|
|
// TODO: can use greatestWholeUnit
|
|
var diff;
|
|
if (d.years) {
|
|
diff = this.diffWholeYears(m0, m1);
|
|
if (diff !== null) {
|
|
return diff / asRoughYears(d);
|
|
}
|
|
}
|
|
if (d.months) {
|
|
diff = this.diffWholeMonths(m0, m1);
|
|
if (diff !== null) {
|
|
return diff / asRoughMonths(d);
|
|
}
|
|
}
|
|
if (d.days) {
|
|
diff = diffWholeDays(m0, m1);
|
|
if (diff !== null) {
|
|
return diff / asRoughDays(d);
|
|
}
|
|
}
|
|
return (m1.valueOf() - m0.valueOf()) / asRoughMs(d);
|
|
};
|
|
// Start-Of
|
|
// these DON'T return zoned-dates. only UTC start-of dates
|
|
DateEnv.prototype.startOf = function (m, unit) {
|
|
if (unit === 'year') {
|
|
return this.startOfYear(m);
|
|
}
|
|
if (unit === 'month') {
|
|
return this.startOfMonth(m);
|
|
}
|
|
if (unit === 'week') {
|
|
return this.startOfWeek(m);
|
|
}
|
|
if (unit === 'day') {
|
|
return startOfDay(m);
|
|
}
|
|
if (unit === 'hour') {
|
|
return startOfHour(m);
|
|
}
|
|
if (unit === 'minute') {
|
|
return startOfMinute(m);
|
|
}
|
|
if (unit === 'second') {
|
|
return startOfSecond(m);
|
|
}
|
|
return null;
|
|
};
|
|
DateEnv.prototype.startOfYear = function (m) {
|
|
return this.calendarSystem.arrayToMarker([
|
|
this.calendarSystem.getMarkerYear(m),
|
|
]);
|
|
};
|
|
DateEnv.prototype.startOfMonth = function (m) {
|
|
return this.calendarSystem.arrayToMarker([
|
|
this.calendarSystem.getMarkerYear(m),
|
|
this.calendarSystem.getMarkerMonth(m),
|
|
]);
|
|
};
|
|
DateEnv.prototype.startOfWeek = function (m) {
|
|
return this.calendarSystem.arrayToMarker([
|
|
this.calendarSystem.getMarkerYear(m),
|
|
this.calendarSystem.getMarkerMonth(m),
|
|
m.getUTCDate() - ((m.getUTCDay() - this.weekDow + 7) % 7),
|
|
]);
|
|
};
|
|
// Week Number
|
|
DateEnv.prototype.computeWeekNumber = function (marker) {
|
|
if (this.weekNumberFunc) {
|
|
return this.weekNumberFunc(this.toDate(marker));
|
|
}
|
|
return weekOfYear(marker, this.weekDow, this.weekDoy);
|
|
};
|
|
// TODO: choke on timeZoneName: long
|
|
DateEnv.prototype.format = function (marker, formatter, dateOptions) {
|
|
if (dateOptions === void 0) { dateOptions = {}; }
|
|
return formatter.format({
|
|
marker: marker,
|
|
timeZoneOffset: dateOptions.forcedTzo != null ?
|
|
dateOptions.forcedTzo :
|
|
this.offsetForMarker(marker),
|
|
}, this);
|
|
};
|
|
DateEnv.prototype.formatRange = function (start, end, formatter, dateOptions) {
|
|
if (dateOptions === void 0) { dateOptions = {}; }
|
|
if (dateOptions.isEndExclusive) {
|
|
end = addMs(end, -1);
|
|
}
|
|
return formatter.formatRange({
|
|
marker: start,
|
|
timeZoneOffset: dateOptions.forcedStartTzo != null ?
|
|
dateOptions.forcedStartTzo :
|
|
this.offsetForMarker(start),
|
|
}, {
|
|
marker: end,
|
|
timeZoneOffset: dateOptions.forcedEndTzo != null ?
|
|
dateOptions.forcedEndTzo :
|
|
this.offsetForMarker(end),
|
|
}, this, dateOptions.defaultSeparator);
|
|
};
|
|
/*
|
|
DUMB: the omitTime arg is dumb. if we omit the time, we want to omit the timezone offset. and if we do that,
|
|
might as well use buildIsoString or some other util directly
|
|
*/
|
|
DateEnv.prototype.formatIso = function (marker, extraOptions) {
|
|
if (extraOptions === void 0) { extraOptions = {}; }
|
|
var timeZoneOffset = null;
|
|
if (!extraOptions.omitTimeZoneOffset) {
|
|
if (extraOptions.forcedTzo != null) {
|
|
timeZoneOffset = extraOptions.forcedTzo;
|
|
}
|
|
else {
|
|
timeZoneOffset = this.offsetForMarker(marker);
|
|
}
|
|
}
|
|
return buildIsoString(marker, timeZoneOffset, extraOptions.omitTime);
|
|
};
|
|
// TimeZone
|
|
DateEnv.prototype.timestampToMarker = function (ms) {
|
|
if (this.timeZone === 'local') {
|
|
return arrayToUtcDate(dateToLocalArray(new Date(ms)));
|
|
}
|
|
if (this.timeZone === 'UTC' || !this.namedTimeZoneImpl) {
|
|
return new Date(ms);
|
|
}
|
|
return arrayToUtcDate(this.namedTimeZoneImpl.timestampToArray(ms));
|
|
};
|
|
DateEnv.prototype.offsetForMarker = function (m) {
|
|
if (this.timeZone === 'local') {
|
|
return -arrayToLocalDate(dateToUtcArray(m)).getTimezoneOffset(); // convert "inverse" offset to "normal" offset
|
|
}
|
|
if (this.timeZone === 'UTC') {
|
|
return 0;
|
|
}
|
|
if (this.namedTimeZoneImpl) {
|
|
return this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m));
|
|
}
|
|
return null;
|
|
};
|
|
// Conversion
|
|
DateEnv.prototype.toDate = function (m, forcedTzo) {
|
|
if (this.timeZone === 'local') {
|
|
return arrayToLocalDate(dateToUtcArray(m));
|
|
}
|
|
if (this.timeZone === 'UTC') {
|
|
return new Date(m.valueOf()); // make sure it's a copy
|
|
}
|
|
if (!this.namedTimeZoneImpl) {
|
|
return new Date(m.valueOf() - (forcedTzo || 0));
|
|
}
|
|
return new Date(m.valueOf() -
|
|
this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m)) * 1000 * 60);
|
|
};
|
|
return DateEnv;
|
|
}());
|
|
|
|
var globalLocales = [];
|
|
|
|
var MINIMAL_RAW_EN_LOCALE = {
|
|
code: 'en',
|
|
week: {
|
|
dow: 0,
|
|
doy: 4, // 4 days need to be within the year to be considered the first week
|
|
},
|
|
direction: 'ltr',
|
|
buttonText: {
|
|
prev: 'prev',
|
|
next: 'next',
|
|
prevYear: 'prev year',
|
|
nextYear: 'next year',
|
|
year: 'year',
|
|
today: 'today',
|
|
month: 'month',
|
|
week: 'week',
|
|
day: 'day',
|
|
list: 'list',
|
|
},
|
|
weekText: 'W',
|
|
weekTextLong: 'Week',
|
|
closeHint: 'Close',
|
|
timeHint: 'Time',
|
|
eventHint: 'Event',
|
|
allDayText: 'all-day',
|
|
moreLinkText: 'more',
|
|
noEventsText: 'No events to display',
|
|
};
|
|
var RAW_EN_LOCALE = __assign(__assign({}, MINIMAL_RAW_EN_LOCALE), {
|
|
// Includes things we don't want other locales to inherit,
|
|
// things that derive from other translatable strings.
|
|
buttonHints: {
|
|
prev: 'Previous $0',
|
|
next: 'Next $0',
|
|
today: function (buttonText, unit) {
|
|
return (unit === 'day')
|
|
? 'Today'
|
|
: "This " + buttonText;
|
|
},
|
|
}, viewHint: '$0 view', navLinkHint: 'Go to $0', moreLinkHint: function (eventCnt) {
|
|
return "Show " + eventCnt + " more event" + (eventCnt === 1 ? '' : 's');
|
|
} });
|
|
function organizeRawLocales(explicitRawLocales) {
|
|
var defaultCode = explicitRawLocales.length > 0 ? explicitRawLocales[0].code : 'en';
|
|
var allRawLocales = globalLocales.concat(explicitRawLocales);
|
|
var rawLocaleMap = {
|
|
en: RAW_EN_LOCALE,
|
|
};
|
|
for (var _i = 0, allRawLocales_1 = allRawLocales; _i < allRawLocales_1.length; _i++) {
|
|
var rawLocale = allRawLocales_1[_i];
|
|
rawLocaleMap[rawLocale.code] = rawLocale;
|
|
}
|
|
return {
|
|
map: rawLocaleMap,
|
|
defaultCode: defaultCode,
|
|
};
|
|
}
|
|
function buildLocale(inputSingular, available) {
|
|
if (typeof inputSingular === 'object' && !Array.isArray(inputSingular)) {
|
|
return parseLocale(inputSingular.code, [inputSingular.code], inputSingular);
|
|
}
|
|
return queryLocale(inputSingular, available);
|
|
}
|
|
function queryLocale(codeArg, available) {
|
|
var codes = [].concat(codeArg || []); // will convert to array
|
|
var raw = queryRawLocale(codes, available) || RAW_EN_LOCALE;
|
|
return parseLocale(codeArg, codes, raw);
|
|
}
|
|
function queryRawLocale(codes, available) {
|
|
for (var i = 0; i < codes.length; i += 1) {
|
|
var parts = codes[i].toLocaleLowerCase().split('-');
|
|
for (var j = parts.length; j > 0; j -= 1) {
|
|
var simpleId = parts.slice(0, j).join('-');
|
|
if (available[simpleId]) {
|
|
return available[simpleId];
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function parseLocale(codeArg, codes, raw) {
|
|
var merged = mergeProps([MINIMAL_RAW_EN_LOCALE, raw], ['buttonText']);
|
|
delete merged.code; // don't want this part of the options
|
|
var week = merged.week;
|
|
delete merged.week;
|
|
return {
|
|
codeArg: codeArg,
|
|
codes: codes,
|
|
week: week,
|
|
simpleNumberFormat: new Intl.NumberFormat(codeArg),
|
|
options: merged,
|
|
};
|
|
}
|
|
|
|
function formatDate(dateInput, options) {
|
|
if (options === void 0) { options = {}; }
|
|
var dateEnv = buildDateEnv$1(options);
|
|
var formatter = createFormatter(options);
|
|
var dateMeta = dateEnv.createMarkerMeta(dateInput);
|
|
if (!dateMeta) { // TODO: warning?
|
|
return '';
|
|
}
|
|
return dateEnv.format(dateMeta.marker, formatter, {
|
|
forcedTzo: dateMeta.forcedTzo,
|
|
});
|
|
}
|
|
function formatRange(startInput, endInput, options) {
|
|
var dateEnv = buildDateEnv$1(typeof options === 'object' && options ? options : {}); // pass in if non-null object
|
|
var formatter = createFormatter(options);
|
|
var startMeta = dateEnv.createMarkerMeta(startInput);
|
|
var endMeta = dateEnv.createMarkerMeta(endInput);
|
|
if (!startMeta || !endMeta) { // TODO: warning?
|
|
return '';
|
|
}
|
|
return dateEnv.formatRange(startMeta.marker, endMeta.marker, formatter, {
|
|
forcedStartTzo: startMeta.forcedTzo,
|
|
forcedEndTzo: endMeta.forcedTzo,
|
|
isEndExclusive: options.isEndExclusive,
|
|
defaultSeparator: BASE_OPTION_DEFAULTS.defaultRangeSeparator,
|
|
});
|
|
}
|
|
// TODO: more DRY and optimized
|
|
function buildDateEnv$1(settings) {
|
|
var locale = buildLocale(settings.locale || 'en', organizeRawLocales([]).map); // TODO: don't hardcode 'en' everywhere
|
|
return new DateEnv(__assign(__assign({ timeZone: BASE_OPTION_DEFAULTS.timeZone, calendarSystem: 'gregory' }, settings), { locale: locale }));
|
|
}
|
|
|
|
var DEF_DEFAULTS = {
|
|
startTime: '09:00',
|
|
endTime: '17:00',
|
|
daysOfWeek: [1, 2, 3, 4, 5],
|
|
display: 'inverse-background',
|
|
classNames: 'fc-non-business',
|
|
groupId: '_businessHours', // so multiple defs get grouped
|
|
};
|
|
/*
|
|
TODO: pass around as EventDefHash!!!
|
|
*/
|
|
function parseBusinessHours(input, context) {
|
|
return parseEvents(refineInputs(input), null, context);
|
|
}
|
|
function refineInputs(input) {
|
|
var rawDefs;
|
|
if (input === true) {
|
|
rawDefs = [{}]; // will get DEF_DEFAULTS verbatim
|
|
}
|
|
else if (Array.isArray(input)) {
|
|
// if specifying an array, every sub-definition NEEDS a day-of-week
|
|
rawDefs = input.filter(function (rawDef) { return rawDef.daysOfWeek; });
|
|
}
|
|
else if (typeof input === 'object' && input) { // non-null object
|
|
rawDefs = [input];
|
|
}
|
|
else { // is probably false
|
|
rawDefs = [];
|
|
}
|
|
rawDefs = rawDefs.map(function (rawDef) { return (__assign(__assign({}, DEF_DEFAULTS), rawDef)); });
|
|
return rawDefs;
|
|
}
|
|
|
|
function pointInsideRect(point, rect) {
|
|
return point.left >= rect.left &&
|
|
point.left < rect.right &&
|
|
point.top >= rect.top &&
|
|
point.top < rect.bottom;
|
|
}
|
|
// Returns a new rectangle that is the intersection of the two rectangles. If they don't intersect, returns false
|
|
function intersectRects(rect1, rect2) {
|
|
var res = {
|
|
left: Math.max(rect1.left, rect2.left),
|
|
right: Math.min(rect1.right, rect2.right),
|
|
top: Math.max(rect1.top, rect2.top),
|
|
bottom: Math.min(rect1.bottom, rect2.bottom),
|
|
};
|
|
if (res.left < res.right && res.top < res.bottom) {
|
|
return res;
|
|
}
|
|
return false;
|
|
}
|
|
function translateRect(rect, deltaX, deltaY) {
|
|
return {
|
|
left: rect.left + deltaX,
|
|
right: rect.right + deltaX,
|
|
top: rect.top + deltaY,
|
|
bottom: rect.bottom + deltaY,
|
|
};
|
|
}
|
|
// Returns a new point that will have been moved to reside within the given rectangle
|
|
function constrainPoint(point, rect) {
|
|
return {
|
|
left: Math.min(Math.max(point.left, rect.left), rect.right),
|
|
top: Math.min(Math.max(point.top, rect.top), rect.bottom),
|
|
};
|
|
}
|
|
// Returns a point that is the center of the given rectangle
|
|
function getRectCenter(rect) {
|
|
return {
|
|
left: (rect.left + rect.right) / 2,
|
|
top: (rect.top + rect.bottom) / 2,
|
|
};
|
|
}
|
|
// Subtracts point2's coordinates from point1's coordinates, returning a delta
|
|
function diffPoints(point1, point2) {
|
|
return {
|
|
left: point1.left - point2.left,
|
|
top: point1.top - point2.top,
|
|
};
|
|
}
|
|
|
|
var canVGrowWithinCell;
|
|
function getCanVGrowWithinCell() {
|
|
if (canVGrowWithinCell == null) {
|
|
canVGrowWithinCell = computeCanVGrowWithinCell();
|
|
}
|
|
return canVGrowWithinCell;
|
|
}
|
|
function computeCanVGrowWithinCell() {
|
|
// for SSR, because this function is call immediately at top-level
|
|
// TODO: just make this logic execute top-level, immediately, instead of doing lazily
|
|
if (typeof document === 'undefined') {
|
|
return true;
|
|
}
|
|
var el = document.createElement('div');
|
|
el.style.position = 'absolute';
|
|
el.style.top = '0px';
|
|
el.style.left = '0px';
|
|
el.innerHTML = '<table><tr><td><div></div></td></tr></table>';
|
|
el.querySelector('table').style.height = '100px';
|
|
el.querySelector('div').style.height = '100%';
|
|
document.body.appendChild(el);
|
|
var div = el.querySelector('div');
|
|
var possible = div.offsetHeight > 0;
|
|
document.body.removeChild(el);
|
|
return possible;
|
|
}
|
|
|
|
var EMPTY_EVENT_STORE = createEmptyEventStore(); // for purecomponents. TODO: keep elsewhere
|
|
var Splitter = /** @class */ (function () {
|
|
function Splitter() {
|
|
this.getKeysForEventDefs = memoize(this._getKeysForEventDefs);
|
|
this.splitDateSelection = memoize(this._splitDateSpan);
|
|
this.splitEventStore = memoize(this._splitEventStore);
|
|
this.splitIndividualUi = memoize(this._splitIndividualUi);
|
|
this.splitEventDrag = memoize(this._splitInteraction);
|
|
this.splitEventResize = memoize(this._splitInteraction);
|
|
this.eventUiBuilders = {}; // TODO: typescript protection
|
|
}
|
|
Splitter.prototype.splitProps = function (props) {
|
|
var _this = this;
|
|
var keyInfos = this.getKeyInfo(props);
|
|
var defKeys = this.getKeysForEventDefs(props.eventStore);
|
|
var dateSelections = this.splitDateSelection(props.dateSelection);
|
|
var individualUi = this.splitIndividualUi(props.eventUiBases, defKeys); // the individual *bases*
|
|
var eventStores = this.splitEventStore(props.eventStore, defKeys);
|
|
var eventDrags = this.splitEventDrag(props.eventDrag);
|
|
var eventResizes = this.splitEventResize(props.eventResize);
|
|
var splitProps = {};
|
|
this.eventUiBuilders = mapHash(keyInfos, function (info, key) { return _this.eventUiBuilders[key] || memoize(buildEventUiForKey); });
|
|
for (var key in keyInfos) {
|
|
var keyInfo = keyInfos[key];
|
|
var eventStore = eventStores[key] || EMPTY_EVENT_STORE;
|
|
var buildEventUi = this.eventUiBuilders[key];
|
|
splitProps[key] = {
|
|
businessHours: keyInfo.businessHours || props.businessHours,
|
|
dateSelection: dateSelections[key] || null,
|
|
eventStore: eventStore,
|
|
eventUiBases: buildEventUi(props.eventUiBases[''], keyInfo.ui, individualUi[key]),
|
|
eventSelection: eventStore.instances[props.eventSelection] ? props.eventSelection : '',
|
|
eventDrag: eventDrags[key] || null,
|
|
eventResize: eventResizes[key] || null,
|
|
};
|
|
}
|
|
return splitProps;
|
|
};
|
|
Splitter.prototype._splitDateSpan = function (dateSpan) {
|
|
var dateSpans = {};
|
|
if (dateSpan) {
|
|
var keys = this.getKeysForDateSpan(dateSpan);
|
|
for (var _i = 0, keys_1 = keys; _i < keys_1.length; _i++) {
|
|
var key = keys_1[_i];
|
|
dateSpans[key] = dateSpan;
|
|
}
|
|
}
|
|
return dateSpans;
|
|
};
|
|
Splitter.prototype._getKeysForEventDefs = function (eventStore) {
|
|
var _this = this;
|
|
return mapHash(eventStore.defs, function (eventDef) { return _this.getKeysForEventDef(eventDef); });
|
|
};
|
|
Splitter.prototype._splitEventStore = function (eventStore, defKeys) {
|
|
var defs = eventStore.defs, instances = eventStore.instances;
|
|
var splitStores = {};
|
|
for (var defId in defs) {
|
|
for (var _i = 0, _a = defKeys[defId]; _i < _a.length; _i++) {
|
|
var key = _a[_i];
|
|
if (!splitStores[key]) {
|
|
splitStores[key] = createEmptyEventStore();
|
|
}
|
|
splitStores[key].defs[defId] = defs[defId];
|
|
}
|
|
}
|
|
for (var instanceId in instances) {
|
|
var instance = instances[instanceId];
|
|
for (var _b = 0, _c = defKeys[instance.defId]; _b < _c.length; _b++) {
|
|
var key = _c[_b];
|
|
if (splitStores[key]) { // must have already been created
|
|
splitStores[key].instances[instanceId] = instance;
|
|
}
|
|
}
|
|
}
|
|
return splitStores;
|
|
};
|
|
Splitter.prototype._splitIndividualUi = function (eventUiBases, defKeys) {
|
|
var splitHashes = {};
|
|
for (var defId in eventUiBases) {
|
|
if (defId) { // not the '' key
|
|
for (var _i = 0, _a = defKeys[defId]; _i < _a.length; _i++) {
|
|
var key = _a[_i];
|
|
if (!splitHashes[key]) {
|
|
splitHashes[key] = {};
|
|
}
|
|
splitHashes[key][defId] = eventUiBases[defId];
|
|
}
|
|
}
|
|
}
|
|
return splitHashes;
|
|
};
|
|
Splitter.prototype._splitInteraction = function (interaction) {
|
|
var splitStates = {};
|
|
if (interaction) {
|
|
var affectedStores_1 = this._splitEventStore(interaction.affectedEvents, this._getKeysForEventDefs(interaction.affectedEvents));
|
|
// can't rely on defKeys because event data is mutated
|
|
var mutatedKeysByDefId = this._getKeysForEventDefs(interaction.mutatedEvents);
|
|
var mutatedStores_1 = this._splitEventStore(interaction.mutatedEvents, mutatedKeysByDefId);
|
|
var populate = function (key) {
|
|
if (!splitStates[key]) {
|
|
splitStates[key] = {
|
|
affectedEvents: affectedStores_1[key] || EMPTY_EVENT_STORE,
|
|
mutatedEvents: mutatedStores_1[key] || EMPTY_EVENT_STORE,
|
|
isEvent: interaction.isEvent,
|
|
};
|
|
}
|
|
};
|
|
for (var key in affectedStores_1) {
|
|
populate(key);
|
|
}
|
|
for (var key in mutatedStores_1) {
|
|
populate(key);
|
|
}
|
|
}
|
|
return splitStates;
|
|
};
|
|
return Splitter;
|
|
}());
|
|
function buildEventUiForKey(allUi, eventUiForKey, individualUi) {
|
|
var baseParts = [];
|
|
if (allUi) {
|
|
baseParts.push(allUi);
|
|
}
|
|
if (eventUiForKey) {
|
|
baseParts.push(eventUiForKey);
|
|
}
|
|
var stuff = {
|
|
'': combineEventUis(baseParts),
|
|
};
|
|
if (individualUi) {
|
|
__assign(stuff, individualUi);
|
|
}
|
|
return stuff;
|
|
}
|
|
|
|
function getDateMeta(date, todayRange, nowDate, dateProfile) {
|
|
return {
|
|
dow: date.getUTCDay(),
|
|
isDisabled: Boolean(dateProfile && !rangeContainsMarker(dateProfile.activeRange, date)),
|
|
isOther: Boolean(dateProfile && !rangeContainsMarker(dateProfile.currentRange, date)),
|
|
isToday: Boolean(todayRange && rangeContainsMarker(todayRange, date)),
|
|
isPast: Boolean(nowDate ? (date < nowDate) : todayRange ? (date < todayRange.start) : false),
|
|
isFuture: Boolean(nowDate ? (date > nowDate) : todayRange ? (date >= todayRange.end) : false),
|
|
};
|
|
}
|
|
function getDayClassNames(meta, theme) {
|
|
var classNames = [
|
|
'fc-day',
|
|
"fc-day-" + DAY_IDS[meta.dow],
|
|
];
|
|
if (meta.isDisabled) {
|
|
classNames.push('fc-day-disabled');
|
|
}
|
|
else {
|
|
if (meta.isToday) {
|
|
classNames.push('fc-day-today');
|
|
classNames.push(theme.getClass('today'));
|
|
}
|
|
if (meta.isPast) {
|
|
classNames.push('fc-day-past');
|
|
}
|
|
if (meta.isFuture) {
|
|
classNames.push('fc-day-future');
|
|
}
|
|
if (meta.isOther) {
|
|
classNames.push('fc-day-other');
|
|
}
|
|
}
|
|
return classNames;
|
|
}
|
|
function getSlotClassNames(meta, theme) {
|
|
var classNames = [
|
|
'fc-slot',
|
|
"fc-slot-" + DAY_IDS[meta.dow],
|
|
];
|
|
if (meta.isDisabled) {
|
|
classNames.push('fc-slot-disabled');
|
|
}
|
|
else {
|
|
if (meta.isToday) {
|
|
classNames.push('fc-slot-today');
|
|
classNames.push(theme.getClass('today'));
|
|
}
|
|
if (meta.isPast) {
|
|
classNames.push('fc-slot-past');
|
|
}
|
|
if (meta.isFuture) {
|
|
classNames.push('fc-slot-future');
|
|
}
|
|
}
|
|
return classNames;
|
|
}
|
|
|
|
var DAY_FORMAT = createFormatter({ year: 'numeric', month: 'long', day: 'numeric' });
|
|
var WEEK_FORMAT = createFormatter({ week: 'long' });
|
|
function buildNavLinkAttrs(context, dateMarker, viewType, isTabbable) {
|
|
if (viewType === void 0) { viewType = 'day'; }
|
|
if (isTabbable === void 0) { isTabbable = true; }
|
|
var dateEnv = context.dateEnv, options = context.options, calendarApi = context.calendarApi;
|
|
var dateStr = dateEnv.format(dateMarker, viewType === 'week' ? WEEK_FORMAT : DAY_FORMAT);
|
|
if (options.navLinks) {
|
|
var zonedDate = dateEnv.toDate(dateMarker);
|
|
var handleInteraction = function (ev) {
|
|
var customAction = viewType === 'day' ? options.navLinkDayClick :
|
|
viewType === 'week' ? options.navLinkWeekClick : null;
|
|
if (typeof customAction === 'function') {
|
|
customAction.call(calendarApi, dateEnv.toDate(dateMarker), ev);
|
|
}
|
|
else {
|
|
if (typeof customAction === 'string') {
|
|
viewType = customAction;
|
|
}
|
|
calendarApi.zoomTo(dateMarker, viewType);
|
|
}
|
|
};
|
|
return __assign({ title: formatWithOrdinals(options.navLinkHint, [dateStr, zonedDate], dateStr), 'data-navlink': '' }, (isTabbable
|
|
? createAriaClickAttrs(handleInteraction)
|
|
: { onClick: handleInteraction }));
|
|
}
|
|
return { 'aria-label': dateStr };
|
|
}
|
|
|
|
var _isRtlScrollbarOnLeft = null;
|
|
function getIsRtlScrollbarOnLeft() {
|
|
if (_isRtlScrollbarOnLeft === null) {
|
|
_isRtlScrollbarOnLeft = computeIsRtlScrollbarOnLeft();
|
|
}
|
|
return _isRtlScrollbarOnLeft;
|
|
}
|
|
function computeIsRtlScrollbarOnLeft() {
|
|
var outerEl = document.createElement('div');
|
|
applyStyle(outerEl, {
|
|
position: 'absolute',
|
|
top: -1000,
|
|
left: 0,
|
|
border: 0,
|
|
padding: 0,
|
|
overflow: 'scroll',
|
|
direction: 'rtl',
|
|
});
|
|
outerEl.innerHTML = '<div></div>';
|
|
document.body.appendChild(outerEl);
|
|
var innerEl = outerEl.firstChild;
|
|
var res = innerEl.getBoundingClientRect().left > outerEl.getBoundingClientRect().left;
|
|
removeElement(outerEl);
|
|
return res;
|
|
}
|
|
|
|
var _scrollbarWidths;
|
|
function getScrollbarWidths() {
|
|
if (!_scrollbarWidths) {
|
|
_scrollbarWidths = computeScrollbarWidths();
|
|
}
|
|
return _scrollbarWidths;
|
|
}
|
|
function computeScrollbarWidths() {
|
|
var el = document.createElement('div');
|
|
el.style.overflow = 'scroll';
|
|
el.style.position = 'absolute';
|
|
el.style.top = '-9999px';
|
|
el.style.left = '-9999px';
|
|
document.body.appendChild(el);
|
|
var res = computeScrollbarWidthsForEl(el);
|
|
document.body.removeChild(el);
|
|
return res;
|
|
}
|
|
// WARNING: will include border
|
|
function computeScrollbarWidthsForEl(el) {
|
|
return {
|
|
x: el.offsetHeight - el.clientHeight,
|
|
y: el.offsetWidth - el.clientWidth,
|
|
};
|
|
}
|
|
|
|
function computeEdges(el, getPadding) {
|
|
if (getPadding === void 0) { getPadding = false; }
|
|
var computedStyle = window.getComputedStyle(el);
|
|
var borderLeft = parseInt(computedStyle.borderLeftWidth, 10) || 0;
|
|
var borderRight = parseInt(computedStyle.borderRightWidth, 10) || 0;
|
|
var borderTop = parseInt(computedStyle.borderTopWidth, 10) || 0;
|
|
var borderBottom = parseInt(computedStyle.borderBottomWidth, 10) || 0;
|
|
var badScrollbarWidths = computeScrollbarWidthsForEl(el); // includes border!
|
|
var scrollbarLeftRight = badScrollbarWidths.y - borderLeft - borderRight;
|
|
var scrollbarBottom = badScrollbarWidths.x - borderTop - borderBottom;
|
|
var res = {
|
|
borderLeft: borderLeft,
|
|
borderRight: borderRight,
|
|
borderTop: borderTop,
|
|
borderBottom: borderBottom,
|
|
scrollbarBottom: scrollbarBottom,
|
|
scrollbarLeft: 0,
|
|
scrollbarRight: 0,
|
|
};
|
|
if (getIsRtlScrollbarOnLeft() && computedStyle.direction === 'rtl') { // is the scrollbar on the left side?
|
|
res.scrollbarLeft = scrollbarLeftRight;
|
|
}
|
|
else {
|
|
res.scrollbarRight = scrollbarLeftRight;
|
|
}
|
|
if (getPadding) {
|
|
res.paddingLeft = parseInt(computedStyle.paddingLeft, 10) || 0;
|
|
res.paddingRight = parseInt(computedStyle.paddingRight, 10) || 0;
|
|
res.paddingTop = parseInt(computedStyle.paddingTop, 10) || 0;
|
|
res.paddingBottom = parseInt(computedStyle.paddingBottom, 10) || 0;
|
|
}
|
|
return res;
|
|
}
|
|
function computeInnerRect(el, goWithinPadding, doFromWindowViewport) {
|
|
if (goWithinPadding === void 0) { goWithinPadding = false; }
|
|
var outerRect = doFromWindowViewport ? el.getBoundingClientRect() : computeRect(el);
|
|
var edges = computeEdges(el, goWithinPadding);
|
|
var res = {
|
|
left: outerRect.left + edges.borderLeft + edges.scrollbarLeft,
|
|
right: outerRect.right - edges.borderRight - edges.scrollbarRight,
|
|
top: outerRect.top + edges.borderTop,
|
|
bottom: outerRect.bottom - edges.borderBottom - edges.scrollbarBottom,
|
|
};
|
|
if (goWithinPadding) {
|
|
res.left += edges.paddingLeft;
|
|
res.right -= edges.paddingRight;
|
|
res.top += edges.paddingTop;
|
|
res.bottom -= edges.paddingBottom;
|
|
}
|
|
return res;
|
|
}
|
|
function computeRect(el) {
|
|
var rect = el.getBoundingClientRect();
|
|
return {
|
|
left: rect.left + window.pageXOffset,
|
|
top: rect.top + window.pageYOffset,
|
|
right: rect.right + window.pageXOffset,
|
|
bottom: rect.bottom + window.pageYOffset,
|
|
};
|
|
}
|
|
function computeClippedClientRect(el) {
|
|
var clippingParents = getClippingParents(el);
|
|
var rect = el.getBoundingClientRect();
|
|
for (var _i = 0, clippingParents_1 = clippingParents; _i < clippingParents_1.length; _i++) {
|
|
var clippingParent = clippingParents_1[_i];
|
|
var intersection = intersectRects(rect, clippingParent.getBoundingClientRect());
|
|
if (intersection) {
|
|
rect = intersection;
|
|
}
|
|
else {
|
|
return null;
|
|
}
|
|
}
|
|
return rect;
|
|
}
|
|
function computeHeightAndMargins(el) {
|
|
return el.getBoundingClientRect().height + computeVMargins(el);
|
|
}
|
|
function computeVMargins(el) {
|
|
var computed = window.getComputedStyle(el);
|
|
return parseInt(computed.marginTop, 10) +
|
|
parseInt(computed.marginBottom, 10);
|
|
}
|
|
// does not return window
|
|
function getClippingParents(el) {
|
|
var parents = [];
|
|
while (el instanceof HTMLElement) { // will stop when gets to document or null
|
|
var computedStyle = window.getComputedStyle(el);
|
|
if (computedStyle.position === 'fixed') {
|
|
break;
|
|
}
|
|
if ((/(auto|scroll)/).test(computedStyle.overflow + computedStyle.overflowY + computedStyle.overflowX)) {
|
|
parents.push(el);
|
|
}
|
|
el = el.parentNode;
|
|
}
|
|
return parents;
|
|
}
|
|
|
|
// given a function that resolves a result asynchronously.
|
|
// the function can either call passed-in success and failure callbacks,
|
|
// or it can return a promise.
|
|
// if you need to pass additional params to func, bind them first.
|
|
function unpromisify(func, success, failure) {
|
|
// guard against success/failure callbacks being called more than once
|
|
// and guard against a promise AND callback being used together.
|
|
var isResolved = false;
|
|
var wrappedSuccess = function () {
|
|
if (!isResolved) {
|
|
isResolved = true;
|
|
success.apply(this, arguments); // eslint-disable-line prefer-rest-params
|
|
}
|
|
};
|
|
var wrappedFailure = function () {
|
|
if (!isResolved) {
|
|
isResolved = true;
|
|
if (failure) {
|
|
failure.apply(this, arguments); // eslint-disable-line prefer-rest-params
|
|
}
|
|
}
|
|
};
|
|
var res = func(wrappedSuccess, wrappedFailure);
|
|
if (res && typeof res.then === 'function') {
|
|
res.then(wrappedSuccess, wrappedFailure);
|
|
}
|
|
}
|
|
|
|
var Emitter = /** @class */ (function () {
|
|
function Emitter() {
|
|
this.handlers = {};
|
|
this.thisContext = null;
|
|
}
|
|
Emitter.prototype.setThisContext = function (thisContext) {
|
|
this.thisContext = thisContext;
|
|
};
|
|
Emitter.prototype.setOptions = function (options) {
|
|
this.options = options;
|
|
};
|
|
Emitter.prototype.on = function (type, handler) {
|
|
addToHash(this.handlers, type, handler);
|
|
};
|
|
Emitter.prototype.off = function (type, handler) {
|
|
removeFromHash(this.handlers, type, handler);
|
|
};
|
|
Emitter.prototype.trigger = function (type) {
|
|
var args = [];
|
|
for (var _i = 1; _i < arguments.length; _i++) {
|
|
args[_i - 1] = arguments[_i];
|
|
}
|
|
var attachedHandlers = this.handlers[type] || [];
|
|
var optionHandler = this.options && this.options[type];
|
|
var handlers = [].concat(optionHandler || [], attachedHandlers);
|
|
for (var _a = 0, handlers_1 = handlers; _a < handlers_1.length; _a++) {
|
|
var handler = handlers_1[_a];
|
|
handler.apply(this.thisContext, args);
|
|
}
|
|
};
|
|
Emitter.prototype.hasHandlers = function (type) {
|
|
return Boolean((this.handlers[type] && this.handlers[type].length) ||
|
|
(this.options && this.options[type]));
|
|
};
|
|
return Emitter;
|
|
}());
|
|
function addToHash(hash, type, handler) {
|
|
(hash[type] || (hash[type] = []))
|
|
.push(handler);
|
|
}
|
|
function removeFromHash(hash, type, handler) {
|
|
if (handler) {
|
|
if (hash[type]) {
|
|
hash[type] = hash[type].filter(function (func) { return func !== handler; });
|
|
}
|
|
}
|
|
else {
|
|
delete hash[type]; // remove all handler funcs for this type
|
|
}
|
|
}
|
|
|
|
/*
|
|
Records offset information for a set of elements, relative to an origin element.
|
|
Can record the left/right OR the top/bottom OR both.
|
|
Provides methods for querying the cache by position.
|
|
*/
|
|
var PositionCache = /** @class */ (function () {
|
|
function PositionCache(originEl, els, isHorizontal, isVertical) {
|
|
this.els = els;
|
|
var originClientRect = this.originClientRect = originEl.getBoundingClientRect(); // relative to viewport top-left
|
|
if (isHorizontal) {
|
|
this.buildElHorizontals(originClientRect.left);
|
|
}
|
|
if (isVertical) {
|
|
this.buildElVerticals(originClientRect.top);
|
|
}
|
|
}
|
|
// Populates the left/right internal coordinate arrays
|
|
PositionCache.prototype.buildElHorizontals = function (originClientLeft) {
|
|
var lefts = [];
|
|
var rights = [];
|
|
for (var _i = 0, _a = this.els; _i < _a.length; _i++) {
|
|
var el = _a[_i];
|
|
var rect = el.getBoundingClientRect();
|
|
lefts.push(rect.left - originClientLeft);
|
|
rights.push(rect.right - originClientLeft);
|
|
}
|
|
this.lefts = lefts;
|
|
this.rights = rights;
|
|
};
|
|
// Populates the top/bottom internal coordinate arrays
|
|
PositionCache.prototype.buildElVerticals = function (originClientTop) {
|
|
var tops = [];
|
|
var bottoms = [];
|
|
for (var _i = 0, _a = this.els; _i < _a.length; _i++) {
|
|
var el = _a[_i];
|
|
var rect = el.getBoundingClientRect();
|
|
tops.push(rect.top - originClientTop);
|
|
bottoms.push(rect.bottom - originClientTop);
|
|
}
|
|
this.tops = tops;
|
|
this.bottoms = bottoms;
|
|
};
|
|
// Given a left offset (from document left), returns the index of the el that it horizontally intersects.
|
|
// If no intersection is made, returns undefined.
|
|
PositionCache.prototype.leftToIndex = function (leftPosition) {
|
|
var _a = this, lefts = _a.lefts, rights = _a.rights;
|
|
var len = lefts.length;
|
|
var i;
|
|
for (i = 0; i < len; i += 1) {
|
|
if (leftPosition >= lefts[i] && leftPosition < rights[i]) {
|
|
return i;
|
|
}
|
|
}
|
|
return undefined; // TODO: better
|
|
};
|
|
// Given a top offset (from document top), returns the index of the el that it vertically intersects.
|
|
// If no intersection is made, returns undefined.
|
|
PositionCache.prototype.topToIndex = function (topPosition) {
|
|
var _a = this, tops = _a.tops, bottoms = _a.bottoms;
|
|
var len = tops.length;
|
|
var i;
|
|
for (i = 0; i < len; i += 1) {
|
|
if (topPosition >= tops[i] && topPosition < bottoms[i]) {
|
|
return i;
|
|
}
|
|
}
|
|
return undefined; // TODO: better
|
|
};
|
|
// Gets the width of the element at the given index
|
|
PositionCache.prototype.getWidth = function (leftIndex) {
|
|
return this.rights[leftIndex] - this.lefts[leftIndex];
|
|
};
|
|
// Gets the height of the element at the given index
|
|
PositionCache.prototype.getHeight = function (topIndex) {
|
|
return this.bottoms[topIndex] - this.tops[topIndex];
|
|
};
|
|
return PositionCache;
|
|
}());
|
|
|
|
/* eslint max-classes-per-file: "off" */
|
|
/*
|
|
An object for getting/setting scroll-related information for an element.
|
|
Internally, this is done very differently for window versus DOM element,
|
|
so this object serves as a common interface.
|
|
*/
|
|
var ScrollController = /** @class */ (function () {
|
|
function ScrollController() {
|
|
}
|
|
ScrollController.prototype.getMaxScrollTop = function () {
|
|
return this.getScrollHeight() - this.getClientHeight();
|
|
};
|
|
ScrollController.prototype.getMaxScrollLeft = function () {
|
|
return this.getScrollWidth() - this.getClientWidth();
|
|
};
|
|
ScrollController.prototype.canScrollVertically = function () {
|
|
return this.getMaxScrollTop() > 0;
|
|
};
|
|
ScrollController.prototype.canScrollHorizontally = function () {
|
|
return this.getMaxScrollLeft() > 0;
|
|
};
|
|
ScrollController.prototype.canScrollUp = function () {
|
|
return this.getScrollTop() > 0;
|
|
};
|
|
ScrollController.prototype.canScrollDown = function () {
|
|
return this.getScrollTop() < this.getMaxScrollTop();
|
|
};
|
|
ScrollController.prototype.canScrollLeft = function () {
|
|
return this.getScrollLeft() > 0;
|
|
};
|
|
ScrollController.prototype.canScrollRight = function () {
|
|
return this.getScrollLeft() < this.getMaxScrollLeft();
|
|
};
|
|
return ScrollController;
|
|
}());
|
|
var ElementScrollController = /** @class */ (function (_super) {
|
|
__extends(ElementScrollController, _super);
|
|
function ElementScrollController(el) {
|
|
var _this = _super.call(this) || this;
|
|
_this.el = el;
|
|
return _this;
|
|
}
|
|
ElementScrollController.prototype.getScrollTop = function () {
|
|
return this.el.scrollTop;
|
|
};
|
|
ElementScrollController.prototype.getScrollLeft = function () {
|
|
return this.el.scrollLeft;
|
|
};
|
|
ElementScrollController.prototype.setScrollTop = function (top) {
|
|
this.el.scrollTop = top;
|
|
};
|
|
ElementScrollController.prototype.setScrollLeft = function (left) {
|
|
this.el.scrollLeft = left;
|
|
};
|
|
ElementScrollController.prototype.getScrollWidth = function () {
|
|
return this.el.scrollWidth;
|
|
};
|
|
ElementScrollController.prototype.getScrollHeight = function () {
|
|
return this.el.scrollHeight;
|
|
};
|
|
ElementScrollController.prototype.getClientHeight = function () {
|
|
return this.el.clientHeight;
|
|
};
|
|
ElementScrollController.prototype.getClientWidth = function () {
|
|
return this.el.clientWidth;
|
|
};
|
|
return ElementScrollController;
|
|
}(ScrollController));
|
|
var WindowScrollController = /** @class */ (function (_super) {
|
|
__extends(WindowScrollController, _super);
|
|
function WindowScrollController() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
WindowScrollController.prototype.getScrollTop = function () {
|
|
return window.pageYOffset;
|
|
};
|
|
WindowScrollController.prototype.getScrollLeft = function () {
|
|
return window.pageXOffset;
|
|
};
|
|
WindowScrollController.prototype.setScrollTop = function (n) {
|
|
window.scroll(window.pageXOffset, n);
|
|
};
|
|
WindowScrollController.prototype.setScrollLeft = function (n) {
|
|
window.scroll(n, window.pageYOffset);
|
|
};
|
|
WindowScrollController.prototype.getScrollWidth = function () {
|
|
return document.documentElement.scrollWidth;
|
|
};
|
|
WindowScrollController.prototype.getScrollHeight = function () {
|
|
return document.documentElement.scrollHeight;
|
|
};
|
|
WindowScrollController.prototype.getClientHeight = function () {
|
|
return document.documentElement.clientHeight;
|
|
};
|
|
WindowScrollController.prototype.getClientWidth = function () {
|
|
return document.documentElement.clientWidth;
|
|
};
|
|
return WindowScrollController;
|
|
}(ScrollController));
|
|
|
|
var Theme = /** @class */ (function () {
|
|
function Theme(calendarOptions) {
|
|
if (this.iconOverrideOption) {
|
|
this.setIconOverride(calendarOptions[this.iconOverrideOption]);
|
|
}
|
|
}
|
|
Theme.prototype.setIconOverride = function (iconOverrideHash) {
|
|
var iconClassesCopy;
|
|
var buttonName;
|
|
if (typeof iconOverrideHash === 'object' && iconOverrideHash) { // non-null object
|
|
iconClassesCopy = __assign({}, this.iconClasses);
|
|
for (buttonName in iconOverrideHash) {
|
|
iconClassesCopy[buttonName] = this.applyIconOverridePrefix(iconOverrideHash[buttonName]);
|
|
}
|
|
this.iconClasses = iconClassesCopy;
|
|
}
|
|
else if (iconOverrideHash === false) {
|
|
this.iconClasses = {};
|
|
}
|
|
};
|
|
Theme.prototype.applyIconOverridePrefix = function (className) {
|
|
var prefix = this.iconOverridePrefix;
|
|
if (prefix && className.indexOf(prefix) !== 0) { // if not already present
|
|
className = prefix + className;
|
|
}
|
|
return className;
|
|
};
|
|
Theme.prototype.getClass = function (key) {
|
|
return this.classes[key] || '';
|
|
};
|
|
Theme.prototype.getIconClass = function (buttonName, isRtl) {
|
|
var className;
|
|
if (isRtl && this.rtlIconClasses) {
|
|
className = this.rtlIconClasses[buttonName] || this.iconClasses[buttonName];
|
|
}
|
|
else {
|
|
className = this.iconClasses[buttonName];
|
|
}
|
|
if (className) {
|
|
return this.baseIconClass + " " + className;
|
|
}
|
|
return '';
|
|
};
|
|
Theme.prototype.getCustomButtonIconClass = function (customButtonProps) {
|
|
var className;
|
|
if (this.iconOverrideCustomButtonOption) {
|
|
className = customButtonProps[this.iconOverrideCustomButtonOption];
|
|
if (className) {
|
|
return this.baseIconClass + " " + this.applyIconOverridePrefix(className);
|
|
}
|
|
}
|
|
return '';
|
|
};
|
|
return Theme;
|
|
}());
|
|
Theme.prototype.classes = {};
|
|
Theme.prototype.iconClasses = {};
|
|
Theme.prototype.baseIconClass = '';
|
|
Theme.prototype.iconOverridePrefix = '';
|
|
|
|
/// <reference types="@fullcalendar/core-preact" />
|
|
if (typeof FullCalendarVDom === 'undefined') {
|
|
throw new Error('Please import the top-level fullcalendar lib before attempting to import a plugin.');
|
|
}
|
|
var Component = FullCalendarVDom.Component;
|
|
var createElement = FullCalendarVDom.createElement;
|
|
var render = FullCalendarVDom.render;
|
|
var createRef = FullCalendarVDom.createRef;
|
|
var Fragment = FullCalendarVDom.Fragment;
|
|
var createContext = FullCalendarVDom.createContext;
|
|
var createPortal = FullCalendarVDom.createPortal;
|
|
var flushSync = FullCalendarVDom.flushSync;
|
|
var unmountComponentAtNode = FullCalendarVDom.unmountComponentAtNode;
|
|
/* eslint-enable */
|
|
|
|
var ScrollResponder = /** @class */ (function () {
|
|
function ScrollResponder(execFunc, emitter, scrollTime, scrollTimeReset) {
|
|
var _this = this;
|
|
this.execFunc = execFunc;
|
|
this.emitter = emitter;
|
|
this.scrollTime = scrollTime;
|
|
this.scrollTimeReset = scrollTimeReset;
|
|
this.handleScrollRequest = function (request) {
|
|
_this.queuedRequest = __assign({}, _this.queuedRequest || {}, request);
|
|
_this.drain();
|
|
};
|
|
emitter.on('_scrollRequest', this.handleScrollRequest);
|
|
this.fireInitialScroll();
|
|
}
|
|
ScrollResponder.prototype.detach = function () {
|
|
this.emitter.off('_scrollRequest', this.handleScrollRequest);
|
|
};
|
|
ScrollResponder.prototype.update = function (isDatesNew) {
|
|
if (isDatesNew && this.scrollTimeReset) {
|
|
this.fireInitialScroll(); // will drain
|
|
}
|
|
else {
|
|
this.drain();
|
|
}
|
|
};
|
|
ScrollResponder.prototype.fireInitialScroll = function () {
|
|
this.handleScrollRequest({
|
|
time: this.scrollTime,
|
|
});
|
|
};
|
|
ScrollResponder.prototype.drain = function () {
|
|
if (this.queuedRequest && this.execFunc(this.queuedRequest)) {
|
|
this.queuedRequest = null;
|
|
}
|
|
};
|
|
return ScrollResponder;
|
|
}());
|
|
|
|
var ViewContextType = createContext({}); // for Components
|
|
function buildViewContext(viewSpec, viewApi, viewOptions, dateProfileGenerator, dateEnv, theme, pluginHooks, dispatch, getCurrentData, emitter, calendarApi, registerInteractiveComponent, unregisterInteractiveComponent) {
|
|
return {
|
|
dateEnv: dateEnv,
|
|
options: viewOptions,
|
|
pluginHooks: pluginHooks,
|
|
emitter: emitter,
|
|
dispatch: dispatch,
|
|
getCurrentData: getCurrentData,
|
|
calendarApi: calendarApi,
|
|
viewSpec: viewSpec,
|
|
viewApi: viewApi,
|
|
dateProfileGenerator: dateProfileGenerator,
|
|
theme: theme,
|
|
isRtl: viewOptions.direction === 'rtl',
|
|
addResizeHandler: function (handler) {
|
|
emitter.on('_resize', handler);
|
|
},
|
|
removeResizeHandler: function (handler) {
|
|
emitter.off('_resize', handler);
|
|
},
|
|
createScrollResponder: function (execFunc) {
|
|
return new ScrollResponder(execFunc, emitter, createDuration(viewOptions.scrollTime), viewOptions.scrollTimeReset);
|
|
},
|
|
registerInteractiveComponent: registerInteractiveComponent,
|
|
unregisterInteractiveComponent: unregisterInteractiveComponent,
|
|
};
|
|
}
|
|
|
|
/* eslint max-classes-per-file: off */
|
|
var PureComponent = /** @class */ (function (_super) {
|
|
__extends(PureComponent, _super);
|
|
function PureComponent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
PureComponent.prototype.shouldComponentUpdate = function (nextProps, nextState) {
|
|
if (this.debug) {
|
|
// eslint-disable-next-line no-console
|
|
console.log(getUnequalProps(nextProps, this.props), getUnequalProps(nextState, this.state));
|
|
}
|
|
return !compareObjs(this.props, nextProps, this.propEquality) ||
|
|
!compareObjs(this.state, nextState, this.stateEquality);
|
|
};
|
|
// HACK for freakin' React StrictMode
|
|
PureComponent.prototype.safeSetState = function (newState) {
|
|
if (!compareObjs(this.state, __assign(__assign({}, this.state), newState), this.stateEquality)) {
|
|
this.setState(newState);
|
|
}
|
|
};
|
|
PureComponent.addPropsEquality = addPropsEquality;
|
|
PureComponent.addStateEquality = addStateEquality;
|
|
PureComponent.contextType = ViewContextType;
|
|
return PureComponent;
|
|
}(Component));
|
|
PureComponent.prototype.propEquality = {};
|
|
PureComponent.prototype.stateEquality = {};
|
|
var BaseComponent = /** @class */ (function (_super) {
|
|
__extends(BaseComponent, _super);
|
|
function BaseComponent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
BaseComponent.contextType = ViewContextType;
|
|
return BaseComponent;
|
|
}(PureComponent));
|
|
function addPropsEquality(propEquality) {
|
|
var hash = Object.create(this.prototype.propEquality);
|
|
__assign(hash, propEquality);
|
|
this.prototype.propEquality = hash;
|
|
}
|
|
function addStateEquality(stateEquality) {
|
|
var hash = Object.create(this.prototype.stateEquality);
|
|
__assign(hash, stateEquality);
|
|
this.prototype.stateEquality = hash;
|
|
}
|
|
// use other one
|
|
function setRef(ref, current) {
|
|
if (typeof ref === 'function') {
|
|
ref(current);
|
|
}
|
|
else if (ref) {
|
|
// see https://github.com/facebook/react/issues/13029
|
|
ref.current = current;
|
|
}
|
|
}
|
|
|
|
/*
|
|
an INTERACTABLE date component
|
|
|
|
PURPOSES:
|
|
- hook up to fg, fill, and mirror renderers
|
|
- interface for dragging and hits
|
|
*/
|
|
var DateComponent = /** @class */ (function (_super) {
|
|
__extends(DateComponent, _super);
|
|
function DateComponent() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.uid = guid();
|
|
return _this;
|
|
}
|
|
// Hit System
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
DateComponent.prototype.prepareHits = function () {
|
|
};
|
|
DateComponent.prototype.queryHit = function (positionLeft, positionTop, elWidth, elHeight) {
|
|
return null; // this should be abstract
|
|
};
|
|
// Pointer Interaction Utils
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
DateComponent.prototype.isValidSegDownEl = function (el) {
|
|
return !this.props.eventDrag && // HACK
|
|
!this.props.eventResize && // HACK
|
|
!elementClosest(el, '.fc-event-mirror');
|
|
};
|
|
DateComponent.prototype.isValidDateDownEl = function (el) {
|
|
return !elementClosest(el, '.fc-event:not(.fc-bg-event)') &&
|
|
!elementClosest(el, '.fc-more-link') && // a "more.." link
|
|
!elementClosest(el, 'a[data-navlink]') && // a clickable nav link
|
|
!elementClosest(el, '.fc-popover'); // hack
|
|
};
|
|
return DateComponent;
|
|
}(BaseComponent));
|
|
|
|
// TODO: easier way to add new hooks? need to update a million things
|
|
function createPlugin(input) {
|
|
return {
|
|
id: guid(),
|
|
deps: input.deps || [],
|
|
reducers: input.reducers || [],
|
|
isLoadingFuncs: input.isLoadingFuncs || [],
|
|
contextInit: [].concat(input.contextInit || []),
|
|
eventRefiners: input.eventRefiners || {},
|
|
eventDefMemberAdders: input.eventDefMemberAdders || [],
|
|
eventSourceRefiners: input.eventSourceRefiners || {},
|
|
isDraggableTransformers: input.isDraggableTransformers || [],
|
|
eventDragMutationMassagers: input.eventDragMutationMassagers || [],
|
|
eventDefMutationAppliers: input.eventDefMutationAppliers || [],
|
|
dateSelectionTransformers: input.dateSelectionTransformers || [],
|
|
datePointTransforms: input.datePointTransforms || [],
|
|
dateSpanTransforms: input.dateSpanTransforms || [],
|
|
views: input.views || {},
|
|
viewPropsTransformers: input.viewPropsTransformers || [],
|
|
isPropsValid: input.isPropsValid || null,
|
|
externalDefTransforms: input.externalDefTransforms || [],
|
|
viewContainerAppends: input.viewContainerAppends || [],
|
|
eventDropTransformers: input.eventDropTransformers || [],
|
|
componentInteractions: input.componentInteractions || [],
|
|
calendarInteractions: input.calendarInteractions || [],
|
|
themeClasses: input.themeClasses || {},
|
|
eventSourceDefs: input.eventSourceDefs || [],
|
|
cmdFormatter: input.cmdFormatter,
|
|
recurringTypes: input.recurringTypes || [],
|
|
namedTimeZonedImpl: input.namedTimeZonedImpl,
|
|
initialView: input.initialView || '',
|
|
elementDraggingImpl: input.elementDraggingImpl,
|
|
optionChangeHandlers: input.optionChangeHandlers || {},
|
|
scrollGridImpl: input.scrollGridImpl || null,
|
|
contentTypeHandlers: input.contentTypeHandlers || {},
|
|
listenerRefiners: input.listenerRefiners || {},
|
|
optionRefiners: input.optionRefiners || {},
|
|
propSetHandlers: input.propSetHandlers || {},
|
|
};
|
|
}
|
|
function buildPluginHooks(pluginDefs, globalDefs) {
|
|
var isAdded = {};
|
|
var hooks = {
|
|
reducers: [],
|
|
isLoadingFuncs: [],
|
|
contextInit: [],
|
|
eventRefiners: {},
|
|
eventDefMemberAdders: [],
|
|
eventSourceRefiners: {},
|
|
isDraggableTransformers: [],
|
|
eventDragMutationMassagers: [],
|
|
eventDefMutationAppliers: [],
|
|
dateSelectionTransformers: [],
|
|
datePointTransforms: [],
|
|
dateSpanTransforms: [],
|
|
views: {},
|
|
viewPropsTransformers: [],
|
|
isPropsValid: null,
|
|
externalDefTransforms: [],
|
|
viewContainerAppends: [],
|
|
eventDropTransformers: [],
|
|
componentInteractions: [],
|
|
calendarInteractions: [],
|
|
themeClasses: {},
|
|
eventSourceDefs: [],
|
|
cmdFormatter: null,
|
|
recurringTypes: [],
|
|
namedTimeZonedImpl: null,
|
|
initialView: '',
|
|
elementDraggingImpl: null,
|
|
optionChangeHandlers: {},
|
|
scrollGridImpl: null,
|
|
contentTypeHandlers: {},
|
|
listenerRefiners: {},
|
|
optionRefiners: {},
|
|
propSetHandlers: {},
|
|
};
|
|
function addDefs(defs) {
|
|
for (var _i = 0, defs_1 = defs; _i < defs_1.length; _i++) {
|
|
var def = defs_1[_i];
|
|
if (!isAdded[def.id]) {
|
|
isAdded[def.id] = true;
|
|
addDefs(def.deps);
|
|
hooks = combineHooks(hooks, def);
|
|
}
|
|
}
|
|
}
|
|
if (pluginDefs) {
|
|
addDefs(pluginDefs);
|
|
}
|
|
addDefs(globalDefs);
|
|
return hooks;
|
|
}
|
|
function buildBuildPluginHooks() {
|
|
var currentOverrideDefs = [];
|
|
var currentGlobalDefs = [];
|
|
var currentHooks;
|
|
return function (overrideDefs, globalDefs) {
|
|
if (!currentHooks || !isArraysEqual(overrideDefs, currentOverrideDefs) || !isArraysEqual(globalDefs, currentGlobalDefs)) {
|
|
currentHooks = buildPluginHooks(overrideDefs, globalDefs);
|
|
}
|
|
currentOverrideDefs = overrideDefs;
|
|
currentGlobalDefs = globalDefs;
|
|
return currentHooks;
|
|
};
|
|
}
|
|
function combineHooks(hooks0, hooks1) {
|
|
return {
|
|
reducers: hooks0.reducers.concat(hooks1.reducers),
|
|
isLoadingFuncs: hooks0.isLoadingFuncs.concat(hooks1.isLoadingFuncs),
|
|
contextInit: hooks0.contextInit.concat(hooks1.contextInit),
|
|
eventRefiners: __assign(__assign({}, hooks0.eventRefiners), hooks1.eventRefiners),
|
|
eventDefMemberAdders: hooks0.eventDefMemberAdders.concat(hooks1.eventDefMemberAdders),
|
|
eventSourceRefiners: __assign(__assign({}, hooks0.eventSourceRefiners), hooks1.eventSourceRefiners),
|
|
isDraggableTransformers: hooks0.isDraggableTransformers.concat(hooks1.isDraggableTransformers),
|
|
eventDragMutationMassagers: hooks0.eventDragMutationMassagers.concat(hooks1.eventDragMutationMassagers),
|
|
eventDefMutationAppliers: hooks0.eventDefMutationAppliers.concat(hooks1.eventDefMutationAppliers),
|
|
dateSelectionTransformers: hooks0.dateSelectionTransformers.concat(hooks1.dateSelectionTransformers),
|
|
datePointTransforms: hooks0.datePointTransforms.concat(hooks1.datePointTransforms),
|
|
dateSpanTransforms: hooks0.dateSpanTransforms.concat(hooks1.dateSpanTransforms),
|
|
views: __assign(__assign({}, hooks0.views), hooks1.views),
|
|
viewPropsTransformers: hooks0.viewPropsTransformers.concat(hooks1.viewPropsTransformers),
|
|
isPropsValid: hooks1.isPropsValid || hooks0.isPropsValid,
|
|
externalDefTransforms: hooks0.externalDefTransforms.concat(hooks1.externalDefTransforms),
|
|
viewContainerAppends: hooks0.viewContainerAppends.concat(hooks1.viewContainerAppends),
|
|
eventDropTransformers: hooks0.eventDropTransformers.concat(hooks1.eventDropTransformers),
|
|
calendarInteractions: hooks0.calendarInteractions.concat(hooks1.calendarInteractions),
|
|
componentInteractions: hooks0.componentInteractions.concat(hooks1.componentInteractions),
|
|
themeClasses: __assign(__assign({}, hooks0.themeClasses), hooks1.themeClasses),
|
|
eventSourceDefs: hooks0.eventSourceDefs.concat(hooks1.eventSourceDefs),
|
|
cmdFormatter: hooks1.cmdFormatter || hooks0.cmdFormatter,
|
|
recurringTypes: hooks0.recurringTypes.concat(hooks1.recurringTypes),
|
|
namedTimeZonedImpl: hooks1.namedTimeZonedImpl || hooks0.namedTimeZonedImpl,
|
|
initialView: hooks0.initialView || hooks1.initialView,
|
|
elementDraggingImpl: hooks0.elementDraggingImpl || hooks1.elementDraggingImpl,
|
|
optionChangeHandlers: __assign(__assign({}, hooks0.optionChangeHandlers), hooks1.optionChangeHandlers),
|
|
scrollGridImpl: hooks1.scrollGridImpl || hooks0.scrollGridImpl,
|
|
contentTypeHandlers: __assign(__assign({}, hooks0.contentTypeHandlers), hooks1.contentTypeHandlers),
|
|
listenerRefiners: __assign(__assign({}, hooks0.listenerRefiners), hooks1.listenerRefiners),
|
|
optionRefiners: __assign(__assign({}, hooks0.optionRefiners), hooks1.optionRefiners),
|
|
propSetHandlers: __assign(__assign({}, hooks0.propSetHandlers), hooks1.propSetHandlers),
|
|
};
|
|
}
|
|
|
|
var StandardTheme = /** @class */ (function (_super) {
|
|
__extends(StandardTheme, _super);
|
|
function StandardTheme() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
return StandardTheme;
|
|
}(Theme));
|
|
StandardTheme.prototype.classes = {
|
|
root: 'fc-theme-standard',
|
|
tableCellShaded: 'fc-cell-shaded',
|
|
buttonGroup: 'fc-button-group',
|
|
button: 'fc-button fc-button-primary',
|
|
buttonActive: 'fc-button-active',
|
|
};
|
|
StandardTheme.prototype.baseIconClass = 'fc-icon';
|
|
StandardTheme.prototype.iconClasses = {
|
|
close: 'fc-icon-x',
|
|
prev: 'fc-icon-chevron-left',
|
|
next: 'fc-icon-chevron-right',
|
|
prevYear: 'fc-icon-chevrons-left',
|
|
nextYear: 'fc-icon-chevrons-right',
|
|
};
|
|
StandardTheme.prototype.rtlIconClasses = {
|
|
prev: 'fc-icon-chevron-right',
|
|
next: 'fc-icon-chevron-left',
|
|
prevYear: 'fc-icon-chevrons-right',
|
|
nextYear: 'fc-icon-chevrons-left',
|
|
};
|
|
StandardTheme.prototype.iconOverrideOption = 'buttonIcons'; // TODO: make TS-friendly
|
|
StandardTheme.prototype.iconOverrideCustomButtonOption = 'icon';
|
|
StandardTheme.prototype.iconOverridePrefix = 'fc-icon-';
|
|
|
|
function compileViewDefs(defaultConfigs, overrideConfigs) {
|
|
var hash = {};
|
|
var viewType;
|
|
for (viewType in defaultConfigs) {
|
|
ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs);
|
|
}
|
|
for (viewType in overrideConfigs) {
|
|
ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs);
|
|
}
|
|
return hash;
|
|
}
|
|
function ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs) {
|
|
if (hash[viewType]) {
|
|
return hash[viewType];
|
|
}
|
|
var viewDef = buildViewDef(viewType, hash, defaultConfigs, overrideConfigs);
|
|
if (viewDef) {
|
|
hash[viewType] = viewDef;
|
|
}
|
|
return viewDef;
|
|
}
|
|
function buildViewDef(viewType, hash, defaultConfigs, overrideConfigs) {
|
|
var defaultConfig = defaultConfigs[viewType];
|
|
var overrideConfig = overrideConfigs[viewType];
|
|
var queryProp = function (name) { return ((defaultConfig && defaultConfig[name] !== null) ? defaultConfig[name] :
|
|
((overrideConfig && overrideConfig[name] !== null) ? overrideConfig[name] : null)); };
|
|
var theComponent = queryProp('component');
|
|
var superType = queryProp('superType');
|
|
var superDef = null;
|
|
if (superType) {
|
|
if (superType === viewType) {
|
|
throw new Error('Can\'t have a custom view type that references itself');
|
|
}
|
|
superDef = ensureViewDef(superType, hash, defaultConfigs, overrideConfigs);
|
|
}
|
|
if (!theComponent && superDef) {
|
|
theComponent = superDef.component;
|
|
}
|
|
if (!theComponent) {
|
|
return null; // don't throw a warning, might be settings for a single-unit view
|
|
}
|
|
return {
|
|
type: viewType,
|
|
component: theComponent,
|
|
defaults: __assign(__assign({}, (superDef ? superDef.defaults : {})), (defaultConfig ? defaultConfig.rawOptions : {})),
|
|
overrides: __assign(__assign({}, (superDef ? superDef.overrides : {})), (overrideConfig ? overrideConfig.rawOptions : {})),
|
|
};
|
|
}
|
|
|
|
/* eslint max-classes-per-file: off */
|
|
// NOTE: in JSX, you should always use this class with <HookProps> arg. otherwise, will default to any???
|
|
var RenderHook = /** @class */ (function (_super) {
|
|
__extends(RenderHook, _super);
|
|
function RenderHook() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
_this.handleRootEl = function (el) {
|
|
setRef(_this.rootElRef, el);
|
|
if (_this.props.elRef) {
|
|
setRef(_this.props.elRef, el);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
RenderHook.prototype.render = function () {
|
|
var _this = this;
|
|
var props = this.props;
|
|
var hookProps = props.hookProps;
|
|
return (createElement(MountHook, { hookProps: hookProps, didMount: props.didMount, willUnmount: props.willUnmount, elRef: this.handleRootEl }, function (rootElRef) { return (createElement(ContentHook, { hookProps: hookProps, content: props.content, defaultContent: props.defaultContent, backupElRef: _this.rootElRef }, function (innerElRef, innerContent) { return props.children(rootElRef, normalizeClassNames(props.classNames, hookProps), innerElRef, innerContent); })); }));
|
|
};
|
|
return RenderHook;
|
|
}(BaseComponent));
|
|
// TODO: rename to be about function, not default. use in above type
|
|
// for forcing rerender of components that use the ContentHook
|
|
var CustomContentRenderContext = createContext(0);
|
|
function ContentHook(props) {
|
|
return (createElement(CustomContentRenderContext.Consumer, null, function (renderId) { return (createElement(ContentHookInner, __assign({ renderId: renderId }, props))); }));
|
|
}
|
|
var ContentHookInner = /** @class */ (function (_super) {
|
|
__extends(ContentHookInner, _super);
|
|
function ContentHookInner() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.innerElRef = createRef();
|
|
return _this;
|
|
}
|
|
ContentHookInner.prototype.render = function () {
|
|
return this.props.children(this.innerElRef, this.renderInnerContent());
|
|
};
|
|
ContentHookInner.prototype.componentDidMount = function () {
|
|
this.updateCustomContent();
|
|
};
|
|
ContentHookInner.prototype.componentDidUpdate = function () {
|
|
this.updateCustomContent();
|
|
};
|
|
ContentHookInner.prototype.componentWillUnmount = function () {
|
|
if (this.customContentInfo && this.customContentInfo.destroy) {
|
|
this.customContentInfo.destroy();
|
|
}
|
|
};
|
|
ContentHookInner.prototype.renderInnerContent = function () {
|
|
var customContentInfo = this.customContentInfo; // only populated if using non-[p]react node(s)
|
|
var innerContent = this.getInnerContent();
|
|
var meta = this.getContentMeta(innerContent);
|
|
// initial run, or content-type changing? (from vue -> react for example)
|
|
if (!customContentInfo || customContentInfo.contentKey !== meta.contentKey) {
|
|
// clearing old value
|
|
if (customContentInfo) {
|
|
if (customContentInfo.destroy) {
|
|
customContentInfo.destroy();
|
|
}
|
|
customContentInfo = this.customContentInfo = null;
|
|
}
|
|
// assigning new value
|
|
if (meta.contentKey) {
|
|
customContentInfo = this.customContentInfo = __assign({ contentKey: meta.contentKey, contentVal: innerContent[meta.contentKey] }, meta.buildLifecycleFuncs());
|
|
}
|
|
// updating
|
|
}
|
|
else if (customContentInfo) {
|
|
customContentInfo.contentVal = innerContent[meta.contentKey];
|
|
}
|
|
return customContentInfo
|
|
? [] // signal that something was specified
|
|
: innerContent; // assume a [p]react vdom node. use it
|
|
};
|
|
ContentHookInner.prototype.getInnerContent = function () {
|
|
var props = this.props;
|
|
var innerContent = normalizeContent(props.content, props.hookProps);
|
|
if (innerContent === undefined) { // use the default
|
|
innerContent = normalizeContent(props.defaultContent, props.hookProps);
|
|
}
|
|
return innerContent == null ? null : innerContent; // convert undefined to null (better for React)
|
|
};
|
|
ContentHookInner.prototype.getContentMeta = function (innerContent) {
|
|
var contentTypeHandlers = this.context.pluginHooks.contentTypeHandlers;
|
|
var contentKey = '';
|
|
var buildLifecycleFuncs = null;
|
|
if (innerContent) { // allowed to be null, for convenience to caller
|
|
for (var searchKey in contentTypeHandlers) {
|
|
if (innerContent[searchKey] !== undefined) {
|
|
contentKey = searchKey;
|
|
buildLifecycleFuncs = contentTypeHandlers[searchKey];
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
return { contentKey: contentKey, buildLifecycleFuncs: buildLifecycleFuncs };
|
|
};
|
|
ContentHookInner.prototype.updateCustomContent = function () {
|
|
if (this.customContentInfo) { // for non-[p]react
|
|
this.customContentInfo.render(this.innerElRef.current || this.props.backupElRef.current, // the element to render into
|
|
this.customContentInfo.contentVal);
|
|
}
|
|
};
|
|
return ContentHookInner;
|
|
}(BaseComponent));
|
|
var MountHook = /** @class */ (function (_super) {
|
|
__extends(MountHook, _super);
|
|
function MountHook() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.handleRootEl = function (rootEl) {
|
|
_this.rootEl = rootEl;
|
|
if (_this.props.elRef) {
|
|
setRef(_this.props.elRef, rootEl);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
MountHook.prototype.render = function () {
|
|
return this.props.children(this.handleRootEl);
|
|
};
|
|
MountHook.prototype.componentDidMount = function () {
|
|
var callback = this.props.didMount;
|
|
if (callback) {
|
|
callback(__assign(__assign({}, this.props.hookProps), { el: this.rootEl }));
|
|
}
|
|
};
|
|
MountHook.prototype.componentWillUnmount = function () {
|
|
var callback = this.props.willUnmount;
|
|
if (callback) {
|
|
callback(__assign(__assign({}, this.props.hookProps), { el: this.rootEl }));
|
|
}
|
|
};
|
|
return MountHook;
|
|
}(BaseComponent));
|
|
function buildClassNameNormalizer() {
|
|
var currentGenerator;
|
|
var currentHookProps;
|
|
var currentClassNames = [];
|
|
return function (generator, hookProps) {
|
|
if (!currentHookProps || !isPropsEqual(currentHookProps, hookProps) || generator !== currentGenerator) {
|
|
currentGenerator = generator;
|
|
currentHookProps = hookProps;
|
|
currentClassNames = normalizeClassNames(generator, hookProps);
|
|
}
|
|
return currentClassNames;
|
|
};
|
|
}
|
|
function normalizeClassNames(classNames, hookProps) {
|
|
if (typeof classNames === 'function') {
|
|
classNames = classNames(hookProps);
|
|
}
|
|
return parseClassNames(classNames);
|
|
}
|
|
function normalizeContent(input, hookProps) {
|
|
if (typeof input === 'function') {
|
|
return input(hookProps, createElement); // give the function the vdom-creation func
|
|
}
|
|
return input;
|
|
}
|
|
|
|
var ViewRoot = /** @class */ (function (_super) {
|
|
__extends(ViewRoot, _super);
|
|
function ViewRoot() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.normalizeClassNames = buildClassNameNormalizer();
|
|
return _this;
|
|
}
|
|
ViewRoot.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var hookProps = { view: context.viewApi };
|
|
var customClassNames = this.normalizeClassNames(options.viewClassNames, hookProps);
|
|
return (createElement(MountHook, { hookProps: hookProps, didMount: options.viewDidMount, willUnmount: options.viewWillUnmount, elRef: props.elRef }, function (rootElRef) { return props.children(rootElRef, ["fc-" + props.viewSpec.type + "-view", 'fc-view'].concat(customClassNames)); }));
|
|
};
|
|
return ViewRoot;
|
|
}(BaseComponent));
|
|
|
|
function parseViewConfigs(inputs) {
|
|
return mapHash(inputs, parseViewConfig);
|
|
}
|
|
function parseViewConfig(input) {
|
|
var rawOptions = typeof input === 'function' ?
|
|
{ component: input } :
|
|
input;
|
|
var component = rawOptions.component;
|
|
if (rawOptions.content) {
|
|
component = createViewHookComponent(rawOptions);
|
|
// TODO: remove content/classNames/didMount/etc from options?
|
|
}
|
|
return {
|
|
superType: rawOptions.type,
|
|
component: component,
|
|
rawOptions: rawOptions,
|
|
};
|
|
}
|
|
function createViewHookComponent(options) {
|
|
return function (viewProps) { return (createElement(ViewContextType.Consumer, null, function (context) { return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (viewElRef, viewClassNames) {
|
|
var hookProps = __assign(__assign({}, viewProps), { nextDayThreshold: context.options.nextDayThreshold });
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.classNames, content: options.content, didMount: options.didMount, willUnmount: options.willUnmount, elRef: viewElRef }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("div", { className: viewClassNames.concat(customClassNames).join(' '), ref: rootElRef }, innerContent)); }));
|
|
})); })); };
|
|
}
|
|
|
|
function buildViewSpecs(defaultInputs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
|
|
var defaultConfigs = parseViewConfigs(defaultInputs);
|
|
var overrideConfigs = parseViewConfigs(optionOverrides.views);
|
|
var viewDefs = compileViewDefs(defaultConfigs, overrideConfigs);
|
|
return mapHash(viewDefs, function (viewDef) { return buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults); });
|
|
}
|
|
function buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
|
|
var durationInput = viewDef.overrides.duration ||
|
|
viewDef.defaults.duration ||
|
|
dynamicOptionOverrides.duration ||
|
|
optionOverrides.duration;
|
|
var duration = null;
|
|
var durationUnit = '';
|
|
var singleUnit = '';
|
|
var singleUnitOverrides = {};
|
|
if (durationInput) {
|
|
duration = createDurationCached(durationInput);
|
|
if (duration) { // valid?
|
|
var denom = greatestDurationDenominator(duration);
|
|
durationUnit = denom.unit;
|
|
if (denom.value === 1) {
|
|
singleUnit = durationUnit;
|
|
singleUnitOverrides = overrideConfigs[durationUnit] ? overrideConfigs[durationUnit].rawOptions : {};
|
|
}
|
|
}
|
|
}
|
|
var queryButtonText = function (optionsSubset) {
|
|
var buttonTextMap = optionsSubset.buttonText || {};
|
|
var buttonTextKey = viewDef.defaults.buttonTextKey;
|
|
if (buttonTextKey != null && buttonTextMap[buttonTextKey] != null) {
|
|
return buttonTextMap[buttonTextKey];
|
|
}
|
|
if (buttonTextMap[viewDef.type] != null) {
|
|
return buttonTextMap[viewDef.type];
|
|
}
|
|
if (buttonTextMap[singleUnit] != null) {
|
|
return buttonTextMap[singleUnit];
|
|
}
|
|
return null;
|
|
};
|
|
var queryButtonTitle = function (optionsSubset) {
|
|
var buttonHints = optionsSubset.buttonHints || {};
|
|
var buttonKey = viewDef.defaults.buttonTextKey; // use same key as text
|
|
if (buttonKey != null && buttonHints[buttonKey] != null) {
|
|
return buttonHints[buttonKey];
|
|
}
|
|
if (buttonHints[viewDef.type] != null) {
|
|
return buttonHints[viewDef.type];
|
|
}
|
|
if (buttonHints[singleUnit] != null) {
|
|
return buttonHints[singleUnit];
|
|
}
|
|
return null;
|
|
};
|
|
return {
|
|
type: viewDef.type,
|
|
component: viewDef.component,
|
|
duration: duration,
|
|
durationUnit: durationUnit,
|
|
singleUnit: singleUnit,
|
|
optionDefaults: viewDef.defaults,
|
|
optionOverrides: __assign(__assign({}, singleUnitOverrides), viewDef.overrides),
|
|
buttonTextOverride: queryButtonText(dynamicOptionOverrides) ||
|
|
queryButtonText(optionOverrides) || // constructor-specified buttonText lookup hash takes precedence
|
|
viewDef.overrides.buttonText,
|
|
buttonTextDefault: queryButtonText(localeDefaults) ||
|
|
viewDef.defaults.buttonText ||
|
|
queryButtonText(BASE_OPTION_DEFAULTS) ||
|
|
viewDef.type,
|
|
// not DRY
|
|
buttonTitleOverride: queryButtonTitle(dynamicOptionOverrides) ||
|
|
queryButtonTitle(optionOverrides) ||
|
|
viewDef.overrides.buttonHint,
|
|
buttonTitleDefault: queryButtonTitle(localeDefaults) ||
|
|
viewDef.defaults.buttonHint ||
|
|
queryButtonTitle(BASE_OPTION_DEFAULTS),
|
|
// will eventually fall back to buttonText
|
|
};
|
|
}
|
|
// hack to get memoization working
|
|
var durationInputMap = {};
|
|
function createDurationCached(durationInput) {
|
|
var json = JSON.stringify(durationInput);
|
|
var res = durationInputMap[json];
|
|
if (res === undefined) {
|
|
res = createDuration(durationInput);
|
|
durationInputMap[json] = res;
|
|
}
|
|
return res;
|
|
}
|
|
|
|
var DateProfileGenerator = /** @class */ (function () {
|
|
function DateProfileGenerator(props) {
|
|
this.props = props;
|
|
this.nowDate = getNow(props.nowInput, props.dateEnv);
|
|
this.initHiddenDays();
|
|
}
|
|
/* Date Range Computation
|
|
------------------------------------------------------------------------------------------------------------------*/
|
|
// Builds a structure with info about what the dates/ranges will be for the "prev" view.
|
|
DateProfileGenerator.prototype.buildPrev = function (currentDateProfile, currentDate, forceToValid) {
|
|
var dateEnv = this.props.dateEnv;
|
|
var prevDate = dateEnv.subtract(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
|
|
currentDateProfile.dateIncrement);
|
|
return this.build(prevDate, -1, forceToValid);
|
|
};
|
|
// Builds a structure with info about what the dates/ranges will be for the "next" view.
|
|
DateProfileGenerator.prototype.buildNext = function (currentDateProfile, currentDate, forceToValid) {
|
|
var dateEnv = this.props.dateEnv;
|
|
var nextDate = dateEnv.add(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
|
|
currentDateProfile.dateIncrement);
|
|
return this.build(nextDate, 1, forceToValid);
|
|
};
|
|
// Builds a structure holding dates/ranges for rendering around the given date.
|
|
// Optional direction param indicates whether the date is being incremented/decremented
|
|
// from its previous value. decremented = -1, incremented = 1 (default).
|
|
DateProfileGenerator.prototype.build = function (currentDate, direction, forceToValid) {
|
|
if (forceToValid === void 0) { forceToValid = true; }
|
|
var props = this.props;
|
|
var validRange;
|
|
var currentInfo;
|
|
var isRangeAllDay;
|
|
var renderRange;
|
|
var activeRange;
|
|
var isValid;
|
|
validRange = this.buildValidRange();
|
|
validRange = this.trimHiddenDays(validRange);
|
|
if (forceToValid) {
|
|
currentDate = constrainMarkerToRange(currentDate, validRange);
|
|
}
|
|
currentInfo = this.buildCurrentRangeInfo(currentDate, direction);
|
|
isRangeAllDay = /^(year|month|week|day)$/.test(currentInfo.unit);
|
|
renderRange = this.buildRenderRange(this.trimHiddenDays(currentInfo.range), currentInfo.unit, isRangeAllDay);
|
|
renderRange = this.trimHiddenDays(renderRange);
|
|
activeRange = renderRange;
|
|
if (!props.showNonCurrentDates) {
|
|
activeRange = intersectRanges(activeRange, currentInfo.range);
|
|
}
|
|
activeRange = this.adjustActiveRange(activeRange);
|
|
activeRange = intersectRanges(activeRange, validRange); // might return null
|
|
// it's invalid if the originally requested date is not contained,
|
|
// or if the range is completely outside of the valid range.
|
|
isValid = rangesIntersect(currentInfo.range, validRange);
|
|
return {
|
|
// constraint for where prev/next operations can go and where events can be dragged/resized to.
|
|
// an object with optional start and end properties.
|
|
validRange: validRange,
|
|
// range the view is formally responsible for.
|
|
// for example, a month view might have 1st-31st, excluding padded dates
|
|
currentRange: currentInfo.range,
|
|
// name of largest unit being displayed, like "month" or "week"
|
|
currentRangeUnit: currentInfo.unit,
|
|
isRangeAllDay: isRangeAllDay,
|
|
// dates that display events and accept drag-n-drop
|
|
// will be `null` if no dates accept events
|
|
activeRange: activeRange,
|
|
// date range with a rendered skeleton
|
|
// includes not-active days that need some sort of DOM
|
|
renderRange: renderRange,
|
|
// Duration object that denotes the first visible time of any given day
|
|
slotMinTime: props.slotMinTime,
|
|
// Duration object that denotes the exclusive visible end time of any given day
|
|
slotMaxTime: props.slotMaxTime,
|
|
isValid: isValid,
|
|
// how far the current date will move for a prev/next operation
|
|
dateIncrement: this.buildDateIncrement(currentInfo.duration),
|
|
// pass a fallback (might be null) ^
|
|
};
|
|
};
|
|
// Builds an object with optional start/end properties.
|
|
// Indicates the minimum/maximum dates to display.
|
|
// not responsible for trimming hidden days.
|
|
DateProfileGenerator.prototype.buildValidRange = function () {
|
|
var input = this.props.validRangeInput;
|
|
var simpleInput = typeof input === 'function'
|
|
? input.call(this.props.calendarApi, this.nowDate)
|
|
: input;
|
|
return this.refineRange(simpleInput) ||
|
|
{ start: null, end: null }; // completely open-ended
|
|
};
|
|
// Builds a structure with info about the "current" range, the range that is
|
|
// highlighted as being the current month for example.
|
|
// See build() for a description of `direction`.
|
|
// Guaranteed to have `range` and `unit` properties. `duration` is optional.
|
|
DateProfileGenerator.prototype.buildCurrentRangeInfo = function (date, direction) {
|
|
var props = this.props;
|
|
var duration = null;
|
|
var unit = null;
|
|
var range = null;
|
|
var dayCount;
|
|
if (props.duration) {
|
|
duration = props.duration;
|
|
unit = props.durationUnit;
|
|
range = this.buildRangeFromDuration(date, direction, duration, unit);
|
|
}
|
|
else if ((dayCount = this.props.dayCount)) {
|
|
unit = 'day';
|
|
range = this.buildRangeFromDayCount(date, direction, dayCount);
|
|
}
|
|
else if ((range = this.buildCustomVisibleRange(date))) {
|
|
unit = props.dateEnv.greatestWholeUnit(range.start, range.end).unit;
|
|
}
|
|
else {
|
|
duration = this.getFallbackDuration();
|
|
unit = greatestDurationDenominator(duration).unit;
|
|
range = this.buildRangeFromDuration(date, direction, duration, unit);
|
|
}
|
|
return { duration: duration, unit: unit, range: range };
|
|
};
|
|
DateProfileGenerator.prototype.getFallbackDuration = function () {
|
|
return createDuration({ day: 1 });
|
|
};
|
|
// Returns a new activeRange to have time values (un-ambiguate)
|
|
// slotMinTime or slotMaxTime causes the range to expand.
|
|
DateProfileGenerator.prototype.adjustActiveRange = function (range) {
|
|
var _a = this.props, dateEnv = _a.dateEnv, usesMinMaxTime = _a.usesMinMaxTime, slotMinTime = _a.slotMinTime, slotMaxTime = _a.slotMaxTime;
|
|
var start = range.start, end = range.end;
|
|
if (usesMinMaxTime) {
|
|
// expand active range if slotMinTime is negative (why not when positive?)
|
|
if (asRoughDays(slotMinTime) < 0) {
|
|
start = startOfDay(start); // necessary?
|
|
start = dateEnv.add(start, slotMinTime);
|
|
}
|
|
// expand active range if slotMaxTime is beyond one day (why not when negative?)
|
|
if (asRoughDays(slotMaxTime) > 1) {
|
|
end = startOfDay(end); // necessary?
|
|
end = addDays(end, -1);
|
|
end = dateEnv.add(end, slotMaxTime);
|
|
}
|
|
}
|
|
return { start: start, end: end };
|
|
};
|
|
// Builds the "current" range when it is specified as an explicit duration.
|
|
// `unit` is the already-computed greatestDurationDenominator unit of duration.
|
|
DateProfileGenerator.prototype.buildRangeFromDuration = function (date, direction, duration, unit) {
|
|
var _a = this.props, dateEnv = _a.dateEnv, dateAlignment = _a.dateAlignment;
|
|
var start;
|
|
var end;
|
|
var res;
|
|
// compute what the alignment should be
|
|
if (!dateAlignment) {
|
|
var dateIncrement = this.props.dateIncrement;
|
|
if (dateIncrement) {
|
|
// use the smaller of the two units
|
|
if (asRoughMs(dateIncrement) < asRoughMs(duration)) {
|
|
dateAlignment = greatestDurationDenominator(dateIncrement).unit;
|
|
}
|
|
else {
|
|
dateAlignment = unit;
|
|
}
|
|
}
|
|
else {
|
|
dateAlignment = unit;
|
|
}
|
|
}
|
|
// if the view displays a single day or smaller
|
|
if (asRoughDays(duration) <= 1) {
|
|
if (this.isHiddenDay(start)) {
|
|
start = this.skipHiddenDays(start, direction);
|
|
start = startOfDay(start);
|
|
}
|
|
}
|
|
function computeRes() {
|
|
start = dateEnv.startOf(date, dateAlignment);
|
|
end = dateEnv.add(start, duration);
|
|
res = { start: start, end: end };
|
|
}
|
|
computeRes();
|
|
// if range is completely enveloped by hidden days, go past the hidden days
|
|
if (!this.trimHiddenDays(res)) {
|
|
date = this.skipHiddenDays(date, direction);
|
|
computeRes();
|
|
}
|
|
return res;
|
|
};
|
|
// Builds the "current" range when a dayCount is specified.
|
|
DateProfileGenerator.prototype.buildRangeFromDayCount = function (date, direction, dayCount) {
|
|
var _a = this.props, dateEnv = _a.dateEnv, dateAlignment = _a.dateAlignment;
|
|
var runningCount = 0;
|
|
var start = date;
|
|
var end;
|
|
if (dateAlignment) {
|
|
start = dateEnv.startOf(start, dateAlignment);
|
|
}
|
|
start = startOfDay(start);
|
|
start = this.skipHiddenDays(start, direction);
|
|
end = start;
|
|
do {
|
|
end = addDays(end, 1);
|
|
if (!this.isHiddenDay(end)) {
|
|
runningCount += 1;
|
|
}
|
|
} while (runningCount < dayCount);
|
|
return { start: start, end: end };
|
|
};
|
|
// Builds a normalized range object for the "visible" range,
|
|
// which is a way to define the currentRange and activeRange at the same time.
|
|
DateProfileGenerator.prototype.buildCustomVisibleRange = function (date) {
|
|
var props = this.props;
|
|
var input = props.visibleRangeInput;
|
|
var simpleInput = typeof input === 'function'
|
|
? input.call(props.calendarApi, props.dateEnv.toDate(date))
|
|
: input;
|
|
var range = this.refineRange(simpleInput);
|
|
if (range && (range.start == null || range.end == null)) {
|
|
return null;
|
|
}
|
|
return range;
|
|
};
|
|
// Computes the range that will represent the element/cells for *rendering*,
|
|
// but which may have voided days/times.
|
|
// not responsible for trimming hidden days.
|
|
DateProfileGenerator.prototype.buildRenderRange = function (currentRange, currentRangeUnit, isRangeAllDay) {
|
|
return currentRange;
|
|
};
|
|
// Compute the duration value that should be added/substracted to the current date
|
|
// when a prev/next operation happens.
|
|
DateProfileGenerator.prototype.buildDateIncrement = function (fallback) {
|
|
var dateIncrement = this.props.dateIncrement;
|
|
var customAlignment;
|
|
if (dateIncrement) {
|
|
return dateIncrement;
|
|
}
|
|
if ((customAlignment = this.props.dateAlignment)) {
|
|
return createDuration(1, customAlignment);
|
|
}
|
|
if (fallback) {
|
|
return fallback;
|
|
}
|
|
return createDuration({ days: 1 });
|
|
};
|
|
DateProfileGenerator.prototype.refineRange = function (rangeInput) {
|
|
if (rangeInput) {
|
|
var range = parseRange(rangeInput, this.props.dateEnv);
|
|
if (range) {
|
|
range = computeVisibleDayRange(range);
|
|
}
|
|
return range;
|
|
}
|
|
return null;
|
|
};
|
|
/* Hidden Days
|
|
------------------------------------------------------------------------------------------------------------------*/
|
|
// Initializes internal variables related to calculating hidden days-of-week
|
|
DateProfileGenerator.prototype.initHiddenDays = function () {
|
|
var hiddenDays = this.props.hiddenDays || []; // array of day-of-week indices that are hidden
|
|
var isHiddenDayHash = []; // is the day-of-week hidden? (hash with day-of-week-index -> bool)
|
|
var dayCnt = 0;
|
|
var i;
|
|
if (this.props.weekends === false) {
|
|
hiddenDays.push(0, 6); // 0=sunday, 6=saturday
|
|
}
|
|
for (i = 0; i < 7; i += 1) {
|
|
if (!(isHiddenDayHash[i] = hiddenDays.indexOf(i) !== -1)) {
|
|
dayCnt += 1;
|
|
}
|
|
}
|
|
if (!dayCnt) {
|
|
throw new Error('invalid hiddenDays'); // all days were hidden? bad.
|
|
}
|
|
this.isHiddenDayHash = isHiddenDayHash;
|
|
};
|
|
// Remove days from the beginning and end of the range that are computed as hidden.
|
|
// If the whole range is trimmed off, returns null
|
|
DateProfileGenerator.prototype.trimHiddenDays = function (range) {
|
|
var start = range.start, end = range.end;
|
|
if (start) {
|
|
start = this.skipHiddenDays(start);
|
|
}
|
|
if (end) {
|
|
end = this.skipHiddenDays(end, -1, true);
|
|
}
|
|
if (start == null || end == null || start < end) {
|
|
return { start: start, end: end };
|
|
}
|
|
return null;
|
|
};
|
|
// Is the current day hidden?
|
|
// `day` is a day-of-week index (0-6), or a Date (used for UTC)
|
|
DateProfileGenerator.prototype.isHiddenDay = function (day) {
|
|
if (day instanceof Date) {
|
|
day = day.getUTCDay();
|
|
}
|
|
return this.isHiddenDayHash[day];
|
|
};
|
|
// Incrementing the current day until it is no longer a hidden day, returning a copy.
|
|
// DOES NOT CONSIDER validRange!
|
|
// If the initial value of `date` is not a hidden day, don't do anything.
|
|
// Pass `isExclusive` as `true` if you are dealing with an end date.
|
|
// `inc` defaults to `1` (increment one day forward each time)
|
|
DateProfileGenerator.prototype.skipHiddenDays = function (date, inc, isExclusive) {
|
|
if (inc === void 0) { inc = 1; }
|
|
if (isExclusive === void 0) { isExclusive = false; }
|
|
while (this.isHiddenDayHash[(date.getUTCDay() + (isExclusive ? inc : 0) + 7) % 7]) {
|
|
date = addDays(date, inc);
|
|
}
|
|
return date;
|
|
};
|
|
return DateProfileGenerator;
|
|
}());
|
|
|
|
function reduceViewType(viewType, action) {
|
|
switch (action.type) {
|
|
case 'CHANGE_VIEW_TYPE':
|
|
viewType = action.viewType;
|
|
}
|
|
return viewType;
|
|
}
|
|
|
|
function reduceDynamicOptionOverrides(dynamicOptionOverrides, action) {
|
|
var _a;
|
|
switch (action.type) {
|
|
case 'SET_OPTION':
|
|
return __assign(__assign({}, dynamicOptionOverrides), (_a = {}, _a[action.optionName] = action.rawOptionValue, _a));
|
|
default:
|
|
return dynamicOptionOverrides;
|
|
}
|
|
}
|
|
|
|
function reduceDateProfile(currentDateProfile, action, currentDate, dateProfileGenerator) {
|
|
var dp;
|
|
switch (action.type) {
|
|
case 'CHANGE_VIEW_TYPE':
|
|
return dateProfileGenerator.build(action.dateMarker || currentDate);
|
|
case 'CHANGE_DATE':
|
|
return dateProfileGenerator.build(action.dateMarker);
|
|
case 'PREV':
|
|
dp = dateProfileGenerator.buildPrev(currentDateProfile, currentDate);
|
|
if (dp.isValid) {
|
|
return dp;
|
|
}
|
|
break;
|
|
case 'NEXT':
|
|
dp = dateProfileGenerator.buildNext(currentDateProfile, currentDate);
|
|
if (dp.isValid) {
|
|
return dp;
|
|
}
|
|
break;
|
|
}
|
|
return currentDateProfile;
|
|
}
|
|
|
|
function initEventSources(calendarOptions, dateProfile, context) {
|
|
var activeRange = dateProfile ? dateProfile.activeRange : null;
|
|
return addSources({}, parseInitialSources(calendarOptions, context), activeRange, context);
|
|
}
|
|
function reduceEventSources(eventSources, action, dateProfile, context) {
|
|
var activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
|
|
switch (action.type) {
|
|
case 'ADD_EVENT_SOURCES': // already parsed
|
|
return addSources(eventSources, action.sources, activeRange, context);
|
|
case 'REMOVE_EVENT_SOURCE':
|
|
return removeSource(eventSources, action.sourceId);
|
|
case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
|
|
case 'NEXT':
|
|
case 'CHANGE_DATE':
|
|
case 'CHANGE_VIEW_TYPE':
|
|
if (dateProfile) {
|
|
return fetchDirtySources(eventSources, activeRange, context);
|
|
}
|
|
return eventSources;
|
|
case 'FETCH_EVENT_SOURCES':
|
|
return fetchSourcesByIds(eventSources, action.sourceIds ? // why no type?
|
|
arrayToHash(action.sourceIds) :
|
|
excludeStaticSources(eventSources, context), activeRange, action.isRefetch || false, context);
|
|
case 'RECEIVE_EVENTS':
|
|
case 'RECEIVE_EVENT_ERROR':
|
|
return receiveResponse$1(eventSources, action.sourceId, action.fetchId, action.fetchRange);
|
|
case 'REMOVE_ALL_EVENT_SOURCES':
|
|
return {};
|
|
default:
|
|
return eventSources;
|
|
}
|
|
}
|
|
function reduceEventSourcesNewTimeZone(eventSources, dateProfile, context) {
|
|
var activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
|
|
return fetchSourcesByIds(eventSources, excludeStaticSources(eventSources, context), activeRange, true, context);
|
|
}
|
|
function computeEventSourcesLoading(eventSources) {
|
|
for (var sourceId in eventSources) {
|
|
if (eventSources[sourceId].isFetching) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function addSources(eventSourceHash, sources, fetchRange, context) {
|
|
var hash = {};
|
|
for (var _i = 0, sources_1 = sources; _i < sources_1.length; _i++) {
|
|
var source = sources_1[_i];
|
|
hash[source.sourceId] = source;
|
|
}
|
|
if (fetchRange) {
|
|
hash = fetchDirtySources(hash, fetchRange, context);
|
|
}
|
|
return __assign(__assign({}, eventSourceHash), hash);
|
|
}
|
|
function removeSource(eventSourceHash, sourceId) {
|
|
return filterHash(eventSourceHash, function (eventSource) { return eventSource.sourceId !== sourceId; });
|
|
}
|
|
function fetchDirtySources(sourceHash, fetchRange, context) {
|
|
return fetchSourcesByIds(sourceHash, filterHash(sourceHash, function (eventSource) { return isSourceDirty(eventSource, fetchRange, context); }), fetchRange, false, context);
|
|
}
|
|
function isSourceDirty(eventSource, fetchRange, context) {
|
|
if (!doesSourceNeedRange(eventSource, context)) {
|
|
return !eventSource.latestFetchId;
|
|
}
|
|
return !context.options.lazyFetching ||
|
|
!eventSource.fetchRange ||
|
|
eventSource.isFetching || // always cancel outdated in-progress fetches
|
|
fetchRange.start < eventSource.fetchRange.start ||
|
|
fetchRange.end > eventSource.fetchRange.end;
|
|
}
|
|
function fetchSourcesByIds(prevSources, sourceIdHash, fetchRange, isRefetch, context) {
|
|
var nextSources = {};
|
|
for (var sourceId in prevSources) {
|
|
var source = prevSources[sourceId];
|
|
if (sourceIdHash[sourceId]) {
|
|
nextSources[sourceId] = fetchSource$1(source, fetchRange, isRefetch, context);
|
|
}
|
|
else {
|
|
nextSources[sourceId] = source;
|
|
}
|
|
}
|
|
return nextSources;
|
|
}
|
|
function fetchSource$1(eventSource, fetchRange, isRefetch, context) {
|
|
var options = context.options, calendarApi = context.calendarApi;
|
|
var sourceDef = context.pluginHooks.eventSourceDefs[eventSource.sourceDefId];
|
|
var fetchId = guid();
|
|
sourceDef.fetch({
|
|
eventSource: eventSource,
|
|
range: fetchRange,
|
|
isRefetch: isRefetch,
|
|
context: context,
|
|
}, function (res) {
|
|
var rawEvents = res.rawEvents;
|
|
if (options.eventSourceSuccess) {
|
|
rawEvents = options.eventSourceSuccess.call(calendarApi, rawEvents, res.xhr) || rawEvents;
|
|
}
|
|
if (eventSource.success) {
|
|
rawEvents = eventSource.success.call(calendarApi, rawEvents, res.xhr) || rawEvents;
|
|
}
|
|
context.dispatch({
|
|
type: 'RECEIVE_EVENTS',
|
|
sourceId: eventSource.sourceId,
|
|
fetchId: fetchId,
|
|
fetchRange: fetchRange,
|
|
rawEvents: rawEvents,
|
|
});
|
|
}, function (error) {
|
|
console.warn(error.message, error);
|
|
if (options.eventSourceFailure) {
|
|
options.eventSourceFailure.call(calendarApi, error);
|
|
}
|
|
if (eventSource.failure) {
|
|
eventSource.failure(error);
|
|
}
|
|
context.dispatch({
|
|
type: 'RECEIVE_EVENT_ERROR',
|
|
sourceId: eventSource.sourceId,
|
|
fetchId: fetchId,
|
|
fetchRange: fetchRange,
|
|
error: error,
|
|
});
|
|
});
|
|
return __assign(__assign({}, eventSource), { isFetching: true, latestFetchId: fetchId });
|
|
}
|
|
function receiveResponse$1(sourceHash, sourceId, fetchId, fetchRange) {
|
|
var _a;
|
|
var eventSource = sourceHash[sourceId];
|
|
if (eventSource && // not already removed
|
|
fetchId === eventSource.latestFetchId) {
|
|
return __assign(__assign({}, sourceHash), (_a = {}, _a[sourceId] = __assign(__assign({}, eventSource), { isFetching: false, fetchRange: fetchRange }), _a));
|
|
}
|
|
return sourceHash;
|
|
}
|
|
function excludeStaticSources(eventSources, context) {
|
|
return filterHash(eventSources, function (eventSource) { return doesSourceNeedRange(eventSource, context); });
|
|
}
|
|
function parseInitialSources(rawOptions, context) {
|
|
var refiners = buildEventSourceRefiners(context);
|
|
var rawSources = [].concat(rawOptions.eventSources || []);
|
|
var sources = []; // parsed
|
|
if (rawOptions.initialEvents) {
|
|
rawSources.unshift(rawOptions.initialEvents);
|
|
}
|
|
if (rawOptions.events) {
|
|
rawSources.unshift(rawOptions.events);
|
|
}
|
|
for (var _i = 0, rawSources_1 = rawSources; _i < rawSources_1.length; _i++) {
|
|
var rawSource = rawSources_1[_i];
|
|
var source = parseEventSource(rawSource, context, refiners);
|
|
if (source) {
|
|
sources.push(source);
|
|
}
|
|
}
|
|
return sources;
|
|
}
|
|
function doesSourceNeedRange(eventSource, context) {
|
|
var defs = context.pluginHooks.eventSourceDefs;
|
|
return !defs[eventSource.sourceDefId].ignoreRange;
|
|
}
|
|
|
|
function reduceEventStore(eventStore, action, eventSources, dateProfile, context) {
|
|
switch (action.type) {
|
|
case 'RECEIVE_EVENTS': // raw
|
|
return receiveRawEvents(eventStore, eventSources[action.sourceId], action.fetchId, action.fetchRange, action.rawEvents, context);
|
|
case 'ADD_EVENTS': // already parsed, but not expanded
|
|
return addEvent(eventStore, action.eventStore, // new ones
|
|
dateProfile ? dateProfile.activeRange : null, context);
|
|
case 'RESET_EVENTS':
|
|
return action.eventStore;
|
|
case 'MERGE_EVENTS': // already parsed and expanded
|
|
return mergeEventStores(eventStore, action.eventStore);
|
|
case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
|
|
case 'NEXT':
|
|
case 'CHANGE_DATE':
|
|
case 'CHANGE_VIEW_TYPE':
|
|
if (dateProfile) {
|
|
return expandRecurring(eventStore, dateProfile.activeRange, context);
|
|
}
|
|
return eventStore;
|
|
case 'REMOVE_EVENTS':
|
|
return excludeSubEventStore(eventStore, action.eventStore);
|
|
case 'REMOVE_EVENT_SOURCE':
|
|
return excludeEventsBySourceId(eventStore, action.sourceId);
|
|
case 'REMOVE_ALL_EVENT_SOURCES':
|
|
return filterEventStoreDefs(eventStore, function (eventDef) { return (!eventDef.sourceId // only keep events with no source id
|
|
); });
|
|
case 'REMOVE_ALL_EVENTS':
|
|
return createEmptyEventStore();
|
|
default:
|
|
return eventStore;
|
|
}
|
|
}
|
|
function receiveRawEvents(eventStore, eventSource, fetchId, fetchRange, rawEvents, context) {
|
|
if (eventSource && // not already removed
|
|
fetchId === eventSource.latestFetchId // TODO: wish this logic was always in event-sources
|
|
) {
|
|
var subset = parseEvents(transformRawEvents(rawEvents, eventSource, context), eventSource, context);
|
|
if (fetchRange) {
|
|
subset = expandRecurring(subset, fetchRange, context);
|
|
}
|
|
return mergeEventStores(excludeEventsBySourceId(eventStore, eventSource.sourceId), subset);
|
|
}
|
|
return eventStore;
|
|
}
|
|
function transformRawEvents(rawEvents, eventSource, context) {
|
|
var calEachTransform = context.options.eventDataTransform;
|
|
var sourceEachTransform = eventSource ? eventSource.eventDataTransform : null;
|
|
if (sourceEachTransform) {
|
|
rawEvents = transformEachRawEvent(rawEvents, sourceEachTransform);
|
|
}
|
|
if (calEachTransform) {
|
|
rawEvents = transformEachRawEvent(rawEvents, calEachTransform);
|
|
}
|
|
return rawEvents;
|
|
}
|
|
function transformEachRawEvent(rawEvents, func) {
|
|
var refinedEvents;
|
|
if (!func) {
|
|
refinedEvents = rawEvents;
|
|
}
|
|
else {
|
|
refinedEvents = [];
|
|
for (var _i = 0, rawEvents_1 = rawEvents; _i < rawEvents_1.length; _i++) {
|
|
var rawEvent = rawEvents_1[_i];
|
|
var refinedEvent = func(rawEvent);
|
|
if (refinedEvent) {
|
|
refinedEvents.push(refinedEvent);
|
|
}
|
|
else if (refinedEvent == null) {
|
|
refinedEvents.push(rawEvent);
|
|
} // if a different falsy value, do nothing
|
|
}
|
|
}
|
|
return refinedEvents;
|
|
}
|
|
function addEvent(eventStore, subset, expandRange, context) {
|
|
if (expandRange) {
|
|
subset = expandRecurring(subset, expandRange, context);
|
|
}
|
|
return mergeEventStores(eventStore, subset);
|
|
}
|
|
function rezoneEventStoreDates(eventStore, oldDateEnv, newDateEnv) {
|
|
var defs = eventStore.defs;
|
|
var instances = mapHash(eventStore.instances, function (instance) {
|
|
var def = defs[instance.defId];
|
|
if (def.allDay || def.recurringDef) {
|
|
return instance; // isn't dependent on timezone
|
|
}
|
|
return __assign(__assign({}, instance), { range: {
|
|
start: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.start, instance.forcedStartTzo)),
|
|
end: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.end, instance.forcedEndTzo)),
|
|
}, forcedStartTzo: newDateEnv.canComputeOffset ? null : instance.forcedStartTzo, forcedEndTzo: newDateEnv.canComputeOffset ? null : instance.forcedEndTzo });
|
|
});
|
|
return { defs: defs, instances: instances };
|
|
}
|
|
function excludeEventsBySourceId(eventStore, sourceId) {
|
|
return filterEventStoreDefs(eventStore, function (eventDef) { return eventDef.sourceId !== sourceId; });
|
|
}
|
|
// QUESTION: why not just return instances? do a general object-property-exclusion util
|
|
function excludeInstances(eventStore, removals) {
|
|
return {
|
|
defs: eventStore.defs,
|
|
instances: filterHash(eventStore.instances, function (instance) { return !removals[instance.instanceId]; }),
|
|
};
|
|
}
|
|
|
|
function reduceDateSelection(currentSelection, action) {
|
|
switch (action.type) {
|
|
case 'UNSELECT_DATES':
|
|
return null;
|
|
case 'SELECT_DATES':
|
|
return action.selection;
|
|
default:
|
|
return currentSelection;
|
|
}
|
|
}
|
|
|
|
function reduceSelectedEvent(currentInstanceId, action) {
|
|
switch (action.type) {
|
|
case 'UNSELECT_EVENT':
|
|
return '';
|
|
case 'SELECT_EVENT':
|
|
return action.eventInstanceId;
|
|
default:
|
|
return currentInstanceId;
|
|
}
|
|
}
|
|
|
|
function reduceEventDrag(currentDrag, action) {
|
|
var newDrag;
|
|
switch (action.type) {
|
|
case 'UNSET_EVENT_DRAG':
|
|
return null;
|
|
case 'SET_EVENT_DRAG':
|
|
newDrag = action.state;
|
|
return {
|
|
affectedEvents: newDrag.affectedEvents,
|
|
mutatedEvents: newDrag.mutatedEvents,
|
|
isEvent: newDrag.isEvent,
|
|
};
|
|
default:
|
|
return currentDrag;
|
|
}
|
|
}
|
|
|
|
function reduceEventResize(currentResize, action) {
|
|
var newResize;
|
|
switch (action.type) {
|
|
case 'UNSET_EVENT_RESIZE':
|
|
return null;
|
|
case 'SET_EVENT_RESIZE':
|
|
newResize = action.state;
|
|
return {
|
|
affectedEvents: newResize.affectedEvents,
|
|
mutatedEvents: newResize.mutatedEvents,
|
|
isEvent: newResize.isEvent,
|
|
};
|
|
default:
|
|
return currentResize;
|
|
}
|
|
}
|
|
|
|
function parseToolbars(calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) {
|
|
var header = calendarOptions.headerToolbar ? parseToolbar(calendarOptions.headerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) : null;
|
|
var footer = calendarOptions.footerToolbar ? parseToolbar(calendarOptions.footerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) : null;
|
|
return { header: header, footer: footer };
|
|
}
|
|
function parseToolbar(sectionStrHash, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) {
|
|
var sectionWidgets = {};
|
|
var viewsWithButtons = [];
|
|
var hasTitle = false;
|
|
for (var sectionName in sectionStrHash) {
|
|
var sectionStr = sectionStrHash[sectionName];
|
|
var sectionRes = parseSection(sectionStr, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi);
|
|
sectionWidgets[sectionName] = sectionRes.widgets;
|
|
viewsWithButtons.push.apply(viewsWithButtons, sectionRes.viewsWithButtons);
|
|
hasTitle = hasTitle || sectionRes.hasTitle;
|
|
}
|
|
return { sectionWidgets: sectionWidgets, viewsWithButtons: viewsWithButtons, hasTitle: hasTitle };
|
|
}
|
|
/*
|
|
BAD: querying icons and text here. should be done at render time
|
|
*/
|
|
function parseSection(sectionStr, calendarOptions, // defaults+overrides, then refined
|
|
calendarOptionOverrides, // overrides only!, unrefined :(
|
|
theme, viewSpecs, calendarApi) {
|
|
var isRtl = calendarOptions.direction === 'rtl';
|
|
var calendarCustomButtons = calendarOptions.customButtons || {};
|
|
var calendarButtonTextOverrides = calendarOptionOverrides.buttonText || {};
|
|
var calendarButtonText = calendarOptions.buttonText || {};
|
|
var calendarButtonHintOverrides = calendarOptionOverrides.buttonHints || {};
|
|
var calendarButtonHints = calendarOptions.buttonHints || {};
|
|
var sectionSubstrs = sectionStr ? sectionStr.split(' ') : [];
|
|
var viewsWithButtons = [];
|
|
var hasTitle = false;
|
|
var widgets = sectionSubstrs.map(function (buttonGroupStr) { return (buttonGroupStr.split(',').map(function (buttonName) {
|
|
if (buttonName === 'title') {
|
|
hasTitle = true;
|
|
return { buttonName: buttonName };
|
|
}
|
|
var customButtonProps;
|
|
var viewSpec;
|
|
var buttonClick;
|
|
var buttonIcon; // only one of these will be set
|
|
var buttonText; // "
|
|
var buttonHint;
|
|
// ^ for the title="" attribute, for accessibility
|
|
if ((customButtonProps = calendarCustomButtons[buttonName])) {
|
|
buttonClick = function (ev) {
|
|
if (customButtonProps.click) {
|
|
customButtonProps.click.call(ev.target, ev, ev.target); // TODO: use Calendar this context?
|
|
}
|
|
};
|
|
(buttonIcon = theme.getCustomButtonIconClass(customButtonProps)) ||
|
|
(buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
|
|
(buttonText = customButtonProps.text);
|
|
buttonHint = customButtonProps.hint || customButtonProps.text;
|
|
}
|
|
else if ((viewSpec = viewSpecs[buttonName])) {
|
|
viewsWithButtons.push(buttonName);
|
|
buttonClick = function () {
|
|
calendarApi.changeView(buttonName);
|
|
};
|
|
(buttonText = viewSpec.buttonTextOverride) ||
|
|
(buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
|
|
(buttonText = viewSpec.buttonTextDefault);
|
|
var textFallback = viewSpec.buttonTextOverride ||
|
|
viewSpec.buttonTextDefault;
|
|
buttonHint = formatWithOrdinals(viewSpec.buttonTitleOverride ||
|
|
viewSpec.buttonTitleDefault ||
|
|
calendarOptions.viewHint, [textFallback, buttonName], // view-name = buttonName
|
|
textFallback);
|
|
}
|
|
else if (calendarApi[buttonName]) { // a calendarApi method
|
|
buttonClick = function () {
|
|
calendarApi[buttonName]();
|
|
};
|
|
(buttonText = calendarButtonTextOverrides[buttonName]) ||
|
|
(buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
|
|
(buttonText = calendarButtonText[buttonName]); // everything else is considered default
|
|
if (buttonName === 'prevYear' || buttonName === 'nextYear') {
|
|
var prevOrNext = buttonName === 'prevYear' ? 'prev' : 'next';
|
|
buttonHint = formatWithOrdinals(calendarButtonHintOverrides[prevOrNext] ||
|
|
calendarButtonHints[prevOrNext], [
|
|
calendarButtonText.year || 'year',
|
|
'year',
|
|
], calendarButtonText[buttonName]);
|
|
}
|
|
else {
|
|
buttonHint = function (navUnit) { return formatWithOrdinals(calendarButtonHintOverrides[buttonName] ||
|
|
calendarButtonHints[buttonName], [
|
|
calendarButtonText[navUnit] || navUnit,
|
|
navUnit,
|
|
], calendarButtonText[buttonName]); };
|
|
}
|
|
}
|
|
return { buttonName: buttonName, buttonClick: buttonClick, buttonIcon: buttonIcon, buttonText: buttonText, buttonHint: buttonHint };
|
|
})); });
|
|
return { widgets: widgets, viewsWithButtons: viewsWithButtons, hasTitle: hasTitle };
|
|
}
|
|
|
|
var eventSourceDef$3 = {
|
|
ignoreRange: true,
|
|
parseMeta: function (refined) {
|
|
if (Array.isArray(refined.events)) {
|
|
return refined.events;
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, success) {
|
|
success({
|
|
rawEvents: arg.eventSource.meta,
|
|
});
|
|
},
|
|
};
|
|
var arrayEventSourcePlugin = createPlugin({
|
|
eventSourceDefs: [eventSourceDef$3],
|
|
});
|
|
|
|
var eventSourceDef$2 = {
|
|
parseMeta: function (refined) {
|
|
if (typeof refined.events === 'function') {
|
|
return refined.events;
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, success, failure) {
|
|
var dateEnv = arg.context.dateEnv;
|
|
var func = arg.eventSource.meta;
|
|
unpromisify(func.bind(null, buildRangeApiWithTimeZone(arg.range, dateEnv)), function (rawEvents) {
|
|
success({ rawEvents: rawEvents }); // needs an object response
|
|
}, failure);
|
|
},
|
|
};
|
|
var funcEventSourcePlugin = createPlugin({
|
|
eventSourceDefs: [eventSourceDef$2],
|
|
});
|
|
|
|
function requestJson(method, url, params, successCallback, failureCallback) {
|
|
method = method.toUpperCase();
|
|
var body = null;
|
|
if (method === 'GET') {
|
|
url = injectQueryStringParams(url, params);
|
|
}
|
|
else {
|
|
body = encodeParams(params);
|
|
}
|
|
var xhr = new XMLHttpRequest();
|
|
xhr.open(method, url, true);
|
|
if (method !== 'GET') {
|
|
xhr.setRequestHeader('Content-Type', 'application/x-www-form-urlencoded');
|
|
}
|
|
xhr.onload = function () {
|
|
if (xhr.status >= 200 && xhr.status < 400) {
|
|
var parsed = false;
|
|
var res = void 0;
|
|
try {
|
|
res = JSON.parse(xhr.responseText);
|
|
parsed = true;
|
|
}
|
|
catch (err) {
|
|
// will handle parsed=false
|
|
}
|
|
if (parsed) {
|
|
successCallback(res, xhr);
|
|
}
|
|
else {
|
|
failureCallback('Failure parsing JSON', xhr);
|
|
}
|
|
}
|
|
else {
|
|
failureCallback('Request failed', xhr);
|
|
}
|
|
};
|
|
xhr.onerror = function () {
|
|
failureCallback('Request failed', xhr);
|
|
};
|
|
xhr.send(body);
|
|
}
|
|
function injectQueryStringParams(url, params) {
|
|
return url +
|
|
(url.indexOf('?') === -1 ? '?' : '&') +
|
|
encodeParams(params);
|
|
}
|
|
function encodeParams(params) {
|
|
var parts = [];
|
|
for (var key in params) {
|
|
parts.push(encodeURIComponent(key) + "=" + encodeURIComponent(params[key]));
|
|
}
|
|
return parts.join('&');
|
|
}
|
|
|
|
var JSON_FEED_EVENT_SOURCE_REFINERS = {
|
|
method: String,
|
|
extraParams: identity,
|
|
startParam: String,
|
|
endParam: String,
|
|
timeZoneParam: String,
|
|
};
|
|
|
|
var eventSourceDef$1 = {
|
|
parseMeta: function (refined) {
|
|
if (refined.url && (refined.format === 'json' || !refined.format)) {
|
|
return {
|
|
url: refined.url,
|
|
format: 'json',
|
|
method: (refined.method || 'GET').toUpperCase(),
|
|
extraParams: refined.extraParams,
|
|
startParam: refined.startParam,
|
|
endParam: refined.endParam,
|
|
timeZoneParam: refined.timeZoneParam,
|
|
};
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, success, failure) {
|
|
var meta = arg.eventSource.meta;
|
|
var requestParams = buildRequestParams$2(meta, arg.range, arg.context);
|
|
requestJson(meta.method, meta.url, requestParams, function (rawEvents, xhr) {
|
|
success({ rawEvents: rawEvents, xhr: xhr });
|
|
}, function (errorMessage, xhr) {
|
|
failure({ message: errorMessage, xhr: xhr });
|
|
});
|
|
},
|
|
};
|
|
var jsonFeedEventSourcePlugin = createPlugin({
|
|
eventSourceRefiners: JSON_FEED_EVENT_SOURCE_REFINERS,
|
|
eventSourceDefs: [eventSourceDef$1],
|
|
});
|
|
function buildRequestParams$2(meta, range, context) {
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var startParam;
|
|
var endParam;
|
|
var timeZoneParam;
|
|
var customRequestParams;
|
|
var params = {};
|
|
startParam = meta.startParam;
|
|
if (startParam == null) {
|
|
startParam = options.startParam;
|
|
}
|
|
endParam = meta.endParam;
|
|
if (endParam == null) {
|
|
endParam = options.endParam;
|
|
}
|
|
timeZoneParam = meta.timeZoneParam;
|
|
if (timeZoneParam == null) {
|
|
timeZoneParam = options.timeZoneParam;
|
|
}
|
|
// retrieve any outbound GET/POST data from the options
|
|
if (typeof meta.extraParams === 'function') {
|
|
// supplied as a function that returns a key/value object
|
|
customRequestParams = meta.extraParams();
|
|
}
|
|
else {
|
|
// probably supplied as a straight key/value object
|
|
customRequestParams = meta.extraParams || {};
|
|
}
|
|
__assign(params, customRequestParams);
|
|
params[startParam] = dateEnv.formatIso(range.start);
|
|
params[endParam] = dateEnv.formatIso(range.end);
|
|
if (dateEnv.timeZone !== 'local') {
|
|
params[timeZoneParam] = dateEnv.timeZone;
|
|
}
|
|
return params;
|
|
}
|
|
|
|
var SIMPLE_RECURRING_REFINERS = {
|
|
daysOfWeek: identity,
|
|
startTime: createDuration,
|
|
endTime: createDuration,
|
|
duration: createDuration,
|
|
startRecur: identity,
|
|
endRecur: identity,
|
|
};
|
|
|
|
var recurring = {
|
|
parse: function (refined, dateEnv) {
|
|
if (refined.daysOfWeek || refined.startTime || refined.endTime || refined.startRecur || refined.endRecur) {
|
|
var recurringData = {
|
|
daysOfWeek: refined.daysOfWeek || null,
|
|
startTime: refined.startTime || null,
|
|
endTime: refined.endTime || null,
|
|
startRecur: refined.startRecur ? dateEnv.createMarker(refined.startRecur) : null,
|
|
endRecur: refined.endRecur ? dateEnv.createMarker(refined.endRecur) : null,
|
|
};
|
|
var duration = void 0;
|
|
if (refined.duration) {
|
|
duration = refined.duration;
|
|
}
|
|
if (!duration && refined.startTime && refined.endTime) {
|
|
duration = subtractDurations(refined.endTime, refined.startTime);
|
|
}
|
|
return {
|
|
allDayGuess: Boolean(!refined.startTime && !refined.endTime),
|
|
duration: duration,
|
|
typeData: recurringData, // doesn't need endTime anymore but oh well
|
|
};
|
|
}
|
|
return null;
|
|
},
|
|
expand: function (typeData, framingRange, dateEnv) {
|
|
var clippedFramingRange = intersectRanges(framingRange, { start: typeData.startRecur, end: typeData.endRecur });
|
|
if (clippedFramingRange) {
|
|
return expandRanges(typeData.daysOfWeek, typeData.startTime, clippedFramingRange, dateEnv);
|
|
}
|
|
return [];
|
|
},
|
|
};
|
|
var simpleRecurringEventsPlugin = createPlugin({
|
|
recurringTypes: [recurring],
|
|
eventRefiners: SIMPLE_RECURRING_REFINERS,
|
|
});
|
|
function expandRanges(daysOfWeek, startTime, framingRange, dateEnv) {
|
|
var dowHash = daysOfWeek ? arrayToHash(daysOfWeek) : null;
|
|
var dayMarker = startOfDay(framingRange.start);
|
|
var endMarker = framingRange.end;
|
|
var instanceStarts = [];
|
|
while (dayMarker < endMarker) {
|
|
var instanceStart
|
|
// if everyday, or this particular day-of-week
|
|
= void 0;
|
|
// if everyday, or this particular day-of-week
|
|
if (!dowHash || dowHash[dayMarker.getUTCDay()]) {
|
|
if (startTime) {
|
|
instanceStart = dateEnv.add(dayMarker, startTime);
|
|
}
|
|
else {
|
|
instanceStart = dayMarker;
|
|
}
|
|
instanceStarts.push(instanceStart);
|
|
}
|
|
dayMarker = addDays(dayMarker, 1);
|
|
}
|
|
return instanceStarts;
|
|
}
|
|
|
|
var changeHandlerPlugin = createPlugin({
|
|
optionChangeHandlers: {
|
|
events: function (events, context) {
|
|
handleEventSources([events], context);
|
|
},
|
|
eventSources: handleEventSources,
|
|
},
|
|
});
|
|
/*
|
|
BUG: if `event` was supplied, all previously-given `eventSources` will be wiped out
|
|
*/
|
|
function handleEventSources(inputs, context) {
|
|
var unfoundSources = hashValuesToArray(context.getCurrentData().eventSources);
|
|
var newInputs = [];
|
|
for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
|
|
var input = inputs_1[_i];
|
|
var inputFound = false;
|
|
for (var i = 0; i < unfoundSources.length; i += 1) {
|
|
if (unfoundSources[i]._raw === input) {
|
|
unfoundSources.splice(i, 1); // delete
|
|
inputFound = true;
|
|
break;
|
|
}
|
|
}
|
|
if (!inputFound) {
|
|
newInputs.push(input);
|
|
}
|
|
}
|
|
for (var _a = 0, unfoundSources_1 = unfoundSources; _a < unfoundSources_1.length; _a++) {
|
|
var unfoundSource = unfoundSources_1[_a];
|
|
context.dispatch({
|
|
type: 'REMOVE_EVENT_SOURCE',
|
|
sourceId: unfoundSource.sourceId,
|
|
});
|
|
}
|
|
for (var _b = 0, newInputs_1 = newInputs; _b < newInputs_1.length; _b++) {
|
|
var newInput = newInputs_1[_b];
|
|
context.calendarApi.addEventSource(newInput);
|
|
}
|
|
}
|
|
|
|
function handleDateProfile(dateProfile, context) {
|
|
context.emitter.trigger('datesSet', __assign(__assign({}, buildRangeApiWithTimeZone(dateProfile.activeRange, context.dateEnv)), { view: context.viewApi }));
|
|
}
|
|
|
|
function handleEventStore(eventStore, context) {
|
|
var emitter = context.emitter;
|
|
if (emitter.hasHandlers('eventsSet')) {
|
|
emitter.trigger('eventsSet', buildEventApis(eventStore, context));
|
|
}
|
|
}
|
|
|
|
/*
|
|
this array is exposed on the root namespace so that UMD plugins can add to it.
|
|
see the rollup-bundles script.
|
|
*/
|
|
var globalPlugins = [
|
|
arrayEventSourcePlugin,
|
|
funcEventSourcePlugin,
|
|
jsonFeedEventSourcePlugin,
|
|
simpleRecurringEventsPlugin,
|
|
changeHandlerPlugin,
|
|
createPlugin({
|
|
isLoadingFuncs: [
|
|
function (state) { return computeEventSourcesLoading(state.eventSources); },
|
|
],
|
|
contentTypeHandlers: {
|
|
html: buildHtmlRenderer,
|
|
domNodes: buildDomNodeRenderer,
|
|
},
|
|
propSetHandlers: {
|
|
dateProfile: handleDateProfile,
|
|
eventStore: handleEventStore,
|
|
},
|
|
}),
|
|
];
|
|
function buildHtmlRenderer() {
|
|
var currentEl = null;
|
|
var currentHtml = '';
|
|
function render(el, html) {
|
|
if (el !== currentEl || html !== currentHtml) {
|
|
el.innerHTML = html;
|
|
}
|
|
currentEl = el;
|
|
currentHtml = html;
|
|
}
|
|
function destroy() {
|
|
currentEl.innerHTML = '';
|
|
currentEl = null;
|
|
currentHtml = '';
|
|
}
|
|
return { render: render, destroy: destroy };
|
|
}
|
|
function buildDomNodeRenderer() {
|
|
var currentEl = null;
|
|
var currentDomNodes = [];
|
|
function render(el, domNodes) {
|
|
var newDomNodes = Array.prototype.slice.call(domNodes);
|
|
if (el !== currentEl || !isArraysEqual(currentDomNodes, newDomNodes)) {
|
|
// append first, remove second (for scroll resetting)
|
|
for (var _i = 0, newDomNodes_1 = newDomNodes; _i < newDomNodes_1.length; _i++) {
|
|
var newNode = newDomNodes_1[_i];
|
|
el.appendChild(newNode);
|
|
}
|
|
destroy();
|
|
}
|
|
currentEl = el;
|
|
currentDomNodes = newDomNodes;
|
|
}
|
|
function destroy() {
|
|
currentDomNodes.forEach(removeElement);
|
|
currentDomNodes = [];
|
|
currentEl = null;
|
|
}
|
|
return { render: render, destroy: destroy };
|
|
}
|
|
|
|
var DelayedRunner = /** @class */ (function () {
|
|
function DelayedRunner(drainedOption) {
|
|
this.drainedOption = drainedOption;
|
|
this.isRunning = false;
|
|
this.isDirty = false;
|
|
this.pauseDepths = {};
|
|
this.timeoutId = 0;
|
|
}
|
|
DelayedRunner.prototype.request = function (delay) {
|
|
this.isDirty = true;
|
|
if (!this.isPaused()) {
|
|
this.clearTimeout();
|
|
if (delay == null) {
|
|
this.tryDrain();
|
|
}
|
|
else {
|
|
this.timeoutId = setTimeout(// NOT OPTIMAL! TODO: look at debounce
|
|
this.tryDrain.bind(this), delay);
|
|
}
|
|
}
|
|
};
|
|
DelayedRunner.prototype.pause = function (scope) {
|
|
if (scope === void 0) { scope = ''; }
|
|
var pauseDepths = this.pauseDepths;
|
|
pauseDepths[scope] = (pauseDepths[scope] || 0) + 1;
|
|
this.clearTimeout();
|
|
};
|
|
DelayedRunner.prototype.resume = function (scope, force) {
|
|
if (scope === void 0) { scope = ''; }
|
|
var pauseDepths = this.pauseDepths;
|
|
if (scope in pauseDepths) {
|
|
if (force) {
|
|
delete pauseDepths[scope];
|
|
}
|
|
else {
|
|
pauseDepths[scope] -= 1;
|
|
var depth = pauseDepths[scope];
|
|
if (depth <= 0) {
|
|
delete pauseDepths[scope];
|
|
}
|
|
}
|
|
this.tryDrain();
|
|
}
|
|
};
|
|
DelayedRunner.prototype.isPaused = function () {
|
|
return Object.keys(this.pauseDepths).length;
|
|
};
|
|
DelayedRunner.prototype.tryDrain = function () {
|
|
if (!this.isRunning && !this.isPaused()) {
|
|
this.isRunning = true;
|
|
while (this.isDirty) {
|
|
this.isDirty = false;
|
|
this.drained(); // might set isDirty to true again
|
|
}
|
|
this.isRunning = false;
|
|
}
|
|
};
|
|
DelayedRunner.prototype.clear = function () {
|
|
this.clearTimeout();
|
|
this.isDirty = false;
|
|
this.pauseDepths = {};
|
|
};
|
|
DelayedRunner.prototype.clearTimeout = function () {
|
|
if (this.timeoutId) {
|
|
clearTimeout(this.timeoutId);
|
|
this.timeoutId = 0;
|
|
}
|
|
};
|
|
DelayedRunner.prototype.drained = function () {
|
|
if (this.drainedOption) {
|
|
this.drainedOption();
|
|
}
|
|
};
|
|
return DelayedRunner;
|
|
}());
|
|
|
|
var TaskRunner = /** @class */ (function () {
|
|
function TaskRunner(runTaskOption, drainedOption) {
|
|
this.runTaskOption = runTaskOption;
|
|
this.drainedOption = drainedOption;
|
|
this.queue = [];
|
|
this.delayedRunner = new DelayedRunner(this.drain.bind(this));
|
|
}
|
|
TaskRunner.prototype.request = function (task, delay) {
|
|
this.queue.push(task);
|
|
this.delayedRunner.request(delay);
|
|
};
|
|
TaskRunner.prototype.pause = function (scope) {
|
|
this.delayedRunner.pause(scope);
|
|
};
|
|
TaskRunner.prototype.resume = function (scope, force) {
|
|
this.delayedRunner.resume(scope, force);
|
|
};
|
|
TaskRunner.prototype.drain = function () {
|
|
var queue = this.queue;
|
|
while (queue.length) {
|
|
var completedTasks = [];
|
|
var task = void 0;
|
|
while ((task = queue.shift())) {
|
|
this.runTask(task);
|
|
completedTasks.push(task);
|
|
}
|
|
this.drained(completedTasks);
|
|
} // keep going, in case new tasks were added in the drained handler
|
|
};
|
|
TaskRunner.prototype.runTask = function (task) {
|
|
if (this.runTaskOption) {
|
|
this.runTaskOption(task);
|
|
}
|
|
};
|
|
TaskRunner.prototype.drained = function (completedTasks) {
|
|
if (this.drainedOption) {
|
|
this.drainedOption(completedTasks);
|
|
}
|
|
};
|
|
return TaskRunner;
|
|
}());
|
|
|
|
// Computes what the title at the top of the calendarApi should be for this view
|
|
function buildTitle(dateProfile, viewOptions, dateEnv) {
|
|
var range;
|
|
// for views that span a large unit of time, show the proper interval, ignoring stray days before and after
|
|
if (/^(year|month)$/.test(dateProfile.currentRangeUnit)) {
|
|
range = dateProfile.currentRange;
|
|
}
|
|
else { // for day units or smaller, use the actual day range
|
|
range = dateProfile.activeRange;
|
|
}
|
|
return dateEnv.formatRange(range.start, range.end, createFormatter(viewOptions.titleFormat || buildTitleFormat(dateProfile)), {
|
|
isEndExclusive: dateProfile.isRangeAllDay,
|
|
defaultSeparator: viewOptions.titleRangeSeparator,
|
|
});
|
|
}
|
|
// Generates the format string that should be used to generate the title for the current date range.
|
|
// Attempts to compute the most appropriate format if not explicitly specified with `titleFormat`.
|
|
function buildTitleFormat(dateProfile) {
|
|
var currentRangeUnit = dateProfile.currentRangeUnit;
|
|
if (currentRangeUnit === 'year') {
|
|
return { year: 'numeric' };
|
|
}
|
|
if (currentRangeUnit === 'month') {
|
|
return { year: 'numeric', month: 'long' }; // like "September 2014"
|
|
}
|
|
var days = diffWholeDays(dateProfile.currentRange.start, dateProfile.currentRange.end);
|
|
if (days !== null && days > 1) {
|
|
// multi-day range. shorter, like "Sep 9 - 10 2014"
|
|
return { year: 'numeric', month: 'short', day: 'numeric' };
|
|
}
|
|
// one day. longer, like "September 9 2014"
|
|
return { year: 'numeric', month: 'long', day: 'numeric' };
|
|
}
|
|
|
|
// in future refactor, do the redux-style function(state=initial) for initial-state
|
|
// also, whatever is happening in constructor, have it happen in action queue too
|
|
var CalendarDataManager = /** @class */ (function () {
|
|
function CalendarDataManager(props) {
|
|
var _this = this;
|
|
this.computeOptionsData = memoize(this._computeOptionsData);
|
|
this.computeCurrentViewData = memoize(this._computeCurrentViewData);
|
|
this.organizeRawLocales = memoize(organizeRawLocales);
|
|
this.buildLocale = memoize(buildLocale);
|
|
this.buildPluginHooks = buildBuildPluginHooks();
|
|
this.buildDateEnv = memoize(buildDateEnv);
|
|
this.buildTheme = memoize(buildTheme);
|
|
this.parseToolbars = memoize(parseToolbars);
|
|
this.buildViewSpecs = memoize(buildViewSpecs);
|
|
this.buildDateProfileGenerator = memoizeObjArg(buildDateProfileGenerator);
|
|
this.buildViewApi = memoize(buildViewApi);
|
|
this.buildViewUiProps = memoizeObjArg(buildViewUiProps);
|
|
this.buildEventUiBySource = memoize(buildEventUiBySource, isPropsEqual);
|
|
this.buildEventUiBases = memoize(buildEventUiBases);
|
|
this.parseContextBusinessHours = memoizeObjArg(parseContextBusinessHours);
|
|
this.buildTitle = memoize(buildTitle);
|
|
this.emitter = new Emitter();
|
|
this.actionRunner = new TaskRunner(this._handleAction.bind(this), this.updateData.bind(this));
|
|
this.currentCalendarOptionsInput = {};
|
|
this.currentCalendarOptionsRefined = {};
|
|
this.currentViewOptionsInput = {};
|
|
this.currentViewOptionsRefined = {};
|
|
this.currentCalendarOptionsRefiners = {};
|
|
this.getCurrentData = function () { return _this.data; };
|
|
this.dispatch = function (action) {
|
|
_this.actionRunner.request(action); // protects against recursive calls to _handleAction
|
|
};
|
|
this.props = props;
|
|
this.actionRunner.pause();
|
|
var dynamicOptionOverrides = {};
|
|
var optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
|
|
var currentViewType = optionsData.calendarOptions.initialView || optionsData.pluginHooks.initialView;
|
|
var currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
|
|
// wire things up
|
|
// TODO: not DRY
|
|
props.calendarApi.currentDataManager = this;
|
|
this.emitter.setThisContext(props.calendarApi);
|
|
this.emitter.setOptions(currentViewData.options);
|
|
var currentDate = getInitialDate(optionsData.calendarOptions, optionsData.dateEnv);
|
|
var dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
|
|
if (!rangeContainsMarker(dateProfile.activeRange, currentDate)) {
|
|
currentDate = dateProfile.currentRange.start;
|
|
}
|
|
var calendarContext = {
|
|
dateEnv: optionsData.dateEnv,
|
|
options: optionsData.calendarOptions,
|
|
pluginHooks: optionsData.pluginHooks,
|
|
calendarApi: props.calendarApi,
|
|
dispatch: this.dispatch,
|
|
emitter: this.emitter,
|
|
getCurrentData: this.getCurrentData,
|
|
};
|
|
// needs to be after setThisContext
|
|
for (var _i = 0, _a = optionsData.pluginHooks.contextInit; _i < _a.length; _i++) {
|
|
var callback = _a[_i];
|
|
callback(calendarContext);
|
|
}
|
|
// NOT DRY
|
|
var eventSources = initEventSources(optionsData.calendarOptions, dateProfile, calendarContext);
|
|
var initialState = {
|
|
dynamicOptionOverrides: dynamicOptionOverrides,
|
|
currentViewType: currentViewType,
|
|
currentDate: currentDate,
|
|
dateProfile: dateProfile,
|
|
businessHours: this.parseContextBusinessHours(calendarContext),
|
|
eventSources: eventSources,
|
|
eventUiBases: {},
|
|
eventStore: createEmptyEventStore(),
|
|
renderableEventStore: createEmptyEventStore(),
|
|
dateSelection: null,
|
|
eventSelection: '',
|
|
eventDrag: null,
|
|
eventResize: null,
|
|
selectionConfig: this.buildViewUiProps(calendarContext).selectionConfig,
|
|
};
|
|
var contextAndState = __assign(__assign({}, calendarContext), initialState);
|
|
for (var _b = 0, _c = optionsData.pluginHooks.reducers; _b < _c.length; _b++) {
|
|
var reducer = _c[_b];
|
|
__assign(initialState, reducer(null, null, contextAndState));
|
|
}
|
|
if (computeIsLoading(initialState, calendarContext)) {
|
|
this.emitter.trigger('loading', true); // NOT DRY
|
|
}
|
|
this.state = initialState;
|
|
this.updateData();
|
|
this.actionRunner.resume();
|
|
}
|
|
CalendarDataManager.prototype.resetOptions = function (optionOverrides, append) {
|
|
var props = this.props;
|
|
props.optionOverrides = append
|
|
? __assign(__assign({}, props.optionOverrides), optionOverrides) : optionOverrides;
|
|
this.actionRunner.request({
|
|
type: 'NOTHING',
|
|
});
|
|
};
|
|
CalendarDataManager.prototype._handleAction = function (action) {
|
|
var _a = this, props = _a.props, state = _a.state, emitter = _a.emitter;
|
|
var dynamicOptionOverrides = reduceDynamicOptionOverrides(state.dynamicOptionOverrides, action);
|
|
var optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
|
|
var currentViewType = reduceViewType(state.currentViewType, action);
|
|
var currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
|
|
// wire things up
|
|
// TODO: not DRY
|
|
props.calendarApi.currentDataManager = this;
|
|
emitter.setThisContext(props.calendarApi);
|
|
emitter.setOptions(currentViewData.options);
|
|
var calendarContext = {
|
|
dateEnv: optionsData.dateEnv,
|
|
options: optionsData.calendarOptions,
|
|
pluginHooks: optionsData.pluginHooks,
|
|
calendarApi: props.calendarApi,
|
|
dispatch: this.dispatch,
|
|
emitter: emitter,
|
|
getCurrentData: this.getCurrentData,
|
|
};
|
|
var currentDate = state.currentDate, dateProfile = state.dateProfile;
|
|
if (this.data && this.data.dateProfileGenerator !== currentViewData.dateProfileGenerator) { // hack
|
|
dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
|
|
}
|
|
currentDate = reduceCurrentDate(currentDate, action);
|
|
dateProfile = reduceDateProfile(dateProfile, action, currentDate, currentViewData.dateProfileGenerator);
|
|
if (action.type === 'PREV' || // TODO: move this logic into DateProfileGenerator
|
|
action.type === 'NEXT' || // "
|
|
!rangeContainsMarker(dateProfile.currentRange, currentDate)) {
|
|
currentDate = dateProfile.currentRange.start;
|
|
}
|
|
var eventSources = reduceEventSources(state.eventSources, action, dateProfile, calendarContext);
|
|
var eventStore = reduceEventStore(state.eventStore, action, eventSources, dateProfile, calendarContext);
|
|
var isEventsLoading = computeEventSourcesLoading(eventSources); // BAD. also called in this func in computeIsLoading
|
|
var renderableEventStore = (isEventsLoading && !currentViewData.options.progressiveEventRendering) ?
|
|
(state.renderableEventStore || eventStore) : // try from previous state
|
|
eventStore;
|
|
var _b = this.buildViewUiProps(calendarContext), eventUiSingleBase = _b.eventUiSingleBase, selectionConfig = _b.selectionConfig; // will memoize obj
|
|
var eventUiBySource = this.buildEventUiBySource(eventSources);
|
|
var eventUiBases = this.buildEventUiBases(renderableEventStore.defs, eventUiSingleBase, eventUiBySource);
|
|
var newState = {
|
|
dynamicOptionOverrides: dynamicOptionOverrides,
|
|
currentViewType: currentViewType,
|
|
currentDate: currentDate,
|
|
dateProfile: dateProfile,
|
|
eventSources: eventSources,
|
|
eventStore: eventStore,
|
|
renderableEventStore: renderableEventStore,
|
|
selectionConfig: selectionConfig,
|
|
eventUiBases: eventUiBases,
|
|
businessHours: this.parseContextBusinessHours(calendarContext),
|
|
dateSelection: reduceDateSelection(state.dateSelection, action),
|
|
eventSelection: reduceSelectedEvent(state.eventSelection, action),
|
|
eventDrag: reduceEventDrag(state.eventDrag, action),
|
|
eventResize: reduceEventResize(state.eventResize, action),
|
|
};
|
|
var contextAndState = __assign(__assign({}, calendarContext), newState);
|
|
for (var _i = 0, _c = optionsData.pluginHooks.reducers; _i < _c.length; _i++) {
|
|
var reducer = _c[_i];
|
|
__assign(newState, reducer(state, action, contextAndState)); // give the OLD state, for old value
|
|
}
|
|
var wasLoading = computeIsLoading(state, calendarContext);
|
|
var isLoading = computeIsLoading(newState, calendarContext);
|
|
// TODO: use propSetHandlers in plugin system
|
|
if (!wasLoading && isLoading) {
|
|
emitter.trigger('loading', true);
|
|
}
|
|
else if (wasLoading && !isLoading) {
|
|
emitter.trigger('loading', false);
|
|
}
|
|
this.state = newState;
|
|
if (props.onAction) {
|
|
props.onAction(action);
|
|
}
|
|
};
|
|
CalendarDataManager.prototype.updateData = function () {
|
|
var _a = this, props = _a.props, state = _a.state;
|
|
var oldData = this.data;
|
|
var optionsData = this.computeOptionsData(props.optionOverrides, state.dynamicOptionOverrides, props.calendarApi);
|
|
var currentViewData = this.computeCurrentViewData(state.currentViewType, optionsData, props.optionOverrides, state.dynamicOptionOverrides);
|
|
var data = this.data = __assign(__assign(__assign({ viewTitle: this.buildTitle(state.dateProfile, currentViewData.options, optionsData.dateEnv), calendarApi: props.calendarApi, dispatch: this.dispatch, emitter: this.emitter, getCurrentData: this.getCurrentData }, optionsData), currentViewData), state);
|
|
var changeHandlers = optionsData.pluginHooks.optionChangeHandlers;
|
|
var oldCalendarOptions = oldData && oldData.calendarOptions;
|
|
var newCalendarOptions = optionsData.calendarOptions;
|
|
if (oldCalendarOptions && oldCalendarOptions !== newCalendarOptions) {
|
|
if (oldCalendarOptions.timeZone !== newCalendarOptions.timeZone) {
|
|
// hack
|
|
state.eventSources = data.eventSources = reduceEventSourcesNewTimeZone(data.eventSources, state.dateProfile, data);
|
|
state.eventStore = data.eventStore = rezoneEventStoreDates(data.eventStore, oldData.dateEnv, data.dateEnv);
|
|
}
|
|
for (var optionName in changeHandlers) {
|
|
if (oldCalendarOptions[optionName] !== newCalendarOptions[optionName]) {
|
|
changeHandlers[optionName](newCalendarOptions[optionName], data);
|
|
}
|
|
}
|
|
}
|
|
if (props.onData) {
|
|
props.onData(data);
|
|
}
|
|
};
|
|
CalendarDataManager.prototype._computeOptionsData = function (optionOverrides, dynamicOptionOverrides, calendarApi) {
|
|
// TODO: blacklist options that are handled by optionChangeHandlers
|
|
var _a = this.processRawCalendarOptions(optionOverrides, dynamicOptionOverrides), refinedOptions = _a.refinedOptions, pluginHooks = _a.pluginHooks, localeDefaults = _a.localeDefaults, availableLocaleData = _a.availableLocaleData, extra = _a.extra;
|
|
warnUnknownOptions(extra);
|
|
var dateEnv = this.buildDateEnv(refinedOptions.timeZone, refinedOptions.locale, refinedOptions.weekNumberCalculation, refinedOptions.firstDay, refinedOptions.weekText, pluginHooks, availableLocaleData, refinedOptions.defaultRangeSeparator);
|
|
var viewSpecs = this.buildViewSpecs(pluginHooks.views, optionOverrides, dynamicOptionOverrides, localeDefaults);
|
|
var theme = this.buildTheme(refinedOptions, pluginHooks);
|
|
var toolbarConfig = this.parseToolbars(refinedOptions, optionOverrides, theme, viewSpecs, calendarApi);
|
|
return {
|
|
calendarOptions: refinedOptions,
|
|
pluginHooks: pluginHooks,
|
|
dateEnv: dateEnv,
|
|
viewSpecs: viewSpecs,
|
|
theme: theme,
|
|
toolbarConfig: toolbarConfig,
|
|
localeDefaults: localeDefaults,
|
|
availableRawLocales: availableLocaleData.map,
|
|
};
|
|
};
|
|
// always called from behind a memoizer
|
|
CalendarDataManager.prototype.processRawCalendarOptions = function (optionOverrides, dynamicOptionOverrides) {
|
|
var _a = mergeRawOptions([
|
|
BASE_OPTION_DEFAULTS,
|
|
optionOverrides,
|
|
dynamicOptionOverrides,
|
|
]), locales = _a.locales, locale = _a.locale;
|
|
var availableLocaleData = this.organizeRawLocales(locales);
|
|
var availableRawLocales = availableLocaleData.map;
|
|
var localeDefaults = this.buildLocale(locale || availableLocaleData.defaultCode, availableRawLocales).options;
|
|
var pluginHooks = this.buildPluginHooks(optionOverrides.plugins || [], globalPlugins);
|
|
var refiners = this.currentCalendarOptionsRefiners = __assign(__assign(__assign(__assign(__assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
|
|
var extra = {};
|
|
var raw = mergeRawOptions([
|
|
BASE_OPTION_DEFAULTS,
|
|
localeDefaults,
|
|
optionOverrides,
|
|
dynamicOptionOverrides,
|
|
]);
|
|
var refined = {};
|
|
var currentRaw = this.currentCalendarOptionsInput;
|
|
var currentRefined = this.currentCalendarOptionsRefined;
|
|
var anyChanges = false;
|
|
for (var optionName in raw) {
|
|
if (optionName !== 'plugins') { // because plugins is special-cased
|
|
if (raw[optionName] === currentRaw[optionName] ||
|
|
(COMPLEX_OPTION_COMPARATORS[optionName] &&
|
|
(optionName in currentRaw) &&
|
|
COMPLEX_OPTION_COMPARATORS[optionName](currentRaw[optionName], raw[optionName]))) {
|
|
refined[optionName] = currentRefined[optionName];
|
|
}
|
|
else if (refiners[optionName]) {
|
|
refined[optionName] = refiners[optionName](raw[optionName]);
|
|
anyChanges = true;
|
|
}
|
|
else {
|
|
extra[optionName] = currentRaw[optionName];
|
|
}
|
|
}
|
|
}
|
|
if (anyChanges) {
|
|
this.currentCalendarOptionsInput = raw;
|
|
this.currentCalendarOptionsRefined = refined;
|
|
}
|
|
return {
|
|
rawOptions: this.currentCalendarOptionsInput,
|
|
refinedOptions: this.currentCalendarOptionsRefined,
|
|
pluginHooks: pluginHooks,
|
|
availableLocaleData: availableLocaleData,
|
|
localeDefaults: localeDefaults,
|
|
extra: extra,
|
|
};
|
|
};
|
|
CalendarDataManager.prototype._computeCurrentViewData = function (viewType, optionsData, optionOverrides, dynamicOptionOverrides) {
|
|
var viewSpec = optionsData.viewSpecs[viewType];
|
|
if (!viewSpec) {
|
|
throw new Error("viewType \"" + viewType + "\" is not available. Please make sure you've loaded all neccessary plugins");
|
|
}
|
|
var _a = this.processRawViewOptions(viewSpec, optionsData.pluginHooks, optionsData.localeDefaults, optionOverrides, dynamicOptionOverrides), refinedOptions = _a.refinedOptions, extra = _a.extra;
|
|
warnUnknownOptions(extra);
|
|
var dateProfileGenerator = this.buildDateProfileGenerator({
|
|
dateProfileGeneratorClass: viewSpec.optionDefaults.dateProfileGeneratorClass,
|
|
duration: viewSpec.duration,
|
|
durationUnit: viewSpec.durationUnit,
|
|
usesMinMaxTime: viewSpec.optionDefaults.usesMinMaxTime,
|
|
dateEnv: optionsData.dateEnv,
|
|
calendarApi: this.props.calendarApi,
|
|
slotMinTime: refinedOptions.slotMinTime,
|
|
slotMaxTime: refinedOptions.slotMaxTime,
|
|
showNonCurrentDates: refinedOptions.showNonCurrentDates,
|
|
dayCount: refinedOptions.dayCount,
|
|
dateAlignment: refinedOptions.dateAlignment,
|
|
dateIncrement: refinedOptions.dateIncrement,
|
|
hiddenDays: refinedOptions.hiddenDays,
|
|
weekends: refinedOptions.weekends,
|
|
nowInput: refinedOptions.now,
|
|
validRangeInput: refinedOptions.validRange,
|
|
visibleRangeInput: refinedOptions.visibleRange,
|
|
monthMode: refinedOptions.monthMode,
|
|
fixedWeekCount: refinedOptions.fixedWeekCount,
|
|
});
|
|
var viewApi = this.buildViewApi(viewType, this.getCurrentData, optionsData.dateEnv);
|
|
return { viewSpec: viewSpec, options: refinedOptions, dateProfileGenerator: dateProfileGenerator, viewApi: viewApi };
|
|
};
|
|
CalendarDataManager.prototype.processRawViewOptions = function (viewSpec, pluginHooks, localeDefaults, optionOverrides, dynamicOptionOverrides) {
|
|
var raw = mergeRawOptions([
|
|
BASE_OPTION_DEFAULTS,
|
|
viewSpec.optionDefaults,
|
|
localeDefaults,
|
|
optionOverrides,
|
|
viewSpec.optionOverrides,
|
|
dynamicOptionOverrides,
|
|
]);
|
|
var refiners = __assign(__assign(__assign(__assign(__assign(__assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), VIEW_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
|
|
var refined = {};
|
|
var currentRaw = this.currentViewOptionsInput;
|
|
var currentRefined = this.currentViewOptionsRefined;
|
|
var anyChanges = false;
|
|
var extra = {};
|
|
for (var optionName in raw) {
|
|
if (raw[optionName] === currentRaw[optionName] ||
|
|
(COMPLEX_OPTION_COMPARATORS[optionName] &&
|
|
COMPLEX_OPTION_COMPARATORS[optionName](raw[optionName], currentRaw[optionName]))) {
|
|
refined[optionName] = currentRefined[optionName];
|
|
}
|
|
else {
|
|
if (raw[optionName] === this.currentCalendarOptionsInput[optionName] ||
|
|
(COMPLEX_OPTION_COMPARATORS[optionName] &&
|
|
COMPLEX_OPTION_COMPARATORS[optionName](raw[optionName], this.currentCalendarOptionsInput[optionName]))) {
|
|
if (optionName in this.currentCalendarOptionsRefined) { // might be an "extra" prop
|
|
refined[optionName] = this.currentCalendarOptionsRefined[optionName];
|
|
}
|
|
}
|
|
else if (refiners[optionName]) {
|
|
refined[optionName] = refiners[optionName](raw[optionName]);
|
|
}
|
|
else {
|
|
extra[optionName] = raw[optionName];
|
|
}
|
|
anyChanges = true;
|
|
}
|
|
}
|
|
if (anyChanges) {
|
|
this.currentViewOptionsInput = raw;
|
|
this.currentViewOptionsRefined = refined;
|
|
}
|
|
return {
|
|
rawOptions: this.currentViewOptionsInput,
|
|
refinedOptions: this.currentViewOptionsRefined,
|
|
extra: extra,
|
|
};
|
|
};
|
|
return CalendarDataManager;
|
|
}());
|
|
function buildDateEnv(timeZone, explicitLocale, weekNumberCalculation, firstDay, weekText, pluginHooks, availableLocaleData, defaultSeparator) {
|
|
var locale = buildLocale(explicitLocale || availableLocaleData.defaultCode, availableLocaleData.map);
|
|
return new DateEnv({
|
|
calendarSystem: 'gregory',
|
|
timeZone: timeZone,
|
|
namedTimeZoneImpl: pluginHooks.namedTimeZonedImpl,
|
|
locale: locale,
|
|
weekNumberCalculation: weekNumberCalculation,
|
|
firstDay: firstDay,
|
|
weekText: weekText,
|
|
cmdFormatter: pluginHooks.cmdFormatter,
|
|
defaultSeparator: defaultSeparator,
|
|
});
|
|
}
|
|
function buildTheme(options, pluginHooks) {
|
|
var ThemeClass = pluginHooks.themeClasses[options.themeSystem] || StandardTheme;
|
|
return new ThemeClass(options);
|
|
}
|
|
function buildDateProfileGenerator(props) {
|
|
var DateProfileGeneratorClass = props.dateProfileGeneratorClass || DateProfileGenerator;
|
|
return new DateProfileGeneratorClass(props);
|
|
}
|
|
function buildViewApi(type, getCurrentData, dateEnv) {
|
|
return new ViewApi(type, getCurrentData, dateEnv);
|
|
}
|
|
function buildEventUiBySource(eventSources) {
|
|
return mapHash(eventSources, function (eventSource) { return eventSource.ui; });
|
|
}
|
|
function buildEventUiBases(eventDefs, eventUiSingleBase, eventUiBySource) {
|
|
var eventUiBases = { '': eventUiSingleBase };
|
|
for (var defId in eventDefs) {
|
|
var def = eventDefs[defId];
|
|
if (def.sourceId && eventUiBySource[def.sourceId]) {
|
|
eventUiBases[defId] = eventUiBySource[def.sourceId];
|
|
}
|
|
}
|
|
return eventUiBases;
|
|
}
|
|
function buildViewUiProps(calendarContext) {
|
|
var options = calendarContext.options;
|
|
return {
|
|
eventUiSingleBase: createEventUi({
|
|
display: options.eventDisplay,
|
|
editable: options.editable,
|
|
startEditable: options.eventStartEditable,
|
|
durationEditable: options.eventDurationEditable,
|
|
constraint: options.eventConstraint,
|
|
overlap: typeof options.eventOverlap === 'boolean' ? options.eventOverlap : undefined,
|
|
allow: options.eventAllow,
|
|
backgroundColor: options.eventBackgroundColor,
|
|
borderColor: options.eventBorderColor,
|
|
textColor: options.eventTextColor,
|
|
color: options.eventColor,
|
|
// classNames: options.eventClassNames // render hook will handle this
|
|
}, calendarContext),
|
|
selectionConfig: createEventUi({
|
|
constraint: options.selectConstraint,
|
|
overlap: typeof options.selectOverlap === 'boolean' ? options.selectOverlap : undefined,
|
|
allow: options.selectAllow,
|
|
}, calendarContext),
|
|
};
|
|
}
|
|
function computeIsLoading(state, context) {
|
|
for (var _i = 0, _a = context.pluginHooks.isLoadingFuncs; _i < _a.length; _i++) {
|
|
var isLoadingFunc = _a[_i];
|
|
if (isLoadingFunc(state)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function parseContextBusinessHours(calendarContext) {
|
|
return parseBusinessHours(calendarContext.options.businessHours, calendarContext);
|
|
}
|
|
function warnUnknownOptions(options, viewName) {
|
|
for (var optionName in options) {
|
|
console.warn("Unknown option '" + optionName + "'" +
|
|
(viewName ? " for view '" + viewName + "'" : ''));
|
|
}
|
|
}
|
|
|
|
// TODO: move this to react plugin?
|
|
var CalendarDataProvider = /** @class */ (function (_super) {
|
|
__extends(CalendarDataProvider, _super);
|
|
function CalendarDataProvider(props) {
|
|
var _this = _super.call(this, props) || this;
|
|
_this.handleData = function (data) {
|
|
if (!_this.dataManager) { // still within initial run, before assignment in constructor
|
|
// eslint-disable-next-line react/no-direct-mutation-state
|
|
_this.state = data; // can't use setState yet
|
|
}
|
|
else {
|
|
_this.setState(data);
|
|
}
|
|
};
|
|
_this.dataManager = new CalendarDataManager({
|
|
optionOverrides: props.optionOverrides,
|
|
calendarApi: props.calendarApi,
|
|
onData: _this.handleData,
|
|
});
|
|
return _this;
|
|
}
|
|
CalendarDataProvider.prototype.render = function () {
|
|
return this.props.children(this.state);
|
|
};
|
|
CalendarDataProvider.prototype.componentDidUpdate = function (prevProps) {
|
|
var newOptionOverrides = this.props.optionOverrides;
|
|
if (newOptionOverrides !== prevProps.optionOverrides) { // prevent recursive handleData
|
|
this.dataManager.resetOptions(newOptionOverrides);
|
|
}
|
|
};
|
|
return CalendarDataProvider;
|
|
}(Component));
|
|
|
|
// HELPERS
|
|
/*
|
|
if nextDayThreshold is specified, slicing is done in an all-day fashion.
|
|
you can get nextDayThreshold from context.nextDayThreshold
|
|
*/
|
|
function sliceEvents(props, allDay) {
|
|
return sliceEventStore(props.eventStore, props.eventUiBases, props.dateProfile.activeRange, allDay ? props.nextDayThreshold : null).fg;
|
|
}
|
|
|
|
var NamedTimeZoneImpl = /** @class */ (function () {
|
|
function NamedTimeZoneImpl(timeZoneName) {
|
|
this.timeZoneName = timeZoneName;
|
|
}
|
|
return NamedTimeZoneImpl;
|
|
}());
|
|
|
|
var SegHierarchy = /** @class */ (function () {
|
|
function SegHierarchy() {
|
|
// settings
|
|
this.strictOrder = false;
|
|
this.allowReslicing = false;
|
|
this.maxCoord = -1; // -1 means no max
|
|
this.maxStackCnt = -1; // -1 means no max
|
|
this.levelCoords = []; // ordered
|
|
this.entriesByLevel = []; // parallel with levelCoords
|
|
this.stackCnts = {}; // TODO: use better technique!?
|
|
}
|
|
SegHierarchy.prototype.addSegs = function (inputs) {
|
|
var hiddenEntries = [];
|
|
for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
|
|
var input = inputs_1[_i];
|
|
this.insertEntry(input, hiddenEntries);
|
|
}
|
|
return hiddenEntries;
|
|
};
|
|
SegHierarchy.prototype.insertEntry = function (entry, hiddenEntries) {
|
|
var insertion = this.findInsertion(entry);
|
|
if (this.isInsertionValid(insertion, entry)) {
|
|
this.insertEntryAt(entry, insertion);
|
|
return 1;
|
|
}
|
|
return this.handleInvalidInsertion(insertion, entry, hiddenEntries);
|
|
};
|
|
SegHierarchy.prototype.isInsertionValid = function (insertion, entry) {
|
|
return (this.maxCoord === -1 || insertion.levelCoord + entry.thickness <= this.maxCoord) &&
|
|
(this.maxStackCnt === -1 || insertion.stackCnt < this.maxStackCnt);
|
|
};
|
|
// returns number of new entries inserted
|
|
SegHierarchy.prototype.handleInvalidInsertion = function (insertion, entry, hiddenEntries) {
|
|
if (this.allowReslicing && insertion.touchingEntry) {
|
|
return this.splitEntry(entry, insertion.touchingEntry, hiddenEntries);
|
|
}
|
|
hiddenEntries.push(entry);
|
|
return 0;
|
|
};
|
|
SegHierarchy.prototype.splitEntry = function (entry, barrier, hiddenEntries) {
|
|
var partCnt = 0;
|
|
var splitHiddenEntries = [];
|
|
var entrySpan = entry.span;
|
|
var barrierSpan = barrier.span;
|
|
if (entrySpan.start < barrierSpan.start) {
|
|
partCnt += this.insertEntry({
|
|
index: entry.index,
|
|
thickness: entry.thickness,
|
|
span: { start: entrySpan.start, end: barrierSpan.start },
|
|
}, splitHiddenEntries);
|
|
}
|
|
if (entrySpan.end > barrierSpan.end) {
|
|
partCnt += this.insertEntry({
|
|
index: entry.index,
|
|
thickness: entry.thickness,
|
|
span: { start: barrierSpan.end, end: entrySpan.end },
|
|
}, splitHiddenEntries);
|
|
}
|
|
if (partCnt) {
|
|
hiddenEntries.push.apply(hiddenEntries, __spreadArray([{
|
|
index: entry.index,
|
|
thickness: entry.thickness,
|
|
span: intersectSpans(barrierSpan, entrySpan), // guaranteed to intersect
|
|
}], splitHiddenEntries));
|
|
return partCnt;
|
|
}
|
|
hiddenEntries.push(entry);
|
|
return 0;
|
|
};
|
|
SegHierarchy.prototype.insertEntryAt = function (entry, insertion) {
|
|
var _a = this, entriesByLevel = _a.entriesByLevel, levelCoords = _a.levelCoords;
|
|
if (insertion.lateral === -1) {
|
|
// create a new level
|
|
insertAt(levelCoords, insertion.level, insertion.levelCoord);
|
|
insertAt(entriesByLevel, insertion.level, [entry]);
|
|
}
|
|
else {
|
|
// insert into existing level
|
|
insertAt(entriesByLevel[insertion.level], insertion.lateral, entry);
|
|
}
|
|
this.stackCnts[buildEntryKey(entry)] = insertion.stackCnt;
|
|
};
|
|
SegHierarchy.prototype.findInsertion = function (newEntry) {
|
|
var _a = this, levelCoords = _a.levelCoords, entriesByLevel = _a.entriesByLevel, strictOrder = _a.strictOrder, stackCnts = _a.stackCnts;
|
|
var levelCnt = levelCoords.length;
|
|
var candidateCoord = 0;
|
|
var touchingLevel = -1;
|
|
var touchingLateral = -1;
|
|
var touchingEntry = null;
|
|
var stackCnt = 0;
|
|
for (var trackingLevel = 0; trackingLevel < levelCnt; trackingLevel += 1) {
|
|
var trackingCoord = levelCoords[trackingLevel];
|
|
// if the current level is past the placed entry, we have found a good empty space and can stop.
|
|
// if strictOrder, keep finding more lateral intersections.
|
|
if (!strictOrder && trackingCoord >= candidateCoord + newEntry.thickness) {
|
|
break;
|
|
}
|
|
var trackingEntries = entriesByLevel[trackingLevel];
|
|
var trackingEntry = void 0;
|
|
var searchRes = binarySearch(trackingEntries, newEntry.span.start, getEntrySpanEnd); // find first entry after newEntry's end
|
|
var lateralIndex = searchRes[0] + searchRes[1]; // if exact match (which doesn't collide), go to next one
|
|
while ( // loop through entries that horizontally intersect
|
|
(trackingEntry = trackingEntries[lateralIndex]) && // but not past the whole entry list
|
|
trackingEntry.span.start < newEntry.span.end // and not entirely past newEntry
|
|
) {
|
|
var trackingEntryBottom = trackingCoord + trackingEntry.thickness;
|
|
// intersects into the top of the candidate?
|
|
if (trackingEntryBottom > candidateCoord) {
|
|
candidateCoord = trackingEntryBottom;
|
|
touchingEntry = trackingEntry;
|
|
touchingLevel = trackingLevel;
|
|
touchingLateral = lateralIndex;
|
|
}
|
|
// butts up against top of candidate? (will happen if just intersected as well)
|
|
if (trackingEntryBottom === candidateCoord) {
|
|
// accumulate the highest possible stackCnt of the trackingEntries that butt up
|
|
stackCnt = Math.max(stackCnt, stackCnts[buildEntryKey(trackingEntry)] + 1);
|
|
}
|
|
lateralIndex += 1;
|
|
}
|
|
}
|
|
// the destination level will be after touchingEntry's level. find it
|
|
var destLevel = 0;
|
|
if (touchingEntry) {
|
|
destLevel = touchingLevel + 1;
|
|
while (destLevel < levelCnt && levelCoords[destLevel] < candidateCoord) {
|
|
destLevel += 1;
|
|
}
|
|
}
|
|
// if adding to an existing level, find where to insert
|
|
var destLateral = -1;
|
|
if (destLevel < levelCnt && levelCoords[destLevel] === candidateCoord) {
|
|
destLateral = binarySearch(entriesByLevel[destLevel], newEntry.span.end, getEntrySpanEnd)[0];
|
|
}
|
|
return {
|
|
touchingLevel: touchingLevel,
|
|
touchingLateral: touchingLateral,
|
|
touchingEntry: touchingEntry,
|
|
stackCnt: stackCnt,
|
|
levelCoord: candidateCoord,
|
|
level: destLevel,
|
|
lateral: destLateral,
|
|
};
|
|
};
|
|
// sorted by levelCoord (lowest to highest)
|
|
SegHierarchy.prototype.toRects = function () {
|
|
var _a = this, entriesByLevel = _a.entriesByLevel, levelCoords = _a.levelCoords;
|
|
var levelCnt = entriesByLevel.length;
|
|
var rects = [];
|
|
for (var level = 0; level < levelCnt; level += 1) {
|
|
var entries = entriesByLevel[level];
|
|
var levelCoord = levelCoords[level];
|
|
for (var _i = 0, entries_1 = entries; _i < entries_1.length; _i++) {
|
|
var entry = entries_1[_i];
|
|
rects.push(__assign(__assign({}, entry), { levelCoord: levelCoord }));
|
|
}
|
|
}
|
|
return rects;
|
|
};
|
|
return SegHierarchy;
|
|
}());
|
|
function getEntrySpanEnd(entry) {
|
|
return entry.span.end;
|
|
}
|
|
function buildEntryKey(entry) {
|
|
return entry.index + ':' + entry.span.start;
|
|
}
|
|
// returns groups with entries sorted by input order
|
|
function groupIntersectingEntries(entries) {
|
|
var merges = [];
|
|
for (var _i = 0, entries_2 = entries; _i < entries_2.length; _i++) {
|
|
var entry = entries_2[_i];
|
|
var filteredMerges = [];
|
|
var hungryMerge = {
|
|
span: entry.span,
|
|
entries: [entry],
|
|
};
|
|
for (var _a = 0, merges_1 = merges; _a < merges_1.length; _a++) {
|
|
var merge = merges_1[_a];
|
|
if (intersectSpans(merge.span, hungryMerge.span)) {
|
|
hungryMerge = {
|
|
entries: merge.entries.concat(hungryMerge.entries),
|
|
span: joinSpans(merge.span, hungryMerge.span),
|
|
};
|
|
}
|
|
else {
|
|
filteredMerges.push(merge);
|
|
}
|
|
}
|
|
filteredMerges.push(hungryMerge);
|
|
merges = filteredMerges;
|
|
}
|
|
return merges;
|
|
}
|
|
function joinSpans(span0, span1) {
|
|
return {
|
|
start: Math.min(span0.start, span1.start),
|
|
end: Math.max(span0.end, span1.end),
|
|
};
|
|
}
|
|
function intersectSpans(span0, span1) {
|
|
var start = Math.max(span0.start, span1.start);
|
|
var end = Math.min(span0.end, span1.end);
|
|
if (start < end) {
|
|
return { start: start, end: end };
|
|
}
|
|
return null;
|
|
}
|
|
// general util
|
|
// ---------------------------------------------------------------------------------------------------------------------
|
|
function insertAt(arr, index, item) {
|
|
arr.splice(index, 0, item);
|
|
}
|
|
function binarySearch(a, searchVal, getItemVal) {
|
|
var startIndex = 0;
|
|
var endIndex = a.length; // exclusive
|
|
if (!endIndex || searchVal < getItemVal(a[startIndex])) { // no items OR before first item
|
|
return [0, 0];
|
|
}
|
|
if (searchVal > getItemVal(a[endIndex - 1])) { // after last item
|
|
return [endIndex, 0];
|
|
}
|
|
while (startIndex < endIndex) {
|
|
var middleIndex = Math.floor(startIndex + (endIndex - startIndex) / 2);
|
|
var middleVal = getItemVal(a[middleIndex]);
|
|
if (searchVal < middleVal) {
|
|
endIndex = middleIndex;
|
|
}
|
|
else if (searchVal > middleVal) {
|
|
startIndex = middleIndex + 1;
|
|
}
|
|
else { // equal!
|
|
return [middleIndex, 1];
|
|
}
|
|
}
|
|
return [startIndex, 0];
|
|
}
|
|
|
|
var Interaction = /** @class */ (function () {
|
|
function Interaction(settings) {
|
|
this.component = settings.component;
|
|
this.isHitComboAllowed = settings.isHitComboAllowed || null;
|
|
}
|
|
Interaction.prototype.destroy = function () {
|
|
};
|
|
return Interaction;
|
|
}());
|
|
function parseInteractionSettings(component, input) {
|
|
return {
|
|
component: component,
|
|
el: input.el,
|
|
useEventCenter: input.useEventCenter != null ? input.useEventCenter : true,
|
|
isHitComboAllowed: input.isHitComboAllowed || null,
|
|
};
|
|
}
|
|
function interactionSettingsToStore(settings) {
|
|
var _a;
|
|
return _a = {},
|
|
_a[settings.component.uid] = settings,
|
|
_a;
|
|
}
|
|
// global state
|
|
var interactionSettingsStore = {};
|
|
|
|
/*
|
|
An abstraction for a dragging interaction originating on an event.
|
|
Does higher-level things than PointerDragger, such as possibly:
|
|
- a "mirror" that moves with the pointer
|
|
- a minimum number of pixels or other criteria for a true drag to begin
|
|
|
|
subclasses must emit:
|
|
- pointerdown
|
|
- dragstart
|
|
- dragmove
|
|
- pointerup
|
|
- dragend
|
|
*/
|
|
var ElementDragging = /** @class */ (function () {
|
|
function ElementDragging(el, selector) {
|
|
this.emitter = new Emitter();
|
|
}
|
|
ElementDragging.prototype.destroy = function () {
|
|
};
|
|
ElementDragging.prototype.setMirrorIsVisible = function (bool) {
|
|
// optional if subclass doesn't want to support a mirror
|
|
};
|
|
ElementDragging.prototype.setMirrorNeedsRevert = function (bool) {
|
|
// optional if subclass doesn't want to support a mirror
|
|
};
|
|
ElementDragging.prototype.setAutoScrollEnabled = function (bool) {
|
|
// optional
|
|
};
|
|
return ElementDragging;
|
|
}());
|
|
|
|
// TODO: get rid of this in favor of options system,
|
|
// tho it's really easy to access this globally rather than pass thru options.
|
|
var config = {};
|
|
|
|
/*
|
|
Information about what will happen when an external element is dragged-and-dropped
|
|
onto a calendar. Contains information for creating an event.
|
|
*/
|
|
var DRAG_META_REFINERS = {
|
|
startTime: createDuration,
|
|
duration: createDuration,
|
|
create: Boolean,
|
|
sourceId: String,
|
|
};
|
|
function parseDragMeta(raw) {
|
|
var _a = refineProps(raw, DRAG_META_REFINERS), refined = _a.refined, extra = _a.extra;
|
|
return {
|
|
startTime: refined.startTime || null,
|
|
duration: refined.duration || null,
|
|
create: refined.create != null ? refined.create : true,
|
|
sourceId: refined.sourceId,
|
|
leftoverProps: extra,
|
|
};
|
|
}
|
|
|
|
var ToolbarSection = /** @class */ (function (_super) {
|
|
__extends(ToolbarSection, _super);
|
|
function ToolbarSection() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ToolbarSection.prototype.render = function () {
|
|
var _this = this;
|
|
var children = this.props.widgetGroups.map(function (widgetGroup) { return _this.renderWidgetGroup(widgetGroup); });
|
|
return createElement.apply(void 0, __spreadArray(['div', { className: 'fc-toolbar-chunk' }], children));
|
|
};
|
|
ToolbarSection.prototype.renderWidgetGroup = function (widgetGroup) {
|
|
var props = this.props;
|
|
var theme = this.context.theme;
|
|
var children = [];
|
|
var isOnlyButtons = true;
|
|
for (var _i = 0, widgetGroup_1 = widgetGroup; _i < widgetGroup_1.length; _i++) {
|
|
var widget = widgetGroup_1[_i];
|
|
var buttonName = widget.buttonName, buttonClick = widget.buttonClick, buttonText = widget.buttonText, buttonIcon = widget.buttonIcon, buttonHint = widget.buttonHint;
|
|
if (buttonName === 'title') {
|
|
isOnlyButtons = false;
|
|
children.push(createElement("h2", { className: "fc-toolbar-title", id: props.titleId }, props.title));
|
|
}
|
|
else {
|
|
var isPressed = buttonName === props.activeButton;
|
|
var isDisabled = (!props.isTodayEnabled && buttonName === 'today') ||
|
|
(!props.isPrevEnabled && buttonName === 'prev') ||
|
|
(!props.isNextEnabled && buttonName === 'next');
|
|
var buttonClasses = ["fc-" + buttonName + "-button", theme.getClass('button')];
|
|
if (isPressed) {
|
|
buttonClasses.push(theme.getClass('buttonActive'));
|
|
}
|
|
children.push(createElement("button", { type: "button", title: typeof buttonHint === 'function' ? buttonHint(props.navUnit) : buttonHint, disabled: isDisabled, "aria-pressed": isPressed, className: buttonClasses.join(' '), onClick: buttonClick }, buttonText || (buttonIcon ? createElement("span", { className: buttonIcon }) : '')));
|
|
}
|
|
}
|
|
if (children.length > 1) {
|
|
var groupClassName = (isOnlyButtons && theme.getClass('buttonGroup')) || '';
|
|
return createElement.apply(void 0, __spreadArray(['div', { className: groupClassName }], children));
|
|
}
|
|
return children[0];
|
|
};
|
|
return ToolbarSection;
|
|
}(BaseComponent));
|
|
|
|
var Toolbar = /** @class */ (function (_super) {
|
|
__extends(Toolbar, _super);
|
|
function Toolbar() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
Toolbar.prototype.render = function () {
|
|
var _a = this.props, model = _a.model, extraClassName = _a.extraClassName;
|
|
var forceLtr = false;
|
|
var startContent;
|
|
var endContent;
|
|
var sectionWidgets = model.sectionWidgets;
|
|
var centerContent = sectionWidgets.center;
|
|
if (sectionWidgets.left) {
|
|
forceLtr = true;
|
|
startContent = sectionWidgets.left;
|
|
}
|
|
else {
|
|
startContent = sectionWidgets.start;
|
|
}
|
|
if (sectionWidgets.right) {
|
|
forceLtr = true;
|
|
endContent = sectionWidgets.right;
|
|
}
|
|
else {
|
|
endContent = sectionWidgets.end;
|
|
}
|
|
var classNames = [
|
|
extraClassName || '',
|
|
'fc-toolbar',
|
|
forceLtr ? 'fc-toolbar-ltr' : '',
|
|
];
|
|
return (createElement("div", { className: classNames.join(' ') },
|
|
this.renderSection('start', startContent || []),
|
|
this.renderSection('center', centerContent || []),
|
|
this.renderSection('end', endContent || [])));
|
|
};
|
|
Toolbar.prototype.renderSection = function (key, widgetGroups) {
|
|
var props = this.props;
|
|
return (createElement(ToolbarSection, { key: key, widgetGroups: widgetGroups, title: props.title, navUnit: props.navUnit, activeButton: props.activeButton, isTodayEnabled: props.isTodayEnabled, isPrevEnabled: props.isPrevEnabled, isNextEnabled: props.isNextEnabled, titleId: props.titleId }));
|
|
};
|
|
return Toolbar;
|
|
}(BaseComponent));
|
|
|
|
// TODO: do function component?
|
|
var ViewContainer = /** @class */ (function (_super) {
|
|
__extends(ViewContainer, _super);
|
|
function ViewContainer() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.state = {
|
|
availableWidth: null,
|
|
};
|
|
_this.handleEl = function (el) {
|
|
_this.el = el;
|
|
setRef(_this.props.elRef, el);
|
|
_this.updateAvailableWidth();
|
|
};
|
|
_this.handleResize = function () {
|
|
_this.updateAvailableWidth();
|
|
};
|
|
return _this;
|
|
}
|
|
ViewContainer.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state;
|
|
var aspectRatio = props.aspectRatio;
|
|
var classNames = [
|
|
'fc-view-harness',
|
|
(aspectRatio || props.liquid || props.height)
|
|
? 'fc-view-harness-active' // harness controls the height
|
|
: 'fc-view-harness-passive', // let the view do the height
|
|
];
|
|
var height = '';
|
|
var paddingBottom = '';
|
|
if (aspectRatio) {
|
|
if (state.availableWidth !== null) {
|
|
height = state.availableWidth / aspectRatio;
|
|
}
|
|
else {
|
|
// while waiting to know availableWidth, we can't set height to *zero*
|
|
// because will cause lots of unnecessary scrollbars within scrollgrid.
|
|
// BETTER: don't start rendering ANYTHING yet until we know container width
|
|
// NOTE: why not always use paddingBottom? Causes height oscillation (issue 5606)
|
|
paddingBottom = (1 / aspectRatio) * 100 + "%";
|
|
}
|
|
}
|
|
else {
|
|
height = props.height || '';
|
|
}
|
|
return (createElement("div", { "aria-labelledby": props.labeledById, ref: this.handleEl, className: classNames.join(' '), style: { height: height, paddingBottom: paddingBottom } }, props.children));
|
|
};
|
|
ViewContainer.prototype.componentDidMount = function () {
|
|
this.context.addResizeHandler(this.handleResize);
|
|
};
|
|
ViewContainer.prototype.componentWillUnmount = function () {
|
|
this.context.removeResizeHandler(this.handleResize);
|
|
};
|
|
ViewContainer.prototype.updateAvailableWidth = function () {
|
|
if (this.el && // needed. but why?
|
|
this.props.aspectRatio // aspectRatio is the only height setting that needs availableWidth
|
|
) {
|
|
this.setState({ availableWidth: this.el.offsetWidth });
|
|
}
|
|
};
|
|
return ViewContainer;
|
|
}(BaseComponent));
|
|
|
|
/*
|
|
Detects when the user clicks on an event within a DateComponent
|
|
*/
|
|
var EventClicking = /** @class */ (function (_super) {
|
|
__extends(EventClicking, _super);
|
|
function EventClicking(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
_this.handleSegClick = function (ev, segEl) {
|
|
var component = _this.component;
|
|
var context = component.context;
|
|
var seg = getElSeg(segEl);
|
|
if (seg && // might be the <div> surrounding the more link
|
|
component.isValidSegDownEl(ev.target)) {
|
|
// our way to simulate a link click for elements that can't be <a> tags
|
|
// grab before trigger fired in case trigger trashes DOM thru rerendering
|
|
var hasUrlContainer = elementClosest(ev.target, '.fc-event-forced-url');
|
|
var url = hasUrlContainer ? hasUrlContainer.querySelector('a[href]').href : '';
|
|
context.emitter.trigger('eventClick', {
|
|
el: segEl,
|
|
event: new EventApi(component.context, seg.eventRange.def, seg.eventRange.instance),
|
|
jsEvent: ev,
|
|
view: context.viewApi,
|
|
});
|
|
if (url && !ev.defaultPrevented) {
|
|
window.location.href = url;
|
|
}
|
|
}
|
|
};
|
|
_this.destroy = listenBySelector(settings.el, 'click', '.fc-event', // on both fg and bg events
|
|
_this.handleSegClick);
|
|
return _this;
|
|
}
|
|
return EventClicking;
|
|
}(Interaction));
|
|
|
|
/*
|
|
Triggers events and adds/removes core classNames when the user's pointer
|
|
enters/leaves event-elements of a component.
|
|
*/
|
|
var EventHovering = /** @class */ (function (_super) {
|
|
__extends(EventHovering, _super);
|
|
function EventHovering(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
// for simulating an eventMouseLeave when the event el is destroyed while mouse is over it
|
|
_this.handleEventElRemove = function (el) {
|
|
if (el === _this.currentSegEl) {
|
|
_this.handleSegLeave(null, _this.currentSegEl);
|
|
}
|
|
};
|
|
_this.handleSegEnter = function (ev, segEl) {
|
|
if (getElSeg(segEl)) { // TODO: better way to make sure not hovering over more+ link or its wrapper
|
|
_this.currentSegEl = segEl;
|
|
_this.triggerEvent('eventMouseEnter', ev, segEl);
|
|
}
|
|
};
|
|
_this.handleSegLeave = function (ev, segEl) {
|
|
if (_this.currentSegEl) {
|
|
_this.currentSegEl = null;
|
|
_this.triggerEvent('eventMouseLeave', ev, segEl);
|
|
}
|
|
};
|
|
_this.removeHoverListeners = listenToHoverBySelector(settings.el, '.fc-event', // on both fg and bg events
|
|
_this.handleSegEnter, _this.handleSegLeave);
|
|
return _this;
|
|
}
|
|
EventHovering.prototype.destroy = function () {
|
|
this.removeHoverListeners();
|
|
};
|
|
EventHovering.prototype.triggerEvent = function (publicEvName, ev, segEl) {
|
|
var component = this.component;
|
|
var context = component.context;
|
|
var seg = getElSeg(segEl);
|
|
if (!ev || component.isValidSegDownEl(ev.target)) {
|
|
context.emitter.trigger(publicEvName, {
|
|
el: segEl,
|
|
event: new EventApi(context, seg.eventRange.def, seg.eventRange.instance),
|
|
jsEvent: ev,
|
|
view: context.viewApi,
|
|
});
|
|
}
|
|
};
|
|
return EventHovering;
|
|
}(Interaction));
|
|
|
|
var CalendarContent = /** @class */ (function (_super) {
|
|
__extends(CalendarContent, _super);
|
|
function CalendarContent() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildViewContext = memoize(buildViewContext);
|
|
_this.buildViewPropTransformers = memoize(buildViewPropTransformers);
|
|
_this.buildToolbarProps = memoize(buildToolbarProps);
|
|
_this.headerRef = createRef();
|
|
_this.footerRef = createRef();
|
|
_this.interactionsStore = {};
|
|
// eslint-disable-next-line
|
|
_this.state = {
|
|
viewLabelId: getUniqueDomId(),
|
|
};
|
|
// Component Registration
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
_this.registerInteractiveComponent = function (component, settingsInput) {
|
|
var settings = parseInteractionSettings(component, settingsInput);
|
|
var DEFAULT_INTERACTIONS = [
|
|
EventClicking,
|
|
EventHovering,
|
|
];
|
|
var interactionClasses = DEFAULT_INTERACTIONS.concat(_this.props.pluginHooks.componentInteractions);
|
|
var interactions = interactionClasses.map(function (TheInteractionClass) { return new TheInteractionClass(settings); });
|
|
_this.interactionsStore[component.uid] = interactions;
|
|
interactionSettingsStore[component.uid] = settings;
|
|
};
|
|
_this.unregisterInteractiveComponent = function (component) {
|
|
var listeners = _this.interactionsStore[component.uid];
|
|
if (listeners) {
|
|
for (var _i = 0, listeners_1 = listeners; _i < listeners_1.length; _i++) {
|
|
var listener = listeners_1[_i];
|
|
listener.destroy();
|
|
}
|
|
delete _this.interactionsStore[component.uid];
|
|
}
|
|
delete interactionSettingsStore[component.uid];
|
|
};
|
|
// Resizing
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
_this.resizeRunner = new DelayedRunner(function () {
|
|
_this.props.emitter.trigger('_resize', true); // should window resizes be considered "forced" ?
|
|
_this.props.emitter.trigger('windowResize', { view: _this.props.viewApi });
|
|
});
|
|
_this.handleWindowResize = function (ev) {
|
|
var options = _this.props.options;
|
|
if (options.handleWindowResize &&
|
|
ev.target === window // avoid jqui events
|
|
) {
|
|
_this.resizeRunner.request(options.windowResizeDelay);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
/*
|
|
renders INSIDE of an outer div
|
|
*/
|
|
CalendarContent.prototype.render = function () {
|
|
var props = this.props;
|
|
var toolbarConfig = props.toolbarConfig, options = props.options;
|
|
var toolbarProps = this.buildToolbarProps(props.viewSpec, props.dateProfile, props.dateProfileGenerator, props.currentDate, getNow(props.options.now, props.dateEnv), // TODO: use NowTimer????
|
|
props.viewTitle);
|
|
var viewVGrow = false;
|
|
var viewHeight = '';
|
|
var viewAspectRatio;
|
|
if (props.isHeightAuto || props.forPrint) {
|
|
viewHeight = '';
|
|
}
|
|
else if (options.height != null) {
|
|
viewVGrow = true;
|
|
}
|
|
else if (options.contentHeight != null) {
|
|
viewHeight = options.contentHeight;
|
|
}
|
|
else {
|
|
viewAspectRatio = Math.max(options.aspectRatio, 0.5); // prevent from getting too tall
|
|
}
|
|
var viewContext = this.buildViewContext(props.viewSpec, props.viewApi, props.options, props.dateProfileGenerator, props.dateEnv, props.theme, props.pluginHooks, props.dispatch, props.getCurrentData, props.emitter, props.calendarApi, this.registerInteractiveComponent, this.unregisterInteractiveComponent);
|
|
var viewLabelId = (toolbarConfig.header && toolbarConfig.header.hasTitle)
|
|
? this.state.viewLabelId
|
|
: '';
|
|
return (createElement(ViewContextType.Provider, { value: viewContext },
|
|
toolbarConfig.header && (createElement(Toolbar, __assign({ ref: this.headerRef, extraClassName: "fc-header-toolbar", model: toolbarConfig.header, titleId: viewLabelId }, toolbarProps))),
|
|
createElement(ViewContainer, { liquid: viewVGrow, height: viewHeight, aspectRatio: viewAspectRatio, labeledById: viewLabelId },
|
|
this.renderView(props),
|
|
this.buildAppendContent()),
|
|
toolbarConfig.footer && (createElement(Toolbar, __assign({ ref: this.footerRef, extraClassName: "fc-footer-toolbar", model: toolbarConfig.footer, titleId: "" }, toolbarProps)))));
|
|
};
|
|
CalendarContent.prototype.componentDidMount = function () {
|
|
var props = this.props;
|
|
this.calendarInteractions = props.pluginHooks.calendarInteractions
|
|
.map(function (CalendarInteractionClass) { return new CalendarInteractionClass(props); });
|
|
window.addEventListener('resize', this.handleWindowResize);
|
|
var propSetHandlers = props.pluginHooks.propSetHandlers;
|
|
for (var propName in propSetHandlers) {
|
|
propSetHandlers[propName](props[propName], props);
|
|
}
|
|
};
|
|
CalendarContent.prototype.componentDidUpdate = function (prevProps) {
|
|
var props = this.props;
|
|
var propSetHandlers = props.pluginHooks.propSetHandlers;
|
|
for (var propName in propSetHandlers) {
|
|
if (props[propName] !== prevProps[propName]) {
|
|
propSetHandlers[propName](props[propName], props);
|
|
}
|
|
}
|
|
};
|
|
CalendarContent.prototype.componentWillUnmount = function () {
|
|
window.removeEventListener('resize', this.handleWindowResize);
|
|
this.resizeRunner.clear();
|
|
for (var _i = 0, _a = this.calendarInteractions; _i < _a.length; _i++) {
|
|
var interaction = _a[_i];
|
|
interaction.destroy();
|
|
}
|
|
this.props.emitter.trigger('_unmount');
|
|
};
|
|
CalendarContent.prototype.buildAppendContent = function () {
|
|
var props = this.props;
|
|
var children = props.pluginHooks.viewContainerAppends.map(function (buildAppendContent) { return buildAppendContent(props); });
|
|
return createElement.apply(void 0, __spreadArray([Fragment, {}], children));
|
|
};
|
|
CalendarContent.prototype.renderView = function (props) {
|
|
var pluginHooks = props.pluginHooks;
|
|
var viewSpec = props.viewSpec;
|
|
var viewProps = {
|
|
dateProfile: props.dateProfile,
|
|
businessHours: props.businessHours,
|
|
eventStore: props.renderableEventStore,
|
|
eventUiBases: props.eventUiBases,
|
|
dateSelection: props.dateSelection,
|
|
eventSelection: props.eventSelection,
|
|
eventDrag: props.eventDrag,
|
|
eventResize: props.eventResize,
|
|
isHeightAuto: props.isHeightAuto,
|
|
forPrint: props.forPrint,
|
|
};
|
|
var transformers = this.buildViewPropTransformers(pluginHooks.viewPropsTransformers);
|
|
for (var _i = 0, transformers_1 = transformers; _i < transformers_1.length; _i++) {
|
|
var transformer = transformers_1[_i];
|
|
__assign(viewProps, transformer.transform(viewProps, props));
|
|
}
|
|
var ViewComponent = viewSpec.component;
|
|
return (createElement(ViewComponent, __assign({}, viewProps)));
|
|
};
|
|
return CalendarContent;
|
|
}(PureComponent));
|
|
function buildToolbarProps(viewSpec, dateProfile, dateProfileGenerator, currentDate, now, title) {
|
|
// don't force any date-profiles to valid date profiles (the `false`) so that we can tell if it's invalid
|
|
var todayInfo = dateProfileGenerator.build(now, undefined, false); // TODO: need `undefined` or else INFINITE LOOP for some reason
|
|
var prevInfo = dateProfileGenerator.buildPrev(dateProfile, currentDate, false);
|
|
var nextInfo = dateProfileGenerator.buildNext(dateProfile, currentDate, false);
|
|
return {
|
|
title: title,
|
|
activeButton: viewSpec.type,
|
|
navUnit: viewSpec.singleUnit,
|
|
isTodayEnabled: todayInfo.isValid && !rangeContainsMarker(dateProfile.currentRange, now),
|
|
isPrevEnabled: prevInfo.isValid,
|
|
isNextEnabled: nextInfo.isValid,
|
|
};
|
|
}
|
|
// Plugin
|
|
// -----------------------------------------------------------------------------------------------------------------
|
|
function buildViewPropTransformers(theClasses) {
|
|
return theClasses.map(function (TheClass) { return new TheClass(); });
|
|
}
|
|
|
|
var CalendarRoot = /** @class */ (function (_super) {
|
|
__extends(CalendarRoot, _super);
|
|
function CalendarRoot() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.state = {
|
|
forPrint: false,
|
|
};
|
|
_this.handleBeforePrint = function () {
|
|
_this.setState({ forPrint: true });
|
|
};
|
|
_this.handleAfterPrint = function () {
|
|
_this.setState({ forPrint: false });
|
|
};
|
|
return _this;
|
|
}
|
|
CalendarRoot.prototype.render = function () {
|
|
var props = this.props;
|
|
var options = props.options;
|
|
var forPrint = this.state.forPrint;
|
|
var isHeightAuto = forPrint || options.height === 'auto' || options.contentHeight === 'auto';
|
|
var height = (!isHeightAuto && options.height != null) ? options.height : '';
|
|
var classNames = [
|
|
'fc',
|
|
forPrint ? 'fc-media-print' : 'fc-media-screen',
|
|
"fc-direction-" + options.direction,
|
|
props.theme.getClass('root'),
|
|
];
|
|
if (!getCanVGrowWithinCell()) {
|
|
classNames.push('fc-liquid-hack');
|
|
}
|
|
return props.children(classNames, height, isHeightAuto, forPrint);
|
|
};
|
|
CalendarRoot.prototype.componentDidMount = function () {
|
|
var emitter = this.props.emitter;
|
|
emitter.on('_beforeprint', this.handleBeforePrint);
|
|
emitter.on('_afterprint', this.handleAfterPrint);
|
|
};
|
|
CalendarRoot.prototype.componentWillUnmount = function () {
|
|
var emitter = this.props.emitter;
|
|
emitter.off('_beforeprint', this.handleBeforePrint);
|
|
emitter.off('_afterprint', this.handleAfterPrint);
|
|
};
|
|
return CalendarRoot;
|
|
}(BaseComponent));
|
|
|
|
// Computes a default column header formatting string if `colFormat` is not explicitly defined
|
|
function computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt) {
|
|
// if more than one week row, or if there are a lot of columns with not much space,
|
|
// put just the day numbers will be in each cell
|
|
if (!datesRepDistinctDays || dayCnt > 10) {
|
|
return createFormatter({ weekday: 'short' }); // "Sat"
|
|
}
|
|
if (dayCnt > 1) {
|
|
return createFormatter({ weekday: 'short', month: 'numeric', day: 'numeric', omitCommas: true }); // "Sat 11/12"
|
|
}
|
|
return createFormatter({ weekday: 'long' }); // "Saturday"
|
|
}
|
|
|
|
var CLASS_NAME = 'fc-col-header-cell'; // do the cushion too? no
|
|
function renderInner$1(hookProps) {
|
|
return hookProps.text;
|
|
}
|
|
|
|
var TableDateCell = /** @class */ (function (_super) {
|
|
__extends(TableDateCell, _super);
|
|
function TableDateCell() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TableDateCell.prototype.render = function () {
|
|
var _a = this.context, dateEnv = _a.dateEnv, options = _a.options, theme = _a.theme, viewApi = _a.viewApi;
|
|
var props = this.props;
|
|
var date = props.date, dateProfile = props.dateProfile;
|
|
var dayMeta = getDateMeta(date, props.todayRange, null, dateProfile);
|
|
var classNames = [CLASS_NAME].concat(getDayClassNames(dayMeta, theme));
|
|
var text = dateEnv.format(date, props.dayHeaderFormat);
|
|
// if colCnt is 1, we are already in a day-view and don't need a navlink
|
|
var navLinkAttrs = (!dayMeta.isDisabled && props.colCnt > 1)
|
|
? buildNavLinkAttrs(this.context, date)
|
|
: {};
|
|
var hookProps = __assign(__assign(__assign({ date: dateEnv.toDate(date), view: viewApi }, props.extraHookProps), { text: text }), dayMeta);
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.dayHeaderClassNames, content: options.dayHeaderContent, defaultContent: renderInner$1, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("th", __assign({ ref: rootElRef, role: "columnheader", className: classNames.concat(customClassNames).join(' '), "data-date": !dayMeta.isDisabled ? formatDayString(date) : undefined, colSpan: props.colSpan }, props.extraDataAttrs),
|
|
createElement("div", { className: "fc-scrollgrid-sync-inner" }, !dayMeta.isDisabled && (createElement("a", __assign({ ref: innerElRef, className: [
|
|
'fc-col-header-cell-cushion',
|
|
props.isSticky ? 'fc-sticky' : '',
|
|
].join(' ') }, navLinkAttrs), innerContent))))); }));
|
|
};
|
|
return TableDateCell;
|
|
}(BaseComponent));
|
|
|
|
var WEEKDAY_FORMAT = createFormatter({ weekday: 'long' });
|
|
var TableDowCell = /** @class */ (function (_super) {
|
|
__extends(TableDowCell, _super);
|
|
function TableDowCell() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TableDowCell.prototype.render = function () {
|
|
var props = this.props;
|
|
var _a = this.context, dateEnv = _a.dateEnv, theme = _a.theme, viewApi = _a.viewApi, options = _a.options;
|
|
var date = addDays(new Date(259200000), props.dow); // start with Sun, 04 Jan 1970 00:00:00 GMT
|
|
var dateMeta = {
|
|
dow: props.dow,
|
|
isDisabled: false,
|
|
isFuture: false,
|
|
isPast: false,
|
|
isToday: false,
|
|
isOther: false,
|
|
};
|
|
var classNames = [CLASS_NAME].concat(getDayClassNames(dateMeta, theme), props.extraClassNames || []);
|
|
var text = dateEnv.format(date, props.dayHeaderFormat);
|
|
var hookProps = __assign(__assign(__assign(__assign({ // TODO: make this public?
|
|
date: date }, dateMeta), { view: viewApi }), props.extraHookProps), { text: text });
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.dayHeaderClassNames, content: options.dayHeaderContent, defaultContent: renderInner$1, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("th", __assign({ ref: rootElRef, role: "columnheader", className: classNames.concat(customClassNames).join(' '), colSpan: props.colSpan }, props.extraDataAttrs),
|
|
createElement("div", { className: "fc-scrollgrid-sync-inner" },
|
|
createElement("a", { "aria-label": dateEnv.format(date, WEEKDAY_FORMAT), className: [
|
|
'fc-col-header-cell-cushion',
|
|
props.isSticky ? 'fc-sticky' : '',
|
|
].join(' '), ref: innerElRef }, innerContent)))); }));
|
|
};
|
|
return TableDowCell;
|
|
}(BaseComponent));
|
|
|
|
var NowTimer = /** @class */ (function (_super) {
|
|
__extends(NowTimer, _super);
|
|
function NowTimer(props, context) {
|
|
var _this = _super.call(this, props, context) || this;
|
|
_this.initialNowDate = getNow(context.options.now, context.dateEnv);
|
|
_this.initialNowQueriedMs = new Date().valueOf();
|
|
_this.state = _this.computeTiming().currentState;
|
|
return _this;
|
|
}
|
|
NowTimer.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state;
|
|
return props.children(state.nowDate, state.todayRange);
|
|
};
|
|
NowTimer.prototype.componentDidMount = function () {
|
|
this.setTimeout();
|
|
};
|
|
NowTimer.prototype.componentDidUpdate = function (prevProps) {
|
|
if (prevProps.unit !== this.props.unit) {
|
|
this.clearTimeout();
|
|
this.setTimeout();
|
|
}
|
|
};
|
|
NowTimer.prototype.componentWillUnmount = function () {
|
|
this.clearTimeout();
|
|
};
|
|
NowTimer.prototype.computeTiming = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var unroundedNow = addMs(this.initialNowDate, new Date().valueOf() - this.initialNowQueriedMs);
|
|
var currentUnitStart = context.dateEnv.startOf(unroundedNow, props.unit);
|
|
var nextUnitStart = context.dateEnv.add(currentUnitStart, createDuration(1, props.unit));
|
|
var waitMs = nextUnitStart.valueOf() - unroundedNow.valueOf();
|
|
// there is a max setTimeout ms value (https://stackoverflow.com/a/3468650/96342)
|
|
// ensure no longer than a day
|
|
waitMs = Math.min(1000 * 60 * 60 * 24, waitMs);
|
|
return {
|
|
currentState: { nowDate: currentUnitStart, todayRange: buildDayRange(currentUnitStart) },
|
|
nextState: { nowDate: nextUnitStart, todayRange: buildDayRange(nextUnitStart) },
|
|
waitMs: waitMs,
|
|
};
|
|
};
|
|
NowTimer.prototype.setTimeout = function () {
|
|
var _this = this;
|
|
var _a = this.computeTiming(), nextState = _a.nextState, waitMs = _a.waitMs;
|
|
this.timeoutId = setTimeout(function () {
|
|
_this.setState(nextState, function () {
|
|
_this.setTimeout();
|
|
});
|
|
}, waitMs);
|
|
};
|
|
NowTimer.prototype.clearTimeout = function () {
|
|
if (this.timeoutId) {
|
|
clearTimeout(this.timeoutId);
|
|
}
|
|
};
|
|
NowTimer.contextType = ViewContextType;
|
|
return NowTimer;
|
|
}(Component));
|
|
function buildDayRange(date) {
|
|
var start = startOfDay(date);
|
|
var end = addDays(start, 1);
|
|
return { start: start, end: end };
|
|
}
|
|
|
|
var DayHeader = /** @class */ (function (_super) {
|
|
__extends(DayHeader, _super);
|
|
function DayHeader() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.createDayHeaderFormatter = memoize(createDayHeaderFormatter);
|
|
return _this;
|
|
}
|
|
DayHeader.prototype.render = function () {
|
|
var context = this.context;
|
|
var _a = this.props, dates = _a.dates, dateProfile = _a.dateProfile, datesRepDistinctDays = _a.datesRepDistinctDays, renderIntro = _a.renderIntro;
|
|
var dayHeaderFormat = this.createDayHeaderFormatter(context.options.dayHeaderFormat, datesRepDistinctDays, dates.length);
|
|
return (createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) { return (createElement("tr", { role: "row" },
|
|
renderIntro && renderIntro('day'),
|
|
dates.map(function (date) { return (datesRepDistinctDays ? (createElement(TableDateCell, { key: date.toISOString(), date: date, dateProfile: dateProfile, todayRange: todayRange, colCnt: dates.length, dayHeaderFormat: dayHeaderFormat })) : (createElement(TableDowCell, { key: date.getUTCDay(), dow: date.getUTCDay(), dayHeaderFormat: dayHeaderFormat }))); }))); }));
|
|
};
|
|
return DayHeader;
|
|
}(BaseComponent));
|
|
function createDayHeaderFormatter(explicitFormat, datesRepDistinctDays, dateCnt) {
|
|
return explicitFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dateCnt);
|
|
}
|
|
|
|
var DaySeriesModel = /** @class */ (function () {
|
|
function DaySeriesModel(range, dateProfileGenerator) {
|
|
var date = range.start;
|
|
var end = range.end;
|
|
var indices = [];
|
|
var dates = [];
|
|
var dayIndex = -1;
|
|
while (date < end) { // loop each day from start to end
|
|
if (dateProfileGenerator.isHiddenDay(date)) {
|
|
indices.push(dayIndex + 0.5); // mark that it's between indices
|
|
}
|
|
else {
|
|
dayIndex += 1;
|
|
indices.push(dayIndex);
|
|
dates.push(date);
|
|
}
|
|
date = addDays(date, 1);
|
|
}
|
|
this.dates = dates;
|
|
this.indices = indices;
|
|
this.cnt = dates.length;
|
|
}
|
|
DaySeriesModel.prototype.sliceRange = function (range) {
|
|
var firstIndex = this.getDateDayIndex(range.start); // inclusive first index
|
|
var lastIndex = this.getDateDayIndex(addDays(range.end, -1)); // inclusive last index
|
|
var clippedFirstIndex = Math.max(0, firstIndex);
|
|
var clippedLastIndex = Math.min(this.cnt - 1, lastIndex);
|
|
// deal with in-between indices
|
|
clippedFirstIndex = Math.ceil(clippedFirstIndex); // in-between starts round to next cell
|
|
clippedLastIndex = Math.floor(clippedLastIndex); // in-between ends round to prev cell
|
|
if (clippedFirstIndex <= clippedLastIndex) {
|
|
return {
|
|
firstIndex: clippedFirstIndex,
|
|
lastIndex: clippedLastIndex,
|
|
isStart: firstIndex === clippedFirstIndex,
|
|
isEnd: lastIndex === clippedLastIndex,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
// Given a date, returns its chronolocial cell-index from the first cell of the grid.
|
|
// If the date lies between cells (because of hiddenDays), returns a floating-point value between offsets.
|
|
// If before the first offset, returns a negative number.
|
|
// If after the last offset, returns an offset past the last cell offset.
|
|
// Only works for *start* dates of cells. Will not work for exclusive end dates for cells.
|
|
DaySeriesModel.prototype.getDateDayIndex = function (date) {
|
|
var indices = this.indices;
|
|
var dayOffset = Math.floor(diffDays(this.dates[0], date));
|
|
if (dayOffset < 0) {
|
|
return indices[0] - 1;
|
|
}
|
|
if (dayOffset >= indices.length) {
|
|
return indices[indices.length - 1] + 1;
|
|
}
|
|
return indices[dayOffset];
|
|
};
|
|
return DaySeriesModel;
|
|
}());
|
|
|
|
var DayTableModel = /** @class */ (function () {
|
|
function DayTableModel(daySeries, breakOnWeeks) {
|
|
var dates = daySeries.dates;
|
|
var daysPerRow;
|
|
var firstDay;
|
|
var rowCnt;
|
|
if (breakOnWeeks) {
|
|
// count columns until the day-of-week repeats
|
|
firstDay = dates[0].getUTCDay();
|
|
for (daysPerRow = 1; daysPerRow < dates.length; daysPerRow += 1) {
|
|
if (dates[daysPerRow].getUTCDay() === firstDay) {
|
|
break;
|
|
}
|
|
}
|
|
rowCnt = Math.ceil(dates.length / daysPerRow);
|
|
}
|
|
else {
|
|
rowCnt = 1;
|
|
daysPerRow = dates.length;
|
|
}
|
|
this.rowCnt = rowCnt;
|
|
this.colCnt = daysPerRow;
|
|
this.daySeries = daySeries;
|
|
this.cells = this.buildCells();
|
|
this.headerDates = this.buildHeaderDates();
|
|
}
|
|
DayTableModel.prototype.buildCells = function () {
|
|
var rows = [];
|
|
for (var row = 0; row < this.rowCnt; row += 1) {
|
|
var cells = [];
|
|
for (var col = 0; col < this.colCnt; col += 1) {
|
|
cells.push(this.buildCell(row, col));
|
|
}
|
|
rows.push(cells);
|
|
}
|
|
return rows;
|
|
};
|
|
DayTableModel.prototype.buildCell = function (row, col) {
|
|
var date = this.daySeries.dates[row * this.colCnt + col];
|
|
return {
|
|
key: date.toISOString(),
|
|
date: date,
|
|
};
|
|
};
|
|
DayTableModel.prototype.buildHeaderDates = function () {
|
|
var dates = [];
|
|
for (var col = 0; col < this.colCnt; col += 1) {
|
|
dates.push(this.cells[0][col].date);
|
|
}
|
|
return dates;
|
|
};
|
|
DayTableModel.prototype.sliceRange = function (range) {
|
|
var colCnt = this.colCnt;
|
|
var seriesSeg = this.daySeries.sliceRange(range);
|
|
var segs = [];
|
|
if (seriesSeg) {
|
|
var firstIndex = seriesSeg.firstIndex, lastIndex = seriesSeg.lastIndex;
|
|
var index = firstIndex;
|
|
while (index <= lastIndex) {
|
|
var row = Math.floor(index / colCnt);
|
|
var nextIndex = Math.min((row + 1) * colCnt, lastIndex + 1);
|
|
segs.push({
|
|
row: row,
|
|
firstCol: index % colCnt,
|
|
lastCol: (nextIndex - 1) % colCnt,
|
|
isStart: seriesSeg.isStart && index === firstIndex,
|
|
isEnd: seriesSeg.isEnd && (nextIndex - 1) === lastIndex,
|
|
});
|
|
index = nextIndex;
|
|
}
|
|
}
|
|
return segs;
|
|
};
|
|
return DayTableModel;
|
|
}());
|
|
|
|
var Slicer = /** @class */ (function () {
|
|
function Slicer() {
|
|
this.sliceBusinessHours = memoize(this._sliceBusinessHours);
|
|
this.sliceDateSelection = memoize(this._sliceDateSpan);
|
|
this.sliceEventStore = memoize(this._sliceEventStore);
|
|
this.sliceEventDrag = memoize(this._sliceInteraction);
|
|
this.sliceEventResize = memoize(this._sliceInteraction);
|
|
this.forceDayIfListItem = false; // hack
|
|
}
|
|
Slicer.prototype.sliceProps = function (props, dateProfile, nextDayThreshold, context) {
|
|
var extraArgs = [];
|
|
for (var _i = 4; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 4] = arguments[_i];
|
|
}
|
|
var eventUiBases = props.eventUiBases;
|
|
var eventSegs = this.sliceEventStore.apply(this, __spreadArray([props.eventStore, eventUiBases, dateProfile, nextDayThreshold], extraArgs));
|
|
return {
|
|
dateSelectionSegs: this.sliceDateSelection.apply(this, __spreadArray([props.dateSelection, eventUiBases, context], extraArgs)),
|
|
businessHourSegs: this.sliceBusinessHours.apply(this, __spreadArray([props.businessHours, dateProfile, nextDayThreshold, context], extraArgs)),
|
|
fgEventSegs: eventSegs.fg,
|
|
bgEventSegs: eventSegs.bg,
|
|
eventDrag: this.sliceEventDrag.apply(this, __spreadArray([props.eventDrag, eventUiBases, dateProfile, nextDayThreshold], extraArgs)),
|
|
eventResize: this.sliceEventResize.apply(this, __spreadArray([props.eventResize, eventUiBases, dateProfile, nextDayThreshold], extraArgs)),
|
|
eventSelection: props.eventSelection,
|
|
}; // TODO: give interactionSegs?
|
|
};
|
|
Slicer.prototype.sliceNowDate = function (// does not memoize
|
|
date, context) {
|
|
var extraArgs = [];
|
|
for (var _i = 2; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 2] = arguments[_i];
|
|
}
|
|
return this._sliceDateSpan.apply(this, __spreadArray([{ range: { start: date, end: addMs(date, 1) }, allDay: false },
|
|
{},
|
|
context], extraArgs));
|
|
};
|
|
Slicer.prototype._sliceBusinessHours = function (businessHours, dateProfile, nextDayThreshold, context) {
|
|
var extraArgs = [];
|
|
for (var _i = 4; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 4] = arguments[_i];
|
|
}
|
|
if (!businessHours) {
|
|
return [];
|
|
}
|
|
return this._sliceEventStore.apply(this, __spreadArray([expandRecurring(businessHours, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), context),
|
|
{},
|
|
dateProfile,
|
|
nextDayThreshold], extraArgs)).bg;
|
|
};
|
|
Slicer.prototype._sliceEventStore = function (eventStore, eventUiBases, dateProfile, nextDayThreshold) {
|
|
var extraArgs = [];
|
|
for (var _i = 4; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 4] = arguments[_i];
|
|
}
|
|
if (eventStore) {
|
|
var rangeRes = sliceEventStore(eventStore, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
|
|
return {
|
|
bg: this.sliceEventRanges(rangeRes.bg, extraArgs),
|
|
fg: this.sliceEventRanges(rangeRes.fg, extraArgs),
|
|
};
|
|
}
|
|
return { bg: [], fg: [] };
|
|
};
|
|
Slicer.prototype._sliceInteraction = function (interaction, eventUiBases, dateProfile, nextDayThreshold) {
|
|
var extraArgs = [];
|
|
for (var _i = 4; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 4] = arguments[_i];
|
|
}
|
|
if (!interaction) {
|
|
return null;
|
|
}
|
|
var rangeRes = sliceEventStore(interaction.mutatedEvents, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
|
|
return {
|
|
segs: this.sliceEventRanges(rangeRes.fg, extraArgs),
|
|
affectedInstances: interaction.affectedEvents.instances,
|
|
isEvent: interaction.isEvent,
|
|
};
|
|
};
|
|
Slicer.prototype._sliceDateSpan = function (dateSpan, eventUiBases, context) {
|
|
var extraArgs = [];
|
|
for (var _i = 3; _i < arguments.length; _i++) {
|
|
extraArgs[_i - 3] = arguments[_i];
|
|
}
|
|
if (!dateSpan) {
|
|
return [];
|
|
}
|
|
var eventRange = fabricateEventRange(dateSpan, eventUiBases, context);
|
|
var segs = this.sliceRange.apply(this, __spreadArray([dateSpan.range], extraArgs));
|
|
for (var _a = 0, segs_1 = segs; _a < segs_1.length; _a++) {
|
|
var seg = segs_1[_a];
|
|
seg.eventRange = eventRange;
|
|
}
|
|
return segs;
|
|
};
|
|
/*
|
|
"complete" seg means it has component and eventRange
|
|
*/
|
|
Slicer.prototype.sliceEventRanges = function (eventRanges, extraArgs) {
|
|
var segs = [];
|
|
for (var _i = 0, eventRanges_1 = eventRanges; _i < eventRanges_1.length; _i++) {
|
|
var eventRange = eventRanges_1[_i];
|
|
segs.push.apply(segs, this.sliceEventRange(eventRange, extraArgs));
|
|
}
|
|
return segs;
|
|
};
|
|
/*
|
|
"complete" seg means it has component and eventRange
|
|
*/
|
|
Slicer.prototype.sliceEventRange = function (eventRange, extraArgs) {
|
|
var dateRange = eventRange.range;
|
|
// hack to make multi-day events that are being force-displayed as list-items to take up only one day
|
|
if (this.forceDayIfListItem && eventRange.ui.display === 'list-item') {
|
|
dateRange = {
|
|
start: dateRange.start,
|
|
end: addDays(dateRange.start, 1),
|
|
};
|
|
}
|
|
var segs = this.sliceRange.apply(this, __spreadArray([dateRange], extraArgs));
|
|
for (var _i = 0, segs_2 = segs; _i < segs_2.length; _i++) {
|
|
var seg = segs_2[_i];
|
|
seg.eventRange = eventRange;
|
|
seg.isStart = eventRange.isStart && seg.isStart;
|
|
seg.isEnd = eventRange.isEnd && seg.isEnd;
|
|
}
|
|
return segs;
|
|
};
|
|
return Slicer;
|
|
}());
|
|
/*
|
|
for incorporating slotMinTime/slotMaxTime if appropriate
|
|
TODO: should be part of DateProfile!
|
|
TimelineDateProfile already does this btw
|
|
*/
|
|
function computeActiveRange(dateProfile, isComponentAllDay) {
|
|
var range = dateProfile.activeRange;
|
|
if (isComponentAllDay) {
|
|
return range;
|
|
}
|
|
return {
|
|
start: addMs(range.start, dateProfile.slotMinTime.milliseconds),
|
|
end: addMs(range.end, dateProfile.slotMaxTime.milliseconds - 864e5), // 864e5 = ms in a day
|
|
};
|
|
}
|
|
|
|
// high-level segmenting-aware tester functions
|
|
// ------------------------------------------------------------------------------------------------------------------------
|
|
function isInteractionValid(interaction, dateProfile, context) {
|
|
var instances = interaction.mutatedEvents.instances;
|
|
for (var instanceId in instances) {
|
|
if (!rangeContainsRange(dateProfile.validRange, instances[instanceId].range)) {
|
|
return false;
|
|
}
|
|
}
|
|
return isNewPropsValid({ eventDrag: interaction }, context); // HACK: the eventDrag props is used for ALL interactions
|
|
}
|
|
function isDateSelectionValid(dateSelection, dateProfile, context) {
|
|
if (!rangeContainsRange(dateProfile.validRange, dateSelection.range)) {
|
|
return false;
|
|
}
|
|
return isNewPropsValid({ dateSelection: dateSelection }, context);
|
|
}
|
|
function isNewPropsValid(newProps, context) {
|
|
var calendarState = context.getCurrentData();
|
|
var props = __assign({ businessHours: calendarState.businessHours, dateSelection: '', eventStore: calendarState.eventStore, eventUiBases: calendarState.eventUiBases, eventSelection: '', eventDrag: null, eventResize: null }, newProps);
|
|
return (context.pluginHooks.isPropsValid || isPropsValid)(props, context);
|
|
}
|
|
function isPropsValid(state, context, dateSpanMeta, filterConfig) {
|
|
if (dateSpanMeta === void 0) { dateSpanMeta = {}; }
|
|
if (state.eventDrag && !isInteractionPropsValid(state, context, dateSpanMeta, filterConfig)) {
|
|
return false;
|
|
}
|
|
if (state.dateSelection && !isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig)) {
|
|
return false;
|
|
}
|
|
return true;
|
|
}
|
|
// Moving Event Validation
|
|
// ------------------------------------------------------------------------------------------------------------------------
|
|
function isInteractionPropsValid(state, context, dateSpanMeta, filterConfig) {
|
|
var currentState = context.getCurrentData();
|
|
var interaction = state.eventDrag; // HACK: the eventDrag props is used for ALL interactions
|
|
var subjectEventStore = interaction.mutatedEvents;
|
|
var subjectDefs = subjectEventStore.defs;
|
|
var subjectInstances = subjectEventStore.instances;
|
|
var subjectConfigs = compileEventUis(subjectDefs, interaction.isEvent ?
|
|
state.eventUiBases :
|
|
{ '': currentState.selectionConfig });
|
|
if (filterConfig) {
|
|
subjectConfigs = mapHash(subjectConfigs, filterConfig);
|
|
}
|
|
// exclude the subject events. TODO: exclude defs too?
|
|
var otherEventStore = excludeInstances(state.eventStore, interaction.affectedEvents.instances);
|
|
var otherDefs = otherEventStore.defs;
|
|
var otherInstances = otherEventStore.instances;
|
|
var otherConfigs = compileEventUis(otherDefs, state.eventUiBases);
|
|
for (var subjectInstanceId in subjectInstances) {
|
|
var subjectInstance = subjectInstances[subjectInstanceId];
|
|
var subjectRange = subjectInstance.range;
|
|
var subjectConfig = subjectConfigs[subjectInstance.defId];
|
|
var subjectDef = subjectDefs[subjectInstance.defId];
|
|
// constraint
|
|
if (!allConstraintsPass(subjectConfig.constraints, subjectRange, otherEventStore, state.businessHours, context)) {
|
|
return false;
|
|
}
|
|
// overlap
|
|
var eventOverlap = context.options.eventOverlap;
|
|
var eventOverlapFunc = typeof eventOverlap === 'function' ? eventOverlap : null;
|
|
for (var otherInstanceId in otherInstances) {
|
|
var otherInstance = otherInstances[otherInstanceId];
|
|
// intersect! evaluate
|
|
if (rangesIntersect(subjectRange, otherInstance.range)) {
|
|
var otherOverlap = otherConfigs[otherInstance.defId].overlap;
|
|
// consider the other event's overlap. only do this if the subject event is a "real" event
|
|
if (otherOverlap === false && interaction.isEvent) {
|
|
return false;
|
|
}
|
|
if (subjectConfig.overlap === false) {
|
|
return false;
|
|
}
|
|
if (eventOverlapFunc && !eventOverlapFunc(new EventApi(context, otherDefs[otherInstance.defId], otherInstance), // still event
|
|
new EventApi(context, subjectDef, subjectInstance))) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
// allow (a function)
|
|
var calendarEventStore = currentState.eventStore; // need global-to-calendar, not local to component (splittable)state
|
|
for (var _i = 0, _a = subjectConfig.allows; _i < _a.length; _i++) {
|
|
var subjectAllow = _a[_i];
|
|
var subjectDateSpan = __assign(__assign({}, dateSpanMeta), { range: subjectInstance.range, allDay: subjectDef.allDay });
|
|
var origDef = calendarEventStore.defs[subjectDef.defId];
|
|
var origInstance = calendarEventStore.instances[subjectInstanceId];
|
|
var eventApi = void 0;
|
|
if (origDef) { // was previously in the calendar
|
|
eventApi = new EventApi(context, origDef, origInstance);
|
|
}
|
|
else { // was an external event
|
|
eventApi = new EventApi(context, subjectDef); // no instance, because had no dates
|
|
}
|
|
if (!subjectAllow(buildDateSpanApiWithContext(subjectDateSpan, context), eventApi)) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
// Date Selection Validation
|
|
// ------------------------------------------------------------------------------------------------------------------------
|
|
function isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig) {
|
|
var relevantEventStore = state.eventStore;
|
|
var relevantDefs = relevantEventStore.defs;
|
|
var relevantInstances = relevantEventStore.instances;
|
|
var selection = state.dateSelection;
|
|
var selectionRange = selection.range;
|
|
var selectionConfig = context.getCurrentData().selectionConfig;
|
|
if (filterConfig) {
|
|
selectionConfig = filterConfig(selectionConfig);
|
|
}
|
|
// constraint
|
|
if (!allConstraintsPass(selectionConfig.constraints, selectionRange, relevantEventStore, state.businessHours, context)) {
|
|
return false;
|
|
}
|
|
// overlap
|
|
var selectOverlap = context.options.selectOverlap;
|
|
var selectOverlapFunc = typeof selectOverlap === 'function' ? selectOverlap : null;
|
|
for (var relevantInstanceId in relevantInstances) {
|
|
var relevantInstance = relevantInstances[relevantInstanceId];
|
|
// intersect! evaluate
|
|
if (rangesIntersect(selectionRange, relevantInstance.range)) {
|
|
if (selectionConfig.overlap === false) {
|
|
return false;
|
|
}
|
|
if (selectOverlapFunc && !selectOverlapFunc(new EventApi(context, relevantDefs[relevantInstance.defId], relevantInstance), null)) {
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
// allow (a function)
|
|
for (var _i = 0, _a = selectionConfig.allows; _i < _a.length; _i++) {
|
|
var selectionAllow = _a[_i];
|
|
var fullDateSpan = __assign(__assign({}, dateSpanMeta), selection);
|
|
if (!selectionAllow(buildDateSpanApiWithContext(fullDateSpan, context), null)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
// Constraint Utils
|
|
// ------------------------------------------------------------------------------------------------------------------------
|
|
function allConstraintsPass(constraints, subjectRange, otherEventStore, businessHoursUnexpanded, context) {
|
|
for (var _i = 0, constraints_1 = constraints; _i < constraints_1.length; _i++) {
|
|
var constraint = constraints_1[_i];
|
|
if (!anyRangesContainRange(constraintToRanges(constraint, subjectRange, otherEventStore, businessHoursUnexpanded, context), subjectRange)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
function constraintToRanges(constraint, subjectRange, // for expanding a recurring constraint, or expanding business hours
|
|
otherEventStore, // for if constraint is an even group ID
|
|
businessHoursUnexpanded, // for if constraint is 'businessHours'
|
|
context) {
|
|
if (constraint === 'businessHours') {
|
|
return eventStoreToRanges(expandRecurring(businessHoursUnexpanded, subjectRange, context));
|
|
}
|
|
if (typeof constraint === 'string') { // an group ID
|
|
return eventStoreToRanges(filterEventStoreDefs(otherEventStore, function (eventDef) { return eventDef.groupId === constraint; }));
|
|
}
|
|
if (typeof constraint === 'object' && constraint) { // non-null object
|
|
return eventStoreToRanges(expandRecurring(constraint, subjectRange, context));
|
|
}
|
|
return []; // if it's false
|
|
}
|
|
// TODO: move to event-store file?
|
|
function eventStoreToRanges(eventStore) {
|
|
var instances = eventStore.instances;
|
|
var ranges = [];
|
|
for (var instanceId in instances) {
|
|
ranges.push(instances[instanceId].range);
|
|
}
|
|
return ranges;
|
|
}
|
|
// TODO: move to geom file?
|
|
function anyRangesContainRange(outerRanges, innerRange) {
|
|
for (var _i = 0, outerRanges_1 = outerRanges; _i < outerRanges_1.length; _i++) {
|
|
var outerRange = outerRanges_1[_i];
|
|
if (rangeContainsRange(outerRange, innerRange)) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
var VISIBLE_HIDDEN_RE = /^(visible|hidden)$/;
|
|
var Scroller = /** @class */ (function (_super) {
|
|
__extends(Scroller, _super);
|
|
function Scroller() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.handleEl = function (el) {
|
|
_this.el = el;
|
|
setRef(_this.props.elRef, el);
|
|
};
|
|
return _this;
|
|
}
|
|
Scroller.prototype.render = function () {
|
|
var props = this.props;
|
|
var liquid = props.liquid, liquidIsAbsolute = props.liquidIsAbsolute;
|
|
var isAbsolute = liquid && liquidIsAbsolute;
|
|
var className = ['fc-scroller'];
|
|
if (liquid) {
|
|
if (liquidIsAbsolute) {
|
|
className.push('fc-scroller-liquid-absolute');
|
|
}
|
|
else {
|
|
className.push('fc-scroller-liquid');
|
|
}
|
|
}
|
|
return (createElement("div", { ref: this.handleEl, className: className.join(' '), style: {
|
|
overflowX: props.overflowX,
|
|
overflowY: props.overflowY,
|
|
left: (isAbsolute && -(props.overcomeLeft || 0)) || '',
|
|
right: (isAbsolute && -(props.overcomeRight || 0)) || '',
|
|
bottom: (isAbsolute && -(props.overcomeBottom || 0)) || '',
|
|
marginLeft: (!isAbsolute && -(props.overcomeLeft || 0)) || '',
|
|
marginRight: (!isAbsolute && -(props.overcomeRight || 0)) || '',
|
|
marginBottom: (!isAbsolute && -(props.overcomeBottom || 0)) || '',
|
|
maxHeight: props.maxHeight || '',
|
|
} }, props.children));
|
|
};
|
|
Scroller.prototype.needsXScrolling = function () {
|
|
if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
|
|
return false;
|
|
}
|
|
// testing scrollWidth>clientWidth is unreliable cross-browser when pixel heights aren't integers.
|
|
// much more reliable to see if children are taller than the scroller, even tho doesn't account for
|
|
// inner-child margins and absolute positioning
|
|
var el = this.el;
|
|
var realClientWidth = this.el.getBoundingClientRect().width - this.getYScrollbarWidth();
|
|
var children = el.children;
|
|
for (var i = 0; i < children.length; i += 1) {
|
|
var childEl = children[i];
|
|
if (childEl.getBoundingClientRect().width > realClientWidth) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
};
|
|
Scroller.prototype.needsYScrolling = function () {
|
|
if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
|
|
return false;
|
|
}
|
|
// testing scrollHeight>clientHeight is unreliable cross-browser when pixel heights aren't integers.
|
|
// much more reliable to see if children are taller than the scroller, even tho doesn't account for
|
|
// inner-child margins and absolute positioning
|
|
var el = this.el;
|
|
var realClientHeight = this.el.getBoundingClientRect().height - this.getXScrollbarWidth();
|
|
var children = el.children;
|
|
for (var i = 0; i < children.length; i += 1) {
|
|
var childEl = children[i];
|
|
if (childEl.getBoundingClientRect().height > realClientHeight) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
};
|
|
Scroller.prototype.getXScrollbarWidth = function () {
|
|
if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
|
|
return 0;
|
|
}
|
|
return this.el.offsetHeight - this.el.clientHeight; // only works because we guarantee no borders. TODO: add to CSS with important?
|
|
};
|
|
Scroller.prototype.getYScrollbarWidth = function () {
|
|
if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
|
|
return 0;
|
|
}
|
|
return this.el.offsetWidth - this.el.clientWidth; // only works because we guarantee no borders. TODO: add to CSS with important?
|
|
};
|
|
return Scroller;
|
|
}(BaseComponent));
|
|
|
|
/*
|
|
TODO: somehow infer OtherArgs from masterCallback?
|
|
TODO: infer RefType from masterCallback if provided
|
|
*/
|
|
var RefMap = /** @class */ (function () {
|
|
function RefMap(masterCallback) {
|
|
var _this = this;
|
|
this.masterCallback = masterCallback;
|
|
this.currentMap = {};
|
|
this.depths = {};
|
|
this.callbackMap = {};
|
|
this.handleValue = function (val, key) {
|
|
var _a = _this, depths = _a.depths, currentMap = _a.currentMap;
|
|
var removed = false;
|
|
var added = false;
|
|
if (val !== null) {
|
|
// for bug... ACTUALLY: can probably do away with this now that callers don't share numeric indices anymore
|
|
removed = (key in currentMap);
|
|
currentMap[key] = val;
|
|
depths[key] = (depths[key] || 0) + 1;
|
|
added = true;
|
|
}
|
|
else {
|
|
depths[key] -= 1;
|
|
if (!depths[key]) {
|
|
delete currentMap[key];
|
|
delete _this.callbackMap[key];
|
|
removed = true;
|
|
}
|
|
}
|
|
if (_this.masterCallback) {
|
|
if (removed) {
|
|
_this.masterCallback(null, String(key));
|
|
}
|
|
if (added) {
|
|
_this.masterCallback(val, String(key));
|
|
}
|
|
}
|
|
};
|
|
}
|
|
RefMap.prototype.createRef = function (key) {
|
|
var _this = this;
|
|
var refCallback = this.callbackMap[key];
|
|
if (!refCallback) {
|
|
refCallback = this.callbackMap[key] = function (val) {
|
|
_this.handleValue(val, String(key));
|
|
};
|
|
}
|
|
return refCallback;
|
|
};
|
|
// TODO: check callers that don't care about order. should use getAll instead
|
|
// NOTE: this method has become less valuable now that we are encouraged to map order by some other index
|
|
// TODO: provide ONE array-export function, buildArray, which fails on non-numeric indexes. caller can manipulate and "collect"
|
|
RefMap.prototype.collect = function (startIndex, endIndex, step) {
|
|
return collectFromHash(this.currentMap, startIndex, endIndex, step);
|
|
};
|
|
RefMap.prototype.getAll = function () {
|
|
return hashValuesToArray(this.currentMap);
|
|
};
|
|
return RefMap;
|
|
}());
|
|
|
|
function computeShrinkWidth(chunkEls) {
|
|
var shrinkCells = findElements(chunkEls, '.fc-scrollgrid-shrink');
|
|
var largestWidth = 0;
|
|
for (var _i = 0, shrinkCells_1 = shrinkCells; _i < shrinkCells_1.length; _i++) {
|
|
var shrinkCell = shrinkCells_1[_i];
|
|
largestWidth = Math.max(largestWidth, computeSmallestCellWidth(shrinkCell));
|
|
}
|
|
return Math.ceil(largestWidth); // <table> elements work best with integers. round up to ensure contents fits
|
|
}
|
|
function getSectionHasLiquidHeight(props, sectionConfig) {
|
|
return props.liquid && sectionConfig.liquid; // does the section do liquid-height? (need to have whole scrollgrid liquid-height as well)
|
|
}
|
|
function getAllowYScrolling(props, sectionConfig) {
|
|
return sectionConfig.maxHeight != null || // if its possible for the height to max out, we might need scrollbars
|
|
getSectionHasLiquidHeight(props, sectionConfig); // if the section is liquid height, it might condense enough to require scrollbars
|
|
}
|
|
// TODO: ONLY use `arg`. force out internal function to use same API
|
|
function renderChunkContent(sectionConfig, chunkConfig, arg, isHeader) {
|
|
var expandRows = arg.expandRows;
|
|
var content = typeof chunkConfig.content === 'function' ?
|
|
chunkConfig.content(arg) :
|
|
createElement('table', {
|
|
role: 'presentation',
|
|
className: [
|
|
chunkConfig.tableClassName,
|
|
sectionConfig.syncRowHeights ? 'fc-scrollgrid-sync-table' : '',
|
|
].join(' '),
|
|
style: {
|
|
minWidth: arg.tableMinWidth,
|
|
width: arg.clientWidth,
|
|
height: expandRows ? arg.clientHeight : '', // css `height` on a <table> serves as a min-height
|
|
},
|
|
}, arg.tableColGroupNode, createElement(isHeader ? 'thead' : 'tbody', {
|
|
role: 'presentation',
|
|
}, typeof chunkConfig.rowContent === 'function'
|
|
? chunkConfig.rowContent(arg)
|
|
: chunkConfig.rowContent));
|
|
return content;
|
|
}
|
|
function isColPropsEqual(cols0, cols1) {
|
|
return isArraysEqual(cols0, cols1, isPropsEqual);
|
|
}
|
|
function renderMicroColGroup(cols, shrinkWidth) {
|
|
var colNodes = [];
|
|
/*
|
|
for ColProps with spans, it would have been great to make a single <col span="">
|
|
HOWEVER, Chrome was getting messing up distributing the width to <td>/<th> elements with colspans.
|
|
SOLUTION: making individual <col> elements makes Chrome behave.
|
|
*/
|
|
for (var _i = 0, cols_1 = cols; _i < cols_1.length; _i++) {
|
|
var colProps = cols_1[_i];
|
|
var span = colProps.span || 1;
|
|
for (var i = 0; i < span; i += 1) {
|
|
colNodes.push(createElement("col", { style: {
|
|
width: colProps.width === 'shrink' ? sanitizeShrinkWidth(shrinkWidth) : (colProps.width || ''),
|
|
minWidth: colProps.minWidth || '',
|
|
} }));
|
|
}
|
|
}
|
|
return createElement.apply(void 0, __spreadArray(['colgroup', {}], colNodes));
|
|
}
|
|
function sanitizeShrinkWidth(shrinkWidth) {
|
|
/* why 4? if we do 0, it will kill any border, which are needed for computeSmallestCellWidth
|
|
4 accounts for 2 2-pixel borders. TODO: better solution? */
|
|
return shrinkWidth == null ? 4 : shrinkWidth;
|
|
}
|
|
function hasShrinkWidth(cols) {
|
|
for (var _i = 0, cols_2 = cols; _i < cols_2.length; _i++) {
|
|
var col = cols_2[_i];
|
|
if (col.width === 'shrink') {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function getScrollGridClassNames(liquid, context) {
|
|
var classNames = [
|
|
'fc-scrollgrid',
|
|
context.theme.getClass('table'),
|
|
];
|
|
if (liquid) {
|
|
classNames.push('fc-scrollgrid-liquid');
|
|
}
|
|
return classNames;
|
|
}
|
|
function getSectionClassNames(sectionConfig, wholeTableVGrow) {
|
|
var classNames = [
|
|
'fc-scrollgrid-section',
|
|
"fc-scrollgrid-section-" + sectionConfig.type,
|
|
sectionConfig.className, // used?
|
|
];
|
|
if (wholeTableVGrow && sectionConfig.liquid && sectionConfig.maxHeight == null) {
|
|
classNames.push('fc-scrollgrid-section-liquid');
|
|
}
|
|
if (sectionConfig.isSticky) {
|
|
classNames.push('fc-scrollgrid-section-sticky');
|
|
}
|
|
return classNames;
|
|
}
|
|
function renderScrollShim(arg) {
|
|
return (createElement("div", { className: "fc-scrollgrid-sticky-shim", style: {
|
|
width: arg.clientWidth,
|
|
minWidth: arg.tableMinWidth,
|
|
} }));
|
|
}
|
|
function getStickyHeaderDates(options) {
|
|
var stickyHeaderDates = options.stickyHeaderDates;
|
|
if (stickyHeaderDates == null || stickyHeaderDates === 'auto') {
|
|
stickyHeaderDates = options.height === 'auto' || options.viewHeight === 'auto';
|
|
}
|
|
return stickyHeaderDates;
|
|
}
|
|
function getStickyFooterScrollbar(options) {
|
|
var stickyFooterScrollbar = options.stickyFooterScrollbar;
|
|
if (stickyFooterScrollbar == null || stickyFooterScrollbar === 'auto') {
|
|
stickyFooterScrollbar = options.height === 'auto' || options.viewHeight === 'auto';
|
|
}
|
|
return stickyFooterScrollbar;
|
|
}
|
|
|
|
var SimpleScrollGrid = /** @class */ (function (_super) {
|
|
__extends(SimpleScrollGrid, _super);
|
|
function SimpleScrollGrid() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.processCols = memoize(function (a) { return a; }, isColPropsEqual); // so we get same `cols` props every time
|
|
// yucky to memoize VNodes, but much more efficient for consumers
|
|
_this.renderMicroColGroup = memoize(renderMicroColGroup);
|
|
_this.scrollerRefs = new RefMap();
|
|
_this.scrollerElRefs = new RefMap(_this._handleScrollerEl.bind(_this));
|
|
_this.state = {
|
|
shrinkWidth: null,
|
|
forceYScrollbars: false,
|
|
scrollerClientWidths: {},
|
|
scrollerClientHeights: {},
|
|
};
|
|
// TODO: can do a really simple print-view. dont need to join rows
|
|
_this.handleSizing = function () {
|
|
_this.safeSetState(__assign({ shrinkWidth: _this.computeShrinkWidth() }, _this.computeScrollerDims()));
|
|
};
|
|
return _this;
|
|
}
|
|
SimpleScrollGrid.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var sectionConfigs = props.sections || [];
|
|
var cols = this.processCols(props.cols);
|
|
var microColGroupNode = this.renderMicroColGroup(cols, state.shrinkWidth);
|
|
var classNames = getScrollGridClassNames(props.liquid, context);
|
|
if (props.collapsibleWidth) {
|
|
classNames.push('fc-scrollgrid-collapsible');
|
|
}
|
|
// TODO: make DRY
|
|
var configCnt = sectionConfigs.length;
|
|
var configI = 0;
|
|
var currentConfig;
|
|
var headSectionNodes = [];
|
|
var bodySectionNodes = [];
|
|
var footSectionNodes = [];
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'header') {
|
|
headSectionNodes.push(this.renderSection(currentConfig, microColGroupNode, true));
|
|
configI += 1;
|
|
}
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'body') {
|
|
bodySectionNodes.push(this.renderSection(currentConfig, microColGroupNode, false));
|
|
configI += 1;
|
|
}
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'footer') {
|
|
footSectionNodes.push(this.renderSection(currentConfig, microColGroupNode, true));
|
|
configI += 1;
|
|
}
|
|
// firefox bug: when setting height on table and there is a thead or tfoot,
|
|
// the necessary height:100% on the liquid-height body section forces the *whole* table to be taller. (bug #5524)
|
|
// use getCanVGrowWithinCell as a way to detect table-stupid firefox.
|
|
// if so, use a simpler dom structure, jam everything into a lone tbody.
|
|
var isBuggy = !getCanVGrowWithinCell();
|
|
var roleAttrs = { role: 'rowgroup' };
|
|
return createElement('table', {
|
|
role: 'grid',
|
|
className: classNames.join(' '),
|
|
style: { height: props.height },
|
|
}, Boolean(!isBuggy && headSectionNodes.length) && createElement.apply(void 0, __spreadArray(['thead', roleAttrs], headSectionNodes)), Boolean(!isBuggy && bodySectionNodes.length) && createElement.apply(void 0, __spreadArray(['tbody', roleAttrs], bodySectionNodes)), Boolean(!isBuggy && footSectionNodes.length) && createElement.apply(void 0, __spreadArray(['tfoot', roleAttrs], footSectionNodes)), isBuggy && createElement.apply(void 0, __spreadArray(__spreadArray(__spreadArray(['tbody', roleAttrs], headSectionNodes), bodySectionNodes), footSectionNodes)));
|
|
};
|
|
SimpleScrollGrid.prototype.renderSection = function (sectionConfig, microColGroupNode, isHeader) {
|
|
if ('outerContent' in sectionConfig) {
|
|
return (createElement(Fragment, { key: sectionConfig.key }, sectionConfig.outerContent));
|
|
}
|
|
return (createElement("tr", { key: sectionConfig.key, role: "presentation", className: getSectionClassNames(sectionConfig, this.props.liquid).join(' ') }, this.renderChunkTd(sectionConfig, microColGroupNode, sectionConfig.chunk, isHeader)));
|
|
};
|
|
SimpleScrollGrid.prototype.renderChunkTd = function (sectionConfig, microColGroupNode, chunkConfig, isHeader) {
|
|
if ('outerContent' in chunkConfig) {
|
|
return chunkConfig.outerContent;
|
|
}
|
|
var props = this.props;
|
|
var _a = this.state, forceYScrollbars = _a.forceYScrollbars, scrollerClientWidths = _a.scrollerClientWidths, scrollerClientHeights = _a.scrollerClientHeights;
|
|
var needsYScrolling = getAllowYScrolling(props, sectionConfig); // TODO: do lazily. do in section config?
|
|
var isLiquid = getSectionHasLiquidHeight(props, sectionConfig);
|
|
// for `!props.liquid` - is WHOLE scrollgrid natural height?
|
|
// TODO: do same thing in advanced scrollgrid? prolly not b/c always has horizontal scrollbars
|
|
var overflowY = !props.liquid ? 'visible' :
|
|
forceYScrollbars ? 'scroll' :
|
|
!needsYScrolling ? 'hidden' :
|
|
'auto';
|
|
var sectionKey = sectionConfig.key;
|
|
var content = renderChunkContent(sectionConfig, chunkConfig, {
|
|
tableColGroupNode: microColGroupNode,
|
|
tableMinWidth: '',
|
|
clientWidth: (!props.collapsibleWidth && scrollerClientWidths[sectionKey] !== undefined) ? scrollerClientWidths[sectionKey] : null,
|
|
clientHeight: scrollerClientHeights[sectionKey] !== undefined ? scrollerClientHeights[sectionKey] : null,
|
|
expandRows: sectionConfig.expandRows,
|
|
syncRowHeights: false,
|
|
rowSyncHeights: [],
|
|
reportRowHeightChange: function () { },
|
|
}, isHeader);
|
|
return createElement(isHeader ? 'th' : 'td', {
|
|
ref: chunkConfig.elRef,
|
|
role: 'presentation',
|
|
}, createElement("div", { className: "fc-scroller-harness" + (isLiquid ? ' fc-scroller-harness-liquid' : '') },
|
|
createElement(Scroller, { ref: this.scrollerRefs.createRef(sectionKey), elRef: this.scrollerElRefs.createRef(sectionKey), overflowY: overflowY, overflowX: !props.liquid ? 'visible' : 'hidden' /* natural height? */, maxHeight: sectionConfig.maxHeight, liquid: isLiquid, liquidIsAbsolute // because its within a harness
|
|
: true }, content)));
|
|
};
|
|
SimpleScrollGrid.prototype._handleScrollerEl = function (scrollerEl, key) {
|
|
var section = getSectionByKey(this.props.sections, key);
|
|
if (section) {
|
|
setRef(section.chunk.scrollerElRef, scrollerEl);
|
|
}
|
|
};
|
|
SimpleScrollGrid.prototype.componentDidMount = function () {
|
|
this.handleSizing();
|
|
this.context.addResizeHandler(this.handleSizing);
|
|
};
|
|
SimpleScrollGrid.prototype.componentDidUpdate = function () {
|
|
// TODO: need better solution when state contains non-sizing things
|
|
this.handleSizing();
|
|
};
|
|
SimpleScrollGrid.prototype.componentWillUnmount = function () {
|
|
this.context.removeResizeHandler(this.handleSizing);
|
|
};
|
|
SimpleScrollGrid.prototype.computeShrinkWidth = function () {
|
|
return hasShrinkWidth(this.props.cols)
|
|
? computeShrinkWidth(this.scrollerElRefs.getAll())
|
|
: 0;
|
|
};
|
|
SimpleScrollGrid.prototype.computeScrollerDims = function () {
|
|
var scrollbarWidth = getScrollbarWidths();
|
|
var _a = this, scrollerRefs = _a.scrollerRefs, scrollerElRefs = _a.scrollerElRefs;
|
|
var forceYScrollbars = false;
|
|
var scrollerClientWidths = {};
|
|
var scrollerClientHeights = {};
|
|
for (var sectionKey in scrollerRefs.currentMap) {
|
|
var scroller = scrollerRefs.currentMap[sectionKey];
|
|
if (scroller && scroller.needsYScrolling()) {
|
|
forceYScrollbars = true;
|
|
break;
|
|
}
|
|
}
|
|
for (var _i = 0, _b = this.props.sections; _i < _b.length; _i++) {
|
|
var section = _b[_i];
|
|
var sectionKey = section.key;
|
|
var scrollerEl = scrollerElRefs.currentMap[sectionKey];
|
|
if (scrollerEl) {
|
|
var harnessEl = scrollerEl.parentNode; // TODO: weird way to get this. need harness b/c doesn't include table borders
|
|
scrollerClientWidths[sectionKey] = Math.floor(harnessEl.getBoundingClientRect().width - (forceYScrollbars
|
|
? scrollbarWidth.y // use global because scroller might not have scrollbars yet but will need them in future
|
|
: 0));
|
|
scrollerClientHeights[sectionKey] = Math.floor(harnessEl.getBoundingClientRect().height);
|
|
}
|
|
}
|
|
return { forceYScrollbars: forceYScrollbars, scrollerClientWidths: scrollerClientWidths, scrollerClientHeights: scrollerClientHeights };
|
|
};
|
|
return SimpleScrollGrid;
|
|
}(BaseComponent));
|
|
SimpleScrollGrid.addStateEquality({
|
|
scrollerClientWidths: isPropsEqual,
|
|
scrollerClientHeights: isPropsEqual,
|
|
});
|
|
function getSectionByKey(sections, key) {
|
|
for (var _i = 0, sections_1 = sections; _i < sections_1.length; _i++) {
|
|
var section = sections_1[_i];
|
|
if (section.key === key) {
|
|
return section;
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
|
|
var EventRoot = /** @class */ (function (_super) {
|
|
__extends(EventRoot, _super);
|
|
function EventRoot() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.elRef = createRef();
|
|
return _this;
|
|
}
|
|
EventRoot.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var seg = props.seg;
|
|
var eventRange = seg.eventRange;
|
|
var ui = eventRange.ui;
|
|
var hookProps = {
|
|
event: new EventApi(context, eventRange.def, eventRange.instance),
|
|
view: context.viewApi,
|
|
timeText: props.timeText,
|
|
textColor: ui.textColor,
|
|
backgroundColor: ui.backgroundColor,
|
|
borderColor: ui.borderColor,
|
|
isDraggable: !props.disableDragging && computeSegDraggable(seg, context),
|
|
isStartResizable: !props.disableResizing && computeSegStartResizable(seg, context),
|
|
isEndResizable: !props.disableResizing && computeSegEndResizable(seg),
|
|
isMirror: Boolean(props.isDragging || props.isResizing || props.isDateSelecting),
|
|
isStart: Boolean(seg.isStart),
|
|
isEnd: Boolean(seg.isEnd),
|
|
isPast: Boolean(props.isPast),
|
|
isFuture: Boolean(props.isFuture),
|
|
isToday: Boolean(props.isToday),
|
|
isSelected: Boolean(props.isSelected),
|
|
isDragging: Boolean(props.isDragging),
|
|
isResizing: Boolean(props.isResizing),
|
|
};
|
|
var standardClassNames = getEventClassNames(hookProps).concat(ui.classNames);
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.eventClassNames, content: options.eventContent, defaultContent: props.defaultContent, didMount: options.eventDidMount, willUnmount: options.eventWillUnmount, elRef: this.elRef }, function (rootElRef, customClassNames, innerElRef, innerContent) { return props.children(rootElRef, standardClassNames.concat(customClassNames), innerElRef, innerContent, hookProps); }));
|
|
};
|
|
EventRoot.prototype.componentDidMount = function () {
|
|
setElSeg(this.elRef.current, this.props.seg);
|
|
};
|
|
/*
|
|
need to re-assign seg to the element if seg changes, even if the element is the same
|
|
*/
|
|
EventRoot.prototype.componentDidUpdate = function (prevProps) {
|
|
var seg = this.props.seg;
|
|
if (seg !== prevProps.seg) {
|
|
setElSeg(this.elRef.current, seg);
|
|
}
|
|
};
|
|
return EventRoot;
|
|
}(BaseComponent));
|
|
|
|
// should not be a purecomponent
|
|
var StandardEvent = /** @class */ (function (_super) {
|
|
__extends(StandardEvent, _super);
|
|
function StandardEvent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
StandardEvent.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var seg = props.seg;
|
|
var timeFormat = context.options.eventTimeFormat || props.defaultTimeFormat;
|
|
var timeText = buildSegTimeText(seg, timeFormat, context, props.defaultDisplayEventTime, props.defaultDisplayEventEnd);
|
|
return (createElement(EventRoot, { seg: seg, timeText: timeText, disableDragging: props.disableDragging, disableResizing: props.disableResizing, defaultContent: props.defaultContent || renderInnerContent$6, isDragging: props.isDragging, isResizing: props.isResizing, isDateSelecting: props.isDateSelecting, isSelected: props.isSelected, isPast: props.isPast, isFuture: props.isFuture, isToday: props.isToday }, function (rootElRef, classNames, innerElRef, innerContent, hookProps) { return (createElement("a", __assign({ className: props.extraClassNames.concat(classNames).join(' '), style: {
|
|
borderColor: hookProps.borderColor,
|
|
backgroundColor: hookProps.backgroundColor,
|
|
}, ref: rootElRef }, getSegAnchorAttrs(seg, context)),
|
|
createElement("div", { className: "fc-event-main", ref: innerElRef, style: { color: hookProps.textColor } }, innerContent),
|
|
hookProps.isStartResizable &&
|
|
createElement("div", { className: "fc-event-resizer fc-event-resizer-start" }),
|
|
hookProps.isEndResizable &&
|
|
createElement("div", { className: "fc-event-resizer fc-event-resizer-end" }))); }));
|
|
};
|
|
return StandardEvent;
|
|
}(BaseComponent));
|
|
function renderInnerContent$6(innerProps) {
|
|
return (createElement("div", { className: "fc-event-main-frame" },
|
|
innerProps.timeText && (createElement("div", { className: "fc-event-time" }, innerProps.timeText)),
|
|
createElement("div", { className: "fc-event-title-container" },
|
|
createElement("div", { className: "fc-event-title fc-sticky" }, innerProps.event.title || createElement(Fragment, null, "\u00A0")))));
|
|
}
|
|
|
|
var NowIndicatorRoot = function (props) { return (createElement(ViewContextType.Consumer, null, function (context) {
|
|
var options = context.options;
|
|
var hookProps = {
|
|
isAxis: props.isAxis,
|
|
date: context.dateEnv.toDate(props.date),
|
|
view: context.viewApi,
|
|
};
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.nowIndicatorClassNames, content: options.nowIndicatorContent, didMount: options.nowIndicatorDidMount, willUnmount: options.nowIndicatorWillUnmount }, props.children));
|
|
})); };
|
|
|
|
var DAY_NUM_FORMAT = createFormatter({ day: 'numeric' });
|
|
var DayCellContent = /** @class */ (function (_super) {
|
|
__extends(DayCellContent, _super);
|
|
function DayCellContent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
DayCellContent.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var hookProps = refineDayCellHookProps({
|
|
date: props.date,
|
|
dateProfile: props.dateProfile,
|
|
todayRange: props.todayRange,
|
|
showDayNumber: props.showDayNumber,
|
|
extraProps: props.extraHookProps,
|
|
viewApi: context.viewApi,
|
|
dateEnv: context.dateEnv,
|
|
});
|
|
return (createElement(ContentHook, { hookProps: hookProps, content: options.dayCellContent, defaultContent: props.defaultContent }, props.children));
|
|
};
|
|
return DayCellContent;
|
|
}(BaseComponent));
|
|
function refineDayCellHookProps(raw) {
|
|
var date = raw.date, dateEnv = raw.dateEnv;
|
|
var dayMeta = getDateMeta(date, raw.todayRange, null, raw.dateProfile);
|
|
return __assign(__assign(__assign({ date: dateEnv.toDate(date), view: raw.viewApi }, dayMeta), { dayNumberText: raw.showDayNumber ? dateEnv.format(date, DAY_NUM_FORMAT) : '' }), raw.extraProps);
|
|
}
|
|
|
|
var DayCellRoot = /** @class */ (function (_super) {
|
|
__extends(DayCellRoot, _super);
|
|
function DayCellRoot() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.refineHookProps = memoizeObjArg(refineDayCellHookProps);
|
|
_this.normalizeClassNames = buildClassNameNormalizer();
|
|
return _this;
|
|
}
|
|
DayCellRoot.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var hookProps = this.refineHookProps({
|
|
date: props.date,
|
|
dateProfile: props.dateProfile,
|
|
todayRange: props.todayRange,
|
|
showDayNumber: props.showDayNumber,
|
|
extraProps: props.extraHookProps,
|
|
viewApi: context.viewApi,
|
|
dateEnv: context.dateEnv,
|
|
});
|
|
var classNames = getDayClassNames(hookProps, context.theme).concat(hookProps.isDisabled
|
|
? [] // don't use custom classNames if disabled
|
|
: this.normalizeClassNames(options.dayCellClassNames, hookProps));
|
|
var dataAttrs = hookProps.isDisabled ? {} : {
|
|
'data-date': formatDayString(props.date),
|
|
};
|
|
return (createElement(MountHook, { hookProps: hookProps, didMount: options.dayCellDidMount, willUnmount: options.dayCellWillUnmount, elRef: props.elRef }, function (rootElRef) { return props.children(rootElRef, classNames, dataAttrs, hookProps.isDisabled); }));
|
|
};
|
|
return DayCellRoot;
|
|
}(BaseComponent));
|
|
|
|
function renderFill(fillType) {
|
|
return (createElement("div", { className: "fc-" + fillType }));
|
|
}
|
|
var BgEvent = function (props) { return (createElement(EventRoot, { defaultContent: renderInnerContent$5, seg: props.seg /* uselesss i think */, timeText: "", disableDragging: true, disableResizing: true, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: false, isPast: props.isPast, isFuture: props.isFuture, isToday: props.isToday }, function (rootElRef, classNames, innerElRef, innerContent, hookProps) { return (createElement("div", { ref: rootElRef, className: ['fc-bg-event'].concat(classNames).join(' '), style: {
|
|
backgroundColor: hookProps.backgroundColor,
|
|
} }, innerContent)); })); };
|
|
function renderInnerContent$5(props) {
|
|
var title = props.event.title;
|
|
return title && (createElement("div", { className: "fc-event-title" }, props.event.title));
|
|
}
|
|
|
|
var WeekNumberRoot = function (props) { return (createElement(ViewContextType.Consumer, null, function (context) {
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var date = props.date;
|
|
var format = options.weekNumberFormat || props.defaultFormat;
|
|
var num = dateEnv.computeWeekNumber(date); // TODO: somehow use for formatting as well?
|
|
var text = dateEnv.format(date, format);
|
|
var hookProps = { num: num, text: text, date: date };
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.weekNumberClassNames, content: options.weekNumberContent, defaultContent: renderInner, didMount: options.weekNumberDidMount, willUnmount: options.weekNumberWillUnmount }, props.children));
|
|
})); };
|
|
function renderInner(innerProps) {
|
|
return innerProps.text;
|
|
}
|
|
|
|
var PADDING_FROM_VIEWPORT = 10;
|
|
var Popover = /** @class */ (function (_super) {
|
|
__extends(Popover, _super);
|
|
function Popover() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.state = {
|
|
titleId: getUniqueDomId(),
|
|
};
|
|
_this.handleRootEl = function (el) {
|
|
_this.rootEl = el;
|
|
if (_this.props.elRef) {
|
|
setRef(_this.props.elRef, el);
|
|
}
|
|
};
|
|
// Triggered when the user clicks *anywhere* in the document, for the autoHide feature
|
|
_this.handleDocumentMouseDown = function (ev) {
|
|
// only hide the popover if the click happened outside the popover
|
|
var target = getEventTargetViaRoot(ev);
|
|
if (!_this.rootEl.contains(target)) {
|
|
_this.handleCloseClick();
|
|
}
|
|
};
|
|
_this.handleDocumentKeyDown = function (ev) {
|
|
if (ev.key === 'Escape') {
|
|
_this.handleCloseClick();
|
|
}
|
|
};
|
|
_this.handleCloseClick = function () {
|
|
var onClose = _this.props.onClose;
|
|
if (onClose) {
|
|
onClose();
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
Popover.prototype.render = function () {
|
|
var _a = this.context, theme = _a.theme, options = _a.options;
|
|
var _b = this, props = _b.props, state = _b.state;
|
|
var classNames = [
|
|
'fc-popover',
|
|
theme.getClass('popover'),
|
|
].concat(props.extraClassNames || []);
|
|
return createPortal(createElement("div", __assign({ id: props.id, className: classNames.join(' '), "aria-labelledby": state.titleId }, props.extraAttrs, { ref: this.handleRootEl }),
|
|
createElement("div", { className: 'fc-popover-header ' + theme.getClass('popoverHeader') },
|
|
createElement("span", { className: "fc-popover-title", id: state.titleId }, props.title),
|
|
createElement("span", { className: 'fc-popover-close ' + theme.getIconClass('close'), title: options.closeHint, onClick: this.handleCloseClick })),
|
|
createElement("div", { className: 'fc-popover-body ' + theme.getClass('popoverContent') }, props.children)), props.parentEl);
|
|
};
|
|
Popover.prototype.componentDidMount = function () {
|
|
document.addEventListener('mousedown', this.handleDocumentMouseDown);
|
|
document.addEventListener('keydown', this.handleDocumentKeyDown);
|
|
this.updateSize();
|
|
};
|
|
Popover.prototype.componentWillUnmount = function () {
|
|
document.removeEventListener('mousedown', this.handleDocumentMouseDown);
|
|
document.removeEventListener('keydown', this.handleDocumentKeyDown);
|
|
};
|
|
Popover.prototype.updateSize = function () {
|
|
var isRtl = this.context.isRtl;
|
|
var _a = this.props, alignmentEl = _a.alignmentEl, alignGridTop = _a.alignGridTop;
|
|
var rootEl = this.rootEl;
|
|
var alignmentRect = computeClippedClientRect(alignmentEl);
|
|
if (alignmentRect) {
|
|
var popoverDims = rootEl.getBoundingClientRect();
|
|
// position relative to viewport
|
|
var popoverTop = alignGridTop
|
|
? elementClosest(alignmentEl, '.fc-scrollgrid').getBoundingClientRect().top
|
|
: alignmentRect.top;
|
|
var popoverLeft = isRtl ? alignmentRect.right - popoverDims.width : alignmentRect.left;
|
|
// constrain
|
|
popoverTop = Math.max(popoverTop, PADDING_FROM_VIEWPORT);
|
|
popoverLeft = Math.min(popoverLeft, document.documentElement.clientWidth - PADDING_FROM_VIEWPORT - popoverDims.width);
|
|
popoverLeft = Math.max(popoverLeft, PADDING_FROM_VIEWPORT);
|
|
var origin_1 = rootEl.offsetParent.getBoundingClientRect();
|
|
applyStyle(rootEl, {
|
|
top: popoverTop - origin_1.top,
|
|
left: popoverLeft - origin_1.left,
|
|
});
|
|
}
|
|
};
|
|
return Popover;
|
|
}(BaseComponent));
|
|
|
|
var MorePopover = /** @class */ (function (_super) {
|
|
__extends(MorePopover, _super);
|
|
function MorePopover() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.handleRootEl = function (rootEl) {
|
|
_this.rootEl = rootEl;
|
|
if (rootEl) {
|
|
_this.context.registerInteractiveComponent(_this, {
|
|
el: rootEl,
|
|
useEventCenter: false,
|
|
});
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
MorePopover.prototype.render = function () {
|
|
var _a = this.context, options = _a.options, dateEnv = _a.dateEnv;
|
|
var props = this.props;
|
|
var startDate = props.startDate, todayRange = props.todayRange, dateProfile = props.dateProfile;
|
|
var title = dateEnv.format(startDate, options.dayPopoverFormat);
|
|
return (createElement(DayCellRoot, { date: startDate, dateProfile: dateProfile, todayRange: todayRange, elRef: this.handleRootEl }, function (rootElRef, dayClassNames, dataAttrs) { return (createElement(Popover, { elRef: rootElRef, id: props.id, title: title, extraClassNames: ['fc-more-popover'].concat(dayClassNames), extraAttrs: dataAttrs /* TODO: make these time-based when not whole-day? */, parentEl: props.parentEl, alignmentEl: props.alignmentEl, alignGridTop: props.alignGridTop, onClose: props.onClose },
|
|
createElement(DayCellContent, { date: startDate, dateProfile: dateProfile, todayRange: todayRange }, function (innerElRef, innerContent) { return (innerContent &&
|
|
createElement("div", { className: "fc-more-popover-misc", ref: innerElRef }, innerContent)); }),
|
|
props.children)); }));
|
|
};
|
|
MorePopover.prototype.queryHit = function (positionLeft, positionTop, elWidth, elHeight) {
|
|
var _a = this, rootEl = _a.rootEl, props = _a.props;
|
|
if (positionLeft >= 0 && positionLeft < elWidth &&
|
|
positionTop >= 0 && positionTop < elHeight) {
|
|
return {
|
|
dateProfile: props.dateProfile,
|
|
dateSpan: __assign({ allDay: true, range: {
|
|
start: props.startDate,
|
|
end: props.endDate,
|
|
} }, props.extraDateSpan),
|
|
dayEl: rootEl,
|
|
rect: {
|
|
left: 0,
|
|
top: 0,
|
|
right: elWidth,
|
|
bottom: elHeight,
|
|
},
|
|
layer: 1, // important when comparing with hits from other components
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return MorePopover;
|
|
}(DateComponent));
|
|
|
|
var MoreLinkRoot = /** @class */ (function (_super) {
|
|
__extends(MoreLinkRoot, _super);
|
|
function MoreLinkRoot() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.linkElRef = createRef();
|
|
_this.state = {
|
|
isPopoverOpen: false,
|
|
popoverId: getUniqueDomId(),
|
|
};
|
|
_this.handleClick = function (ev) {
|
|
var _a = _this, props = _a.props, context = _a.context;
|
|
var moreLinkClick = context.options.moreLinkClick;
|
|
var date = computeRange(props).start;
|
|
function buildPublicSeg(seg) {
|
|
var _a = seg.eventRange, def = _a.def, instance = _a.instance, range = _a.range;
|
|
return {
|
|
event: new EventApi(context, def, instance),
|
|
start: context.dateEnv.toDate(range.start),
|
|
end: context.dateEnv.toDate(range.end),
|
|
isStart: seg.isStart,
|
|
isEnd: seg.isEnd,
|
|
};
|
|
}
|
|
if (typeof moreLinkClick === 'function') {
|
|
moreLinkClick = moreLinkClick({
|
|
date: date,
|
|
allDay: Boolean(props.allDayDate),
|
|
allSegs: props.allSegs.map(buildPublicSeg),
|
|
hiddenSegs: props.hiddenSegs.map(buildPublicSeg),
|
|
jsEvent: ev,
|
|
view: context.viewApi,
|
|
});
|
|
}
|
|
if (!moreLinkClick || moreLinkClick === 'popover') {
|
|
_this.setState({ isPopoverOpen: true });
|
|
}
|
|
else if (typeof moreLinkClick === 'string') { // a view name
|
|
context.calendarApi.zoomTo(date, moreLinkClick);
|
|
}
|
|
};
|
|
_this.handlePopoverClose = function () {
|
|
_this.setState({ isPopoverOpen: false });
|
|
};
|
|
return _this;
|
|
}
|
|
MoreLinkRoot.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state;
|
|
return (createElement(ViewContextType.Consumer, null, function (context) {
|
|
var viewApi = context.viewApi, options = context.options, calendarApi = context.calendarApi;
|
|
var moreLinkText = options.moreLinkText;
|
|
var moreCnt = props.moreCnt;
|
|
var range = computeRange(props);
|
|
var text = typeof moreLinkText === 'function' // TODO: eventually use formatWithOrdinals
|
|
? moreLinkText.call(calendarApi, moreCnt)
|
|
: "+" + moreCnt + " " + moreLinkText;
|
|
var title = formatWithOrdinals(options.moreLinkHint, [moreCnt], text);
|
|
var hookProps = {
|
|
num: moreCnt,
|
|
shortText: "+" + moreCnt,
|
|
text: text,
|
|
view: viewApi,
|
|
};
|
|
return (createElement(Fragment, null,
|
|
Boolean(props.moreCnt) && (createElement(RenderHook, { elRef: _this.linkElRef, hookProps: hookProps, classNames: options.moreLinkClassNames, content: options.moreLinkContent, defaultContent: props.defaultContent || renderMoreLinkInner$1, didMount: options.moreLinkDidMount, willUnmount: options.moreLinkWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return props.children(rootElRef, ['fc-more-link'].concat(customClassNames), innerElRef, innerContent, _this.handleClick, title, state.isPopoverOpen, state.isPopoverOpen ? state.popoverId : ''); })),
|
|
state.isPopoverOpen && (createElement(MorePopover, { id: state.popoverId, startDate: range.start, endDate: range.end, dateProfile: props.dateProfile, todayRange: props.todayRange, extraDateSpan: props.extraDateSpan, parentEl: _this.parentEl, alignmentEl: props.alignmentElRef.current, alignGridTop: props.alignGridTop, onClose: _this.handlePopoverClose }, props.popoverContent()))));
|
|
}));
|
|
};
|
|
MoreLinkRoot.prototype.componentDidMount = function () {
|
|
this.updateParentEl();
|
|
};
|
|
MoreLinkRoot.prototype.componentDidUpdate = function () {
|
|
this.updateParentEl();
|
|
};
|
|
MoreLinkRoot.prototype.updateParentEl = function () {
|
|
if (this.linkElRef.current) {
|
|
this.parentEl = elementClosest(this.linkElRef.current, '.fc-view-harness');
|
|
}
|
|
};
|
|
return MoreLinkRoot;
|
|
}(BaseComponent));
|
|
function renderMoreLinkInner$1(props) {
|
|
return props.text;
|
|
}
|
|
function computeRange(props) {
|
|
if (props.allDayDate) {
|
|
return {
|
|
start: props.allDayDate,
|
|
end: addDays(props.allDayDate, 1),
|
|
};
|
|
}
|
|
var hiddenSegs = props.hiddenSegs;
|
|
return {
|
|
start: computeEarliestSegStart(hiddenSegs),
|
|
end: computeLatestSegEnd(hiddenSegs),
|
|
};
|
|
}
|
|
function computeEarliestSegStart(segs) {
|
|
return segs.reduce(pickEarliestStart).eventRange.range.start;
|
|
}
|
|
function pickEarliestStart(seg0, seg1) {
|
|
return seg0.eventRange.range.start < seg1.eventRange.range.start ? seg0 : seg1;
|
|
}
|
|
function computeLatestSegEnd(segs) {
|
|
return segs.reduce(pickLatestEnd).eventRange.range.end;
|
|
}
|
|
function pickLatestEnd(seg0, seg1) {
|
|
return seg0.eventRange.range.end > seg1.eventRange.range.end ? seg0 : seg1;
|
|
}
|
|
|
|
// exports
|
|
// --------------------------------------------------------------------------------------------------
|
|
var version = '5.11.5'; // important to type it, so .d.ts has generic string
|
|
|
|
var Calendar = /** @class */ (function (_super) {
|
|
__extends(Calendar, _super);
|
|
function Calendar(el, optionOverrides) {
|
|
if (optionOverrides === void 0) { optionOverrides = {}; }
|
|
var _this = _super.call(this) || this;
|
|
_this.isRendering = false;
|
|
_this.isRendered = false;
|
|
_this.currentClassNames = [];
|
|
_this.customContentRenderId = 0; // will affect custom generated classNames?
|
|
_this.handleAction = function (action) {
|
|
// actions we know we want to render immediately
|
|
switch (action.type) {
|
|
case 'SET_EVENT_DRAG':
|
|
case 'SET_EVENT_RESIZE':
|
|
_this.renderRunner.tryDrain();
|
|
}
|
|
};
|
|
_this.handleData = function (data) {
|
|
_this.currentData = data;
|
|
_this.renderRunner.request(data.calendarOptions.rerenderDelay);
|
|
};
|
|
_this.handleRenderRequest = function () {
|
|
if (_this.isRendering) {
|
|
_this.isRendered = true;
|
|
var currentData_1 = _this.currentData;
|
|
flushSync(function () {
|
|
render(createElement(CalendarRoot, { options: currentData_1.calendarOptions, theme: currentData_1.theme, emitter: currentData_1.emitter }, function (classNames, height, isHeightAuto, forPrint) {
|
|
_this.setClassNames(classNames);
|
|
_this.setHeight(height);
|
|
return (createElement(CustomContentRenderContext.Provider, { value: _this.customContentRenderId },
|
|
createElement(CalendarContent, __assign({ isHeightAuto: isHeightAuto, forPrint: forPrint }, currentData_1))));
|
|
}), _this.el);
|
|
});
|
|
}
|
|
else if (_this.isRendered) {
|
|
_this.isRendered = false;
|
|
unmountComponentAtNode(_this.el);
|
|
_this.setClassNames([]);
|
|
_this.setHeight('');
|
|
}
|
|
};
|
|
_this.el = el;
|
|
_this.renderRunner = new DelayedRunner(_this.handleRenderRequest);
|
|
new CalendarDataManager({
|
|
optionOverrides: optionOverrides,
|
|
calendarApi: _this,
|
|
onAction: _this.handleAction,
|
|
onData: _this.handleData,
|
|
});
|
|
return _this;
|
|
}
|
|
Object.defineProperty(Calendar.prototype, "view", {
|
|
get: function () { return this.currentData.viewApi; } // for public API
|
|
,
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Calendar.prototype.render = function () {
|
|
var wasRendering = this.isRendering;
|
|
if (!wasRendering) {
|
|
this.isRendering = true;
|
|
}
|
|
else {
|
|
this.customContentRenderId += 1;
|
|
}
|
|
this.renderRunner.request();
|
|
if (wasRendering) {
|
|
this.updateSize();
|
|
}
|
|
};
|
|
Calendar.prototype.destroy = function () {
|
|
if (this.isRendering) {
|
|
this.isRendering = false;
|
|
this.renderRunner.request();
|
|
}
|
|
};
|
|
Calendar.prototype.updateSize = function () {
|
|
var _this = this;
|
|
flushSync(function () {
|
|
_super.prototype.updateSize.call(_this);
|
|
});
|
|
};
|
|
Calendar.prototype.batchRendering = function (func) {
|
|
this.renderRunner.pause('batchRendering');
|
|
func();
|
|
this.renderRunner.resume('batchRendering');
|
|
};
|
|
Calendar.prototype.pauseRendering = function () {
|
|
this.renderRunner.pause('pauseRendering');
|
|
};
|
|
Calendar.prototype.resumeRendering = function () {
|
|
this.renderRunner.resume('pauseRendering', true);
|
|
};
|
|
Calendar.prototype.resetOptions = function (optionOverrides, append) {
|
|
this.currentDataManager.resetOptions(optionOverrides, append);
|
|
};
|
|
Calendar.prototype.setClassNames = function (classNames) {
|
|
if (!isArraysEqual(classNames, this.currentClassNames)) {
|
|
var classList = this.el.classList;
|
|
for (var _i = 0, _a = this.currentClassNames; _i < _a.length; _i++) {
|
|
var className = _a[_i];
|
|
classList.remove(className);
|
|
}
|
|
for (var _b = 0, classNames_1 = classNames; _b < classNames_1.length; _b++) {
|
|
var className = classNames_1[_b];
|
|
classList.add(className);
|
|
}
|
|
this.currentClassNames = classNames;
|
|
}
|
|
};
|
|
Calendar.prototype.setHeight = function (height) {
|
|
applyStyleProp(this.el, 'height', height);
|
|
};
|
|
return Calendar;
|
|
}(CalendarApi));
|
|
|
|
config.touchMouseIgnoreWait = 500;
|
|
var ignoreMouseDepth = 0;
|
|
var listenerCnt = 0;
|
|
var isWindowTouchMoveCancelled = false;
|
|
/*
|
|
Uses a "pointer" abstraction, which monitors UI events for both mouse and touch.
|
|
Tracks when the pointer "drags" on a certain element, meaning down+move+up.
|
|
|
|
Also, tracks if there was touch-scrolling.
|
|
Also, can prevent touch-scrolling from happening.
|
|
Also, can fire pointermove events when scrolling happens underneath, even when no real pointer movement.
|
|
|
|
emits:
|
|
- pointerdown
|
|
- pointermove
|
|
- pointerup
|
|
*/
|
|
var PointerDragging = /** @class */ (function () {
|
|
function PointerDragging(containerEl) {
|
|
var _this = this;
|
|
this.subjectEl = null;
|
|
// options that can be directly assigned by caller
|
|
this.selector = ''; // will cause subjectEl in all emitted events to be this element
|
|
this.handleSelector = '';
|
|
this.shouldIgnoreMove = false;
|
|
this.shouldWatchScroll = true; // for simulating pointermove on scroll
|
|
// internal states
|
|
this.isDragging = false;
|
|
this.isTouchDragging = false;
|
|
this.wasTouchScroll = false;
|
|
// Mouse
|
|
// ----------------------------------------------------------------------------------------------------
|
|
this.handleMouseDown = function (ev) {
|
|
if (!_this.shouldIgnoreMouse() &&
|
|
isPrimaryMouseButton(ev) &&
|
|
_this.tryStart(ev)) {
|
|
var pev = _this.createEventFromMouse(ev, true);
|
|
_this.emitter.trigger('pointerdown', pev);
|
|
_this.initScrollWatch(pev);
|
|
if (!_this.shouldIgnoreMove) {
|
|
document.addEventListener('mousemove', _this.handleMouseMove);
|
|
}
|
|
document.addEventListener('mouseup', _this.handleMouseUp);
|
|
}
|
|
};
|
|
this.handleMouseMove = function (ev) {
|
|
var pev = _this.createEventFromMouse(ev);
|
|
_this.recordCoords(pev);
|
|
_this.emitter.trigger('pointermove', pev);
|
|
};
|
|
this.handleMouseUp = function (ev) {
|
|
document.removeEventListener('mousemove', _this.handleMouseMove);
|
|
document.removeEventListener('mouseup', _this.handleMouseUp);
|
|
_this.emitter.trigger('pointerup', _this.createEventFromMouse(ev));
|
|
_this.cleanup(); // call last so that pointerup has access to props
|
|
};
|
|
// Touch
|
|
// ----------------------------------------------------------------------------------------------------
|
|
this.handleTouchStart = function (ev) {
|
|
if (_this.tryStart(ev)) {
|
|
_this.isTouchDragging = true;
|
|
var pev = _this.createEventFromTouch(ev, true);
|
|
_this.emitter.trigger('pointerdown', pev);
|
|
_this.initScrollWatch(pev);
|
|
// unlike mouse, need to attach to target, not document
|
|
// https://stackoverflow.com/a/45760014
|
|
var targetEl = ev.target;
|
|
if (!_this.shouldIgnoreMove) {
|
|
targetEl.addEventListener('touchmove', _this.handleTouchMove);
|
|
}
|
|
targetEl.addEventListener('touchend', _this.handleTouchEnd);
|
|
targetEl.addEventListener('touchcancel', _this.handleTouchEnd); // treat it as a touch end
|
|
// attach a handler to get called when ANY scroll action happens on the page.
|
|
// this was impossible to do with normal on/off because 'scroll' doesn't bubble.
|
|
// http://stackoverflow.com/a/32954565/96342
|
|
window.addEventListener('scroll', _this.handleTouchScroll, true);
|
|
}
|
|
};
|
|
this.handleTouchMove = function (ev) {
|
|
var pev = _this.createEventFromTouch(ev);
|
|
_this.recordCoords(pev);
|
|
_this.emitter.trigger('pointermove', pev);
|
|
};
|
|
this.handleTouchEnd = function (ev) {
|
|
if (_this.isDragging) { // done to guard against touchend followed by touchcancel
|
|
var targetEl = ev.target;
|
|
targetEl.removeEventListener('touchmove', _this.handleTouchMove);
|
|
targetEl.removeEventListener('touchend', _this.handleTouchEnd);
|
|
targetEl.removeEventListener('touchcancel', _this.handleTouchEnd);
|
|
window.removeEventListener('scroll', _this.handleTouchScroll, true); // useCaptured=true
|
|
_this.emitter.trigger('pointerup', _this.createEventFromTouch(ev));
|
|
_this.cleanup(); // call last so that pointerup has access to props
|
|
_this.isTouchDragging = false;
|
|
startIgnoringMouse();
|
|
}
|
|
};
|
|
this.handleTouchScroll = function () {
|
|
_this.wasTouchScroll = true;
|
|
};
|
|
this.handleScroll = function (ev) {
|
|
if (!_this.shouldIgnoreMove) {
|
|
var pageX = (window.pageXOffset - _this.prevScrollX) + _this.prevPageX;
|
|
var pageY = (window.pageYOffset - _this.prevScrollY) + _this.prevPageY;
|
|
_this.emitter.trigger('pointermove', {
|
|
origEvent: ev,
|
|
isTouch: _this.isTouchDragging,
|
|
subjectEl: _this.subjectEl,
|
|
pageX: pageX,
|
|
pageY: pageY,
|
|
deltaX: pageX - _this.origPageX,
|
|
deltaY: pageY - _this.origPageY,
|
|
});
|
|
}
|
|
};
|
|
this.containerEl = containerEl;
|
|
this.emitter = new Emitter();
|
|
containerEl.addEventListener('mousedown', this.handleMouseDown);
|
|
containerEl.addEventListener('touchstart', this.handleTouchStart, { passive: true });
|
|
listenerCreated();
|
|
}
|
|
PointerDragging.prototype.destroy = function () {
|
|
this.containerEl.removeEventListener('mousedown', this.handleMouseDown);
|
|
this.containerEl.removeEventListener('touchstart', this.handleTouchStart, { passive: true });
|
|
listenerDestroyed();
|
|
};
|
|
PointerDragging.prototype.tryStart = function (ev) {
|
|
var subjectEl = this.querySubjectEl(ev);
|
|
var downEl = ev.target;
|
|
if (subjectEl &&
|
|
(!this.handleSelector || elementClosest(downEl, this.handleSelector))) {
|
|
this.subjectEl = subjectEl;
|
|
this.isDragging = true; // do this first so cancelTouchScroll will work
|
|
this.wasTouchScroll = false;
|
|
return true;
|
|
}
|
|
return false;
|
|
};
|
|
PointerDragging.prototype.cleanup = function () {
|
|
isWindowTouchMoveCancelled = false;
|
|
this.isDragging = false;
|
|
this.subjectEl = null;
|
|
// keep wasTouchScroll around for later access
|
|
this.destroyScrollWatch();
|
|
};
|
|
PointerDragging.prototype.querySubjectEl = function (ev) {
|
|
if (this.selector) {
|
|
return elementClosest(ev.target, this.selector);
|
|
}
|
|
return this.containerEl;
|
|
};
|
|
PointerDragging.prototype.shouldIgnoreMouse = function () {
|
|
return ignoreMouseDepth || this.isTouchDragging;
|
|
};
|
|
// can be called by user of this class, to cancel touch-based scrolling for the current drag
|
|
PointerDragging.prototype.cancelTouchScroll = function () {
|
|
if (this.isDragging) {
|
|
isWindowTouchMoveCancelled = true;
|
|
}
|
|
};
|
|
// Scrolling that simulates pointermoves
|
|
// ----------------------------------------------------------------------------------------------------
|
|
PointerDragging.prototype.initScrollWatch = function (ev) {
|
|
if (this.shouldWatchScroll) {
|
|
this.recordCoords(ev);
|
|
window.addEventListener('scroll', this.handleScroll, true); // useCapture=true
|
|
}
|
|
};
|
|
PointerDragging.prototype.recordCoords = function (ev) {
|
|
if (this.shouldWatchScroll) {
|
|
this.prevPageX = ev.pageX;
|
|
this.prevPageY = ev.pageY;
|
|
this.prevScrollX = window.pageXOffset;
|
|
this.prevScrollY = window.pageYOffset;
|
|
}
|
|
};
|
|
PointerDragging.prototype.destroyScrollWatch = function () {
|
|
if (this.shouldWatchScroll) {
|
|
window.removeEventListener('scroll', this.handleScroll, true); // useCaptured=true
|
|
}
|
|
};
|
|
// Event Normalization
|
|
// ----------------------------------------------------------------------------------------------------
|
|
PointerDragging.prototype.createEventFromMouse = function (ev, isFirst) {
|
|
var deltaX = 0;
|
|
var deltaY = 0;
|
|
// TODO: repeat code
|
|
if (isFirst) {
|
|
this.origPageX = ev.pageX;
|
|
this.origPageY = ev.pageY;
|
|
}
|
|
else {
|
|
deltaX = ev.pageX - this.origPageX;
|
|
deltaY = ev.pageY - this.origPageY;
|
|
}
|
|
return {
|
|
origEvent: ev,
|
|
isTouch: false,
|
|
subjectEl: this.subjectEl,
|
|
pageX: ev.pageX,
|
|
pageY: ev.pageY,
|
|
deltaX: deltaX,
|
|
deltaY: deltaY,
|
|
};
|
|
};
|
|
PointerDragging.prototype.createEventFromTouch = function (ev, isFirst) {
|
|
var touches = ev.touches;
|
|
var pageX;
|
|
var pageY;
|
|
var deltaX = 0;
|
|
var deltaY = 0;
|
|
// if touch coords available, prefer,
|
|
// because FF would give bad ev.pageX ev.pageY
|
|
if (touches && touches.length) {
|
|
pageX = touches[0].pageX;
|
|
pageY = touches[0].pageY;
|
|
}
|
|
else {
|
|
pageX = ev.pageX;
|
|
pageY = ev.pageY;
|
|
}
|
|
// TODO: repeat code
|
|
if (isFirst) {
|
|
this.origPageX = pageX;
|
|
this.origPageY = pageY;
|
|
}
|
|
else {
|
|
deltaX = pageX - this.origPageX;
|
|
deltaY = pageY - this.origPageY;
|
|
}
|
|
return {
|
|
origEvent: ev,
|
|
isTouch: true,
|
|
subjectEl: this.subjectEl,
|
|
pageX: pageX,
|
|
pageY: pageY,
|
|
deltaX: deltaX,
|
|
deltaY: deltaY,
|
|
};
|
|
};
|
|
return PointerDragging;
|
|
}());
|
|
// Returns a boolean whether this was a left mouse click and no ctrl key (which means right click on Mac)
|
|
function isPrimaryMouseButton(ev) {
|
|
return ev.button === 0 && !ev.ctrlKey;
|
|
}
|
|
// Ignoring fake mouse events generated by touch
|
|
// ----------------------------------------------------------------------------------------------------
|
|
function startIgnoringMouse() {
|
|
ignoreMouseDepth += 1;
|
|
setTimeout(function () {
|
|
ignoreMouseDepth -= 1;
|
|
}, config.touchMouseIgnoreWait);
|
|
}
|
|
// We want to attach touchmove as early as possible for Safari
|
|
// ----------------------------------------------------------------------------------------------------
|
|
function listenerCreated() {
|
|
listenerCnt += 1;
|
|
if (listenerCnt === 1) {
|
|
window.addEventListener('touchmove', onWindowTouchMove, { passive: false });
|
|
}
|
|
}
|
|
function listenerDestroyed() {
|
|
listenerCnt -= 1;
|
|
if (!listenerCnt) {
|
|
window.removeEventListener('touchmove', onWindowTouchMove, { passive: false });
|
|
}
|
|
}
|
|
function onWindowTouchMove(ev) {
|
|
if (isWindowTouchMoveCancelled) {
|
|
ev.preventDefault();
|
|
}
|
|
}
|
|
|
|
/*
|
|
An effect in which an element follows the movement of a pointer across the screen.
|
|
The moving element is a clone of some other element.
|
|
Must call start + handleMove + stop.
|
|
*/
|
|
var ElementMirror = /** @class */ (function () {
|
|
function ElementMirror() {
|
|
this.isVisible = false; // must be explicitly enabled
|
|
this.sourceEl = null;
|
|
this.mirrorEl = null;
|
|
this.sourceElRect = null; // screen coords relative to viewport
|
|
// options that can be set directly by caller
|
|
this.parentNode = document.body; // HIGHLY SUGGESTED to set this to sidestep ShadowDOM issues
|
|
this.zIndex = 9999;
|
|
this.revertDuration = 0;
|
|
}
|
|
ElementMirror.prototype.start = function (sourceEl, pageX, pageY) {
|
|
this.sourceEl = sourceEl;
|
|
this.sourceElRect = this.sourceEl.getBoundingClientRect();
|
|
this.origScreenX = pageX - window.pageXOffset;
|
|
this.origScreenY = pageY - window.pageYOffset;
|
|
this.deltaX = 0;
|
|
this.deltaY = 0;
|
|
this.updateElPosition();
|
|
};
|
|
ElementMirror.prototype.handleMove = function (pageX, pageY) {
|
|
this.deltaX = (pageX - window.pageXOffset) - this.origScreenX;
|
|
this.deltaY = (pageY - window.pageYOffset) - this.origScreenY;
|
|
this.updateElPosition();
|
|
};
|
|
// can be called before start
|
|
ElementMirror.prototype.setIsVisible = function (bool) {
|
|
if (bool) {
|
|
if (!this.isVisible) {
|
|
if (this.mirrorEl) {
|
|
this.mirrorEl.style.display = '';
|
|
}
|
|
this.isVisible = bool; // needs to happen before updateElPosition
|
|
this.updateElPosition(); // because was not updating the position while invisible
|
|
}
|
|
}
|
|
else if (this.isVisible) {
|
|
if (this.mirrorEl) {
|
|
this.mirrorEl.style.display = 'none';
|
|
}
|
|
this.isVisible = bool;
|
|
}
|
|
};
|
|
// always async
|
|
ElementMirror.prototype.stop = function (needsRevertAnimation, callback) {
|
|
var _this = this;
|
|
var done = function () {
|
|
_this.cleanup();
|
|
callback();
|
|
};
|
|
if (needsRevertAnimation &&
|
|
this.mirrorEl &&
|
|
this.isVisible &&
|
|
this.revertDuration && // if 0, transition won't work
|
|
(this.deltaX || this.deltaY) // if same coords, transition won't work
|
|
) {
|
|
this.doRevertAnimation(done, this.revertDuration);
|
|
}
|
|
else {
|
|
setTimeout(done, 0);
|
|
}
|
|
};
|
|
ElementMirror.prototype.doRevertAnimation = function (callback, revertDuration) {
|
|
var mirrorEl = this.mirrorEl;
|
|
var finalSourceElRect = this.sourceEl.getBoundingClientRect(); // because autoscrolling might have happened
|
|
mirrorEl.style.transition =
|
|
'top ' + revertDuration + 'ms,' +
|
|
'left ' + revertDuration + 'ms';
|
|
applyStyle(mirrorEl, {
|
|
left: finalSourceElRect.left,
|
|
top: finalSourceElRect.top,
|
|
});
|
|
whenTransitionDone(mirrorEl, function () {
|
|
mirrorEl.style.transition = '';
|
|
callback();
|
|
});
|
|
};
|
|
ElementMirror.prototype.cleanup = function () {
|
|
if (this.mirrorEl) {
|
|
removeElement(this.mirrorEl);
|
|
this.mirrorEl = null;
|
|
}
|
|
this.sourceEl = null;
|
|
};
|
|
ElementMirror.prototype.updateElPosition = function () {
|
|
if (this.sourceEl && this.isVisible) {
|
|
applyStyle(this.getMirrorEl(), {
|
|
left: this.sourceElRect.left + this.deltaX,
|
|
top: this.sourceElRect.top + this.deltaY,
|
|
});
|
|
}
|
|
};
|
|
ElementMirror.prototype.getMirrorEl = function () {
|
|
var sourceElRect = this.sourceElRect;
|
|
var mirrorEl = this.mirrorEl;
|
|
if (!mirrorEl) {
|
|
mirrorEl = this.mirrorEl = this.sourceEl.cloneNode(true); // cloneChildren=true
|
|
// we don't want long taps or any mouse interaction causing selection/menus.
|
|
// would use preventSelection(), but that prevents selectstart, causing problems.
|
|
mirrorEl.classList.add('fc-unselectable');
|
|
mirrorEl.classList.add('fc-event-dragging');
|
|
applyStyle(mirrorEl, {
|
|
position: 'fixed',
|
|
zIndex: this.zIndex,
|
|
visibility: '',
|
|
boxSizing: 'border-box',
|
|
width: sourceElRect.right - sourceElRect.left,
|
|
height: sourceElRect.bottom - sourceElRect.top,
|
|
right: 'auto',
|
|
bottom: 'auto',
|
|
margin: 0,
|
|
});
|
|
this.parentNode.appendChild(mirrorEl);
|
|
}
|
|
return mirrorEl;
|
|
};
|
|
return ElementMirror;
|
|
}());
|
|
|
|
/*
|
|
Is a cache for a given element's scroll information (all the info that ScrollController stores)
|
|
in addition the "client rectangle" of the element.. the area within the scrollbars.
|
|
|
|
The cache can be in one of two modes:
|
|
- doesListening:false - ignores when the container is scrolled by someone else
|
|
- doesListening:true - watch for scrolling and update the cache
|
|
*/
|
|
var ScrollGeomCache = /** @class */ (function (_super) {
|
|
__extends(ScrollGeomCache, _super);
|
|
function ScrollGeomCache(scrollController, doesListening) {
|
|
var _this = _super.call(this) || this;
|
|
_this.handleScroll = function () {
|
|
_this.scrollTop = _this.scrollController.getScrollTop();
|
|
_this.scrollLeft = _this.scrollController.getScrollLeft();
|
|
_this.handleScrollChange();
|
|
};
|
|
_this.scrollController = scrollController;
|
|
_this.doesListening = doesListening;
|
|
_this.scrollTop = _this.origScrollTop = scrollController.getScrollTop();
|
|
_this.scrollLeft = _this.origScrollLeft = scrollController.getScrollLeft();
|
|
_this.scrollWidth = scrollController.getScrollWidth();
|
|
_this.scrollHeight = scrollController.getScrollHeight();
|
|
_this.clientWidth = scrollController.getClientWidth();
|
|
_this.clientHeight = scrollController.getClientHeight();
|
|
_this.clientRect = _this.computeClientRect(); // do last in case it needs cached values
|
|
if (_this.doesListening) {
|
|
_this.getEventTarget().addEventListener('scroll', _this.handleScroll);
|
|
}
|
|
return _this;
|
|
}
|
|
ScrollGeomCache.prototype.destroy = function () {
|
|
if (this.doesListening) {
|
|
this.getEventTarget().removeEventListener('scroll', this.handleScroll);
|
|
}
|
|
};
|
|
ScrollGeomCache.prototype.getScrollTop = function () {
|
|
return this.scrollTop;
|
|
};
|
|
ScrollGeomCache.prototype.getScrollLeft = function () {
|
|
return this.scrollLeft;
|
|
};
|
|
ScrollGeomCache.prototype.setScrollTop = function (top) {
|
|
this.scrollController.setScrollTop(top);
|
|
if (!this.doesListening) {
|
|
// we are not relying on the element to normalize out-of-bounds scroll values
|
|
// so we need to sanitize ourselves
|
|
this.scrollTop = Math.max(Math.min(top, this.getMaxScrollTop()), 0);
|
|
this.handleScrollChange();
|
|
}
|
|
};
|
|
ScrollGeomCache.prototype.setScrollLeft = function (top) {
|
|
this.scrollController.setScrollLeft(top);
|
|
if (!this.doesListening) {
|
|
// we are not relying on the element to normalize out-of-bounds scroll values
|
|
// so we need to sanitize ourselves
|
|
this.scrollLeft = Math.max(Math.min(top, this.getMaxScrollLeft()), 0);
|
|
this.handleScrollChange();
|
|
}
|
|
};
|
|
ScrollGeomCache.prototype.getClientWidth = function () {
|
|
return this.clientWidth;
|
|
};
|
|
ScrollGeomCache.prototype.getClientHeight = function () {
|
|
return this.clientHeight;
|
|
};
|
|
ScrollGeomCache.prototype.getScrollWidth = function () {
|
|
return this.scrollWidth;
|
|
};
|
|
ScrollGeomCache.prototype.getScrollHeight = function () {
|
|
return this.scrollHeight;
|
|
};
|
|
ScrollGeomCache.prototype.handleScrollChange = function () {
|
|
};
|
|
return ScrollGeomCache;
|
|
}(ScrollController));
|
|
|
|
var ElementScrollGeomCache = /** @class */ (function (_super) {
|
|
__extends(ElementScrollGeomCache, _super);
|
|
function ElementScrollGeomCache(el, doesListening) {
|
|
return _super.call(this, new ElementScrollController(el), doesListening) || this;
|
|
}
|
|
ElementScrollGeomCache.prototype.getEventTarget = function () {
|
|
return this.scrollController.el;
|
|
};
|
|
ElementScrollGeomCache.prototype.computeClientRect = function () {
|
|
return computeInnerRect(this.scrollController.el);
|
|
};
|
|
return ElementScrollGeomCache;
|
|
}(ScrollGeomCache));
|
|
|
|
var WindowScrollGeomCache = /** @class */ (function (_super) {
|
|
__extends(WindowScrollGeomCache, _super);
|
|
function WindowScrollGeomCache(doesListening) {
|
|
return _super.call(this, new WindowScrollController(), doesListening) || this;
|
|
}
|
|
WindowScrollGeomCache.prototype.getEventTarget = function () {
|
|
return window;
|
|
};
|
|
WindowScrollGeomCache.prototype.computeClientRect = function () {
|
|
return {
|
|
left: this.scrollLeft,
|
|
right: this.scrollLeft + this.clientWidth,
|
|
top: this.scrollTop,
|
|
bottom: this.scrollTop + this.clientHeight,
|
|
};
|
|
};
|
|
// the window is the only scroll object that changes it's rectangle relative
|
|
// to the document's topleft as it scrolls
|
|
WindowScrollGeomCache.prototype.handleScrollChange = function () {
|
|
this.clientRect = this.computeClientRect();
|
|
};
|
|
return WindowScrollGeomCache;
|
|
}(ScrollGeomCache));
|
|
|
|
// If available we are using native "performance" API instead of "Date"
|
|
// Read more about it on MDN:
|
|
// https://developer.mozilla.org/en-US/docs/Web/API/Performance
|
|
var getTime = typeof performance === 'function' ? performance.now : Date.now;
|
|
/*
|
|
For a pointer interaction, automatically scrolls certain scroll containers when the pointer
|
|
approaches the edge.
|
|
|
|
The caller must call start + handleMove + stop.
|
|
*/
|
|
var AutoScroller = /** @class */ (function () {
|
|
function AutoScroller() {
|
|
var _this = this;
|
|
// options that can be set by caller
|
|
this.isEnabled = true;
|
|
this.scrollQuery = [window, '.fc-scroller'];
|
|
this.edgeThreshold = 50; // pixels
|
|
this.maxVelocity = 300; // pixels per second
|
|
// internal state
|
|
this.pointerScreenX = null;
|
|
this.pointerScreenY = null;
|
|
this.isAnimating = false;
|
|
this.scrollCaches = null;
|
|
// protect against the initial pointerdown being too close to an edge and starting the scroll
|
|
this.everMovedUp = false;
|
|
this.everMovedDown = false;
|
|
this.everMovedLeft = false;
|
|
this.everMovedRight = false;
|
|
this.animate = function () {
|
|
if (_this.isAnimating) { // wasn't cancelled between animation calls
|
|
var edge = _this.computeBestEdge(_this.pointerScreenX + window.pageXOffset, _this.pointerScreenY + window.pageYOffset);
|
|
if (edge) {
|
|
var now = getTime();
|
|
_this.handleSide(edge, (now - _this.msSinceRequest) / 1000);
|
|
_this.requestAnimation(now);
|
|
}
|
|
else {
|
|
_this.isAnimating = false; // will stop animation
|
|
}
|
|
}
|
|
};
|
|
}
|
|
AutoScroller.prototype.start = function (pageX, pageY, scrollStartEl) {
|
|
if (this.isEnabled) {
|
|
this.scrollCaches = this.buildCaches(scrollStartEl);
|
|
this.pointerScreenX = null;
|
|
this.pointerScreenY = null;
|
|
this.everMovedUp = false;
|
|
this.everMovedDown = false;
|
|
this.everMovedLeft = false;
|
|
this.everMovedRight = false;
|
|
this.handleMove(pageX, pageY);
|
|
}
|
|
};
|
|
AutoScroller.prototype.handleMove = function (pageX, pageY) {
|
|
if (this.isEnabled) {
|
|
var pointerScreenX = pageX - window.pageXOffset;
|
|
var pointerScreenY = pageY - window.pageYOffset;
|
|
var yDelta = this.pointerScreenY === null ? 0 : pointerScreenY - this.pointerScreenY;
|
|
var xDelta = this.pointerScreenX === null ? 0 : pointerScreenX - this.pointerScreenX;
|
|
if (yDelta < 0) {
|
|
this.everMovedUp = true;
|
|
}
|
|
else if (yDelta > 0) {
|
|
this.everMovedDown = true;
|
|
}
|
|
if (xDelta < 0) {
|
|
this.everMovedLeft = true;
|
|
}
|
|
else if (xDelta > 0) {
|
|
this.everMovedRight = true;
|
|
}
|
|
this.pointerScreenX = pointerScreenX;
|
|
this.pointerScreenY = pointerScreenY;
|
|
if (!this.isAnimating) {
|
|
this.isAnimating = true;
|
|
this.requestAnimation(getTime());
|
|
}
|
|
}
|
|
};
|
|
AutoScroller.prototype.stop = function () {
|
|
if (this.isEnabled) {
|
|
this.isAnimating = false; // will stop animation
|
|
for (var _i = 0, _a = this.scrollCaches; _i < _a.length; _i++) {
|
|
var scrollCache = _a[_i];
|
|
scrollCache.destroy();
|
|
}
|
|
this.scrollCaches = null;
|
|
}
|
|
};
|
|
AutoScroller.prototype.requestAnimation = function (now) {
|
|
this.msSinceRequest = now;
|
|
requestAnimationFrame(this.animate);
|
|
};
|
|
AutoScroller.prototype.handleSide = function (edge, seconds) {
|
|
var scrollCache = edge.scrollCache;
|
|
var edgeThreshold = this.edgeThreshold;
|
|
var invDistance = edgeThreshold - edge.distance;
|
|
var velocity = // the closer to the edge, the faster we scroll
|
|
((invDistance * invDistance) / (edgeThreshold * edgeThreshold)) * // quadratic
|
|
this.maxVelocity * seconds;
|
|
var sign = 1;
|
|
switch (edge.name) {
|
|
case 'left':
|
|
sign = -1;
|
|
// falls through
|
|
case 'right':
|
|
scrollCache.setScrollLeft(scrollCache.getScrollLeft() + velocity * sign);
|
|
break;
|
|
case 'top':
|
|
sign = -1;
|
|
// falls through
|
|
case 'bottom':
|
|
scrollCache.setScrollTop(scrollCache.getScrollTop() + velocity * sign);
|
|
break;
|
|
}
|
|
};
|
|
// left/top are relative to document topleft
|
|
AutoScroller.prototype.computeBestEdge = function (left, top) {
|
|
var edgeThreshold = this.edgeThreshold;
|
|
var bestSide = null;
|
|
var scrollCaches = this.scrollCaches || [];
|
|
for (var _i = 0, scrollCaches_1 = scrollCaches; _i < scrollCaches_1.length; _i++) {
|
|
var scrollCache = scrollCaches_1[_i];
|
|
var rect = scrollCache.clientRect;
|
|
var leftDist = left - rect.left;
|
|
var rightDist = rect.right - left;
|
|
var topDist = top - rect.top;
|
|
var bottomDist = rect.bottom - top;
|
|
// completely within the rect?
|
|
if (leftDist >= 0 && rightDist >= 0 && topDist >= 0 && bottomDist >= 0) {
|
|
if (topDist <= edgeThreshold && this.everMovedUp && scrollCache.canScrollUp() &&
|
|
(!bestSide || bestSide.distance > topDist)) {
|
|
bestSide = { scrollCache: scrollCache, name: 'top', distance: topDist };
|
|
}
|
|
if (bottomDist <= edgeThreshold && this.everMovedDown && scrollCache.canScrollDown() &&
|
|
(!bestSide || bestSide.distance > bottomDist)) {
|
|
bestSide = { scrollCache: scrollCache, name: 'bottom', distance: bottomDist };
|
|
}
|
|
if (leftDist <= edgeThreshold && this.everMovedLeft && scrollCache.canScrollLeft() &&
|
|
(!bestSide || bestSide.distance > leftDist)) {
|
|
bestSide = { scrollCache: scrollCache, name: 'left', distance: leftDist };
|
|
}
|
|
if (rightDist <= edgeThreshold && this.everMovedRight && scrollCache.canScrollRight() &&
|
|
(!bestSide || bestSide.distance > rightDist)) {
|
|
bestSide = { scrollCache: scrollCache, name: 'right', distance: rightDist };
|
|
}
|
|
}
|
|
}
|
|
return bestSide;
|
|
};
|
|
AutoScroller.prototype.buildCaches = function (scrollStartEl) {
|
|
return this.queryScrollEls(scrollStartEl).map(function (el) {
|
|
if (el === window) {
|
|
return new WindowScrollGeomCache(false); // false = don't listen to user-generated scrolls
|
|
}
|
|
return new ElementScrollGeomCache(el, false); // false = don't listen to user-generated scrolls
|
|
});
|
|
};
|
|
AutoScroller.prototype.queryScrollEls = function (scrollStartEl) {
|
|
var els = [];
|
|
for (var _i = 0, _a = this.scrollQuery; _i < _a.length; _i++) {
|
|
var query = _a[_i];
|
|
if (typeof query === 'object') {
|
|
els.push(query);
|
|
}
|
|
else {
|
|
els.push.apply(els, Array.prototype.slice.call(getElRoot(scrollStartEl).querySelectorAll(query)));
|
|
}
|
|
}
|
|
return els;
|
|
};
|
|
return AutoScroller;
|
|
}());
|
|
|
|
/*
|
|
Monitors dragging on an element. Has a number of high-level features:
|
|
- minimum distance required before dragging
|
|
- minimum wait time ("delay") before dragging
|
|
- a mirror element that follows the pointer
|
|
*/
|
|
var FeaturefulElementDragging = /** @class */ (function (_super) {
|
|
__extends(FeaturefulElementDragging, _super);
|
|
function FeaturefulElementDragging(containerEl, selector) {
|
|
var _this = _super.call(this, containerEl) || this;
|
|
_this.containerEl = containerEl;
|
|
// options that can be directly set by caller
|
|
// the caller can also set the PointerDragging's options as well
|
|
_this.delay = null;
|
|
_this.minDistance = 0;
|
|
_this.touchScrollAllowed = true; // prevents drag from starting and blocks scrolling during drag
|
|
_this.mirrorNeedsRevert = false;
|
|
_this.isInteracting = false; // is the user validly moving the pointer? lasts until pointerup
|
|
_this.isDragging = false; // is it INTENTFULLY dragging? lasts until after revert animation
|
|
_this.isDelayEnded = false;
|
|
_this.isDistanceSurpassed = false;
|
|
_this.delayTimeoutId = null;
|
|
_this.onPointerDown = function (ev) {
|
|
if (!_this.isDragging) { // so new drag doesn't happen while revert animation is going
|
|
_this.isInteracting = true;
|
|
_this.isDelayEnded = false;
|
|
_this.isDistanceSurpassed = false;
|
|
preventSelection(document.body);
|
|
preventContextMenu(document.body);
|
|
// prevent links from being visited if there's an eventual drag.
|
|
// also prevents selection in older browsers (maybe?).
|
|
// not necessary for touch, besides, browser would complain about passiveness.
|
|
if (!ev.isTouch) {
|
|
ev.origEvent.preventDefault();
|
|
}
|
|
_this.emitter.trigger('pointerdown', ev);
|
|
if (_this.isInteracting && // not destroyed via pointerdown handler
|
|
!_this.pointer.shouldIgnoreMove) {
|
|
// actions related to initiating dragstart+dragmove+dragend...
|
|
_this.mirror.setIsVisible(false); // reset. caller must set-visible
|
|
_this.mirror.start(ev.subjectEl, ev.pageX, ev.pageY); // must happen on first pointer down
|
|
_this.startDelay(ev);
|
|
if (!_this.minDistance) {
|
|
_this.handleDistanceSurpassed(ev);
|
|
}
|
|
}
|
|
}
|
|
};
|
|
_this.onPointerMove = function (ev) {
|
|
if (_this.isInteracting) {
|
|
_this.emitter.trigger('pointermove', ev);
|
|
if (!_this.isDistanceSurpassed) {
|
|
var minDistance = _this.minDistance;
|
|
var distanceSq = void 0; // current distance from the origin, squared
|
|
var deltaX = ev.deltaX, deltaY = ev.deltaY;
|
|
distanceSq = deltaX * deltaX + deltaY * deltaY;
|
|
if (distanceSq >= minDistance * minDistance) { // use pythagorean theorem
|
|
_this.handleDistanceSurpassed(ev);
|
|
}
|
|
}
|
|
if (_this.isDragging) {
|
|
// a real pointer move? (not one simulated by scrolling)
|
|
if (ev.origEvent.type !== 'scroll') {
|
|
_this.mirror.handleMove(ev.pageX, ev.pageY);
|
|
_this.autoScroller.handleMove(ev.pageX, ev.pageY);
|
|
}
|
|
_this.emitter.trigger('dragmove', ev);
|
|
}
|
|
}
|
|
};
|
|
_this.onPointerUp = function (ev) {
|
|
if (_this.isInteracting) {
|
|
_this.isInteracting = false;
|
|
allowSelection(document.body);
|
|
allowContextMenu(document.body);
|
|
_this.emitter.trigger('pointerup', ev); // can potentially set mirrorNeedsRevert
|
|
if (_this.isDragging) {
|
|
_this.autoScroller.stop();
|
|
_this.tryStopDrag(ev); // which will stop the mirror
|
|
}
|
|
if (_this.delayTimeoutId) {
|
|
clearTimeout(_this.delayTimeoutId);
|
|
_this.delayTimeoutId = null;
|
|
}
|
|
}
|
|
};
|
|
var pointer = _this.pointer = new PointerDragging(containerEl);
|
|
pointer.emitter.on('pointerdown', _this.onPointerDown);
|
|
pointer.emitter.on('pointermove', _this.onPointerMove);
|
|
pointer.emitter.on('pointerup', _this.onPointerUp);
|
|
if (selector) {
|
|
pointer.selector = selector;
|
|
}
|
|
_this.mirror = new ElementMirror();
|
|
_this.autoScroller = new AutoScroller();
|
|
return _this;
|
|
}
|
|
FeaturefulElementDragging.prototype.destroy = function () {
|
|
this.pointer.destroy();
|
|
// HACK: simulate a pointer-up to end the current drag
|
|
// TODO: fire 'dragend' directly and stop interaction. discourage use of pointerup event (b/c might not fire)
|
|
this.onPointerUp({});
|
|
};
|
|
FeaturefulElementDragging.prototype.startDelay = function (ev) {
|
|
var _this = this;
|
|
if (typeof this.delay === 'number') {
|
|
this.delayTimeoutId = setTimeout(function () {
|
|
_this.delayTimeoutId = null;
|
|
_this.handleDelayEnd(ev);
|
|
}, this.delay); // not assignable to number!
|
|
}
|
|
else {
|
|
this.handleDelayEnd(ev);
|
|
}
|
|
};
|
|
FeaturefulElementDragging.prototype.handleDelayEnd = function (ev) {
|
|
this.isDelayEnded = true;
|
|
this.tryStartDrag(ev);
|
|
};
|
|
FeaturefulElementDragging.prototype.handleDistanceSurpassed = function (ev) {
|
|
this.isDistanceSurpassed = true;
|
|
this.tryStartDrag(ev);
|
|
};
|
|
FeaturefulElementDragging.prototype.tryStartDrag = function (ev) {
|
|
if (this.isDelayEnded && this.isDistanceSurpassed) {
|
|
if (!this.pointer.wasTouchScroll || this.touchScrollAllowed) {
|
|
this.isDragging = true;
|
|
this.mirrorNeedsRevert = false;
|
|
this.autoScroller.start(ev.pageX, ev.pageY, this.containerEl);
|
|
this.emitter.trigger('dragstart', ev);
|
|
if (this.touchScrollAllowed === false) {
|
|
this.pointer.cancelTouchScroll();
|
|
}
|
|
}
|
|
}
|
|
};
|
|
FeaturefulElementDragging.prototype.tryStopDrag = function (ev) {
|
|
// .stop() is ALWAYS asynchronous, which we NEED because we want all pointerup events
|
|
// that come from the document to fire beforehand. much more convenient this way.
|
|
this.mirror.stop(this.mirrorNeedsRevert, this.stopDrag.bind(this, ev));
|
|
};
|
|
FeaturefulElementDragging.prototype.stopDrag = function (ev) {
|
|
this.isDragging = false;
|
|
this.emitter.trigger('dragend', ev);
|
|
};
|
|
// fill in the implementations...
|
|
FeaturefulElementDragging.prototype.setIgnoreMove = function (bool) {
|
|
this.pointer.shouldIgnoreMove = bool;
|
|
};
|
|
FeaturefulElementDragging.prototype.setMirrorIsVisible = function (bool) {
|
|
this.mirror.setIsVisible(bool);
|
|
};
|
|
FeaturefulElementDragging.prototype.setMirrorNeedsRevert = function (bool) {
|
|
this.mirrorNeedsRevert = bool;
|
|
};
|
|
FeaturefulElementDragging.prototype.setAutoScrollEnabled = function (bool) {
|
|
this.autoScroller.isEnabled = bool;
|
|
};
|
|
return FeaturefulElementDragging;
|
|
}(ElementDragging));
|
|
|
|
/*
|
|
When this class is instantiated, it records the offset of an element (relative to the document topleft),
|
|
and continues to monitor scrolling, updating the cached coordinates if it needs to.
|
|
Does not access the DOM after instantiation, so highly performant.
|
|
|
|
Also keeps track of all scrolling/overflow:hidden containers that are parents of the given element
|
|
and an determine if a given point is inside the combined clipping rectangle.
|
|
*/
|
|
var OffsetTracker = /** @class */ (function () {
|
|
function OffsetTracker(el) {
|
|
this.origRect = computeRect(el);
|
|
// will work fine for divs that have overflow:hidden
|
|
this.scrollCaches = getClippingParents(el).map(function (scrollEl) { return new ElementScrollGeomCache(scrollEl, true); });
|
|
}
|
|
OffsetTracker.prototype.destroy = function () {
|
|
for (var _i = 0, _a = this.scrollCaches; _i < _a.length; _i++) {
|
|
var scrollCache = _a[_i];
|
|
scrollCache.destroy();
|
|
}
|
|
};
|
|
OffsetTracker.prototype.computeLeft = function () {
|
|
var left = this.origRect.left;
|
|
for (var _i = 0, _a = this.scrollCaches; _i < _a.length; _i++) {
|
|
var scrollCache = _a[_i];
|
|
left += scrollCache.origScrollLeft - scrollCache.getScrollLeft();
|
|
}
|
|
return left;
|
|
};
|
|
OffsetTracker.prototype.computeTop = function () {
|
|
var top = this.origRect.top;
|
|
for (var _i = 0, _a = this.scrollCaches; _i < _a.length; _i++) {
|
|
var scrollCache = _a[_i];
|
|
top += scrollCache.origScrollTop - scrollCache.getScrollTop();
|
|
}
|
|
return top;
|
|
};
|
|
OffsetTracker.prototype.isWithinClipping = function (pageX, pageY) {
|
|
var point = { left: pageX, top: pageY };
|
|
for (var _i = 0, _a = this.scrollCaches; _i < _a.length; _i++) {
|
|
var scrollCache = _a[_i];
|
|
if (!isIgnoredClipping(scrollCache.getEventTarget()) &&
|
|
!pointInsideRect(point, scrollCache.clientRect)) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
};
|
|
return OffsetTracker;
|
|
}());
|
|
// certain clipping containers should never constrain interactions, like <html> and <body>
|
|
// https://github.com/fullcalendar/fullcalendar/issues/3615
|
|
function isIgnoredClipping(node) {
|
|
var tagName = node.tagName;
|
|
return tagName === 'HTML' || tagName === 'BODY';
|
|
}
|
|
|
|
/*
|
|
Tracks movement over multiple droppable areas (aka "hits")
|
|
that exist in one or more DateComponents.
|
|
Relies on an existing draggable.
|
|
|
|
emits:
|
|
- pointerdown
|
|
- dragstart
|
|
- hitchange - fires initially, even if not over a hit
|
|
- pointerup
|
|
- (hitchange - again, to null, if ended over a hit)
|
|
- dragend
|
|
*/
|
|
var HitDragging = /** @class */ (function () {
|
|
function HitDragging(dragging, droppableStore) {
|
|
var _this = this;
|
|
// options that can be set by caller
|
|
this.useSubjectCenter = false;
|
|
this.requireInitial = true; // if doesn't start out on a hit, won't emit any events
|
|
this.initialHit = null;
|
|
this.movingHit = null;
|
|
this.finalHit = null; // won't ever be populated if shouldIgnoreMove
|
|
this.handlePointerDown = function (ev) {
|
|
var dragging = _this.dragging;
|
|
_this.initialHit = null;
|
|
_this.movingHit = null;
|
|
_this.finalHit = null;
|
|
_this.prepareHits();
|
|
_this.processFirstCoord(ev);
|
|
if (_this.initialHit || !_this.requireInitial) {
|
|
dragging.setIgnoreMove(false);
|
|
// TODO: fire this before computing processFirstCoord, so listeners can cancel. this gets fired by almost every handler :(
|
|
_this.emitter.trigger('pointerdown', ev);
|
|
}
|
|
else {
|
|
dragging.setIgnoreMove(true);
|
|
}
|
|
};
|
|
this.handleDragStart = function (ev) {
|
|
_this.emitter.trigger('dragstart', ev);
|
|
_this.handleMove(ev, true); // force = fire even if initially null
|
|
};
|
|
this.handleDragMove = function (ev) {
|
|
_this.emitter.trigger('dragmove', ev);
|
|
_this.handleMove(ev);
|
|
};
|
|
this.handlePointerUp = function (ev) {
|
|
_this.releaseHits();
|
|
_this.emitter.trigger('pointerup', ev);
|
|
};
|
|
this.handleDragEnd = function (ev) {
|
|
if (_this.movingHit) {
|
|
_this.emitter.trigger('hitupdate', null, true, ev);
|
|
}
|
|
_this.finalHit = _this.movingHit;
|
|
_this.movingHit = null;
|
|
_this.emitter.trigger('dragend', ev);
|
|
};
|
|
this.droppableStore = droppableStore;
|
|
dragging.emitter.on('pointerdown', this.handlePointerDown);
|
|
dragging.emitter.on('dragstart', this.handleDragStart);
|
|
dragging.emitter.on('dragmove', this.handleDragMove);
|
|
dragging.emitter.on('pointerup', this.handlePointerUp);
|
|
dragging.emitter.on('dragend', this.handleDragEnd);
|
|
this.dragging = dragging;
|
|
this.emitter = new Emitter();
|
|
}
|
|
// sets initialHit
|
|
// sets coordAdjust
|
|
HitDragging.prototype.processFirstCoord = function (ev) {
|
|
var origPoint = { left: ev.pageX, top: ev.pageY };
|
|
var adjustedPoint = origPoint;
|
|
var subjectEl = ev.subjectEl;
|
|
var subjectRect;
|
|
if (subjectEl instanceof HTMLElement) { // i.e. not a Document/ShadowRoot
|
|
subjectRect = computeRect(subjectEl);
|
|
adjustedPoint = constrainPoint(adjustedPoint, subjectRect);
|
|
}
|
|
var initialHit = this.initialHit = this.queryHitForOffset(adjustedPoint.left, adjustedPoint.top);
|
|
if (initialHit) {
|
|
if (this.useSubjectCenter && subjectRect) {
|
|
var slicedSubjectRect = intersectRects(subjectRect, initialHit.rect);
|
|
if (slicedSubjectRect) {
|
|
adjustedPoint = getRectCenter(slicedSubjectRect);
|
|
}
|
|
}
|
|
this.coordAdjust = diffPoints(adjustedPoint, origPoint);
|
|
}
|
|
else {
|
|
this.coordAdjust = { left: 0, top: 0 };
|
|
}
|
|
};
|
|
HitDragging.prototype.handleMove = function (ev, forceHandle) {
|
|
var hit = this.queryHitForOffset(ev.pageX + this.coordAdjust.left, ev.pageY + this.coordAdjust.top);
|
|
if (forceHandle || !isHitsEqual(this.movingHit, hit)) {
|
|
this.movingHit = hit;
|
|
this.emitter.trigger('hitupdate', hit, false, ev);
|
|
}
|
|
};
|
|
HitDragging.prototype.prepareHits = function () {
|
|
this.offsetTrackers = mapHash(this.droppableStore, function (interactionSettings) {
|
|
interactionSettings.component.prepareHits();
|
|
return new OffsetTracker(interactionSettings.el);
|
|
});
|
|
};
|
|
HitDragging.prototype.releaseHits = function () {
|
|
var offsetTrackers = this.offsetTrackers;
|
|
for (var id in offsetTrackers) {
|
|
offsetTrackers[id].destroy();
|
|
}
|
|
this.offsetTrackers = {};
|
|
};
|
|
HitDragging.prototype.queryHitForOffset = function (offsetLeft, offsetTop) {
|
|
var _a = this, droppableStore = _a.droppableStore, offsetTrackers = _a.offsetTrackers;
|
|
var bestHit = null;
|
|
for (var id in droppableStore) {
|
|
var component = droppableStore[id].component;
|
|
var offsetTracker = offsetTrackers[id];
|
|
if (offsetTracker && // wasn't destroyed mid-drag
|
|
offsetTracker.isWithinClipping(offsetLeft, offsetTop)) {
|
|
var originLeft = offsetTracker.computeLeft();
|
|
var originTop = offsetTracker.computeTop();
|
|
var positionLeft = offsetLeft - originLeft;
|
|
var positionTop = offsetTop - originTop;
|
|
var origRect = offsetTracker.origRect;
|
|
var width = origRect.right - origRect.left;
|
|
var height = origRect.bottom - origRect.top;
|
|
if (
|
|
// must be within the element's bounds
|
|
positionLeft >= 0 && positionLeft < width &&
|
|
positionTop >= 0 && positionTop < height) {
|
|
var hit = component.queryHit(positionLeft, positionTop, width, height);
|
|
if (hit && (
|
|
// make sure the hit is within activeRange, meaning it's not a dead cell
|
|
rangeContainsRange(hit.dateProfile.activeRange, hit.dateSpan.range)) &&
|
|
(!bestHit || hit.layer > bestHit.layer)) {
|
|
hit.componentId = id;
|
|
hit.context = component.context;
|
|
// TODO: better way to re-orient rectangle
|
|
hit.rect.left += originLeft;
|
|
hit.rect.right += originLeft;
|
|
hit.rect.top += originTop;
|
|
hit.rect.bottom += originTop;
|
|
bestHit = hit;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
return bestHit;
|
|
};
|
|
return HitDragging;
|
|
}());
|
|
function isHitsEqual(hit0, hit1) {
|
|
if (!hit0 && !hit1) {
|
|
return true;
|
|
}
|
|
if (Boolean(hit0) !== Boolean(hit1)) {
|
|
return false;
|
|
}
|
|
return isDateSpansEqual(hit0.dateSpan, hit1.dateSpan);
|
|
}
|
|
|
|
function buildDatePointApiWithContext(dateSpan, context) {
|
|
var props = {};
|
|
for (var _i = 0, _a = context.pluginHooks.datePointTransforms; _i < _a.length; _i++) {
|
|
var transform = _a[_i];
|
|
__assign(props, transform(dateSpan, context));
|
|
}
|
|
__assign(props, buildDatePointApi(dateSpan, context.dateEnv));
|
|
return props;
|
|
}
|
|
function buildDatePointApi(span, dateEnv) {
|
|
return {
|
|
date: dateEnv.toDate(span.range.start),
|
|
dateStr: dateEnv.formatIso(span.range.start, { omitTime: span.allDay }),
|
|
allDay: span.allDay,
|
|
};
|
|
}
|
|
|
|
/*
|
|
Monitors when the user clicks on a specific date/time of a component.
|
|
A pointerdown+pointerup on the same "hit" constitutes a click.
|
|
*/
|
|
var DateClicking = /** @class */ (function (_super) {
|
|
__extends(DateClicking, _super);
|
|
function DateClicking(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
_this.handlePointerDown = function (pev) {
|
|
var dragging = _this.dragging;
|
|
var downEl = pev.origEvent.target;
|
|
// do this in pointerdown (not dragend) because DOM might be mutated by the time dragend is fired
|
|
dragging.setIgnoreMove(!_this.component.isValidDateDownEl(downEl));
|
|
};
|
|
// won't even fire if moving was ignored
|
|
_this.handleDragEnd = function (ev) {
|
|
var component = _this.component;
|
|
var pointer = _this.dragging.pointer;
|
|
if (!pointer.wasTouchScroll) {
|
|
var _a = _this.hitDragging, initialHit = _a.initialHit, finalHit = _a.finalHit;
|
|
if (initialHit && finalHit && isHitsEqual(initialHit, finalHit)) {
|
|
var context = component.context;
|
|
var arg = __assign(__assign({}, buildDatePointApiWithContext(initialHit.dateSpan, context)), { dayEl: initialHit.dayEl, jsEvent: ev.origEvent, view: context.viewApi || context.calendarApi.view });
|
|
context.emitter.trigger('dateClick', arg);
|
|
}
|
|
}
|
|
};
|
|
// we DO want to watch pointer moves because otherwise finalHit won't get populated
|
|
_this.dragging = new FeaturefulElementDragging(settings.el);
|
|
_this.dragging.autoScroller.isEnabled = false;
|
|
var hitDragging = _this.hitDragging = new HitDragging(_this.dragging, interactionSettingsToStore(settings));
|
|
hitDragging.emitter.on('pointerdown', _this.handlePointerDown);
|
|
hitDragging.emitter.on('dragend', _this.handleDragEnd);
|
|
return _this;
|
|
}
|
|
DateClicking.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
return DateClicking;
|
|
}(Interaction));
|
|
|
|
/*
|
|
Tracks when the user selects a portion of time of a component,
|
|
constituted by a drag over date cells, with a possible delay at the beginning of the drag.
|
|
*/
|
|
var DateSelecting = /** @class */ (function (_super) {
|
|
__extends(DateSelecting, _super);
|
|
function DateSelecting(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
_this.dragSelection = null;
|
|
_this.handlePointerDown = function (ev) {
|
|
var _a = _this, component = _a.component, dragging = _a.dragging;
|
|
var options = component.context.options;
|
|
var canSelect = options.selectable &&
|
|
component.isValidDateDownEl(ev.origEvent.target);
|
|
// don't bother to watch expensive moves if component won't do selection
|
|
dragging.setIgnoreMove(!canSelect);
|
|
// if touch, require user to hold down
|
|
dragging.delay = ev.isTouch ? getComponentTouchDelay$1(component) : null;
|
|
};
|
|
_this.handleDragStart = function (ev) {
|
|
_this.component.context.calendarApi.unselect(ev); // unselect previous selections
|
|
};
|
|
_this.handleHitUpdate = function (hit, isFinal) {
|
|
var context = _this.component.context;
|
|
var dragSelection = null;
|
|
var isInvalid = false;
|
|
if (hit) {
|
|
var initialHit = _this.hitDragging.initialHit;
|
|
var disallowed = hit.componentId === initialHit.componentId
|
|
&& _this.isHitComboAllowed
|
|
&& !_this.isHitComboAllowed(initialHit, hit);
|
|
if (!disallowed) {
|
|
dragSelection = joinHitsIntoSelection(initialHit, hit, context.pluginHooks.dateSelectionTransformers);
|
|
}
|
|
if (!dragSelection || !isDateSelectionValid(dragSelection, hit.dateProfile, context)) {
|
|
isInvalid = true;
|
|
dragSelection = null;
|
|
}
|
|
}
|
|
if (dragSelection) {
|
|
context.dispatch({ type: 'SELECT_DATES', selection: dragSelection });
|
|
}
|
|
else if (!isFinal) { // only unselect if moved away while dragging
|
|
context.dispatch({ type: 'UNSELECT_DATES' });
|
|
}
|
|
if (!isInvalid) {
|
|
enableCursor();
|
|
}
|
|
else {
|
|
disableCursor();
|
|
}
|
|
if (!isFinal) {
|
|
_this.dragSelection = dragSelection; // only clear if moved away from all hits while dragging
|
|
}
|
|
};
|
|
_this.handlePointerUp = function (pev) {
|
|
if (_this.dragSelection) {
|
|
// selection is already rendered, so just need to report selection
|
|
triggerDateSelect(_this.dragSelection, pev, _this.component.context);
|
|
_this.dragSelection = null;
|
|
}
|
|
};
|
|
var component = settings.component;
|
|
var options = component.context.options;
|
|
var dragging = _this.dragging = new FeaturefulElementDragging(settings.el);
|
|
dragging.touchScrollAllowed = false;
|
|
dragging.minDistance = options.selectMinDistance || 0;
|
|
dragging.autoScroller.isEnabled = options.dragScroll;
|
|
var hitDragging = _this.hitDragging = new HitDragging(_this.dragging, interactionSettingsToStore(settings));
|
|
hitDragging.emitter.on('pointerdown', _this.handlePointerDown);
|
|
hitDragging.emitter.on('dragstart', _this.handleDragStart);
|
|
hitDragging.emitter.on('hitupdate', _this.handleHitUpdate);
|
|
hitDragging.emitter.on('pointerup', _this.handlePointerUp);
|
|
return _this;
|
|
}
|
|
DateSelecting.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
return DateSelecting;
|
|
}(Interaction));
|
|
function getComponentTouchDelay$1(component) {
|
|
var options = component.context.options;
|
|
var delay = options.selectLongPressDelay;
|
|
if (delay == null) {
|
|
delay = options.longPressDelay;
|
|
}
|
|
return delay;
|
|
}
|
|
function joinHitsIntoSelection(hit0, hit1, dateSelectionTransformers) {
|
|
var dateSpan0 = hit0.dateSpan;
|
|
var dateSpan1 = hit1.dateSpan;
|
|
var ms = [
|
|
dateSpan0.range.start,
|
|
dateSpan0.range.end,
|
|
dateSpan1.range.start,
|
|
dateSpan1.range.end,
|
|
];
|
|
ms.sort(compareNumbers);
|
|
var props = {};
|
|
for (var _i = 0, dateSelectionTransformers_1 = dateSelectionTransformers; _i < dateSelectionTransformers_1.length; _i++) {
|
|
var transformer = dateSelectionTransformers_1[_i];
|
|
var res = transformer(hit0, hit1);
|
|
if (res === false) {
|
|
return null;
|
|
}
|
|
if (res) {
|
|
__assign(props, res);
|
|
}
|
|
}
|
|
props.range = { start: ms[0], end: ms[3] };
|
|
props.allDay = dateSpan0.allDay;
|
|
return props;
|
|
}
|
|
|
|
var EventDragging = /** @class */ (function (_super) {
|
|
__extends(EventDragging, _super);
|
|
function EventDragging(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
// internal state
|
|
_this.subjectEl = null;
|
|
_this.subjectSeg = null; // the seg being selected/dragged
|
|
_this.isDragging = false;
|
|
_this.eventRange = null;
|
|
_this.relevantEvents = null; // the events being dragged
|
|
_this.receivingContext = null;
|
|
_this.validMutation = null;
|
|
_this.mutatedRelevantEvents = null;
|
|
_this.handlePointerDown = function (ev) {
|
|
var origTarget = ev.origEvent.target;
|
|
var _a = _this, component = _a.component, dragging = _a.dragging;
|
|
var mirror = dragging.mirror;
|
|
var options = component.context.options;
|
|
var initialContext = component.context;
|
|
_this.subjectEl = ev.subjectEl;
|
|
var subjectSeg = _this.subjectSeg = getElSeg(ev.subjectEl);
|
|
var eventRange = _this.eventRange = subjectSeg.eventRange;
|
|
var eventInstanceId = eventRange.instance.instanceId;
|
|
_this.relevantEvents = getRelevantEvents(initialContext.getCurrentData().eventStore, eventInstanceId);
|
|
dragging.minDistance = ev.isTouch ? 0 : options.eventDragMinDistance;
|
|
dragging.delay =
|
|
// only do a touch delay if touch and this event hasn't been selected yet
|
|
(ev.isTouch && eventInstanceId !== component.props.eventSelection) ?
|
|
getComponentTouchDelay(component) :
|
|
null;
|
|
if (options.fixedMirrorParent) {
|
|
mirror.parentNode = options.fixedMirrorParent;
|
|
}
|
|
else {
|
|
mirror.parentNode = elementClosest(origTarget, '.fc');
|
|
}
|
|
mirror.revertDuration = options.dragRevertDuration;
|
|
var isValid = component.isValidSegDownEl(origTarget) &&
|
|
!elementClosest(origTarget, '.fc-event-resizer'); // NOT on a resizer
|
|
dragging.setIgnoreMove(!isValid);
|
|
// disable dragging for elements that are resizable (ie, selectable)
|
|
// but are not draggable
|
|
_this.isDragging = isValid &&
|
|
ev.subjectEl.classList.contains('fc-event-draggable');
|
|
};
|
|
_this.handleDragStart = function (ev) {
|
|
var initialContext = _this.component.context;
|
|
var eventRange = _this.eventRange;
|
|
var eventInstanceId = eventRange.instance.instanceId;
|
|
if (ev.isTouch) {
|
|
// need to select a different event?
|
|
if (eventInstanceId !== _this.component.props.eventSelection) {
|
|
initialContext.dispatch({ type: 'SELECT_EVENT', eventInstanceId: eventInstanceId });
|
|
}
|
|
}
|
|
else {
|
|
// if now using mouse, but was previous touch interaction, clear selected event
|
|
initialContext.dispatch({ type: 'UNSELECT_EVENT' });
|
|
}
|
|
if (_this.isDragging) {
|
|
initialContext.calendarApi.unselect(ev); // unselect *date* selection
|
|
initialContext.emitter.trigger('eventDragStart', {
|
|
el: _this.subjectEl,
|
|
event: new EventApi(initialContext, eventRange.def, eventRange.instance),
|
|
jsEvent: ev.origEvent,
|
|
view: initialContext.viewApi,
|
|
});
|
|
}
|
|
};
|
|
_this.handleHitUpdate = function (hit, isFinal) {
|
|
if (!_this.isDragging) {
|
|
return;
|
|
}
|
|
var relevantEvents = _this.relevantEvents;
|
|
var initialHit = _this.hitDragging.initialHit;
|
|
var initialContext = _this.component.context;
|
|
// states based on new hit
|
|
var receivingContext = null;
|
|
var mutation = null;
|
|
var mutatedRelevantEvents = null;
|
|
var isInvalid = false;
|
|
var interaction = {
|
|
affectedEvents: relevantEvents,
|
|
mutatedEvents: createEmptyEventStore(),
|
|
isEvent: true,
|
|
};
|
|
if (hit) {
|
|
receivingContext = hit.context;
|
|
var receivingOptions = receivingContext.options;
|
|
if (initialContext === receivingContext ||
|
|
(receivingOptions.editable && receivingOptions.droppable)) {
|
|
mutation = computeEventMutation(initialHit, hit, receivingContext.getCurrentData().pluginHooks.eventDragMutationMassagers);
|
|
if (mutation) {
|
|
mutatedRelevantEvents = applyMutationToEventStore(relevantEvents, receivingContext.getCurrentData().eventUiBases, mutation, receivingContext);
|
|
interaction.mutatedEvents = mutatedRelevantEvents;
|
|
if (!isInteractionValid(interaction, hit.dateProfile, receivingContext)) {
|
|
isInvalid = true;
|
|
mutation = null;
|
|
mutatedRelevantEvents = null;
|
|
interaction.mutatedEvents = createEmptyEventStore();
|
|
}
|
|
}
|
|
}
|
|
else {
|
|
receivingContext = null;
|
|
}
|
|
}
|
|
_this.displayDrag(receivingContext, interaction);
|
|
if (!isInvalid) {
|
|
enableCursor();
|
|
}
|
|
else {
|
|
disableCursor();
|
|
}
|
|
if (!isFinal) {
|
|
if (initialContext === receivingContext && // TODO: write test for this
|
|
isHitsEqual(initialHit, hit)) {
|
|
mutation = null;
|
|
}
|
|
_this.dragging.setMirrorNeedsRevert(!mutation);
|
|
// render the mirror if no already-rendered mirror
|
|
// TODO: wish we could somehow wait for dispatch to guarantee render
|
|
_this.dragging.setMirrorIsVisible(!hit || !getElRoot(_this.subjectEl).querySelector('.fc-event-mirror'));
|
|
// assign states based on new hit
|
|
_this.receivingContext = receivingContext;
|
|
_this.validMutation = mutation;
|
|
_this.mutatedRelevantEvents = mutatedRelevantEvents;
|
|
}
|
|
};
|
|
_this.handlePointerUp = function () {
|
|
if (!_this.isDragging) {
|
|
_this.cleanup(); // because handleDragEnd won't fire
|
|
}
|
|
};
|
|
_this.handleDragEnd = function (ev) {
|
|
if (_this.isDragging) {
|
|
var initialContext_1 = _this.component.context;
|
|
var initialView = initialContext_1.viewApi;
|
|
var _a = _this, receivingContext_1 = _a.receivingContext, validMutation = _a.validMutation;
|
|
var eventDef = _this.eventRange.def;
|
|
var eventInstance = _this.eventRange.instance;
|
|
var eventApi = new EventApi(initialContext_1, eventDef, eventInstance);
|
|
var relevantEvents_1 = _this.relevantEvents;
|
|
var mutatedRelevantEvents_1 = _this.mutatedRelevantEvents;
|
|
var finalHit = _this.hitDragging.finalHit;
|
|
_this.clearDrag(); // must happen after revert animation
|
|
initialContext_1.emitter.trigger('eventDragStop', {
|
|
el: _this.subjectEl,
|
|
event: eventApi,
|
|
jsEvent: ev.origEvent,
|
|
view: initialView,
|
|
});
|
|
if (validMutation) {
|
|
// dropped within same calendar
|
|
if (receivingContext_1 === initialContext_1) {
|
|
var updatedEventApi = new EventApi(initialContext_1, mutatedRelevantEvents_1.defs[eventDef.defId], eventInstance ? mutatedRelevantEvents_1.instances[eventInstance.instanceId] : null);
|
|
initialContext_1.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: mutatedRelevantEvents_1,
|
|
});
|
|
var eventChangeArg = {
|
|
oldEvent: eventApi,
|
|
event: updatedEventApi,
|
|
relatedEvents: buildEventApis(mutatedRelevantEvents_1, initialContext_1, eventInstance),
|
|
revert: function () {
|
|
initialContext_1.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: relevantEvents_1, // the pre-change data
|
|
});
|
|
},
|
|
};
|
|
var transformed = {};
|
|
for (var _i = 0, _b = initialContext_1.getCurrentData().pluginHooks.eventDropTransformers; _i < _b.length; _i++) {
|
|
var transformer = _b[_i];
|
|
__assign(transformed, transformer(validMutation, initialContext_1));
|
|
}
|
|
initialContext_1.emitter.trigger('eventDrop', __assign(__assign(__assign({}, eventChangeArg), transformed), { el: ev.subjectEl, delta: validMutation.datesDelta, jsEvent: ev.origEvent, view: initialView }));
|
|
initialContext_1.emitter.trigger('eventChange', eventChangeArg);
|
|
// dropped in different calendar
|
|
}
|
|
else if (receivingContext_1) {
|
|
var eventRemoveArg = {
|
|
event: eventApi,
|
|
relatedEvents: buildEventApis(relevantEvents_1, initialContext_1, eventInstance),
|
|
revert: function () {
|
|
initialContext_1.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: relevantEvents_1,
|
|
});
|
|
},
|
|
};
|
|
initialContext_1.emitter.trigger('eventLeave', __assign(__assign({}, eventRemoveArg), { draggedEl: ev.subjectEl, view: initialView }));
|
|
initialContext_1.dispatch({
|
|
type: 'REMOVE_EVENTS',
|
|
eventStore: relevantEvents_1,
|
|
});
|
|
initialContext_1.emitter.trigger('eventRemove', eventRemoveArg);
|
|
var addedEventDef = mutatedRelevantEvents_1.defs[eventDef.defId];
|
|
var addedEventInstance = mutatedRelevantEvents_1.instances[eventInstance.instanceId];
|
|
var addedEventApi = new EventApi(receivingContext_1, addedEventDef, addedEventInstance);
|
|
receivingContext_1.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: mutatedRelevantEvents_1,
|
|
});
|
|
var eventAddArg = {
|
|
event: addedEventApi,
|
|
relatedEvents: buildEventApis(mutatedRelevantEvents_1, receivingContext_1, addedEventInstance),
|
|
revert: function () {
|
|
receivingContext_1.dispatch({
|
|
type: 'REMOVE_EVENTS',
|
|
eventStore: mutatedRelevantEvents_1,
|
|
});
|
|
},
|
|
};
|
|
receivingContext_1.emitter.trigger('eventAdd', eventAddArg);
|
|
if (ev.isTouch) {
|
|
receivingContext_1.dispatch({
|
|
type: 'SELECT_EVENT',
|
|
eventInstanceId: eventInstance.instanceId,
|
|
});
|
|
}
|
|
receivingContext_1.emitter.trigger('drop', __assign(__assign({}, buildDatePointApiWithContext(finalHit.dateSpan, receivingContext_1)), { draggedEl: ev.subjectEl, jsEvent: ev.origEvent, view: finalHit.context.viewApi }));
|
|
receivingContext_1.emitter.trigger('eventReceive', __assign(__assign({}, eventAddArg), { draggedEl: ev.subjectEl, view: finalHit.context.viewApi }));
|
|
}
|
|
}
|
|
else {
|
|
initialContext_1.emitter.trigger('_noEventDrop');
|
|
}
|
|
}
|
|
_this.cleanup();
|
|
};
|
|
var component = _this.component;
|
|
var options = component.context.options;
|
|
var dragging = _this.dragging = new FeaturefulElementDragging(settings.el);
|
|
dragging.pointer.selector = EventDragging.SELECTOR;
|
|
dragging.touchScrollAllowed = false;
|
|
dragging.autoScroller.isEnabled = options.dragScroll;
|
|
var hitDragging = _this.hitDragging = new HitDragging(_this.dragging, interactionSettingsStore);
|
|
hitDragging.useSubjectCenter = settings.useEventCenter;
|
|
hitDragging.emitter.on('pointerdown', _this.handlePointerDown);
|
|
hitDragging.emitter.on('dragstart', _this.handleDragStart);
|
|
hitDragging.emitter.on('hitupdate', _this.handleHitUpdate);
|
|
hitDragging.emitter.on('pointerup', _this.handlePointerUp);
|
|
hitDragging.emitter.on('dragend', _this.handleDragEnd);
|
|
return _this;
|
|
}
|
|
EventDragging.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
// render a drag state on the next receivingCalendar
|
|
EventDragging.prototype.displayDrag = function (nextContext, state) {
|
|
var initialContext = this.component.context;
|
|
var prevContext = this.receivingContext;
|
|
// does the previous calendar need to be cleared?
|
|
if (prevContext && prevContext !== nextContext) {
|
|
// does the initial calendar need to be cleared?
|
|
// if so, don't clear all the way. we still need to to hide the affectedEvents
|
|
if (prevContext === initialContext) {
|
|
prevContext.dispatch({
|
|
type: 'SET_EVENT_DRAG',
|
|
state: {
|
|
affectedEvents: state.affectedEvents,
|
|
mutatedEvents: createEmptyEventStore(),
|
|
isEvent: true,
|
|
},
|
|
});
|
|
// completely clear the old calendar if it wasn't the initial
|
|
}
|
|
else {
|
|
prevContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
|
|
}
|
|
}
|
|
if (nextContext) {
|
|
nextContext.dispatch({ type: 'SET_EVENT_DRAG', state: state });
|
|
}
|
|
};
|
|
EventDragging.prototype.clearDrag = function () {
|
|
var initialCalendar = this.component.context;
|
|
var receivingContext = this.receivingContext;
|
|
if (receivingContext) {
|
|
receivingContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
|
|
}
|
|
// the initial calendar might have an dummy drag state from displayDrag
|
|
if (initialCalendar !== receivingContext) {
|
|
initialCalendar.dispatch({ type: 'UNSET_EVENT_DRAG' });
|
|
}
|
|
};
|
|
EventDragging.prototype.cleanup = function () {
|
|
this.subjectSeg = null;
|
|
this.isDragging = false;
|
|
this.eventRange = null;
|
|
this.relevantEvents = null;
|
|
this.receivingContext = null;
|
|
this.validMutation = null;
|
|
this.mutatedRelevantEvents = null;
|
|
};
|
|
// TODO: test this in IE11
|
|
// QUESTION: why do we need it on the resizable???
|
|
EventDragging.SELECTOR = '.fc-event-draggable, .fc-event-resizable';
|
|
return EventDragging;
|
|
}(Interaction));
|
|
function computeEventMutation(hit0, hit1, massagers) {
|
|
var dateSpan0 = hit0.dateSpan;
|
|
var dateSpan1 = hit1.dateSpan;
|
|
var date0 = dateSpan0.range.start;
|
|
var date1 = dateSpan1.range.start;
|
|
var standardProps = {};
|
|
if (dateSpan0.allDay !== dateSpan1.allDay) {
|
|
standardProps.allDay = dateSpan1.allDay;
|
|
standardProps.hasEnd = hit1.context.options.allDayMaintainDuration;
|
|
if (dateSpan1.allDay) {
|
|
// means date1 is already start-of-day,
|
|
// but date0 needs to be converted
|
|
date0 = startOfDay(date0);
|
|
}
|
|
}
|
|
var delta = diffDates(date0, date1, hit0.context.dateEnv, hit0.componentId === hit1.componentId ?
|
|
hit0.largeUnit :
|
|
null);
|
|
if (delta.milliseconds) { // has hours/minutes/seconds
|
|
standardProps.allDay = false;
|
|
}
|
|
var mutation = {
|
|
datesDelta: delta,
|
|
standardProps: standardProps,
|
|
};
|
|
for (var _i = 0, massagers_1 = massagers; _i < massagers_1.length; _i++) {
|
|
var massager = massagers_1[_i];
|
|
massager(mutation, hit0, hit1);
|
|
}
|
|
return mutation;
|
|
}
|
|
function getComponentTouchDelay(component) {
|
|
var options = component.context.options;
|
|
var delay = options.eventLongPressDelay;
|
|
if (delay == null) {
|
|
delay = options.longPressDelay;
|
|
}
|
|
return delay;
|
|
}
|
|
|
|
var EventResizing = /** @class */ (function (_super) {
|
|
__extends(EventResizing, _super);
|
|
function EventResizing(settings) {
|
|
var _this = _super.call(this, settings) || this;
|
|
// internal state
|
|
_this.draggingSegEl = null;
|
|
_this.draggingSeg = null; // TODO: rename to resizingSeg? subjectSeg?
|
|
_this.eventRange = null;
|
|
_this.relevantEvents = null;
|
|
_this.validMutation = null;
|
|
_this.mutatedRelevantEvents = null;
|
|
_this.handlePointerDown = function (ev) {
|
|
var component = _this.component;
|
|
var segEl = _this.querySegEl(ev);
|
|
var seg = getElSeg(segEl);
|
|
var eventRange = _this.eventRange = seg.eventRange;
|
|
_this.dragging.minDistance = component.context.options.eventDragMinDistance;
|
|
// if touch, need to be working with a selected event
|
|
_this.dragging.setIgnoreMove(!_this.component.isValidSegDownEl(ev.origEvent.target) ||
|
|
(ev.isTouch && _this.component.props.eventSelection !== eventRange.instance.instanceId));
|
|
};
|
|
_this.handleDragStart = function (ev) {
|
|
var context = _this.component.context;
|
|
var eventRange = _this.eventRange;
|
|
_this.relevantEvents = getRelevantEvents(context.getCurrentData().eventStore, _this.eventRange.instance.instanceId);
|
|
var segEl = _this.querySegEl(ev);
|
|
_this.draggingSegEl = segEl;
|
|
_this.draggingSeg = getElSeg(segEl);
|
|
context.calendarApi.unselect();
|
|
context.emitter.trigger('eventResizeStart', {
|
|
el: segEl,
|
|
event: new EventApi(context, eventRange.def, eventRange.instance),
|
|
jsEvent: ev.origEvent,
|
|
view: context.viewApi,
|
|
});
|
|
};
|
|
_this.handleHitUpdate = function (hit, isFinal, ev) {
|
|
var context = _this.component.context;
|
|
var relevantEvents = _this.relevantEvents;
|
|
var initialHit = _this.hitDragging.initialHit;
|
|
var eventInstance = _this.eventRange.instance;
|
|
var mutation = null;
|
|
var mutatedRelevantEvents = null;
|
|
var isInvalid = false;
|
|
var interaction = {
|
|
affectedEvents: relevantEvents,
|
|
mutatedEvents: createEmptyEventStore(),
|
|
isEvent: true,
|
|
};
|
|
if (hit) {
|
|
var disallowed = hit.componentId === initialHit.componentId
|
|
&& _this.isHitComboAllowed
|
|
&& !_this.isHitComboAllowed(initialHit, hit);
|
|
if (!disallowed) {
|
|
mutation = computeMutation(initialHit, hit, ev.subjectEl.classList.contains('fc-event-resizer-start'), eventInstance.range);
|
|
}
|
|
}
|
|
if (mutation) {
|
|
mutatedRelevantEvents = applyMutationToEventStore(relevantEvents, context.getCurrentData().eventUiBases, mutation, context);
|
|
interaction.mutatedEvents = mutatedRelevantEvents;
|
|
if (!isInteractionValid(interaction, hit.dateProfile, context)) {
|
|
isInvalid = true;
|
|
mutation = null;
|
|
mutatedRelevantEvents = null;
|
|
interaction.mutatedEvents = null;
|
|
}
|
|
}
|
|
if (mutatedRelevantEvents) {
|
|
context.dispatch({
|
|
type: 'SET_EVENT_RESIZE',
|
|
state: interaction,
|
|
});
|
|
}
|
|
else {
|
|
context.dispatch({ type: 'UNSET_EVENT_RESIZE' });
|
|
}
|
|
if (!isInvalid) {
|
|
enableCursor();
|
|
}
|
|
else {
|
|
disableCursor();
|
|
}
|
|
if (!isFinal) {
|
|
if (mutation && isHitsEqual(initialHit, hit)) {
|
|
mutation = null;
|
|
}
|
|
_this.validMutation = mutation;
|
|
_this.mutatedRelevantEvents = mutatedRelevantEvents;
|
|
}
|
|
};
|
|
_this.handleDragEnd = function (ev) {
|
|
var context = _this.component.context;
|
|
var eventDef = _this.eventRange.def;
|
|
var eventInstance = _this.eventRange.instance;
|
|
var eventApi = new EventApi(context, eventDef, eventInstance);
|
|
var relevantEvents = _this.relevantEvents;
|
|
var mutatedRelevantEvents = _this.mutatedRelevantEvents;
|
|
context.emitter.trigger('eventResizeStop', {
|
|
el: _this.draggingSegEl,
|
|
event: eventApi,
|
|
jsEvent: ev.origEvent,
|
|
view: context.viewApi,
|
|
});
|
|
if (_this.validMutation) {
|
|
var updatedEventApi = new EventApi(context, mutatedRelevantEvents.defs[eventDef.defId], eventInstance ? mutatedRelevantEvents.instances[eventInstance.instanceId] : null);
|
|
context.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: mutatedRelevantEvents,
|
|
});
|
|
var eventChangeArg = {
|
|
oldEvent: eventApi,
|
|
event: updatedEventApi,
|
|
relatedEvents: buildEventApis(mutatedRelevantEvents, context, eventInstance),
|
|
revert: function () {
|
|
context.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: relevantEvents, // the pre-change events
|
|
});
|
|
},
|
|
};
|
|
context.emitter.trigger('eventResize', __assign(__assign({}, eventChangeArg), { el: _this.draggingSegEl, startDelta: _this.validMutation.startDelta || createDuration(0), endDelta: _this.validMutation.endDelta || createDuration(0), jsEvent: ev.origEvent, view: context.viewApi }));
|
|
context.emitter.trigger('eventChange', eventChangeArg);
|
|
}
|
|
else {
|
|
context.emitter.trigger('_noEventResize');
|
|
}
|
|
// reset all internal state
|
|
_this.draggingSeg = null;
|
|
_this.relevantEvents = null;
|
|
_this.validMutation = null;
|
|
// okay to keep eventInstance around. useful to set it in handlePointerDown
|
|
};
|
|
var component = settings.component;
|
|
var dragging = _this.dragging = new FeaturefulElementDragging(settings.el);
|
|
dragging.pointer.selector = '.fc-event-resizer';
|
|
dragging.touchScrollAllowed = false;
|
|
dragging.autoScroller.isEnabled = component.context.options.dragScroll;
|
|
var hitDragging = _this.hitDragging = new HitDragging(_this.dragging, interactionSettingsToStore(settings));
|
|
hitDragging.emitter.on('pointerdown', _this.handlePointerDown);
|
|
hitDragging.emitter.on('dragstart', _this.handleDragStart);
|
|
hitDragging.emitter.on('hitupdate', _this.handleHitUpdate);
|
|
hitDragging.emitter.on('dragend', _this.handleDragEnd);
|
|
return _this;
|
|
}
|
|
EventResizing.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
EventResizing.prototype.querySegEl = function (ev) {
|
|
return elementClosest(ev.subjectEl, '.fc-event');
|
|
};
|
|
return EventResizing;
|
|
}(Interaction));
|
|
function computeMutation(hit0, hit1, isFromStart, instanceRange) {
|
|
var dateEnv = hit0.context.dateEnv;
|
|
var date0 = hit0.dateSpan.range.start;
|
|
var date1 = hit1.dateSpan.range.start;
|
|
var delta = diffDates(date0, date1, dateEnv, hit0.largeUnit);
|
|
if (isFromStart) {
|
|
if (dateEnv.add(instanceRange.start, delta) < instanceRange.end) {
|
|
return { startDelta: delta };
|
|
}
|
|
}
|
|
else if (dateEnv.add(instanceRange.end, delta) > instanceRange.start) {
|
|
return { endDelta: delta };
|
|
}
|
|
return null;
|
|
}
|
|
|
|
var UnselectAuto = /** @class */ (function () {
|
|
function UnselectAuto(context) {
|
|
var _this = this;
|
|
this.context = context;
|
|
this.isRecentPointerDateSelect = false; // wish we could use a selector to detect date selection, but uses hit system
|
|
this.matchesCancel = false;
|
|
this.matchesEvent = false;
|
|
this.onSelect = function (selectInfo) {
|
|
if (selectInfo.jsEvent) {
|
|
_this.isRecentPointerDateSelect = true;
|
|
}
|
|
};
|
|
this.onDocumentPointerDown = function (pev) {
|
|
var unselectCancel = _this.context.options.unselectCancel;
|
|
var downEl = getEventTargetViaRoot(pev.origEvent);
|
|
_this.matchesCancel = !!elementClosest(downEl, unselectCancel);
|
|
_this.matchesEvent = !!elementClosest(downEl, EventDragging.SELECTOR); // interaction started on an event?
|
|
};
|
|
this.onDocumentPointerUp = function (pev) {
|
|
var context = _this.context;
|
|
var documentPointer = _this.documentPointer;
|
|
var calendarState = context.getCurrentData();
|
|
// touch-scrolling should never unfocus any type of selection
|
|
if (!documentPointer.wasTouchScroll) {
|
|
if (calendarState.dateSelection && // an existing date selection?
|
|
!_this.isRecentPointerDateSelect // a new pointer-initiated date selection since last onDocumentPointerUp?
|
|
) {
|
|
var unselectAuto = context.options.unselectAuto;
|
|
if (unselectAuto && (!unselectAuto || !_this.matchesCancel)) {
|
|
context.calendarApi.unselect(pev);
|
|
}
|
|
}
|
|
if (calendarState.eventSelection && // an existing event selected?
|
|
!_this.matchesEvent // interaction DIDN'T start on an event
|
|
) {
|
|
context.dispatch({ type: 'UNSELECT_EVENT' });
|
|
}
|
|
}
|
|
_this.isRecentPointerDateSelect = false;
|
|
};
|
|
var documentPointer = this.documentPointer = new PointerDragging(document);
|
|
documentPointer.shouldIgnoreMove = true;
|
|
documentPointer.shouldWatchScroll = false;
|
|
documentPointer.emitter.on('pointerdown', this.onDocumentPointerDown);
|
|
documentPointer.emitter.on('pointerup', this.onDocumentPointerUp);
|
|
/*
|
|
TODO: better way to know about whether there was a selection with the pointer
|
|
*/
|
|
context.emitter.on('select', this.onSelect);
|
|
}
|
|
UnselectAuto.prototype.destroy = function () {
|
|
this.context.emitter.off('select', this.onSelect);
|
|
this.documentPointer.destroy();
|
|
};
|
|
return UnselectAuto;
|
|
}());
|
|
|
|
var OPTION_REFINERS$5 = {
|
|
fixedMirrorParent: identity,
|
|
};
|
|
var LISTENER_REFINERS$1 = {
|
|
dateClick: identity,
|
|
eventDragStart: identity,
|
|
eventDragStop: identity,
|
|
eventDrop: identity,
|
|
eventResizeStart: identity,
|
|
eventResizeStop: identity,
|
|
eventResize: identity,
|
|
drop: identity,
|
|
eventReceive: identity,
|
|
eventLeave: identity,
|
|
};
|
|
|
|
/*
|
|
Given an already instantiated draggable object for one-or-more elements,
|
|
Interprets any dragging as an attempt to drag an events that lives outside
|
|
of a calendar onto a calendar.
|
|
*/
|
|
var ExternalElementDragging = /** @class */ (function () {
|
|
function ExternalElementDragging(dragging, suppliedDragMeta) {
|
|
var _this = this;
|
|
this.receivingContext = null;
|
|
this.droppableEvent = null; // will exist for all drags, even if create:false
|
|
this.suppliedDragMeta = null;
|
|
this.dragMeta = null;
|
|
this.handleDragStart = function (ev) {
|
|
_this.dragMeta = _this.buildDragMeta(ev.subjectEl);
|
|
};
|
|
this.handleHitUpdate = function (hit, isFinal, ev) {
|
|
var dragging = _this.hitDragging.dragging;
|
|
var receivingContext = null;
|
|
var droppableEvent = null;
|
|
var isInvalid = false;
|
|
var interaction = {
|
|
affectedEvents: createEmptyEventStore(),
|
|
mutatedEvents: createEmptyEventStore(),
|
|
isEvent: _this.dragMeta.create,
|
|
};
|
|
if (hit) {
|
|
receivingContext = hit.context;
|
|
if (_this.canDropElOnCalendar(ev.subjectEl, receivingContext)) {
|
|
droppableEvent = computeEventForDateSpan(hit.dateSpan, _this.dragMeta, receivingContext);
|
|
interaction.mutatedEvents = eventTupleToStore(droppableEvent);
|
|
isInvalid = !isInteractionValid(interaction, hit.dateProfile, receivingContext);
|
|
if (isInvalid) {
|
|
interaction.mutatedEvents = createEmptyEventStore();
|
|
droppableEvent = null;
|
|
}
|
|
}
|
|
}
|
|
_this.displayDrag(receivingContext, interaction);
|
|
// show mirror if no already-rendered mirror element OR if we are shutting down the mirror (?)
|
|
// TODO: wish we could somehow wait for dispatch to guarantee render
|
|
dragging.setMirrorIsVisible(isFinal || !droppableEvent || !document.querySelector('.fc-event-mirror'));
|
|
if (!isInvalid) {
|
|
enableCursor();
|
|
}
|
|
else {
|
|
disableCursor();
|
|
}
|
|
if (!isFinal) {
|
|
dragging.setMirrorNeedsRevert(!droppableEvent);
|
|
_this.receivingContext = receivingContext;
|
|
_this.droppableEvent = droppableEvent;
|
|
}
|
|
};
|
|
this.handleDragEnd = function (pev) {
|
|
var _a = _this, receivingContext = _a.receivingContext, droppableEvent = _a.droppableEvent;
|
|
_this.clearDrag();
|
|
if (receivingContext && droppableEvent) {
|
|
var finalHit = _this.hitDragging.finalHit;
|
|
var finalView = finalHit.context.viewApi;
|
|
var dragMeta = _this.dragMeta;
|
|
receivingContext.emitter.trigger('drop', __assign(__assign({}, buildDatePointApiWithContext(finalHit.dateSpan, receivingContext)), { draggedEl: pev.subjectEl, jsEvent: pev.origEvent, view: finalView }));
|
|
if (dragMeta.create) {
|
|
var addingEvents_1 = eventTupleToStore(droppableEvent);
|
|
receivingContext.dispatch({
|
|
type: 'MERGE_EVENTS',
|
|
eventStore: addingEvents_1,
|
|
});
|
|
if (pev.isTouch) {
|
|
receivingContext.dispatch({
|
|
type: 'SELECT_EVENT',
|
|
eventInstanceId: droppableEvent.instance.instanceId,
|
|
});
|
|
}
|
|
// signal that an external event landed
|
|
receivingContext.emitter.trigger('eventReceive', {
|
|
event: new EventApi(receivingContext, droppableEvent.def, droppableEvent.instance),
|
|
relatedEvents: [],
|
|
revert: function () {
|
|
receivingContext.dispatch({
|
|
type: 'REMOVE_EVENTS',
|
|
eventStore: addingEvents_1,
|
|
});
|
|
},
|
|
draggedEl: pev.subjectEl,
|
|
view: finalView,
|
|
});
|
|
}
|
|
}
|
|
_this.receivingContext = null;
|
|
_this.droppableEvent = null;
|
|
};
|
|
var hitDragging = this.hitDragging = new HitDragging(dragging, interactionSettingsStore);
|
|
hitDragging.requireInitial = false; // will start outside of a component
|
|
hitDragging.emitter.on('dragstart', this.handleDragStart);
|
|
hitDragging.emitter.on('hitupdate', this.handleHitUpdate);
|
|
hitDragging.emitter.on('dragend', this.handleDragEnd);
|
|
this.suppliedDragMeta = suppliedDragMeta;
|
|
}
|
|
ExternalElementDragging.prototype.buildDragMeta = function (subjectEl) {
|
|
if (typeof this.suppliedDragMeta === 'object') {
|
|
return parseDragMeta(this.suppliedDragMeta);
|
|
}
|
|
if (typeof this.suppliedDragMeta === 'function') {
|
|
return parseDragMeta(this.suppliedDragMeta(subjectEl));
|
|
}
|
|
return getDragMetaFromEl(subjectEl);
|
|
};
|
|
ExternalElementDragging.prototype.displayDrag = function (nextContext, state) {
|
|
var prevContext = this.receivingContext;
|
|
if (prevContext && prevContext !== nextContext) {
|
|
prevContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
|
|
}
|
|
if (nextContext) {
|
|
nextContext.dispatch({ type: 'SET_EVENT_DRAG', state: state });
|
|
}
|
|
};
|
|
ExternalElementDragging.prototype.clearDrag = function () {
|
|
if (this.receivingContext) {
|
|
this.receivingContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
|
|
}
|
|
};
|
|
ExternalElementDragging.prototype.canDropElOnCalendar = function (el, receivingContext) {
|
|
var dropAccept = receivingContext.options.dropAccept;
|
|
if (typeof dropAccept === 'function') {
|
|
return dropAccept.call(receivingContext.calendarApi, el);
|
|
}
|
|
if (typeof dropAccept === 'string' && dropAccept) {
|
|
return Boolean(elementMatches(el, dropAccept));
|
|
}
|
|
return true;
|
|
};
|
|
return ExternalElementDragging;
|
|
}());
|
|
// Utils for computing event store from the DragMeta
|
|
// ----------------------------------------------------------------------------------------------------
|
|
function computeEventForDateSpan(dateSpan, dragMeta, context) {
|
|
var defProps = __assign({}, dragMeta.leftoverProps);
|
|
for (var _i = 0, _a = context.pluginHooks.externalDefTransforms; _i < _a.length; _i++) {
|
|
var transform = _a[_i];
|
|
__assign(defProps, transform(dateSpan, dragMeta));
|
|
}
|
|
var _b = refineEventDef(defProps, context), refined = _b.refined, extra = _b.extra;
|
|
var def = parseEventDef(refined, extra, dragMeta.sourceId, dateSpan.allDay, context.options.forceEventDuration || Boolean(dragMeta.duration), // hasEnd
|
|
context);
|
|
var start = dateSpan.range.start;
|
|
// only rely on time info if drop zone is all-day,
|
|
// otherwise, we already know the time
|
|
if (dateSpan.allDay && dragMeta.startTime) {
|
|
start = context.dateEnv.add(start, dragMeta.startTime);
|
|
}
|
|
var end = dragMeta.duration ?
|
|
context.dateEnv.add(start, dragMeta.duration) :
|
|
getDefaultEventEnd(dateSpan.allDay, start, context);
|
|
var instance = createEventInstance(def.defId, { start: start, end: end });
|
|
return { def: def, instance: instance };
|
|
}
|
|
// Utils for extracting data from element
|
|
// ----------------------------------------------------------------------------------------------------
|
|
function getDragMetaFromEl(el) {
|
|
var str = getEmbeddedElData(el, 'event');
|
|
var obj = str ?
|
|
JSON.parse(str) :
|
|
{ create: false }; // if no embedded data, assume no event creation
|
|
return parseDragMeta(obj);
|
|
}
|
|
config.dataAttrPrefix = '';
|
|
function getEmbeddedElData(el, name) {
|
|
var prefix = config.dataAttrPrefix;
|
|
var prefixedName = (prefix ? prefix + '-' : '') + name;
|
|
return el.getAttribute('data-' + prefixedName) || '';
|
|
}
|
|
|
|
/*
|
|
Makes an element (that is *external* to any calendar) draggable.
|
|
Can pass in data that determines how an event will be created when dropped onto a calendar.
|
|
Leverages FullCalendar's internal drag-n-drop functionality WITHOUT a third-party drag system.
|
|
*/
|
|
var ExternalDraggable = /** @class */ (function () {
|
|
function ExternalDraggable(el, settings) {
|
|
var _this = this;
|
|
if (settings === void 0) { settings = {}; }
|
|
this.handlePointerDown = function (ev) {
|
|
var dragging = _this.dragging;
|
|
var _a = _this.settings, minDistance = _a.minDistance, longPressDelay = _a.longPressDelay;
|
|
dragging.minDistance =
|
|
minDistance != null ?
|
|
minDistance :
|
|
(ev.isTouch ? 0 : BASE_OPTION_DEFAULTS.eventDragMinDistance);
|
|
dragging.delay =
|
|
ev.isTouch ? // TODO: eventually read eventLongPressDelay instead vvv
|
|
(longPressDelay != null ? longPressDelay : BASE_OPTION_DEFAULTS.longPressDelay) :
|
|
0;
|
|
};
|
|
this.handleDragStart = function (ev) {
|
|
if (ev.isTouch &&
|
|
_this.dragging.delay &&
|
|
ev.subjectEl.classList.contains('fc-event')) {
|
|
_this.dragging.mirror.getMirrorEl().classList.add('fc-event-selected');
|
|
}
|
|
};
|
|
this.settings = settings;
|
|
var dragging = this.dragging = new FeaturefulElementDragging(el);
|
|
dragging.touchScrollAllowed = false;
|
|
if (settings.itemSelector != null) {
|
|
dragging.pointer.selector = settings.itemSelector;
|
|
}
|
|
if (settings.appendTo != null) {
|
|
dragging.mirror.parentNode = settings.appendTo; // TODO: write tests
|
|
}
|
|
dragging.emitter.on('pointerdown', this.handlePointerDown);
|
|
dragging.emitter.on('dragstart', this.handleDragStart);
|
|
new ExternalElementDragging(dragging, settings.eventData); // eslint-disable-line no-new
|
|
}
|
|
ExternalDraggable.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
return ExternalDraggable;
|
|
}());
|
|
|
|
/*
|
|
Detects when a *THIRD-PARTY* drag-n-drop system interacts with elements.
|
|
The third-party system is responsible for drawing the visuals effects of the drag.
|
|
This class simply monitors for pointer movements and fires events.
|
|
It also has the ability to hide the moving element (the "mirror") during the drag.
|
|
*/
|
|
var InferredElementDragging = /** @class */ (function (_super) {
|
|
__extends(InferredElementDragging, _super);
|
|
function InferredElementDragging(containerEl) {
|
|
var _this = _super.call(this, containerEl) || this;
|
|
_this.shouldIgnoreMove = false;
|
|
_this.mirrorSelector = '';
|
|
_this.currentMirrorEl = null;
|
|
_this.handlePointerDown = function (ev) {
|
|
_this.emitter.trigger('pointerdown', ev);
|
|
if (!_this.shouldIgnoreMove) {
|
|
// fire dragstart right away. does not support delay or min-distance
|
|
_this.emitter.trigger('dragstart', ev);
|
|
}
|
|
};
|
|
_this.handlePointerMove = function (ev) {
|
|
if (!_this.shouldIgnoreMove) {
|
|
_this.emitter.trigger('dragmove', ev);
|
|
}
|
|
};
|
|
_this.handlePointerUp = function (ev) {
|
|
_this.emitter.trigger('pointerup', ev);
|
|
if (!_this.shouldIgnoreMove) {
|
|
// fire dragend right away. does not support a revert animation
|
|
_this.emitter.trigger('dragend', ev);
|
|
}
|
|
};
|
|
var pointer = _this.pointer = new PointerDragging(containerEl);
|
|
pointer.emitter.on('pointerdown', _this.handlePointerDown);
|
|
pointer.emitter.on('pointermove', _this.handlePointerMove);
|
|
pointer.emitter.on('pointerup', _this.handlePointerUp);
|
|
return _this;
|
|
}
|
|
InferredElementDragging.prototype.destroy = function () {
|
|
this.pointer.destroy();
|
|
};
|
|
InferredElementDragging.prototype.setIgnoreMove = function (bool) {
|
|
this.shouldIgnoreMove = bool;
|
|
};
|
|
InferredElementDragging.prototype.setMirrorIsVisible = function (bool) {
|
|
if (bool) {
|
|
// restore a previously hidden element.
|
|
// use the reference in case the selector class has already been removed.
|
|
if (this.currentMirrorEl) {
|
|
this.currentMirrorEl.style.visibility = '';
|
|
this.currentMirrorEl = null;
|
|
}
|
|
}
|
|
else {
|
|
var mirrorEl = this.mirrorSelector
|
|
// TODO: somehow query FullCalendars WITHIN shadow-roots
|
|
? document.querySelector(this.mirrorSelector)
|
|
: null;
|
|
if (mirrorEl) {
|
|
this.currentMirrorEl = mirrorEl;
|
|
mirrorEl.style.visibility = 'hidden';
|
|
}
|
|
}
|
|
};
|
|
return InferredElementDragging;
|
|
}(ElementDragging));
|
|
|
|
/*
|
|
Bridges third-party drag-n-drop systems with FullCalendar.
|
|
Must be instantiated and destroyed by caller.
|
|
*/
|
|
var ThirdPartyDraggable = /** @class */ (function () {
|
|
function ThirdPartyDraggable(containerOrSettings, settings) {
|
|
var containerEl = document;
|
|
if (
|
|
// wish we could just test instanceof EventTarget, but doesn't work in IE11
|
|
containerOrSettings === document ||
|
|
containerOrSettings instanceof Element) {
|
|
containerEl = containerOrSettings;
|
|
settings = settings || {};
|
|
}
|
|
else {
|
|
settings = (containerOrSettings || {});
|
|
}
|
|
var dragging = this.dragging = new InferredElementDragging(containerEl);
|
|
if (typeof settings.itemSelector === 'string') {
|
|
dragging.pointer.selector = settings.itemSelector;
|
|
}
|
|
else if (containerEl === document) {
|
|
dragging.pointer.selector = '[data-event]';
|
|
}
|
|
if (typeof settings.mirrorSelector === 'string') {
|
|
dragging.mirrorSelector = settings.mirrorSelector;
|
|
}
|
|
new ExternalElementDragging(dragging, settings.eventData); // eslint-disable-line no-new
|
|
}
|
|
ThirdPartyDraggable.prototype.destroy = function () {
|
|
this.dragging.destroy();
|
|
};
|
|
return ThirdPartyDraggable;
|
|
}());
|
|
|
|
var interactionPlugin = createPlugin({
|
|
componentInteractions: [DateClicking, DateSelecting, EventDragging, EventResizing],
|
|
calendarInteractions: [UnselectAuto],
|
|
elementDraggingImpl: FeaturefulElementDragging,
|
|
optionRefiners: OPTION_REFINERS$5,
|
|
listenerRefiners: LISTENER_REFINERS$1,
|
|
});
|
|
|
|
/* An abstract class for the daygrid views, as well as month view. Renders one or more rows of day cells.
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
// It is a manager for a Table subcomponent, which does most of the heavy lifting.
|
|
// It is responsible for managing width/height.
|
|
var TableView = /** @class */ (function (_super) {
|
|
__extends(TableView, _super);
|
|
function TableView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.headerElRef = createRef();
|
|
return _this;
|
|
}
|
|
TableView.prototype.renderSimpleLayout = function (headerRowContent, bodyContent) {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var sections = [];
|
|
var stickyHeaderDates = getStickyHeaderDates(context.options);
|
|
if (headerRowContent) {
|
|
sections.push({
|
|
type: 'header',
|
|
key: 'header',
|
|
isSticky: stickyHeaderDates,
|
|
chunk: {
|
|
elRef: this.headerElRef,
|
|
tableClassName: 'fc-col-header',
|
|
rowContent: headerRowContent,
|
|
},
|
|
});
|
|
}
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'body',
|
|
liquid: true,
|
|
chunk: { content: bodyContent },
|
|
});
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: ['fc-daygrid'].concat(classNames).join(' ') },
|
|
createElement(SimpleScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, cols: [] /* TODO: make optional? */, sections: sections }))); }));
|
|
};
|
|
TableView.prototype.renderHScrollLayout = function (headerRowContent, bodyContent, colCnt, dayMinWidth) {
|
|
var ScrollGrid = this.context.pluginHooks.scrollGridImpl;
|
|
if (!ScrollGrid) {
|
|
throw new Error('No ScrollGrid implementation');
|
|
}
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(context.options);
|
|
var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(context.options);
|
|
var sections = [];
|
|
if (headerRowContent) {
|
|
sections.push({
|
|
type: 'header',
|
|
key: 'header',
|
|
isSticky: stickyHeaderDates,
|
|
chunks: [{
|
|
key: 'main',
|
|
elRef: this.headerElRef,
|
|
tableClassName: 'fc-col-header',
|
|
rowContent: headerRowContent,
|
|
}],
|
|
});
|
|
}
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'body',
|
|
liquid: true,
|
|
chunks: [{
|
|
key: 'main',
|
|
content: bodyContent,
|
|
}],
|
|
});
|
|
if (stickyFooterScrollbar) {
|
|
sections.push({
|
|
type: 'footer',
|
|
key: 'footer',
|
|
isSticky: true,
|
|
chunks: [{
|
|
key: 'main',
|
|
content: renderScrollShim,
|
|
}],
|
|
});
|
|
}
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: ['fc-daygrid'].concat(classNames).join(' ') },
|
|
createElement(ScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, colGroups: [{ cols: [{ span: colCnt, minWidth: dayMinWidth }] }], sections: sections }))); }));
|
|
};
|
|
return TableView;
|
|
}(DateComponent));
|
|
|
|
function splitSegsByRow(segs, rowCnt) {
|
|
var byRow = [];
|
|
for (var i = 0; i < rowCnt; i += 1) {
|
|
byRow[i] = [];
|
|
}
|
|
for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
|
|
var seg = segs_1[_i];
|
|
byRow[seg.row].push(seg);
|
|
}
|
|
return byRow;
|
|
}
|
|
function splitSegsByFirstCol(segs, colCnt) {
|
|
var byCol = [];
|
|
for (var i = 0; i < colCnt; i += 1) {
|
|
byCol[i] = [];
|
|
}
|
|
for (var _i = 0, segs_2 = segs; _i < segs_2.length; _i++) {
|
|
var seg = segs_2[_i];
|
|
byCol[seg.firstCol].push(seg);
|
|
}
|
|
return byCol;
|
|
}
|
|
function splitInteractionByRow(ui, rowCnt) {
|
|
var byRow = [];
|
|
if (!ui) {
|
|
for (var i = 0; i < rowCnt; i += 1) {
|
|
byRow[i] = null;
|
|
}
|
|
}
|
|
else {
|
|
for (var i = 0; i < rowCnt; i += 1) {
|
|
byRow[i] = {
|
|
affectedInstances: ui.affectedInstances,
|
|
isEvent: ui.isEvent,
|
|
segs: [],
|
|
};
|
|
}
|
|
for (var _i = 0, _a = ui.segs; _i < _a.length; _i++) {
|
|
var seg = _a[_i];
|
|
byRow[seg.row].segs.push(seg);
|
|
}
|
|
}
|
|
return byRow;
|
|
}
|
|
|
|
var TableCellTop = /** @class */ (function (_super) {
|
|
__extends(TableCellTop, _super);
|
|
function TableCellTop() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TableCellTop.prototype.render = function () {
|
|
var props = this.props;
|
|
var navLinkAttrs = buildNavLinkAttrs(this.context, props.date);
|
|
return (createElement(DayCellContent, { date: props.date, dateProfile: props.dateProfile, todayRange: props.todayRange, showDayNumber: props.showDayNumber, extraHookProps: props.extraHookProps, defaultContent: renderTopInner }, function (innerElRef, innerContent) { return ((innerContent || props.forceDayTop) && (createElement("div", { className: "fc-daygrid-day-top", ref: innerElRef },
|
|
createElement("a", __assign({ id: props.dayNumberId, className: "fc-daygrid-day-number" }, navLinkAttrs), innerContent || createElement(Fragment, null, "\u00A0"))))); }));
|
|
};
|
|
return TableCellTop;
|
|
}(BaseComponent));
|
|
function renderTopInner(props) {
|
|
return props.dayNumberText;
|
|
}
|
|
|
|
var DEFAULT_TABLE_EVENT_TIME_FORMAT = createFormatter({
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
omitZeroMinute: true,
|
|
meridiem: 'narrow',
|
|
});
|
|
function hasListItemDisplay(seg) {
|
|
var display = seg.eventRange.ui.display;
|
|
return display === 'list-item' || (display === 'auto' &&
|
|
!seg.eventRange.def.allDay &&
|
|
seg.firstCol === seg.lastCol && // can't be multi-day
|
|
seg.isStart && // "
|
|
seg.isEnd // "
|
|
);
|
|
}
|
|
|
|
var TableBlockEvent = /** @class */ (function (_super) {
|
|
__extends(TableBlockEvent, _super);
|
|
function TableBlockEvent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TableBlockEvent.prototype.render = function () {
|
|
var props = this.props;
|
|
return (createElement(StandardEvent, __assign({}, props, { extraClassNames: ['fc-daygrid-event', 'fc-daygrid-block-event', 'fc-h-event'], defaultTimeFormat: DEFAULT_TABLE_EVENT_TIME_FORMAT, defaultDisplayEventEnd: props.defaultDisplayEventEnd, disableResizing: !props.seg.eventRange.def.allDay })));
|
|
};
|
|
return TableBlockEvent;
|
|
}(BaseComponent));
|
|
|
|
var TableListItemEvent = /** @class */ (function (_super) {
|
|
__extends(TableListItemEvent, _super);
|
|
function TableListItemEvent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TableListItemEvent.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var timeFormat = context.options.eventTimeFormat || DEFAULT_TABLE_EVENT_TIME_FORMAT;
|
|
var timeText = buildSegTimeText(props.seg, timeFormat, context, true, props.defaultDisplayEventEnd);
|
|
return (createElement(EventRoot, { seg: props.seg, timeText: timeText, defaultContent: renderInnerContent$4, isDragging: props.isDragging, isResizing: false, isDateSelecting: false, isSelected: props.isSelected, isPast: props.isPast, isFuture: props.isFuture, isToday: props.isToday }, function (rootElRef, classNames, innerElRef, innerContent) { return ( // we don't use styles!
|
|
createElement("a", __assign({ className: ['fc-daygrid-event', 'fc-daygrid-dot-event'].concat(classNames).join(' '), ref: rootElRef }, getSegAnchorAttrs(props.seg, context)), innerContent)); }));
|
|
};
|
|
return TableListItemEvent;
|
|
}(BaseComponent));
|
|
function renderInnerContent$4(innerProps) {
|
|
return (createElement(Fragment, null,
|
|
createElement("div", { className: "fc-daygrid-event-dot", style: { borderColor: innerProps.borderColor || innerProps.backgroundColor } }),
|
|
innerProps.timeText && (createElement("div", { className: "fc-event-time" }, innerProps.timeText)),
|
|
createElement("div", { className: "fc-event-title" }, innerProps.event.title || createElement(Fragment, null, "\u00A0"))));
|
|
}
|
|
|
|
var TableCellMoreLink = /** @class */ (function (_super) {
|
|
__extends(TableCellMoreLink, _super);
|
|
function TableCellMoreLink() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.compileSegs = memoize(compileSegs);
|
|
return _this;
|
|
}
|
|
TableCellMoreLink.prototype.render = function () {
|
|
var props = this.props;
|
|
var _a = this.compileSegs(props.singlePlacements), allSegs = _a.allSegs, invisibleSegs = _a.invisibleSegs;
|
|
return (createElement(MoreLinkRoot, { dateProfile: props.dateProfile, todayRange: props.todayRange, allDayDate: props.allDayDate, moreCnt: props.moreCnt, allSegs: allSegs, hiddenSegs: invisibleSegs, alignmentElRef: props.alignmentElRef, alignGridTop: props.alignGridTop, extraDateSpan: props.extraDateSpan, popoverContent: function () {
|
|
var isForcedInvisible = (props.eventDrag ? props.eventDrag.affectedInstances : null) ||
|
|
(props.eventResize ? props.eventResize.affectedInstances : null) ||
|
|
{};
|
|
return (createElement(Fragment, null, allSegs.map(function (seg) {
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
return (createElement("div", { className: "fc-daygrid-event-harness", key: instanceId, style: {
|
|
visibility: isForcedInvisible[instanceId] ? 'hidden' : '',
|
|
} }, hasListItemDisplay(seg) ? (createElement(TableListItemEvent, __assign({ seg: seg, isDragging: false, isSelected: instanceId === props.eventSelection, defaultDisplayEventEnd: false }, getSegMeta(seg, props.todayRange)))) : (createElement(TableBlockEvent, __assign({ seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === props.eventSelection, defaultDisplayEventEnd: false }, getSegMeta(seg, props.todayRange))))));
|
|
})));
|
|
} }, function (rootElRef, classNames, innerElRef, innerContent, handleClick, title, isExpanded, popoverId) { return (createElement("a", __assign({ ref: rootElRef, className: ['fc-daygrid-more-link'].concat(classNames).join(' '), title: title, "aria-expanded": isExpanded, "aria-controls": popoverId }, createAriaClickAttrs(handleClick)), innerContent)); }));
|
|
};
|
|
return TableCellMoreLink;
|
|
}(BaseComponent));
|
|
function compileSegs(singlePlacements) {
|
|
var allSegs = [];
|
|
var invisibleSegs = [];
|
|
for (var _i = 0, singlePlacements_1 = singlePlacements; _i < singlePlacements_1.length; _i++) {
|
|
var placement = singlePlacements_1[_i];
|
|
allSegs.push(placement.seg);
|
|
if (!placement.isVisible) {
|
|
invisibleSegs.push(placement.seg);
|
|
}
|
|
}
|
|
return { allSegs: allSegs, invisibleSegs: invisibleSegs };
|
|
}
|
|
|
|
var DEFAULT_WEEK_NUM_FORMAT$1 = createFormatter({ week: 'narrow' });
|
|
var TableCell = /** @class */ (function (_super) {
|
|
__extends(TableCell, _super);
|
|
function TableCell() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
_this.state = {
|
|
dayNumberId: getUniqueDomId(),
|
|
};
|
|
_this.handleRootEl = function (el) {
|
|
setRef(_this.rootElRef, el);
|
|
setRef(_this.props.elRef, el);
|
|
};
|
|
return _this;
|
|
}
|
|
TableCell.prototype.render = function () {
|
|
var _a = this, context = _a.context, props = _a.props, state = _a.state, rootElRef = _a.rootElRef;
|
|
var date = props.date, dateProfile = props.dateProfile;
|
|
var navLinkAttrs = buildNavLinkAttrs(context, date, 'week');
|
|
return (createElement(DayCellRoot, { date: date, dateProfile: dateProfile, todayRange: props.todayRange, showDayNumber: props.showDayNumber, extraHookProps: props.extraHookProps, elRef: this.handleRootEl }, function (dayElRef, dayClassNames, rootDataAttrs, isDisabled) { return (createElement("td", __assign({ ref: dayElRef, role: "gridcell", className: ['fc-daygrid-day'].concat(dayClassNames, props.extraClassNames || []).join(' ') }, rootDataAttrs, props.extraDataAttrs, (props.showDayNumber ? { 'aria-labelledby': state.dayNumberId } : {})),
|
|
createElement("div", { className: "fc-daygrid-day-frame fc-scrollgrid-sync-inner", ref: props.innerElRef /* different from hook system! RENAME */ },
|
|
props.showWeekNumber && (createElement(WeekNumberRoot, { date: date, defaultFormat: DEFAULT_WEEK_NUM_FORMAT$1 }, function (weekElRef, weekClassNames, innerElRef, innerContent) { return (createElement("a", __assign({ ref: weekElRef, className: ['fc-daygrid-week-number'].concat(weekClassNames).join(' ') }, navLinkAttrs), innerContent)); })),
|
|
!isDisabled && (createElement(TableCellTop, { date: date, dateProfile: dateProfile, showDayNumber: props.showDayNumber, dayNumberId: state.dayNumberId, forceDayTop: props.forceDayTop, todayRange: props.todayRange, extraHookProps: props.extraHookProps })),
|
|
createElement("div", { className: "fc-daygrid-day-events", ref: props.fgContentElRef },
|
|
props.fgContent,
|
|
createElement("div", { className: "fc-daygrid-day-bottom", style: { marginTop: props.moreMarginTop } },
|
|
createElement(TableCellMoreLink, { allDayDate: date, singlePlacements: props.singlePlacements, moreCnt: props.moreCnt, alignmentElRef: rootElRef, alignGridTop: !props.showDayNumber, extraDateSpan: props.extraDateSpan, dateProfile: props.dateProfile, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, todayRange: props.todayRange }))),
|
|
createElement("div", { className: "fc-daygrid-day-bg" }, props.bgContent)))); }));
|
|
};
|
|
return TableCell;
|
|
}(DateComponent));
|
|
|
|
function computeFgSegPlacement(segs, // assumed already sorted
|
|
dayMaxEvents, dayMaxEventRows, strictOrder, eventInstanceHeights, maxContentHeight, cells) {
|
|
var hierarchy = new DayGridSegHierarchy();
|
|
hierarchy.allowReslicing = true;
|
|
hierarchy.strictOrder = strictOrder;
|
|
if (dayMaxEvents === true || dayMaxEventRows === true) {
|
|
hierarchy.maxCoord = maxContentHeight;
|
|
hierarchy.hiddenConsumes = true;
|
|
}
|
|
else if (typeof dayMaxEvents === 'number') {
|
|
hierarchy.maxStackCnt = dayMaxEvents;
|
|
}
|
|
else if (typeof dayMaxEventRows === 'number') {
|
|
hierarchy.maxStackCnt = dayMaxEventRows;
|
|
hierarchy.hiddenConsumes = true;
|
|
}
|
|
// create segInputs only for segs with known heights
|
|
var segInputs = [];
|
|
var unknownHeightSegs = [];
|
|
for (var i = 0; i < segs.length; i += 1) {
|
|
var seg = segs[i];
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
var eventHeight = eventInstanceHeights[instanceId];
|
|
if (eventHeight != null) {
|
|
segInputs.push({
|
|
index: i,
|
|
thickness: eventHeight,
|
|
span: {
|
|
start: seg.firstCol,
|
|
end: seg.lastCol + 1,
|
|
},
|
|
});
|
|
}
|
|
else {
|
|
unknownHeightSegs.push(seg);
|
|
}
|
|
}
|
|
var hiddenEntries = hierarchy.addSegs(segInputs);
|
|
var segRects = hierarchy.toRects();
|
|
var _a = placeRects(segRects, segs, cells), singleColPlacements = _a.singleColPlacements, multiColPlacements = _a.multiColPlacements, leftoverMargins = _a.leftoverMargins;
|
|
var moreCnts = [];
|
|
var moreMarginTops = [];
|
|
// add segs with unknown heights
|
|
for (var _i = 0, unknownHeightSegs_1 = unknownHeightSegs; _i < unknownHeightSegs_1.length; _i++) {
|
|
var seg = unknownHeightSegs_1[_i];
|
|
multiColPlacements[seg.firstCol].push({
|
|
seg: seg,
|
|
isVisible: false,
|
|
isAbsolute: true,
|
|
absoluteTop: 0,
|
|
marginTop: 0,
|
|
});
|
|
for (var col = seg.firstCol; col <= seg.lastCol; col += 1) {
|
|
singleColPlacements[col].push({
|
|
seg: resliceSeg(seg, col, col + 1, cells),
|
|
isVisible: false,
|
|
isAbsolute: false,
|
|
absoluteTop: 0,
|
|
marginTop: 0,
|
|
});
|
|
}
|
|
}
|
|
// add the hidden entries
|
|
for (var col = 0; col < cells.length; col += 1) {
|
|
moreCnts.push(0);
|
|
}
|
|
for (var _b = 0, hiddenEntries_1 = hiddenEntries; _b < hiddenEntries_1.length; _b++) {
|
|
var hiddenEntry = hiddenEntries_1[_b];
|
|
var seg = segs[hiddenEntry.index];
|
|
var hiddenSpan = hiddenEntry.span;
|
|
multiColPlacements[hiddenSpan.start].push({
|
|
seg: resliceSeg(seg, hiddenSpan.start, hiddenSpan.end, cells),
|
|
isVisible: false,
|
|
isAbsolute: true,
|
|
absoluteTop: 0,
|
|
marginTop: 0,
|
|
});
|
|
for (var col = hiddenSpan.start; col < hiddenSpan.end; col += 1) {
|
|
moreCnts[col] += 1;
|
|
singleColPlacements[col].push({
|
|
seg: resliceSeg(seg, col, col + 1, cells),
|
|
isVisible: false,
|
|
isAbsolute: false,
|
|
absoluteTop: 0,
|
|
marginTop: 0,
|
|
});
|
|
}
|
|
}
|
|
// deal with leftover margins
|
|
for (var col = 0; col < cells.length; col += 1) {
|
|
moreMarginTops.push(leftoverMargins[col]);
|
|
}
|
|
return { singleColPlacements: singleColPlacements, multiColPlacements: multiColPlacements, moreCnts: moreCnts, moreMarginTops: moreMarginTops };
|
|
}
|
|
// rects ordered by top coord, then left
|
|
function placeRects(allRects, segs, cells) {
|
|
var rectsByEachCol = groupRectsByEachCol(allRects, cells.length);
|
|
var singleColPlacements = [];
|
|
var multiColPlacements = [];
|
|
var leftoverMargins = [];
|
|
for (var col = 0; col < cells.length; col += 1) {
|
|
var rects = rectsByEachCol[col];
|
|
// compute all static segs in singlePlacements
|
|
var singlePlacements = [];
|
|
var currentHeight = 0;
|
|
var currentMarginTop = 0;
|
|
for (var _i = 0, rects_1 = rects; _i < rects_1.length; _i++) {
|
|
var rect = rects_1[_i];
|
|
var seg = segs[rect.index];
|
|
singlePlacements.push({
|
|
seg: resliceSeg(seg, col, col + 1, cells),
|
|
isVisible: true,
|
|
isAbsolute: false,
|
|
absoluteTop: rect.levelCoord,
|
|
marginTop: rect.levelCoord - currentHeight,
|
|
});
|
|
currentHeight = rect.levelCoord + rect.thickness;
|
|
}
|
|
// compute mixed static/absolute segs in multiPlacements
|
|
var multiPlacements = [];
|
|
currentHeight = 0;
|
|
currentMarginTop = 0;
|
|
for (var _a = 0, rects_2 = rects; _a < rects_2.length; _a++) {
|
|
var rect = rects_2[_a];
|
|
var seg = segs[rect.index];
|
|
var isAbsolute = rect.span.end - rect.span.start > 1; // multi-column?
|
|
var isFirstCol = rect.span.start === col;
|
|
currentMarginTop += rect.levelCoord - currentHeight; // amount of space since bottom of previous seg
|
|
currentHeight = rect.levelCoord + rect.thickness; // height will now be bottom of current seg
|
|
if (isAbsolute) {
|
|
currentMarginTop += rect.thickness;
|
|
if (isFirstCol) {
|
|
multiPlacements.push({
|
|
seg: resliceSeg(seg, rect.span.start, rect.span.end, cells),
|
|
isVisible: true,
|
|
isAbsolute: true,
|
|
absoluteTop: rect.levelCoord,
|
|
marginTop: 0,
|
|
});
|
|
}
|
|
}
|
|
else if (isFirstCol) {
|
|
multiPlacements.push({
|
|
seg: resliceSeg(seg, rect.span.start, rect.span.end, cells),
|
|
isVisible: true,
|
|
isAbsolute: false,
|
|
absoluteTop: rect.levelCoord,
|
|
marginTop: currentMarginTop, // claim the margin
|
|
});
|
|
currentMarginTop = 0;
|
|
}
|
|
}
|
|
singleColPlacements.push(singlePlacements);
|
|
multiColPlacements.push(multiPlacements);
|
|
leftoverMargins.push(currentMarginTop);
|
|
}
|
|
return { singleColPlacements: singleColPlacements, multiColPlacements: multiColPlacements, leftoverMargins: leftoverMargins };
|
|
}
|
|
function groupRectsByEachCol(rects, colCnt) {
|
|
var rectsByEachCol = [];
|
|
for (var col = 0; col < colCnt; col += 1) {
|
|
rectsByEachCol.push([]);
|
|
}
|
|
for (var _i = 0, rects_3 = rects; _i < rects_3.length; _i++) {
|
|
var rect = rects_3[_i];
|
|
for (var col = rect.span.start; col < rect.span.end; col += 1) {
|
|
rectsByEachCol[col].push(rect);
|
|
}
|
|
}
|
|
return rectsByEachCol;
|
|
}
|
|
function resliceSeg(seg, spanStart, spanEnd, cells) {
|
|
if (seg.firstCol === spanStart && seg.lastCol === spanEnd - 1) {
|
|
return seg;
|
|
}
|
|
var eventRange = seg.eventRange;
|
|
var origRange = eventRange.range;
|
|
var slicedRange = intersectRanges(origRange, {
|
|
start: cells[spanStart].date,
|
|
end: addDays(cells[spanEnd - 1].date, 1),
|
|
});
|
|
return __assign(__assign({}, seg), { firstCol: spanStart, lastCol: spanEnd - 1, eventRange: {
|
|
def: eventRange.def,
|
|
ui: __assign(__assign({}, eventRange.ui), { durationEditable: false }),
|
|
instance: eventRange.instance,
|
|
range: slicedRange,
|
|
}, isStart: seg.isStart && slicedRange.start.valueOf() === origRange.start.valueOf(), isEnd: seg.isEnd && slicedRange.end.valueOf() === origRange.end.valueOf() });
|
|
}
|
|
var DayGridSegHierarchy = /** @class */ (function (_super) {
|
|
__extends(DayGridSegHierarchy, _super);
|
|
function DayGridSegHierarchy() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
// config
|
|
_this.hiddenConsumes = false;
|
|
// allows us to keep hidden entries in the hierarchy so they take up space
|
|
_this.forceHidden = {};
|
|
return _this;
|
|
}
|
|
DayGridSegHierarchy.prototype.addSegs = function (segInputs) {
|
|
var _this = this;
|
|
var hiddenSegs = _super.prototype.addSegs.call(this, segInputs);
|
|
var entriesByLevel = this.entriesByLevel;
|
|
var excludeHidden = function (entry) { return !_this.forceHidden[buildEntryKey(entry)]; };
|
|
// remove the forced-hidden segs
|
|
for (var level = 0; level < entriesByLevel.length; level += 1) {
|
|
entriesByLevel[level] = entriesByLevel[level].filter(excludeHidden);
|
|
}
|
|
return hiddenSegs;
|
|
};
|
|
DayGridSegHierarchy.prototype.handleInvalidInsertion = function (insertion, entry, hiddenEntries) {
|
|
var _a = this, entriesByLevel = _a.entriesByLevel, forceHidden = _a.forceHidden;
|
|
var touchingEntry = insertion.touchingEntry, touchingLevel = insertion.touchingLevel, touchingLateral = insertion.touchingLateral;
|
|
if (this.hiddenConsumes && touchingEntry) {
|
|
var touchingEntryId = buildEntryKey(touchingEntry);
|
|
// if not already hidden
|
|
if (!forceHidden[touchingEntryId]) {
|
|
if (this.allowReslicing) {
|
|
var placeholderEntry = __assign(__assign({}, touchingEntry), { span: intersectSpans(touchingEntry.span, entry.span) });
|
|
var placeholderEntryId = buildEntryKey(placeholderEntry);
|
|
forceHidden[placeholderEntryId] = true;
|
|
entriesByLevel[touchingLevel][touchingLateral] = placeholderEntry; // replace touchingEntry with our placeholder
|
|
this.splitEntry(touchingEntry, entry, hiddenEntries); // split up the touchingEntry, reinsert it
|
|
}
|
|
else {
|
|
forceHidden[touchingEntryId] = true;
|
|
hiddenEntries.push(touchingEntry);
|
|
}
|
|
}
|
|
}
|
|
return _super.prototype.handleInvalidInsertion.call(this, insertion, entry, hiddenEntries);
|
|
};
|
|
return DayGridSegHierarchy;
|
|
}(SegHierarchy));
|
|
|
|
var TableRow = /** @class */ (function (_super) {
|
|
__extends(TableRow, _super);
|
|
function TableRow() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.cellElRefs = new RefMap(); // the <td>
|
|
_this.frameElRefs = new RefMap(); // the fc-daygrid-day-frame
|
|
_this.fgElRefs = new RefMap(); // the fc-daygrid-day-events
|
|
_this.segHarnessRefs = new RefMap(); // indexed by "instanceId:firstCol"
|
|
_this.rootElRef = createRef();
|
|
_this.state = {
|
|
framePositions: null,
|
|
maxContentHeight: null,
|
|
eventInstanceHeights: {},
|
|
};
|
|
return _this;
|
|
}
|
|
TableRow.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options;
|
|
var colCnt = props.cells.length;
|
|
var businessHoursByCol = splitSegsByFirstCol(props.businessHourSegs, colCnt);
|
|
var bgEventSegsByCol = splitSegsByFirstCol(props.bgEventSegs, colCnt);
|
|
var highlightSegsByCol = splitSegsByFirstCol(this.getHighlightSegs(), colCnt);
|
|
var mirrorSegsByCol = splitSegsByFirstCol(this.getMirrorSegs(), colCnt);
|
|
var _b = computeFgSegPlacement(sortEventSegs(props.fgEventSegs, options.eventOrder), props.dayMaxEvents, props.dayMaxEventRows, options.eventOrderStrict, state.eventInstanceHeights, state.maxContentHeight, props.cells), singleColPlacements = _b.singleColPlacements, multiColPlacements = _b.multiColPlacements, moreCnts = _b.moreCnts, moreMarginTops = _b.moreMarginTops;
|
|
var isForcedInvisible = // TODO: messy way to compute this
|
|
(props.eventDrag && props.eventDrag.affectedInstances) ||
|
|
(props.eventResize && props.eventResize.affectedInstances) ||
|
|
{};
|
|
return (createElement("tr", { ref: this.rootElRef, role: "row" },
|
|
props.renderIntro && props.renderIntro(),
|
|
props.cells.map(function (cell, col) {
|
|
var normalFgNodes = _this.renderFgSegs(col, props.forPrint ? singleColPlacements[col] : multiColPlacements[col], props.todayRange, isForcedInvisible);
|
|
var mirrorFgNodes = _this.renderFgSegs(col, buildMirrorPlacements$1(mirrorSegsByCol[col], multiColPlacements), props.todayRange, {}, Boolean(props.eventDrag), Boolean(props.eventResize), false);
|
|
return (createElement(TableCell, { key: cell.key, elRef: _this.cellElRefs.createRef(cell.key), innerElRef: _this.frameElRefs.createRef(cell.key) /* FF <td> problem, but okay to use for left/right. TODO: rename prop */, dateProfile: props.dateProfile, date: cell.date, showDayNumber: props.showDayNumbers, showWeekNumber: props.showWeekNumbers && col === 0, forceDayTop: props.showWeekNumbers /* even displaying weeknum for row, not necessarily day */, todayRange: props.todayRange, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, extraHookProps: cell.extraHookProps, extraDataAttrs: cell.extraDataAttrs, extraClassNames: cell.extraClassNames, extraDateSpan: cell.extraDateSpan, moreCnt: moreCnts[col], moreMarginTop: moreMarginTops[col], singlePlacements: singleColPlacements[col], fgContentElRef: _this.fgElRefs.createRef(cell.key), fgContent: ( // Fragment scopes the keys
|
|
createElement(Fragment, null,
|
|
createElement(Fragment, null, normalFgNodes),
|
|
createElement(Fragment, null, mirrorFgNodes))), bgContent: ( // Fragment scopes the keys
|
|
createElement(Fragment, null,
|
|
_this.renderFillSegs(highlightSegsByCol[col], 'highlight'),
|
|
_this.renderFillSegs(businessHoursByCol[col], 'non-business'),
|
|
_this.renderFillSegs(bgEventSegsByCol[col], 'bg-event'))) }));
|
|
})));
|
|
};
|
|
TableRow.prototype.componentDidMount = function () {
|
|
this.updateSizing(true);
|
|
};
|
|
TableRow.prototype.componentDidUpdate = function (prevProps, prevState) {
|
|
var currentProps = this.props;
|
|
this.updateSizing(!isPropsEqual(prevProps, currentProps));
|
|
};
|
|
TableRow.prototype.getHighlightSegs = function () {
|
|
var props = this.props;
|
|
if (props.eventDrag && props.eventDrag.segs.length) { // messy check
|
|
return props.eventDrag.segs;
|
|
}
|
|
if (props.eventResize && props.eventResize.segs.length) { // messy check
|
|
return props.eventResize.segs;
|
|
}
|
|
return props.dateSelectionSegs;
|
|
};
|
|
TableRow.prototype.getMirrorSegs = function () {
|
|
var props = this.props;
|
|
if (props.eventResize && props.eventResize.segs.length) { // messy check
|
|
return props.eventResize.segs;
|
|
}
|
|
return [];
|
|
};
|
|
TableRow.prototype.renderFgSegs = function (col, segPlacements, todayRange, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
|
|
var context = this.context;
|
|
var eventSelection = this.props.eventSelection;
|
|
var framePositions = this.state.framePositions;
|
|
var defaultDisplayEventEnd = this.props.cells.length === 1; // colCnt === 1
|
|
var isMirror = isDragging || isResizing || isDateSelecting;
|
|
var nodes = [];
|
|
if (framePositions) {
|
|
for (var _i = 0, segPlacements_1 = segPlacements; _i < segPlacements_1.length; _i++) {
|
|
var placement = segPlacements_1[_i];
|
|
var seg = placement.seg;
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
var key = instanceId + ':' + col;
|
|
var isVisible = placement.isVisible && !isForcedInvisible[instanceId];
|
|
var isAbsolute = placement.isAbsolute;
|
|
var left = '';
|
|
var right = '';
|
|
if (isAbsolute) {
|
|
if (context.isRtl) {
|
|
right = 0;
|
|
left = framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol];
|
|
}
|
|
else {
|
|
left = 0;
|
|
right = framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol];
|
|
}
|
|
}
|
|
/*
|
|
known bug: events that are force to be list-item but span multiple days still take up space in later columns
|
|
todo: in print view, for multi-day events, don't display title within non-start/end segs
|
|
*/
|
|
nodes.push(createElement("div", { className: 'fc-daygrid-event-harness' + (isAbsolute ? ' fc-daygrid-event-harness-abs' : ''), key: key, ref: isMirror ? null : this.segHarnessRefs.createRef(key), style: {
|
|
visibility: isVisible ? '' : 'hidden',
|
|
marginTop: isAbsolute ? '' : placement.marginTop,
|
|
top: isAbsolute ? placement.absoluteTop : '',
|
|
left: left,
|
|
right: right,
|
|
} }, hasListItemDisplay(seg) ? (createElement(TableListItemEvent, __assign({ seg: seg, isDragging: isDragging, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange)))) : (createElement(TableBlockEvent, __assign({ seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange))))));
|
|
}
|
|
}
|
|
return nodes;
|
|
};
|
|
TableRow.prototype.renderFillSegs = function (segs, fillType) {
|
|
var isRtl = this.context.isRtl;
|
|
var todayRange = this.props.todayRange;
|
|
var framePositions = this.state.framePositions;
|
|
var nodes = [];
|
|
if (framePositions) {
|
|
for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
|
|
var seg = segs_1[_i];
|
|
var leftRightCss = isRtl ? {
|
|
right: 0,
|
|
left: framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol],
|
|
} : {
|
|
left: 0,
|
|
right: framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol],
|
|
};
|
|
nodes.push(createElement("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-daygrid-bg-harness", style: leftRightCss }, fillType === 'bg-event' ?
|
|
createElement(BgEvent, __assign({ seg: seg }, getSegMeta(seg, todayRange))) :
|
|
renderFill(fillType)));
|
|
}
|
|
}
|
|
return createElement.apply(void 0, __spreadArray([Fragment, {}], nodes));
|
|
};
|
|
TableRow.prototype.updateSizing = function (isExternalSizingChange) {
|
|
var _a = this, props = _a.props, frameElRefs = _a.frameElRefs;
|
|
if (!props.forPrint &&
|
|
props.clientWidth !== null // positioning ready?
|
|
) {
|
|
if (isExternalSizingChange) {
|
|
var frameEls = props.cells.map(function (cell) { return frameElRefs.currentMap[cell.key]; });
|
|
if (frameEls.length) {
|
|
var originEl = this.rootElRef.current;
|
|
this.setState({
|
|
framePositions: new PositionCache(originEl, frameEls, true, // isHorizontal
|
|
false),
|
|
});
|
|
}
|
|
}
|
|
var oldInstanceHeights = this.state.eventInstanceHeights;
|
|
var newInstanceHeights = this.queryEventInstanceHeights();
|
|
var limitByContentHeight = props.dayMaxEvents === true || props.dayMaxEventRows === true;
|
|
this.safeSetState({
|
|
// HACK to prevent oscillations of events being shown/hidden from max-event-rows
|
|
// Essentially, once you compute an element's height, never null-out.
|
|
// TODO: always display all events, as visibility:hidden?
|
|
eventInstanceHeights: __assign(__assign({}, oldInstanceHeights), newInstanceHeights),
|
|
maxContentHeight: limitByContentHeight ? this.computeMaxContentHeight() : null,
|
|
});
|
|
}
|
|
};
|
|
TableRow.prototype.queryEventInstanceHeights = function () {
|
|
var segElMap = this.segHarnessRefs.currentMap;
|
|
var eventInstanceHeights = {};
|
|
// get the max height amongst instance segs
|
|
for (var key in segElMap) {
|
|
var height = Math.round(segElMap[key].getBoundingClientRect().height);
|
|
var instanceId = key.split(':')[0]; // deconstruct how renderFgSegs makes the key
|
|
eventInstanceHeights[instanceId] = Math.max(eventInstanceHeights[instanceId] || 0, height);
|
|
}
|
|
return eventInstanceHeights;
|
|
};
|
|
TableRow.prototype.computeMaxContentHeight = function () {
|
|
var firstKey = this.props.cells[0].key;
|
|
var cellEl = this.cellElRefs.currentMap[firstKey];
|
|
var fcContainerEl = this.fgElRefs.currentMap[firstKey];
|
|
return cellEl.getBoundingClientRect().bottom - fcContainerEl.getBoundingClientRect().top;
|
|
};
|
|
TableRow.prototype.getCellEls = function () {
|
|
var elMap = this.cellElRefs.currentMap;
|
|
return this.props.cells.map(function (cell) { return elMap[cell.key]; });
|
|
};
|
|
return TableRow;
|
|
}(DateComponent));
|
|
TableRow.addStateEquality({
|
|
eventInstanceHeights: isPropsEqual,
|
|
});
|
|
function buildMirrorPlacements$1(mirrorSegs, colPlacements) {
|
|
if (!mirrorSegs.length) {
|
|
return [];
|
|
}
|
|
var topsByInstanceId = buildAbsoluteTopHash$1(colPlacements); // TODO: cache this at first render?
|
|
return mirrorSegs.map(function (seg) { return ({
|
|
seg: seg,
|
|
isVisible: true,
|
|
isAbsolute: true,
|
|
absoluteTop: topsByInstanceId[seg.eventRange.instance.instanceId],
|
|
marginTop: 0,
|
|
}); });
|
|
}
|
|
function buildAbsoluteTopHash$1(colPlacements) {
|
|
var topsByInstanceId = {};
|
|
for (var _i = 0, colPlacements_1 = colPlacements; _i < colPlacements_1.length; _i++) {
|
|
var placements = colPlacements_1[_i];
|
|
for (var _a = 0, placements_1 = placements; _a < placements_1.length; _a++) {
|
|
var placement = placements_1[_a];
|
|
topsByInstanceId[placement.seg.eventRange.instance.instanceId] = placement.absoluteTop;
|
|
}
|
|
}
|
|
return topsByInstanceId;
|
|
}
|
|
|
|
var Table = /** @class */ (function (_super) {
|
|
__extends(Table, _super);
|
|
function Table() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.splitBusinessHourSegs = memoize(splitSegsByRow);
|
|
_this.splitBgEventSegs = memoize(splitSegsByRow);
|
|
_this.splitFgEventSegs = memoize(splitSegsByRow);
|
|
_this.splitDateSelectionSegs = memoize(splitSegsByRow);
|
|
_this.splitEventDrag = memoize(splitInteractionByRow);
|
|
_this.splitEventResize = memoize(splitInteractionByRow);
|
|
_this.rowRefs = new RefMap();
|
|
_this.handleRootEl = function (rootEl) {
|
|
_this.rootEl = rootEl;
|
|
if (rootEl) {
|
|
_this.context.registerInteractiveComponent(_this, {
|
|
el: rootEl,
|
|
isHitComboAllowed: _this.props.isHitComboAllowed,
|
|
});
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
Table.prototype.render = function () {
|
|
var _this = this;
|
|
var props = this.props;
|
|
var dateProfile = props.dateProfile, dayMaxEventRows = props.dayMaxEventRows, dayMaxEvents = props.dayMaxEvents, expandRows = props.expandRows;
|
|
var rowCnt = props.cells.length;
|
|
var businessHourSegsByRow = this.splitBusinessHourSegs(props.businessHourSegs, rowCnt);
|
|
var bgEventSegsByRow = this.splitBgEventSegs(props.bgEventSegs, rowCnt);
|
|
var fgEventSegsByRow = this.splitFgEventSegs(props.fgEventSegs, rowCnt);
|
|
var dateSelectionSegsByRow = this.splitDateSelectionSegs(props.dateSelectionSegs, rowCnt);
|
|
var eventDragByRow = this.splitEventDrag(props.eventDrag, rowCnt);
|
|
var eventResizeByRow = this.splitEventResize(props.eventResize, rowCnt);
|
|
var limitViaBalanced = dayMaxEvents === true || dayMaxEventRows === true;
|
|
// if rows can't expand to fill fixed height, can't do balanced-height event limit
|
|
// TODO: best place to normalize these options?
|
|
if (limitViaBalanced && !expandRows) {
|
|
limitViaBalanced = false;
|
|
dayMaxEventRows = null;
|
|
dayMaxEvents = null;
|
|
}
|
|
var classNames = [
|
|
'fc-daygrid-body',
|
|
limitViaBalanced ? 'fc-daygrid-body-balanced' : 'fc-daygrid-body-unbalanced',
|
|
expandRows ? '' : 'fc-daygrid-body-natural', // will height of one row depend on the others?
|
|
];
|
|
return (createElement("div", { className: classNames.join(' '), ref: this.handleRootEl, style: {
|
|
// these props are important to give this wrapper correct dimensions for interactions
|
|
// TODO: if we set it here, can we avoid giving to inner tables?
|
|
width: props.clientWidth,
|
|
minWidth: props.tableMinWidth,
|
|
} },
|
|
createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) { return (createElement(Fragment, null,
|
|
createElement("table", { role: "presentation", className: "fc-scrollgrid-sync-table", style: {
|
|
width: props.clientWidth,
|
|
minWidth: props.tableMinWidth,
|
|
height: expandRows ? props.clientHeight : '',
|
|
} },
|
|
props.colGroupNode,
|
|
createElement("tbody", { role: "presentation" }, props.cells.map(function (cells, row) { return (createElement(TableRow, { ref: _this.rowRefs.createRef(row), key: cells.length
|
|
? cells[0].date.toISOString() /* best? or put key on cell? or use diff formatter? */
|
|
: row // in case there are no cells (like when resource view is loading)
|
|
, showDayNumbers: rowCnt > 1, showWeekNumbers: props.showWeekNumbers, todayRange: todayRange, dateProfile: dateProfile, cells: cells, renderIntro: props.renderRowIntro, businessHourSegs: businessHourSegsByRow[row], eventSelection: props.eventSelection, bgEventSegs: bgEventSegsByRow[row].filter(isSegAllDay) /* hack */, fgEventSegs: fgEventSegsByRow[row], dateSelectionSegs: dateSelectionSegsByRow[row], eventDrag: eventDragByRow[row], eventResize: eventResizeByRow[row], dayMaxEvents: dayMaxEvents, dayMaxEventRows: dayMaxEventRows, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint })); }))))); })));
|
|
};
|
|
// Hit System
|
|
// ----------------------------------------------------------------------------------------------------
|
|
Table.prototype.prepareHits = function () {
|
|
this.rowPositions = new PositionCache(this.rootEl, this.rowRefs.collect().map(function (rowObj) { return rowObj.getCellEls()[0]; }), // first cell el in each row. TODO: not optimal
|
|
false, true);
|
|
this.colPositions = new PositionCache(this.rootEl, this.rowRefs.currentMap[0].getCellEls(), // cell els in first row
|
|
true, // horizontal
|
|
false);
|
|
};
|
|
Table.prototype.queryHit = function (positionLeft, positionTop) {
|
|
var _a = this, colPositions = _a.colPositions, rowPositions = _a.rowPositions;
|
|
var col = colPositions.leftToIndex(positionLeft);
|
|
var row = rowPositions.topToIndex(positionTop);
|
|
if (row != null && col != null) {
|
|
var cell = this.props.cells[row][col];
|
|
return {
|
|
dateProfile: this.props.dateProfile,
|
|
dateSpan: __assign({ range: this.getCellRange(row, col), allDay: true }, cell.extraDateSpan),
|
|
dayEl: this.getCellEl(row, col),
|
|
rect: {
|
|
left: colPositions.lefts[col],
|
|
right: colPositions.rights[col],
|
|
top: rowPositions.tops[row],
|
|
bottom: rowPositions.bottoms[row],
|
|
},
|
|
layer: 0,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
Table.prototype.getCellEl = function (row, col) {
|
|
return this.rowRefs.currentMap[row].getCellEls()[col]; // TODO: not optimal
|
|
};
|
|
Table.prototype.getCellRange = function (row, col) {
|
|
var start = this.props.cells[row][col].date;
|
|
var end = addDays(start, 1);
|
|
return { start: start, end: end };
|
|
};
|
|
return Table;
|
|
}(DateComponent));
|
|
function isSegAllDay(seg) {
|
|
return seg.eventRange.def.allDay;
|
|
}
|
|
|
|
var DayTableSlicer = /** @class */ (function (_super) {
|
|
__extends(DayTableSlicer, _super);
|
|
function DayTableSlicer() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.forceDayIfListItem = true;
|
|
return _this;
|
|
}
|
|
DayTableSlicer.prototype.sliceRange = function (dateRange, dayTableModel) {
|
|
return dayTableModel.sliceRange(dateRange);
|
|
};
|
|
return DayTableSlicer;
|
|
}(Slicer));
|
|
|
|
var DayTable = /** @class */ (function (_super) {
|
|
__extends(DayTable, _super);
|
|
function DayTable() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.slicer = new DayTableSlicer();
|
|
_this.tableRef = createRef();
|
|
return _this;
|
|
}
|
|
DayTable.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
return (createElement(Table, __assign({ ref: this.tableRef }, this.slicer.sliceProps(props, props.dateProfile, props.nextDayThreshold, context, props.dayTableModel), { dateProfile: props.dateProfile, cells: props.dayTableModel.cells, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint })));
|
|
};
|
|
return DayTable;
|
|
}(DateComponent));
|
|
|
|
var DayTableView = /** @class */ (function (_super) {
|
|
__extends(DayTableView, _super);
|
|
function DayTableView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildDayTableModel = memoize(buildDayTableModel);
|
|
_this.headerRef = createRef();
|
|
_this.tableRef = createRef();
|
|
return _this;
|
|
}
|
|
DayTableView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this.context, options = _a.options, dateProfileGenerator = _a.dateProfileGenerator;
|
|
var props = this.props;
|
|
var dayTableModel = this.buildDayTableModel(props.dateProfile, dateProfileGenerator);
|
|
var headerContent = options.dayHeaders && (createElement(DayHeader, { ref: this.headerRef, dateProfile: props.dateProfile, dates: dayTableModel.headerDates, datesRepDistinctDays: dayTableModel.rowCnt === 1 }));
|
|
var bodyContent = function (contentArg) { return (createElement(DayTable, { ref: _this.tableRef, dateProfile: props.dateProfile, dayTableModel: dayTableModel, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, colGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint })); };
|
|
return options.dayMinWidth
|
|
? this.renderHScrollLayout(headerContent, bodyContent, dayTableModel.colCnt, options.dayMinWidth)
|
|
: this.renderSimpleLayout(headerContent, bodyContent);
|
|
};
|
|
return DayTableView;
|
|
}(TableView));
|
|
function buildDayTableModel(dateProfile, dateProfileGenerator) {
|
|
var daySeries = new DaySeriesModel(dateProfile.renderRange, dateProfileGenerator);
|
|
return new DayTableModel(daySeries, /year|month|week/.test(dateProfile.currentRangeUnit));
|
|
}
|
|
|
|
var TableDateProfileGenerator = /** @class */ (function (_super) {
|
|
__extends(TableDateProfileGenerator, _super);
|
|
function TableDateProfileGenerator() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
// Computes the date range that will be rendered.
|
|
TableDateProfileGenerator.prototype.buildRenderRange = function (currentRange, currentRangeUnit, isRangeAllDay) {
|
|
var dateEnv = this.props.dateEnv;
|
|
var renderRange = _super.prototype.buildRenderRange.call(this, currentRange, currentRangeUnit, isRangeAllDay);
|
|
var start = renderRange.start;
|
|
var end = renderRange.end;
|
|
var endOfWeek;
|
|
// year and month views should be aligned with weeks. this is already done for week
|
|
if (/^(year|month)$/.test(currentRangeUnit)) {
|
|
start = dateEnv.startOfWeek(start);
|
|
// make end-of-week if not already
|
|
endOfWeek = dateEnv.startOfWeek(end);
|
|
if (endOfWeek.valueOf() !== end.valueOf()) {
|
|
end = addWeeks(endOfWeek, 1);
|
|
}
|
|
}
|
|
// ensure 6 weeks
|
|
if (this.props.monthMode &&
|
|
this.props.fixedWeekCount) {
|
|
var rowCnt = Math.ceil(// could be partial weeks due to hiddenDays
|
|
diffWeeks(start, end));
|
|
end = addWeeks(end, 6 - rowCnt);
|
|
}
|
|
return { start: start, end: end };
|
|
};
|
|
return TableDateProfileGenerator;
|
|
}(DateProfileGenerator));
|
|
|
|
var dayGridPlugin = createPlugin({
|
|
initialView: 'dayGridMonth',
|
|
views: {
|
|
dayGrid: {
|
|
component: DayTableView,
|
|
dateProfileGeneratorClass: TableDateProfileGenerator,
|
|
},
|
|
dayGridDay: {
|
|
type: 'dayGrid',
|
|
duration: { days: 1 },
|
|
},
|
|
dayGridWeek: {
|
|
type: 'dayGrid',
|
|
duration: { weeks: 1 },
|
|
},
|
|
dayGridMonth: {
|
|
type: 'dayGrid',
|
|
duration: { months: 1 },
|
|
monthMode: true,
|
|
fixedWeekCount: true,
|
|
},
|
|
},
|
|
});
|
|
|
|
var AllDaySplitter = /** @class */ (function (_super) {
|
|
__extends(AllDaySplitter, _super);
|
|
function AllDaySplitter() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
AllDaySplitter.prototype.getKeyInfo = function () {
|
|
return {
|
|
allDay: {},
|
|
timed: {},
|
|
};
|
|
};
|
|
AllDaySplitter.prototype.getKeysForDateSpan = function (dateSpan) {
|
|
if (dateSpan.allDay) {
|
|
return ['allDay'];
|
|
}
|
|
return ['timed'];
|
|
};
|
|
AllDaySplitter.prototype.getKeysForEventDef = function (eventDef) {
|
|
if (!eventDef.allDay) {
|
|
return ['timed'];
|
|
}
|
|
if (hasBgRendering(eventDef)) {
|
|
return ['timed', 'allDay'];
|
|
}
|
|
return ['allDay'];
|
|
};
|
|
return AllDaySplitter;
|
|
}(Splitter));
|
|
|
|
var DEFAULT_SLAT_LABEL_FORMAT = createFormatter({
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
omitZeroMinute: true,
|
|
meridiem: 'short',
|
|
});
|
|
function TimeColsAxisCell(props) {
|
|
var classNames = [
|
|
'fc-timegrid-slot',
|
|
'fc-timegrid-slot-label',
|
|
props.isLabeled ? 'fc-scrollgrid-shrink' : 'fc-timegrid-slot-minor',
|
|
];
|
|
return (createElement(ViewContextType.Consumer, null, function (context) {
|
|
if (!props.isLabeled) {
|
|
return (createElement("td", { className: classNames.join(' '), "data-time": props.isoTimeStr }));
|
|
}
|
|
var dateEnv = context.dateEnv, options = context.options, viewApi = context.viewApi;
|
|
var labelFormat = // TODO: fully pre-parse
|
|
options.slotLabelFormat == null ? DEFAULT_SLAT_LABEL_FORMAT :
|
|
Array.isArray(options.slotLabelFormat) ? createFormatter(options.slotLabelFormat[0]) :
|
|
createFormatter(options.slotLabelFormat);
|
|
var hookProps = {
|
|
level: 0,
|
|
time: props.time,
|
|
date: dateEnv.toDate(props.date),
|
|
view: viewApi,
|
|
text: dateEnv.format(props.date, labelFormat),
|
|
};
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLabelClassNames, content: options.slotLabelContent, defaultContent: renderInnerContent$3, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-time": props.isoTimeStr },
|
|
createElement("div", { className: "fc-timegrid-slot-label-frame fc-scrollgrid-shrink-frame" },
|
|
createElement("div", { className: "fc-timegrid-slot-label-cushion fc-scrollgrid-shrink-cushion", ref: innerElRef }, innerContent)))); }));
|
|
}));
|
|
}
|
|
function renderInnerContent$3(props) {
|
|
return props.text;
|
|
}
|
|
|
|
var TimeBodyAxis = /** @class */ (function (_super) {
|
|
__extends(TimeBodyAxis, _super);
|
|
function TimeBodyAxis() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimeBodyAxis.prototype.render = function () {
|
|
return this.props.slatMetas.map(function (slatMeta) { return (createElement("tr", { key: slatMeta.key },
|
|
createElement(TimeColsAxisCell, __assign({}, slatMeta)))); });
|
|
};
|
|
return TimeBodyAxis;
|
|
}(BaseComponent));
|
|
|
|
var DEFAULT_WEEK_NUM_FORMAT = createFormatter({ week: 'short' });
|
|
var AUTO_ALL_DAY_MAX_EVENT_ROWS = 5;
|
|
var TimeColsView = /** @class */ (function (_super) {
|
|
__extends(TimeColsView, _super);
|
|
function TimeColsView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.allDaySplitter = new AllDaySplitter(); // for use by subclasses
|
|
_this.headerElRef = createRef();
|
|
_this.rootElRef = createRef();
|
|
_this.scrollerElRef = createRef();
|
|
_this.state = {
|
|
slatCoords: null,
|
|
};
|
|
_this.handleScrollTopRequest = function (scrollTop) {
|
|
var scrollerEl = _this.scrollerElRef.current;
|
|
if (scrollerEl) { // TODO: not sure how this could ever be null. weirdness with the reducer
|
|
scrollerEl.scrollTop = scrollTop;
|
|
}
|
|
};
|
|
/* Header Render Methods
|
|
------------------------------------------------------------------------------------------------------------------*/
|
|
_this.renderHeadAxis = function (rowKey, frameHeight) {
|
|
if (frameHeight === void 0) { frameHeight = ''; }
|
|
var options = _this.context.options;
|
|
var dateProfile = _this.props.dateProfile;
|
|
var range = dateProfile.renderRange;
|
|
var dayCnt = diffDays(range.start, range.end);
|
|
var navLinkAttrs = (dayCnt === 1) // only do in day views (to avoid doing in week views that dont need it)
|
|
? buildNavLinkAttrs(_this.context, range.start, 'week')
|
|
: {};
|
|
if (options.weekNumbers && rowKey === 'day') {
|
|
return (createElement(WeekNumberRoot, { date: range.start, defaultFormat: DEFAULT_WEEK_NUM_FORMAT }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef, "aria-hidden": true, className: [
|
|
'fc-timegrid-axis',
|
|
'fc-scrollgrid-shrink',
|
|
].concat(classNames).join(' ') },
|
|
createElement("div", { className: "fc-timegrid-axis-frame fc-scrollgrid-shrink-frame fc-timegrid-axis-frame-liquid", style: { height: frameHeight } },
|
|
createElement("a", __assign({ ref: innerElRef, className: "fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner" }, navLinkAttrs), innerContent)))); }));
|
|
}
|
|
return (createElement("th", { "aria-hidden": true, className: "fc-timegrid-axis" },
|
|
createElement("div", { className: "fc-timegrid-axis-frame", style: { height: frameHeight } })));
|
|
};
|
|
/* Table Component Render Methods
|
|
------------------------------------------------------------------------------------------------------------------*/
|
|
// only a one-way height sync. we don't send the axis inner-content height to the DayGrid,
|
|
// but DayGrid still needs to have classNames on inner elements in order to measure.
|
|
_this.renderTableRowAxis = function (rowHeight) {
|
|
var _a = _this.context, options = _a.options, viewApi = _a.viewApi;
|
|
var hookProps = {
|
|
text: options.allDayText,
|
|
view: viewApi,
|
|
};
|
|
return (
|
|
// TODO: make reusable hook. used in list view too
|
|
createElement(RenderHook, { hookProps: hookProps, classNames: options.allDayClassNames, content: options.allDayContent, defaultContent: renderAllDayInner$1, didMount: options.allDayDidMount, willUnmount: options.allDayWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, "aria-hidden": true, className: [
|
|
'fc-timegrid-axis',
|
|
'fc-scrollgrid-shrink',
|
|
].concat(classNames).join(' ') },
|
|
createElement("div", { className: 'fc-timegrid-axis-frame fc-scrollgrid-shrink-frame' + (rowHeight == null ? ' fc-timegrid-axis-frame-liquid' : ''), style: { height: rowHeight } },
|
|
createElement("span", { className: "fc-timegrid-axis-cushion fc-scrollgrid-shrink-cushion fc-scrollgrid-sync-inner", ref: innerElRef }, innerContent)))); }));
|
|
};
|
|
_this.handleSlatCoords = function (slatCoords) {
|
|
_this.setState({ slatCoords: slatCoords });
|
|
};
|
|
return _this;
|
|
}
|
|
// rendering
|
|
// ----------------------------------------------------------------------------------------------------
|
|
TimeColsView.prototype.renderSimpleLayout = function (headerRowContent, allDayContent, timeContent) {
|
|
var _a = this, context = _a.context, props = _a.props;
|
|
var sections = [];
|
|
var stickyHeaderDates = getStickyHeaderDates(context.options);
|
|
if (headerRowContent) {
|
|
sections.push({
|
|
type: 'header',
|
|
key: 'header',
|
|
isSticky: stickyHeaderDates,
|
|
chunk: {
|
|
elRef: this.headerElRef,
|
|
tableClassName: 'fc-col-header',
|
|
rowContent: headerRowContent,
|
|
},
|
|
});
|
|
}
|
|
if (allDayContent) {
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'all-day',
|
|
chunk: { content: allDayContent },
|
|
});
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'all-day-divider',
|
|
outerContent: ( // TODO: rename to cellContent so don't need to define <tr>?
|
|
createElement("tr", { role: "presentation", className: "fc-scrollgrid-section" },
|
|
createElement("td", { className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
|
|
});
|
|
}
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'body',
|
|
liquid: true,
|
|
expandRows: Boolean(context.options.expandRows),
|
|
chunk: {
|
|
scrollerElRef: this.scrollerElRef,
|
|
content: timeContent,
|
|
},
|
|
});
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec, elRef: this.rootElRef }, function (rootElRef, classNames) { return (createElement("div", { className: ['fc-timegrid'].concat(classNames).join(' '), ref: rootElRef },
|
|
createElement(SimpleScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, cols: [{ width: 'shrink' }], sections: sections }))); }));
|
|
};
|
|
TimeColsView.prototype.renderHScrollLayout = function (headerRowContent, allDayContent, timeContent, colCnt, dayMinWidth, slatMetas, slatCoords) {
|
|
var _this = this;
|
|
var ScrollGrid = this.context.pluginHooks.scrollGridImpl;
|
|
if (!ScrollGrid) {
|
|
throw new Error('No ScrollGrid implementation');
|
|
}
|
|
var _a = this, context = _a.context, props = _a.props;
|
|
var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(context.options);
|
|
var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(context.options);
|
|
var sections = [];
|
|
if (headerRowContent) {
|
|
sections.push({
|
|
type: 'header',
|
|
key: 'header',
|
|
isSticky: stickyHeaderDates,
|
|
syncRowHeights: true,
|
|
chunks: [
|
|
{
|
|
key: 'axis',
|
|
rowContent: function (arg) { return (createElement("tr", { role: "presentation" }, _this.renderHeadAxis('day', arg.rowSyncHeights[0]))); },
|
|
},
|
|
{
|
|
key: 'cols',
|
|
elRef: this.headerElRef,
|
|
tableClassName: 'fc-col-header',
|
|
rowContent: headerRowContent,
|
|
},
|
|
],
|
|
});
|
|
}
|
|
if (allDayContent) {
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'all-day',
|
|
syncRowHeights: true,
|
|
chunks: [
|
|
{
|
|
key: 'axis',
|
|
rowContent: function (contentArg) { return (createElement("tr", { role: "presentation" }, _this.renderTableRowAxis(contentArg.rowSyncHeights[0]))); },
|
|
},
|
|
{
|
|
key: 'cols',
|
|
content: allDayContent,
|
|
},
|
|
],
|
|
});
|
|
sections.push({
|
|
key: 'all-day-divider',
|
|
type: 'body',
|
|
outerContent: ( // TODO: rename to cellContent so don't need to define <tr>?
|
|
createElement("tr", { role: "presentation", className: "fc-scrollgrid-section" },
|
|
createElement("td", { colSpan: 2, className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
|
|
});
|
|
}
|
|
var isNowIndicator = context.options.nowIndicator;
|
|
sections.push({
|
|
type: 'body',
|
|
key: 'body',
|
|
liquid: true,
|
|
expandRows: Boolean(context.options.expandRows),
|
|
chunks: [
|
|
{
|
|
key: 'axis',
|
|
content: function (arg) { return (
|
|
// TODO: make this now-indicator arrow more DRY with TimeColsContent
|
|
createElement("div", { className: "fc-timegrid-axis-chunk" },
|
|
createElement("table", { "aria-hidden": true, style: { height: arg.expandRows ? arg.clientHeight : '' } },
|
|
arg.tableColGroupNode,
|
|
createElement("tbody", null,
|
|
createElement(TimeBodyAxis, { slatMetas: slatMetas }))),
|
|
createElement("div", { className: "fc-timegrid-now-indicator-container" },
|
|
createElement(NowTimer, { unit: isNowIndicator ? 'minute' : 'day' /* hacky */ }, function (nowDate) {
|
|
var nowIndicatorTop = isNowIndicator &&
|
|
slatCoords &&
|
|
slatCoords.safeComputeTop(nowDate); // might return void
|
|
if (typeof nowIndicatorTop === 'number') {
|
|
return (createElement(NowIndicatorRoot, { isAxis: true, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timegrid-now-indicator-arrow'].concat(classNames).join(' '), style: { top: nowIndicatorTop } }, innerContent)); }));
|
|
}
|
|
return null;
|
|
})))); },
|
|
},
|
|
{
|
|
key: 'cols',
|
|
scrollerElRef: this.scrollerElRef,
|
|
content: timeContent,
|
|
},
|
|
],
|
|
});
|
|
if (stickyFooterScrollbar) {
|
|
sections.push({
|
|
key: 'footer',
|
|
type: 'footer',
|
|
isSticky: true,
|
|
chunks: [
|
|
{
|
|
key: 'axis',
|
|
content: renderScrollShim,
|
|
},
|
|
{
|
|
key: 'cols',
|
|
content: renderScrollShim,
|
|
},
|
|
],
|
|
});
|
|
}
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec, elRef: this.rootElRef }, function (rootElRef, classNames) { return (createElement("div", { className: ['fc-timegrid'].concat(classNames).join(' '), ref: rootElRef },
|
|
createElement(ScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
|
|
{ width: 'shrink', cols: [{ width: 'shrink' }] },
|
|
{ cols: [{ span: colCnt, minWidth: dayMinWidth }] },
|
|
], sections: sections }))); }));
|
|
};
|
|
/* Dimensions
|
|
------------------------------------------------------------------------------------------------------------------*/
|
|
TimeColsView.prototype.getAllDayMaxEventProps = function () {
|
|
var _a = this.context.options, dayMaxEvents = _a.dayMaxEvents, dayMaxEventRows = _a.dayMaxEventRows;
|
|
if (dayMaxEvents === true || dayMaxEventRows === true) { // is auto?
|
|
dayMaxEvents = undefined;
|
|
dayMaxEventRows = AUTO_ALL_DAY_MAX_EVENT_ROWS; // make sure "auto" goes to a real number
|
|
}
|
|
return { dayMaxEvents: dayMaxEvents, dayMaxEventRows: dayMaxEventRows };
|
|
};
|
|
return TimeColsView;
|
|
}(DateComponent));
|
|
function renderAllDayInner$1(hookProps) {
|
|
return hookProps.text;
|
|
}
|
|
|
|
var TimeColsSlatsCoords = /** @class */ (function () {
|
|
function TimeColsSlatsCoords(positions, dateProfile, slotDuration) {
|
|
this.positions = positions;
|
|
this.dateProfile = dateProfile;
|
|
this.slotDuration = slotDuration;
|
|
}
|
|
TimeColsSlatsCoords.prototype.safeComputeTop = function (date) {
|
|
var dateProfile = this.dateProfile;
|
|
if (rangeContainsMarker(dateProfile.currentRange, date)) {
|
|
var startOfDayDate = startOfDay(date);
|
|
var timeMs = date.valueOf() - startOfDayDate.valueOf();
|
|
if (timeMs >= asRoughMs(dateProfile.slotMinTime) &&
|
|
timeMs < asRoughMs(dateProfile.slotMaxTime)) {
|
|
return this.computeTimeTop(createDuration(timeMs));
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
// Computes the top coordinate, relative to the bounds of the grid, of the given date.
|
|
// A `startOfDayDate` must be given for avoiding ambiguity over how to treat midnight.
|
|
TimeColsSlatsCoords.prototype.computeDateTop = function (when, startOfDayDate) {
|
|
if (!startOfDayDate) {
|
|
startOfDayDate = startOfDay(when);
|
|
}
|
|
return this.computeTimeTop(createDuration(when.valueOf() - startOfDayDate.valueOf()));
|
|
};
|
|
// Computes the top coordinate, relative to the bounds of the grid, of the given time (a Duration).
|
|
// This is a makeshify way to compute the time-top. Assumes all slatMetas dates are uniform.
|
|
// Eventually allow computation with arbirary slat dates.
|
|
TimeColsSlatsCoords.prototype.computeTimeTop = function (duration) {
|
|
var _a = this, positions = _a.positions, dateProfile = _a.dateProfile;
|
|
var len = positions.els.length;
|
|
// floating-point value of # of slots covered
|
|
var slatCoverage = (duration.milliseconds - asRoughMs(dateProfile.slotMinTime)) / asRoughMs(this.slotDuration);
|
|
var slatIndex;
|
|
var slatRemainder;
|
|
// compute a floating-point number for how many slats should be progressed through.
|
|
// from 0 to number of slats (inclusive)
|
|
// constrained because slotMinTime/slotMaxTime might be customized.
|
|
slatCoverage = Math.max(0, slatCoverage);
|
|
slatCoverage = Math.min(len, slatCoverage);
|
|
// an integer index of the furthest whole slat
|
|
// from 0 to number slats (*exclusive*, so len-1)
|
|
slatIndex = Math.floor(slatCoverage);
|
|
slatIndex = Math.min(slatIndex, len - 1);
|
|
// how much further through the slatIndex slat (from 0.0-1.0) must be covered in addition.
|
|
// could be 1.0 if slatCoverage is covering *all* the slots
|
|
slatRemainder = slatCoverage - slatIndex;
|
|
return positions.tops[slatIndex] +
|
|
positions.getHeight(slatIndex) * slatRemainder;
|
|
};
|
|
return TimeColsSlatsCoords;
|
|
}());
|
|
|
|
var TimeColsSlatsBody = /** @class */ (function (_super) {
|
|
__extends(TimeColsSlatsBody, _super);
|
|
function TimeColsSlatsBody() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimeColsSlatsBody.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var slatElRefs = props.slatElRefs;
|
|
return (createElement("tbody", null, props.slatMetas.map(function (slatMeta, i) {
|
|
var hookProps = {
|
|
time: slatMeta.time,
|
|
date: context.dateEnv.toDate(slatMeta.date),
|
|
view: context.viewApi,
|
|
};
|
|
var classNames = [
|
|
'fc-timegrid-slot',
|
|
'fc-timegrid-slot-lane',
|
|
slatMeta.isLabeled ? '' : 'fc-timegrid-slot-minor',
|
|
];
|
|
return (createElement("tr", { key: slatMeta.key, ref: slatElRefs.createRef(slatMeta.key) },
|
|
props.axis && (createElement(TimeColsAxisCell, __assign({}, slatMeta))),
|
|
createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLaneClassNames, content: options.slotLaneContent, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-time": slatMeta.isoTimeStr }, innerContent)); })));
|
|
})));
|
|
};
|
|
return TimeColsSlatsBody;
|
|
}(BaseComponent));
|
|
|
|
/*
|
|
for the horizontal "slats" that run width-wise. Has a time axis on a side. Depends on RTL.
|
|
*/
|
|
var TimeColsSlats = /** @class */ (function (_super) {
|
|
__extends(TimeColsSlats, _super);
|
|
function TimeColsSlats() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
_this.slatElRefs = new RefMap();
|
|
return _this;
|
|
}
|
|
TimeColsSlats.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
return (createElement("div", { ref: this.rootElRef, className: "fc-timegrid-slots" },
|
|
createElement("table", { "aria-hidden": true, className: context.theme.getClass('table'), style: {
|
|
minWidth: props.tableMinWidth,
|
|
width: props.clientWidth,
|
|
height: props.minHeight,
|
|
} },
|
|
props.tableColGroupNode /* relies on there only being a single <col> for the axis */,
|
|
createElement(TimeColsSlatsBody, { slatElRefs: this.slatElRefs, axis: props.axis, slatMetas: props.slatMetas }))));
|
|
};
|
|
TimeColsSlats.prototype.componentDidMount = function () {
|
|
this.updateSizing();
|
|
};
|
|
TimeColsSlats.prototype.componentDidUpdate = function () {
|
|
this.updateSizing();
|
|
};
|
|
TimeColsSlats.prototype.componentWillUnmount = function () {
|
|
if (this.props.onCoords) {
|
|
this.props.onCoords(null);
|
|
}
|
|
};
|
|
TimeColsSlats.prototype.updateSizing = function () {
|
|
var _a = this, context = _a.context, props = _a.props;
|
|
if (props.onCoords &&
|
|
props.clientWidth !== null // means sizing has stabilized
|
|
) {
|
|
var rootEl = this.rootElRef.current;
|
|
if (rootEl.offsetHeight) { // not hidden by css
|
|
props.onCoords(new TimeColsSlatsCoords(new PositionCache(this.rootElRef.current, collectSlatEls(this.slatElRefs.currentMap, props.slatMetas), false, true), this.props.dateProfile, context.options.slotDuration));
|
|
}
|
|
}
|
|
};
|
|
return TimeColsSlats;
|
|
}(BaseComponent));
|
|
function collectSlatEls(elMap, slatMetas) {
|
|
return slatMetas.map(function (slatMeta) { return elMap[slatMeta.key]; });
|
|
}
|
|
|
|
function splitSegsByCol(segs, colCnt) {
|
|
var segsByCol = [];
|
|
var i;
|
|
for (i = 0; i < colCnt; i += 1) {
|
|
segsByCol.push([]);
|
|
}
|
|
if (segs) {
|
|
for (i = 0; i < segs.length; i += 1) {
|
|
segsByCol[segs[i].col].push(segs[i]);
|
|
}
|
|
}
|
|
return segsByCol;
|
|
}
|
|
function splitInteractionByCol(ui, colCnt) {
|
|
var byRow = [];
|
|
if (!ui) {
|
|
for (var i = 0; i < colCnt; i += 1) {
|
|
byRow[i] = null;
|
|
}
|
|
}
|
|
else {
|
|
for (var i = 0; i < colCnt; i += 1) {
|
|
byRow[i] = {
|
|
affectedInstances: ui.affectedInstances,
|
|
isEvent: ui.isEvent,
|
|
segs: [],
|
|
};
|
|
}
|
|
for (var _i = 0, _a = ui.segs; _i < _a.length; _i++) {
|
|
var seg = _a[_i];
|
|
byRow[seg.col].segs.push(seg);
|
|
}
|
|
}
|
|
return byRow;
|
|
}
|
|
|
|
var TimeColMoreLink = /** @class */ (function (_super) {
|
|
__extends(TimeColMoreLink, _super);
|
|
function TimeColMoreLink() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
return _this;
|
|
}
|
|
TimeColMoreLink.prototype.render = function () {
|
|
var _this = this;
|
|
var props = this.props;
|
|
return (createElement(MoreLinkRoot, { allDayDate: null, moreCnt: props.hiddenSegs.length, allSegs: props.hiddenSegs, hiddenSegs: props.hiddenSegs, alignmentElRef: this.rootElRef, defaultContent: renderMoreLinkInner, extraDateSpan: props.extraDateSpan, dateProfile: props.dateProfile, todayRange: props.todayRange, popoverContent: function () { return renderPlainFgSegs(props.hiddenSegs, props); } }, function (rootElRef, classNames, innerElRef, innerContent, handleClick, title, isExpanded, popoverId) { return (createElement("a", { ref: function (el) {
|
|
setRef(rootElRef, el);
|
|
setRef(_this.rootElRef, el);
|
|
}, className: ['fc-timegrid-more-link'].concat(classNames).join(' '), style: { top: props.top, bottom: props.bottom }, onClick: handleClick, title: title, "aria-expanded": isExpanded, "aria-controls": popoverId },
|
|
createElement("div", { ref: innerElRef, className: "fc-timegrid-more-link-inner fc-sticky" }, innerContent))); }));
|
|
};
|
|
return TimeColMoreLink;
|
|
}(BaseComponent));
|
|
function renderMoreLinkInner(props) {
|
|
return props.shortText;
|
|
}
|
|
|
|
// segInputs assumed sorted
|
|
function buildPositioning(segInputs, strictOrder, maxStackCnt) {
|
|
var hierarchy = new SegHierarchy();
|
|
if (strictOrder != null) {
|
|
hierarchy.strictOrder = strictOrder;
|
|
}
|
|
if (maxStackCnt != null) {
|
|
hierarchy.maxStackCnt = maxStackCnt;
|
|
}
|
|
var hiddenEntries = hierarchy.addSegs(segInputs);
|
|
var hiddenGroups = groupIntersectingEntries(hiddenEntries);
|
|
var web = buildWeb(hierarchy);
|
|
web = stretchWeb(web, 1); // all levelCoords/thickness will have 0.0-1.0
|
|
var segRects = webToRects(web);
|
|
return { segRects: segRects, hiddenGroups: hiddenGroups };
|
|
}
|
|
function buildWeb(hierarchy) {
|
|
var entriesByLevel = hierarchy.entriesByLevel;
|
|
var buildNode = cacheable(function (level, lateral) { return level + ':' + lateral; }, function (level, lateral) {
|
|
var siblingRange = findNextLevelSegs(hierarchy, level, lateral);
|
|
var nextLevelRes = buildNodes(siblingRange, buildNode);
|
|
var entry = entriesByLevel[level][lateral];
|
|
return [
|
|
__assign(__assign({}, entry), { nextLevelNodes: nextLevelRes[0] }),
|
|
entry.thickness + nextLevelRes[1], // the pressure builds
|
|
];
|
|
});
|
|
return buildNodes(entriesByLevel.length
|
|
? { level: 0, lateralStart: 0, lateralEnd: entriesByLevel[0].length }
|
|
: null, buildNode)[0];
|
|
}
|
|
function buildNodes(siblingRange, buildNode) {
|
|
if (!siblingRange) {
|
|
return [[], 0];
|
|
}
|
|
var level = siblingRange.level, lateralStart = siblingRange.lateralStart, lateralEnd = siblingRange.lateralEnd;
|
|
var lateral = lateralStart;
|
|
var pairs = [];
|
|
while (lateral < lateralEnd) {
|
|
pairs.push(buildNode(level, lateral));
|
|
lateral += 1;
|
|
}
|
|
pairs.sort(cmpDescPressures);
|
|
return [
|
|
pairs.map(extractNode),
|
|
pairs[0][1], // first item's pressure
|
|
];
|
|
}
|
|
function cmpDescPressures(a, b) {
|
|
return b[1] - a[1];
|
|
}
|
|
function extractNode(a) {
|
|
return a[0];
|
|
}
|
|
function findNextLevelSegs(hierarchy, subjectLevel, subjectLateral) {
|
|
var levelCoords = hierarchy.levelCoords, entriesByLevel = hierarchy.entriesByLevel;
|
|
var subjectEntry = entriesByLevel[subjectLevel][subjectLateral];
|
|
var afterSubject = levelCoords[subjectLevel] + subjectEntry.thickness;
|
|
var levelCnt = levelCoords.length;
|
|
var level = subjectLevel;
|
|
// skip past levels that are too high up
|
|
for (; level < levelCnt && levelCoords[level] < afterSubject; level += 1)
|
|
; // do nothing
|
|
for (; level < levelCnt; level += 1) {
|
|
var entries = entriesByLevel[level];
|
|
var entry = void 0;
|
|
var searchIndex = binarySearch(entries, subjectEntry.span.start, getEntrySpanEnd);
|
|
var lateralStart = searchIndex[0] + searchIndex[1]; // if exact match (which doesn't collide), go to next one
|
|
var lateralEnd = lateralStart;
|
|
while ( // loop through entries that horizontally intersect
|
|
(entry = entries[lateralEnd]) && // but not past the whole seg list
|
|
entry.span.start < subjectEntry.span.end) {
|
|
lateralEnd += 1;
|
|
}
|
|
if (lateralStart < lateralEnd) {
|
|
return { level: level, lateralStart: lateralStart, lateralEnd: lateralEnd };
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function stretchWeb(topLevelNodes, totalThickness) {
|
|
var stretchNode = cacheable(function (node, startCoord, prevThickness) { return buildEntryKey(node); }, function (node, startCoord, prevThickness) {
|
|
var nextLevelNodes = node.nextLevelNodes, thickness = node.thickness;
|
|
var allThickness = thickness + prevThickness;
|
|
var thicknessFraction = thickness / allThickness;
|
|
var endCoord;
|
|
var newChildren = [];
|
|
if (!nextLevelNodes.length) {
|
|
endCoord = totalThickness;
|
|
}
|
|
else {
|
|
for (var _i = 0, nextLevelNodes_1 = nextLevelNodes; _i < nextLevelNodes_1.length; _i++) {
|
|
var childNode = nextLevelNodes_1[_i];
|
|
if (endCoord === undefined) {
|
|
var res = stretchNode(childNode, startCoord, allThickness);
|
|
endCoord = res[0];
|
|
newChildren.push(res[1]);
|
|
}
|
|
else {
|
|
var res = stretchNode(childNode, endCoord, 0);
|
|
newChildren.push(res[1]);
|
|
}
|
|
}
|
|
}
|
|
var newThickness = (endCoord - startCoord) * thicknessFraction;
|
|
return [endCoord - newThickness, __assign(__assign({}, node), { thickness: newThickness, nextLevelNodes: newChildren })];
|
|
});
|
|
return topLevelNodes.map(function (node) { return stretchNode(node, 0, 0)[1]; });
|
|
}
|
|
// not sorted in any particular order
|
|
function webToRects(topLevelNodes) {
|
|
var rects = [];
|
|
var processNode = cacheable(function (node, levelCoord, stackDepth) { return buildEntryKey(node); }, function (node, levelCoord, stackDepth) {
|
|
var rect = __assign(__assign({}, node), { levelCoord: levelCoord,
|
|
stackDepth: stackDepth, stackForward: 0 });
|
|
rects.push(rect);
|
|
return (rect.stackForward = processNodes(node.nextLevelNodes, levelCoord + node.thickness, stackDepth + 1) + 1);
|
|
});
|
|
function processNodes(nodes, levelCoord, stackDepth) {
|
|
var stackForward = 0;
|
|
for (var _i = 0, nodes_1 = nodes; _i < nodes_1.length; _i++) {
|
|
var node = nodes_1[_i];
|
|
stackForward = Math.max(processNode(node, levelCoord, stackDepth), stackForward);
|
|
}
|
|
return stackForward;
|
|
}
|
|
processNodes(topLevelNodes, 0, 0);
|
|
return rects; // TODO: sort rects by levelCoord to be consistent with toRects?
|
|
}
|
|
// TODO: move to general util
|
|
function cacheable(keyFunc, workFunc) {
|
|
var cache = {};
|
|
return function () {
|
|
var args = [];
|
|
for (var _i = 0; _i < arguments.length; _i++) {
|
|
args[_i] = arguments[_i];
|
|
}
|
|
var key = keyFunc.apply(void 0, args);
|
|
return (key in cache)
|
|
? cache[key]
|
|
: (cache[key] = workFunc.apply(void 0, args));
|
|
};
|
|
}
|
|
|
|
function computeSegVCoords(segs, colDate, slatCoords, eventMinHeight) {
|
|
if (slatCoords === void 0) { slatCoords = null; }
|
|
if (eventMinHeight === void 0) { eventMinHeight = 0; }
|
|
var vcoords = [];
|
|
if (slatCoords) {
|
|
for (var i = 0; i < segs.length; i += 1) {
|
|
var seg = segs[i];
|
|
var spanStart = slatCoords.computeDateTop(seg.start, colDate);
|
|
var spanEnd = Math.max(spanStart + (eventMinHeight || 0), // :(
|
|
slatCoords.computeDateTop(seg.end, colDate));
|
|
vcoords.push({
|
|
start: Math.round(spanStart),
|
|
end: Math.round(spanEnd), //
|
|
});
|
|
}
|
|
}
|
|
return vcoords;
|
|
}
|
|
function computeFgSegPlacements$1(segs, segVCoords, // might not have for every seg
|
|
eventOrderStrict, eventMaxStack) {
|
|
var segInputs = [];
|
|
var dumbSegs = []; // segs without coords
|
|
for (var i = 0; i < segs.length; i += 1) {
|
|
var vcoords = segVCoords[i];
|
|
if (vcoords) {
|
|
segInputs.push({
|
|
index: i,
|
|
thickness: 1,
|
|
span: vcoords,
|
|
});
|
|
}
|
|
else {
|
|
dumbSegs.push(segs[i]);
|
|
}
|
|
}
|
|
var _a = buildPositioning(segInputs, eventOrderStrict, eventMaxStack), segRects = _a.segRects, hiddenGroups = _a.hiddenGroups;
|
|
var segPlacements = [];
|
|
for (var _i = 0, segRects_1 = segRects; _i < segRects_1.length; _i++) {
|
|
var segRect = segRects_1[_i];
|
|
segPlacements.push({
|
|
seg: segs[segRect.index],
|
|
rect: segRect,
|
|
});
|
|
}
|
|
for (var _b = 0, dumbSegs_1 = dumbSegs; _b < dumbSegs_1.length; _b++) {
|
|
var dumbSeg = dumbSegs_1[_b];
|
|
segPlacements.push({ seg: dumbSeg, rect: null });
|
|
}
|
|
return { segPlacements: segPlacements, hiddenGroups: hiddenGroups };
|
|
}
|
|
|
|
var DEFAULT_TIME_FORMAT$2 = createFormatter({
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
meridiem: false,
|
|
});
|
|
var TimeColEvent = /** @class */ (function (_super) {
|
|
__extends(TimeColEvent, _super);
|
|
function TimeColEvent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimeColEvent.prototype.render = function () {
|
|
var classNames = [
|
|
'fc-timegrid-event',
|
|
'fc-v-event',
|
|
];
|
|
if (this.props.isShort) {
|
|
classNames.push('fc-timegrid-event-short');
|
|
}
|
|
return (createElement(StandardEvent, __assign({}, this.props, { defaultTimeFormat: DEFAULT_TIME_FORMAT$2, extraClassNames: classNames })));
|
|
};
|
|
return TimeColEvent;
|
|
}(BaseComponent));
|
|
|
|
var TimeColMisc = /** @class */ (function (_super) {
|
|
__extends(TimeColMisc, _super);
|
|
function TimeColMisc() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimeColMisc.prototype.render = function () {
|
|
var props = this.props;
|
|
return (createElement(DayCellContent, { date: props.date, dateProfile: props.dateProfile, todayRange: props.todayRange, extraHookProps: props.extraHookProps }, function (innerElRef, innerContent) { return (innerContent &&
|
|
createElement("div", { className: "fc-timegrid-col-misc", ref: innerElRef }, innerContent)); }));
|
|
};
|
|
return TimeColMisc;
|
|
}(BaseComponent));
|
|
|
|
var TimeCol = /** @class */ (function (_super) {
|
|
__extends(TimeCol, _super);
|
|
function TimeCol() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.sortEventSegs = memoize(sortEventSegs);
|
|
return _this;
|
|
}
|
|
// TODO: memoize event-placement?
|
|
TimeCol.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var isSelectMirror = context.options.selectMirror;
|
|
var mirrorSegs = (props.eventDrag && props.eventDrag.segs) ||
|
|
(props.eventResize && props.eventResize.segs) ||
|
|
(isSelectMirror && props.dateSelectionSegs) ||
|
|
[];
|
|
var interactionAffectedInstances = // TODO: messy way to compute this
|
|
(props.eventDrag && props.eventDrag.affectedInstances) ||
|
|
(props.eventResize && props.eventResize.affectedInstances) ||
|
|
{};
|
|
var sortedFgSegs = this.sortEventSegs(props.fgEventSegs, context.options.eventOrder);
|
|
return (createElement(DayCellRoot, { elRef: props.elRef, date: props.date, dateProfile: props.dateProfile, todayRange: props.todayRange, extraHookProps: props.extraHookProps }, function (rootElRef, classNames, dataAttrs) { return (createElement("td", __assign({ ref: rootElRef, role: "gridcell", className: ['fc-timegrid-col'].concat(classNames, props.extraClassNames || []).join(' ') }, dataAttrs, props.extraDataAttrs),
|
|
createElement("div", { className: "fc-timegrid-col-frame" },
|
|
createElement("div", { className: "fc-timegrid-col-bg" },
|
|
_this.renderFillSegs(props.businessHourSegs, 'non-business'),
|
|
_this.renderFillSegs(props.bgEventSegs, 'bg-event'),
|
|
_this.renderFillSegs(props.dateSelectionSegs, 'highlight')),
|
|
createElement("div", { className: "fc-timegrid-col-events" }, _this.renderFgSegs(sortedFgSegs, interactionAffectedInstances, false, false, false)),
|
|
createElement("div", { className: "fc-timegrid-col-events" }, _this.renderFgSegs(mirrorSegs, {}, Boolean(props.eventDrag), Boolean(props.eventResize), Boolean(isSelectMirror))),
|
|
createElement("div", { className: "fc-timegrid-now-indicator-container" }, _this.renderNowIndicator(props.nowIndicatorSegs)),
|
|
createElement(TimeColMisc, { date: props.date, dateProfile: props.dateProfile, todayRange: props.todayRange, extraHookProps: props.extraHookProps })))); }));
|
|
};
|
|
TimeCol.prototype.renderFgSegs = function (sortedFgSegs, segIsInvisible, isDragging, isResizing, isDateSelecting) {
|
|
var props = this.props;
|
|
if (props.forPrint) {
|
|
return renderPlainFgSegs(sortedFgSegs, props);
|
|
}
|
|
return this.renderPositionedFgSegs(sortedFgSegs, segIsInvisible, isDragging, isResizing, isDateSelecting);
|
|
};
|
|
TimeCol.prototype.renderPositionedFgSegs = function (segs, // if not mirror, needs to be sorted
|
|
segIsInvisible, isDragging, isResizing, isDateSelecting) {
|
|
var _this = this;
|
|
var _a = this.context.options, eventMaxStack = _a.eventMaxStack, eventShortHeight = _a.eventShortHeight, eventOrderStrict = _a.eventOrderStrict, eventMinHeight = _a.eventMinHeight;
|
|
var _b = this.props, date = _b.date, slatCoords = _b.slatCoords, eventSelection = _b.eventSelection, todayRange = _b.todayRange, nowDate = _b.nowDate;
|
|
var isMirror = isDragging || isResizing || isDateSelecting;
|
|
var segVCoords = computeSegVCoords(segs, date, slatCoords, eventMinHeight);
|
|
var _c = computeFgSegPlacements$1(segs, segVCoords, eventOrderStrict, eventMaxStack), segPlacements = _c.segPlacements, hiddenGroups = _c.hiddenGroups;
|
|
return (createElement(Fragment, null,
|
|
this.renderHiddenGroups(hiddenGroups, segs),
|
|
segPlacements.map(function (segPlacement) {
|
|
var seg = segPlacement.seg, rect = segPlacement.rect;
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
var isVisible = isMirror || Boolean(!segIsInvisible[instanceId] && rect);
|
|
var vStyle = computeSegVStyle(rect && rect.span);
|
|
var hStyle = (!isMirror && rect) ? _this.computeSegHStyle(rect) : { left: 0, right: 0 };
|
|
var isInset = Boolean(rect) && rect.stackForward > 0;
|
|
var isShort = Boolean(rect) && (rect.span.end - rect.span.start) < eventShortHeight; // look at other places for this problem
|
|
return (createElement("div", { className: 'fc-timegrid-event-harness' +
|
|
(isInset ? ' fc-timegrid-event-harness-inset' : ''), key: instanceId, style: __assign(__assign({ visibility: isVisible ? '' : 'hidden' }, vStyle), hStyle) },
|
|
createElement(TimeColEvent, __assign({ seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === eventSelection, isShort: isShort }, getSegMeta(seg, todayRange, nowDate)))));
|
|
})));
|
|
};
|
|
// will already have eventMinHeight applied because segInputs already had it
|
|
TimeCol.prototype.renderHiddenGroups = function (hiddenGroups, segs) {
|
|
var _a = this.props, extraDateSpan = _a.extraDateSpan, dateProfile = _a.dateProfile, todayRange = _a.todayRange, nowDate = _a.nowDate, eventSelection = _a.eventSelection, eventDrag = _a.eventDrag, eventResize = _a.eventResize;
|
|
return (createElement(Fragment, null, hiddenGroups.map(function (hiddenGroup) {
|
|
var positionCss = computeSegVStyle(hiddenGroup.span);
|
|
var hiddenSegs = compileSegsFromEntries(hiddenGroup.entries, segs);
|
|
return (createElement(TimeColMoreLink, { key: buildIsoString(computeEarliestSegStart(hiddenSegs)), hiddenSegs: hiddenSegs, top: positionCss.top, bottom: positionCss.bottom, extraDateSpan: extraDateSpan, dateProfile: dateProfile, todayRange: todayRange, nowDate: nowDate, eventSelection: eventSelection, eventDrag: eventDrag, eventResize: eventResize }));
|
|
})));
|
|
};
|
|
TimeCol.prototype.renderFillSegs = function (segs, fillType) {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var segVCoords = computeSegVCoords(segs, props.date, props.slatCoords, context.options.eventMinHeight); // don't assume all populated
|
|
var children = segVCoords.map(function (vcoords, i) {
|
|
var seg = segs[i];
|
|
return (createElement("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-timegrid-bg-harness", style: computeSegVStyle(vcoords) }, fillType === 'bg-event' ?
|
|
createElement(BgEvent, __assign({ seg: seg }, getSegMeta(seg, props.todayRange, props.nowDate))) :
|
|
renderFill(fillType)));
|
|
});
|
|
return createElement(Fragment, null, children);
|
|
};
|
|
TimeCol.prototype.renderNowIndicator = function (segs) {
|
|
var _a = this.props, slatCoords = _a.slatCoords, date = _a.date;
|
|
if (!slatCoords) {
|
|
return null;
|
|
}
|
|
return segs.map(function (seg, i) { return (createElement(NowIndicatorRoot, { isAxis: false, date: date,
|
|
// key doesn't matter. will only ever be one
|
|
key: i }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timegrid-now-indicator-line'].concat(classNames).join(' '), style: { top: slatCoords.computeDateTop(seg.start, date) } }, innerContent)); })); });
|
|
};
|
|
TimeCol.prototype.computeSegHStyle = function (segHCoords) {
|
|
var _a = this.context, isRtl = _a.isRtl, options = _a.options;
|
|
var shouldOverlap = options.slotEventOverlap;
|
|
var nearCoord = segHCoords.levelCoord; // the left side if LTR. the right side if RTL. floating-point
|
|
var farCoord = segHCoords.levelCoord + segHCoords.thickness; // the right side if LTR. the left side if RTL. floating-point
|
|
var left; // amount of space from left edge, a fraction of the total width
|
|
var right; // amount of space from right edge, a fraction of the total width
|
|
if (shouldOverlap) {
|
|
// double the width, but don't go beyond the maximum forward coordinate (1.0)
|
|
farCoord = Math.min(1, nearCoord + (farCoord - nearCoord) * 2);
|
|
}
|
|
if (isRtl) {
|
|
left = 1 - farCoord;
|
|
right = nearCoord;
|
|
}
|
|
else {
|
|
left = nearCoord;
|
|
right = 1 - farCoord;
|
|
}
|
|
var props = {
|
|
zIndex: segHCoords.stackDepth + 1,
|
|
left: left * 100 + '%',
|
|
right: right * 100 + '%',
|
|
};
|
|
if (shouldOverlap && !segHCoords.stackForward) {
|
|
// add padding to the edge so that forward stacked events don't cover the resizer's icon
|
|
props[isRtl ? 'marginLeft' : 'marginRight'] = 10 * 2; // 10 is a guesstimate of the icon's width
|
|
}
|
|
return props;
|
|
};
|
|
return TimeCol;
|
|
}(BaseComponent));
|
|
function renderPlainFgSegs(sortedFgSegs, _a) {
|
|
var todayRange = _a.todayRange, nowDate = _a.nowDate, eventSelection = _a.eventSelection, eventDrag = _a.eventDrag, eventResize = _a.eventResize;
|
|
var hiddenInstances = (eventDrag ? eventDrag.affectedInstances : null) ||
|
|
(eventResize ? eventResize.affectedInstances : null) ||
|
|
{};
|
|
return (createElement(Fragment, null, sortedFgSegs.map(function (seg) {
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
return (createElement("div", { key: instanceId, style: { visibility: hiddenInstances[instanceId] ? 'hidden' : '' } },
|
|
createElement(TimeColEvent, __assign({ seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === eventSelection, isShort: false }, getSegMeta(seg, todayRange, nowDate)))));
|
|
})));
|
|
}
|
|
function computeSegVStyle(segVCoords) {
|
|
if (!segVCoords) {
|
|
return { top: '', bottom: '' };
|
|
}
|
|
return {
|
|
top: segVCoords.start,
|
|
bottom: -segVCoords.end,
|
|
};
|
|
}
|
|
function compileSegsFromEntries(segEntries, allSegs) {
|
|
return segEntries.map(function (segEntry) { return allSegs[segEntry.index]; });
|
|
}
|
|
|
|
var TimeColsContent = /** @class */ (function (_super) {
|
|
__extends(TimeColsContent, _super);
|
|
function TimeColsContent() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.splitFgEventSegs = memoize(splitSegsByCol);
|
|
_this.splitBgEventSegs = memoize(splitSegsByCol);
|
|
_this.splitBusinessHourSegs = memoize(splitSegsByCol);
|
|
_this.splitNowIndicatorSegs = memoize(splitSegsByCol);
|
|
_this.splitDateSelectionSegs = memoize(splitSegsByCol);
|
|
_this.splitEventDrag = memoize(splitInteractionByCol);
|
|
_this.splitEventResize = memoize(splitInteractionByCol);
|
|
_this.rootElRef = createRef();
|
|
_this.cellElRefs = new RefMap();
|
|
return _this;
|
|
}
|
|
TimeColsContent.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var nowIndicatorTop = context.options.nowIndicator &&
|
|
props.slatCoords &&
|
|
props.slatCoords.safeComputeTop(props.nowDate); // might return void
|
|
var colCnt = props.cells.length;
|
|
var fgEventSegsByRow = this.splitFgEventSegs(props.fgEventSegs, colCnt);
|
|
var bgEventSegsByRow = this.splitBgEventSegs(props.bgEventSegs, colCnt);
|
|
var businessHourSegsByRow = this.splitBusinessHourSegs(props.businessHourSegs, colCnt);
|
|
var nowIndicatorSegsByRow = this.splitNowIndicatorSegs(props.nowIndicatorSegs, colCnt);
|
|
var dateSelectionSegsByRow = this.splitDateSelectionSegs(props.dateSelectionSegs, colCnt);
|
|
var eventDragByRow = this.splitEventDrag(props.eventDrag, colCnt);
|
|
var eventResizeByRow = this.splitEventResize(props.eventResize, colCnt);
|
|
return (createElement("div", { className: "fc-timegrid-cols", ref: this.rootElRef },
|
|
createElement("table", { role: "presentation", style: {
|
|
minWidth: props.tableMinWidth,
|
|
width: props.clientWidth,
|
|
} },
|
|
props.tableColGroupNode,
|
|
createElement("tbody", { role: "presentation" },
|
|
createElement("tr", { role: "row" },
|
|
props.axis && (createElement("td", { "aria-hidden": true, className: "fc-timegrid-col fc-timegrid-axis" },
|
|
createElement("div", { className: "fc-timegrid-col-frame" },
|
|
createElement("div", { className: "fc-timegrid-now-indicator-container" }, typeof nowIndicatorTop === 'number' && (createElement(NowIndicatorRoot, { isAxis: true, date: props.nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timegrid-now-indicator-arrow'].concat(classNames).join(' '), style: { top: nowIndicatorTop } }, innerContent)); })))))),
|
|
props.cells.map(function (cell, i) { return (createElement(TimeCol, { key: cell.key, elRef: _this.cellElRefs.createRef(cell.key), dateProfile: props.dateProfile, date: cell.date, nowDate: props.nowDate, todayRange: props.todayRange, extraHookProps: cell.extraHookProps, extraDataAttrs: cell.extraDataAttrs, extraClassNames: cell.extraClassNames, extraDateSpan: cell.extraDateSpan, fgEventSegs: fgEventSegsByRow[i], bgEventSegs: bgEventSegsByRow[i], businessHourSegs: businessHourSegsByRow[i], nowIndicatorSegs: nowIndicatorSegsByRow[i], dateSelectionSegs: dateSelectionSegsByRow[i], eventDrag: eventDragByRow[i], eventResize: eventResizeByRow[i], slatCoords: props.slatCoords, eventSelection: props.eventSelection, forPrint: props.forPrint })); }))))));
|
|
};
|
|
TimeColsContent.prototype.componentDidMount = function () {
|
|
this.updateCoords();
|
|
};
|
|
TimeColsContent.prototype.componentDidUpdate = function () {
|
|
this.updateCoords();
|
|
};
|
|
TimeColsContent.prototype.updateCoords = function () {
|
|
var props = this.props;
|
|
if (props.onColCoords &&
|
|
props.clientWidth !== null // means sizing has stabilized
|
|
) {
|
|
props.onColCoords(new PositionCache(this.rootElRef.current, collectCellEls$1(this.cellElRefs.currentMap, props.cells), true, // horizontal
|
|
false));
|
|
}
|
|
};
|
|
return TimeColsContent;
|
|
}(BaseComponent));
|
|
function collectCellEls$1(elMap, cells) {
|
|
return cells.map(function (cell) { return elMap[cell.key]; });
|
|
}
|
|
|
|
/* A component that renders one or more columns of vertical time slots
|
|
----------------------------------------------------------------------------------------------------------------------*/
|
|
var TimeCols = /** @class */ (function (_super) {
|
|
__extends(TimeCols, _super);
|
|
function TimeCols() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.processSlotOptions = memoize(processSlotOptions);
|
|
_this.state = {
|
|
slatCoords: null,
|
|
};
|
|
_this.handleRootEl = function (el) {
|
|
if (el) {
|
|
_this.context.registerInteractiveComponent(_this, {
|
|
el: el,
|
|
isHitComboAllowed: _this.props.isHitComboAllowed,
|
|
});
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
_this.handleScrollRequest = function (request) {
|
|
var onScrollTopRequest = _this.props.onScrollTopRequest;
|
|
var slatCoords = _this.state.slatCoords;
|
|
if (onScrollTopRequest && slatCoords) {
|
|
if (request.time) {
|
|
var top_1 = slatCoords.computeTimeTop(request.time);
|
|
top_1 = Math.ceil(top_1); // zoom can give weird floating-point values. rather scroll a little bit further
|
|
if (top_1) {
|
|
top_1 += 1; // to overcome top border that slots beyond the first have. looks better
|
|
}
|
|
onScrollTopRequest(top_1);
|
|
}
|
|
return true;
|
|
}
|
|
return false;
|
|
};
|
|
_this.handleColCoords = function (colCoords) {
|
|
_this.colCoords = colCoords;
|
|
};
|
|
_this.handleSlatCoords = function (slatCoords) {
|
|
_this.setState({ slatCoords: slatCoords });
|
|
if (_this.props.onSlatCoords) {
|
|
_this.props.onSlatCoords(slatCoords);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
TimeCols.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state;
|
|
return (createElement("div", { className: "fc-timegrid-body", ref: this.handleRootEl, style: {
|
|
// these props are important to give this wrapper correct dimensions for interactions
|
|
// TODO: if we set it here, can we avoid giving to inner tables?
|
|
width: props.clientWidth,
|
|
minWidth: props.tableMinWidth,
|
|
} },
|
|
createElement(TimeColsSlats, { axis: props.axis, dateProfile: props.dateProfile, slatMetas: props.slatMetas, clientWidth: props.clientWidth, minHeight: props.expandRows ? props.clientHeight : '', tableMinWidth: props.tableMinWidth, tableColGroupNode: props.axis ? props.tableColGroupNode : null /* axis depends on the colgroup's shrinking */, onCoords: this.handleSlatCoords }),
|
|
createElement(TimeColsContent, { cells: props.cells, axis: props.axis, dateProfile: props.dateProfile, businessHourSegs: props.businessHourSegs, bgEventSegs: props.bgEventSegs, fgEventSegs: props.fgEventSegs, dateSelectionSegs: props.dateSelectionSegs, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, todayRange: props.todayRange, nowDate: props.nowDate, nowIndicatorSegs: props.nowIndicatorSegs, clientWidth: props.clientWidth, tableMinWidth: props.tableMinWidth, tableColGroupNode: props.tableColGroupNode, slatCoords: state.slatCoords, onColCoords: this.handleColCoords, forPrint: props.forPrint })));
|
|
};
|
|
TimeCols.prototype.componentDidMount = function () {
|
|
this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
|
|
};
|
|
TimeCols.prototype.componentDidUpdate = function (prevProps) {
|
|
this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
|
|
};
|
|
TimeCols.prototype.componentWillUnmount = function () {
|
|
this.scrollResponder.detach();
|
|
};
|
|
TimeCols.prototype.queryHit = function (positionLeft, positionTop) {
|
|
var _a = this.context, dateEnv = _a.dateEnv, options = _a.options;
|
|
var colCoords = this.colCoords;
|
|
var dateProfile = this.props.dateProfile;
|
|
var slatCoords = this.state.slatCoords;
|
|
var _b = this.processSlotOptions(this.props.slotDuration, options.snapDuration), snapDuration = _b.snapDuration, snapsPerSlot = _b.snapsPerSlot;
|
|
var colIndex = colCoords.leftToIndex(positionLeft);
|
|
var slatIndex = slatCoords.positions.topToIndex(positionTop);
|
|
if (colIndex != null && slatIndex != null) {
|
|
var cell = this.props.cells[colIndex];
|
|
var slatTop = slatCoords.positions.tops[slatIndex];
|
|
var slatHeight = slatCoords.positions.getHeight(slatIndex);
|
|
var partial = (positionTop - slatTop) / slatHeight; // floating point number between 0 and 1
|
|
var localSnapIndex = Math.floor(partial * snapsPerSlot); // the snap # relative to start of slat
|
|
var snapIndex = slatIndex * snapsPerSlot + localSnapIndex;
|
|
var dayDate = this.props.cells[colIndex].date;
|
|
var time = addDurations(dateProfile.slotMinTime, multiplyDuration(snapDuration, snapIndex));
|
|
var start = dateEnv.add(dayDate, time);
|
|
var end = dateEnv.add(start, snapDuration);
|
|
return {
|
|
dateProfile: dateProfile,
|
|
dateSpan: __assign({ range: { start: start, end: end }, allDay: false }, cell.extraDateSpan),
|
|
dayEl: colCoords.els[colIndex],
|
|
rect: {
|
|
left: colCoords.lefts[colIndex],
|
|
right: colCoords.rights[colIndex],
|
|
top: slatTop,
|
|
bottom: slatTop + slatHeight,
|
|
},
|
|
layer: 0,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return TimeCols;
|
|
}(DateComponent));
|
|
function processSlotOptions(slotDuration, snapDurationOverride) {
|
|
var snapDuration = snapDurationOverride || slotDuration;
|
|
var snapsPerSlot = wholeDivideDurations(slotDuration, snapDuration);
|
|
if (snapsPerSlot === null) {
|
|
snapDuration = slotDuration;
|
|
snapsPerSlot = 1;
|
|
// TODO: say warning?
|
|
}
|
|
return { snapDuration: snapDuration, snapsPerSlot: snapsPerSlot };
|
|
}
|
|
|
|
var DayTimeColsSlicer = /** @class */ (function (_super) {
|
|
__extends(DayTimeColsSlicer, _super);
|
|
function DayTimeColsSlicer() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
DayTimeColsSlicer.prototype.sliceRange = function (range, dayRanges) {
|
|
var segs = [];
|
|
for (var col = 0; col < dayRanges.length; col += 1) {
|
|
var segRange = intersectRanges(range, dayRanges[col]);
|
|
if (segRange) {
|
|
segs.push({
|
|
start: segRange.start,
|
|
end: segRange.end,
|
|
isStart: segRange.start.valueOf() === range.start.valueOf(),
|
|
isEnd: segRange.end.valueOf() === range.end.valueOf(),
|
|
col: col,
|
|
});
|
|
}
|
|
}
|
|
return segs;
|
|
};
|
|
return DayTimeColsSlicer;
|
|
}(Slicer));
|
|
|
|
var DayTimeCols = /** @class */ (function (_super) {
|
|
__extends(DayTimeCols, _super);
|
|
function DayTimeCols() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildDayRanges = memoize(buildDayRanges);
|
|
_this.slicer = new DayTimeColsSlicer();
|
|
_this.timeColsRef = createRef();
|
|
return _this;
|
|
}
|
|
DayTimeCols.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var dateProfile = props.dateProfile, dayTableModel = props.dayTableModel;
|
|
var isNowIndicator = context.options.nowIndicator;
|
|
var dayRanges = this.buildDayRanges(dayTableModel, dateProfile, context.dateEnv);
|
|
// give it the first row of cells
|
|
// TODO: would move this further down hierarchy, but sliceNowDate needs it
|
|
return (createElement(NowTimer, { unit: isNowIndicator ? 'minute' : 'day' }, function (nowDate, todayRange) { return (createElement(TimeCols, __assign({ ref: _this.timeColsRef }, _this.slicer.sliceProps(props, dateProfile, null, context, dayRanges), { forPrint: props.forPrint, axis: props.axis, dateProfile: dateProfile, slatMetas: props.slatMetas, slotDuration: props.slotDuration, cells: dayTableModel.cells[0], tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, clientWidth: props.clientWidth, clientHeight: props.clientHeight, expandRows: props.expandRows, nowDate: nowDate, nowIndicatorSegs: isNowIndicator && _this.slicer.sliceNowDate(nowDate, context, dayRanges), todayRange: todayRange, onScrollTopRequest: props.onScrollTopRequest, onSlatCoords: props.onSlatCoords }))); }));
|
|
};
|
|
return DayTimeCols;
|
|
}(DateComponent));
|
|
function buildDayRanges(dayTableModel, dateProfile, dateEnv) {
|
|
var ranges = [];
|
|
for (var _i = 0, _a = dayTableModel.headerDates; _i < _a.length; _i++) {
|
|
var date = _a[_i];
|
|
ranges.push({
|
|
start: dateEnv.add(date, dateProfile.slotMinTime),
|
|
end: dateEnv.add(date, dateProfile.slotMaxTime),
|
|
});
|
|
}
|
|
return ranges;
|
|
}
|
|
|
|
// potential nice values for the slot-duration and interval-duration
|
|
// from largest to smallest
|
|
var STOCK_SUB_DURATIONS$1 = [
|
|
{ hours: 1 },
|
|
{ minutes: 30 },
|
|
{ minutes: 15 },
|
|
{ seconds: 30 },
|
|
{ seconds: 15 },
|
|
];
|
|
function buildSlatMetas(slotMinTime, slotMaxTime, explicitLabelInterval, slotDuration, dateEnv) {
|
|
var dayStart = new Date(0);
|
|
var slatTime = slotMinTime;
|
|
var slatIterator = createDuration(0);
|
|
var labelInterval = explicitLabelInterval || computeLabelInterval(slotDuration);
|
|
var metas = [];
|
|
while (asRoughMs(slatTime) < asRoughMs(slotMaxTime)) {
|
|
var date = dateEnv.add(dayStart, slatTime);
|
|
var isLabeled = wholeDivideDurations(slatIterator, labelInterval) !== null;
|
|
metas.push({
|
|
date: date,
|
|
time: slatTime,
|
|
key: date.toISOString(),
|
|
isoTimeStr: formatIsoTimeString(date),
|
|
isLabeled: isLabeled,
|
|
});
|
|
slatTime = addDurations(slatTime, slotDuration);
|
|
slatIterator = addDurations(slatIterator, slotDuration);
|
|
}
|
|
return metas;
|
|
}
|
|
// Computes an automatic value for slotLabelInterval
|
|
function computeLabelInterval(slotDuration) {
|
|
var i;
|
|
var labelInterval;
|
|
var slotsPerLabel;
|
|
// find the smallest stock label interval that results in more than one slots-per-label
|
|
for (i = STOCK_SUB_DURATIONS$1.length - 1; i >= 0; i -= 1) {
|
|
labelInterval = createDuration(STOCK_SUB_DURATIONS$1[i]);
|
|
slotsPerLabel = wholeDivideDurations(labelInterval, slotDuration);
|
|
if (slotsPerLabel !== null && slotsPerLabel > 1) {
|
|
return labelInterval;
|
|
}
|
|
}
|
|
return slotDuration; // fall back
|
|
}
|
|
|
|
var DayTimeColsView = /** @class */ (function (_super) {
|
|
__extends(DayTimeColsView, _super);
|
|
function DayTimeColsView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildTimeColsModel = memoize(buildTimeColsModel);
|
|
_this.buildSlatMetas = memoize(buildSlatMetas);
|
|
return _this;
|
|
}
|
|
DayTimeColsView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this.context, options = _a.options, dateEnv = _a.dateEnv, dateProfileGenerator = _a.dateProfileGenerator;
|
|
var props = this.props;
|
|
var dateProfile = props.dateProfile;
|
|
var dayTableModel = this.buildTimeColsModel(dateProfile, dateProfileGenerator);
|
|
var splitProps = this.allDaySplitter.splitProps(props);
|
|
var slatMetas = this.buildSlatMetas(dateProfile.slotMinTime, dateProfile.slotMaxTime, options.slotLabelInterval, options.slotDuration, dateEnv);
|
|
var dayMinWidth = options.dayMinWidth;
|
|
var hasAttachedAxis = !dayMinWidth;
|
|
var hasDetachedAxis = dayMinWidth;
|
|
var headerContent = options.dayHeaders && (createElement(DayHeader, { dates: dayTableModel.headerDates, dateProfile: dateProfile, datesRepDistinctDays: true, renderIntro: hasAttachedAxis ? this.renderHeadAxis : null }));
|
|
var allDayContent = (options.allDaySlot !== false) && (function (contentArg) { return (createElement(DayTable, __assign({}, splitProps.allDay, { dateProfile: dateProfile, dayTableModel: dayTableModel, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, renderRowIntro: hasAttachedAxis ? _this.renderTableRowAxis : null, showWeekNumbers: false, expandRows: false, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }, _this.getAllDayMaxEventProps()))); });
|
|
var timeGridContent = function (contentArg) { return (createElement(DayTimeCols, __assign({}, splitProps.timed, { dayTableModel: dayTableModel, dateProfile: dateProfile, axis: hasAttachedAxis, slotDuration: options.slotDuration, slatMetas: slatMetas, forPrint: props.forPrint, tableColGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, onSlatCoords: _this.handleSlatCoords, expandRows: contentArg.expandRows, onScrollTopRequest: _this.handleScrollTopRequest }))); };
|
|
return hasDetachedAxis
|
|
? this.renderHScrollLayout(headerContent, allDayContent, timeGridContent, dayTableModel.colCnt, dayMinWidth, slatMetas, this.state.slatCoords)
|
|
: this.renderSimpleLayout(headerContent, allDayContent, timeGridContent);
|
|
};
|
|
return DayTimeColsView;
|
|
}(TimeColsView));
|
|
function buildTimeColsModel(dateProfile, dateProfileGenerator) {
|
|
var daySeries = new DaySeriesModel(dateProfile.renderRange, dateProfileGenerator);
|
|
return new DayTableModel(daySeries, false);
|
|
}
|
|
|
|
var OPTION_REFINERS$4 = {
|
|
allDaySlot: Boolean,
|
|
};
|
|
|
|
var timeGridPlugin = createPlugin({
|
|
initialView: 'timeGridWeek',
|
|
optionRefiners: OPTION_REFINERS$4,
|
|
views: {
|
|
timeGrid: {
|
|
component: DayTimeColsView,
|
|
usesMinMaxTime: true,
|
|
allDaySlot: true,
|
|
slotDuration: '00:30:00',
|
|
slotEventOverlap: true, // a bad name. confused with overlap/constraint system
|
|
},
|
|
timeGridDay: {
|
|
type: 'timeGrid',
|
|
duration: { days: 1 },
|
|
},
|
|
timeGridWeek: {
|
|
type: 'timeGrid',
|
|
duration: { weeks: 1 },
|
|
},
|
|
},
|
|
});
|
|
|
|
var ListViewHeaderRow = /** @class */ (function (_super) {
|
|
__extends(ListViewHeaderRow, _super);
|
|
function ListViewHeaderRow() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.state = {
|
|
textId: getUniqueDomId(),
|
|
};
|
|
return _this;
|
|
}
|
|
ListViewHeaderRow.prototype.render = function () {
|
|
var _a = this.context, theme = _a.theme, dateEnv = _a.dateEnv, options = _a.options, viewApi = _a.viewApi;
|
|
var _b = this.props, cellId = _b.cellId, dayDate = _b.dayDate, todayRange = _b.todayRange;
|
|
var textId = this.state.textId;
|
|
var dayMeta = getDateMeta(dayDate, todayRange);
|
|
// will ever be falsy?
|
|
var text = options.listDayFormat ? dateEnv.format(dayDate, options.listDayFormat) : '';
|
|
// will ever be falsy? also, BAD NAME "alt"
|
|
var sideText = options.listDaySideFormat ? dateEnv.format(dayDate, options.listDaySideFormat) : '';
|
|
var hookProps = __assign({ date: dateEnv.toDate(dayDate), view: viewApi, textId: textId,
|
|
text: text,
|
|
sideText: sideText, navLinkAttrs: buildNavLinkAttrs(this.context, dayDate), sideNavLinkAttrs: buildNavLinkAttrs(this.context, dayDate, 'day', false) }, dayMeta);
|
|
var classNames = ['fc-list-day'].concat(getDayClassNames(dayMeta, theme));
|
|
// TODO: make a reusable HOC for dayHeader (used in daygrid/timegrid too)
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.dayHeaderClassNames, content: options.dayHeaderContent, defaultContent: renderInnerContent$2, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("tr", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-date": formatDayString(dayDate) },
|
|
createElement("th", { scope: "colgroup", colSpan: 3, id: cellId, "aria-labelledby": textId },
|
|
createElement("div", { className: 'fc-list-day-cushion ' + theme.getClass('tableCellShaded'), ref: innerElRef }, innerContent)))); }));
|
|
};
|
|
return ListViewHeaderRow;
|
|
}(BaseComponent));
|
|
function renderInnerContent$2(props) {
|
|
return (createElement(Fragment, null,
|
|
props.text && (createElement("a", __assign({ id: props.textId, className: "fc-list-day-text" }, props.navLinkAttrs), props.text)),
|
|
props.sideText && ( /* not keyboard tabbable */createElement("a", __assign({ "aria-hidden": true, className: "fc-list-day-side-text" }, props.sideNavLinkAttrs), props.sideText))));
|
|
}
|
|
|
|
var DEFAULT_TIME_FORMAT$1 = createFormatter({
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
meridiem: 'short',
|
|
});
|
|
var ListViewEventRow = /** @class */ (function (_super) {
|
|
__extends(ListViewEventRow, _super);
|
|
function ListViewEventRow() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ListViewEventRow.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var seg = props.seg, timeHeaderId = props.timeHeaderId, eventHeaderId = props.eventHeaderId, dateHeaderId = props.dateHeaderId;
|
|
var timeFormat = context.options.eventTimeFormat || DEFAULT_TIME_FORMAT$1;
|
|
return (createElement(EventRoot, { seg: seg, timeText: "" // BAD. because of all-day content
|
|
, disableDragging: true, disableResizing: true, defaultContent: function () { return renderEventInnerContent(seg, context); } /* weird */, isPast: props.isPast, isFuture: props.isFuture, isToday: props.isToday, isSelected: props.isSelected, isDragging: props.isDragging, isResizing: props.isResizing, isDateSelecting: props.isDateSelecting }, function (rootElRef, classNames, innerElRef, innerContent, hookProps) { return (createElement("tr", { className: ['fc-list-event', hookProps.event.url ? 'fc-event-forced-url' : ''].concat(classNames).join(' '), ref: rootElRef },
|
|
buildTimeContent(seg, timeFormat, context, timeHeaderId, dateHeaderId),
|
|
createElement("td", { "aria-hidden": true, className: "fc-list-event-graphic" },
|
|
createElement("span", { className: "fc-list-event-dot", style: { borderColor: hookProps.borderColor || hookProps.backgroundColor } })),
|
|
createElement("td", { ref: innerElRef, headers: eventHeaderId + " " + dateHeaderId, className: "fc-list-event-title" }, innerContent))); }));
|
|
};
|
|
return ListViewEventRow;
|
|
}(BaseComponent));
|
|
function renderEventInnerContent(seg, context) {
|
|
var interactiveAttrs = getSegAnchorAttrs(seg, context);
|
|
return (createElement("a", __assign({}, interactiveAttrs), seg.eventRange.def.title));
|
|
}
|
|
function buildTimeContent(seg, timeFormat, context, timeHeaderId, dateHeaderId) {
|
|
var options = context.options;
|
|
if (options.displayEventTime !== false) {
|
|
var eventDef = seg.eventRange.def;
|
|
var eventInstance = seg.eventRange.instance;
|
|
var doAllDay = false;
|
|
var timeText = void 0;
|
|
if (eventDef.allDay) {
|
|
doAllDay = true;
|
|
}
|
|
else if (isMultiDayRange(seg.eventRange.range)) { // TODO: use (!isStart || !isEnd) instead?
|
|
if (seg.isStart) {
|
|
timeText = buildSegTimeText(seg, timeFormat, context, null, null, eventInstance.range.start, seg.end);
|
|
}
|
|
else if (seg.isEnd) {
|
|
timeText = buildSegTimeText(seg, timeFormat, context, null, null, seg.start, eventInstance.range.end);
|
|
}
|
|
else {
|
|
doAllDay = true;
|
|
}
|
|
}
|
|
else {
|
|
timeText = buildSegTimeText(seg, timeFormat, context);
|
|
}
|
|
if (doAllDay) {
|
|
var hookProps = {
|
|
text: context.options.allDayText,
|
|
view: context.viewApi,
|
|
};
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.allDayClassNames, content: options.allDayContent, defaultContent: renderAllDayInner, didMount: options.allDayDidMount, willUnmount: options.allDayWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, headers: timeHeaderId + " " + dateHeaderId, className: ['fc-list-event-time'].concat(classNames).join(' ') }, innerContent)); }));
|
|
}
|
|
return (createElement("td", { className: "fc-list-event-time" }, timeText));
|
|
}
|
|
return null;
|
|
}
|
|
function renderAllDayInner(hookProps) {
|
|
return hookProps.text;
|
|
}
|
|
|
|
/*
|
|
Responsible for the scroller, and forwarding event-related actions into the "grid".
|
|
*/
|
|
var ListView = /** @class */ (function (_super) {
|
|
__extends(ListView, _super);
|
|
function ListView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.computeDateVars = memoize(computeDateVars);
|
|
_this.eventStoreToSegs = memoize(_this._eventStoreToSegs);
|
|
_this.state = {
|
|
timeHeaderId: getUniqueDomId(),
|
|
eventHeaderId: getUniqueDomId(),
|
|
dateHeaderIdRoot: getUniqueDomId(),
|
|
};
|
|
_this.setRootEl = function (rootEl) {
|
|
if (rootEl) {
|
|
_this.context.registerInteractiveComponent(_this, {
|
|
el: rootEl,
|
|
});
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
ListView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var extraClassNames = [
|
|
'fc-list',
|
|
context.theme.getClass('table'),
|
|
context.options.stickyHeaderDates !== false ? 'fc-list-sticky' : '',
|
|
];
|
|
var _b = this.computeDateVars(props.dateProfile), dayDates = _b.dayDates, dayRanges = _b.dayRanges;
|
|
var eventSegs = this.eventStoreToSegs(props.eventStore, props.eventUiBases, dayRanges);
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec, elRef: this.setRootEl }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: extraClassNames.concat(classNames).join(' ') },
|
|
createElement(Scroller, { liquid: !props.isHeightAuto, overflowX: props.isHeightAuto ? 'visible' : 'hidden', overflowY: props.isHeightAuto ? 'visible' : 'auto' }, eventSegs.length > 0 ?
|
|
_this.renderSegList(eventSegs, dayDates) :
|
|
_this.renderEmptyMessage()))); }));
|
|
};
|
|
ListView.prototype.renderEmptyMessage = function () {
|
|
var _a = this.context, options = _a.options, viewApi = _a.viewApi;
|
|
var hookProps = {
|
|
text: options.noEventsText,
|
|
view: viewApi,
|
|
};
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.noEventsClassNames, content: options.noEventsContent, defaultContent: renderNoEventsInner, didMount: options.noEventsDidMount, willUnmount: options.noEventsWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { className: ['fc-list-empty'].concat(classNames).join(' '), ref: rootElRef },
|
|
createElement("div", { className: "fc-list-empty-cushion", ref: innerElRef }, innerContent))); }));
|
|
};
|
|
ListView.prototype.renderSegList = function (allSegs, dayDates) {
|
|
var _a = this.context, theme = _a.theme, options = _a.options;
|
|
var _b = this.state, timeHeaderId = _b.timeHeaderId, eventHeaderId = _b.eventHeaderId, dateHeaderIdRoot = _b.dateHeaderIdRoot;
|
|
var segsByDay = groupSegsByDay(allSegs); // sparse array
|
|
return (createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) {
|
|
var innerNodes = [];
|
|
for (var dayIndex = 0; dayIndex < segsByDay.length; dayIndex += 1) {
|
|
var daySegs = segsByDay[dayIndex];
|
|
if (daySegs) { // sparse array, so might be undefined
|
|
var dayStr = formatDayString(dayDates[dayIndex]);
|
|
var dateHeaderId = dateHeaderIdRoot + '-' + dayStr;
|
|
// append a day header
|
|
innerNodes.push(createElement(ListViewHeaderRow, { key: dayStr, cellId: dateHeaderId, dayDate: dayDates[dayIndex], todayRange: todayRange }));
|
|
daySegs = sortEventSegs(daySegs, options.eventOrder);
|
|
for (var _i = 0, daySegs_1 = daySegs; _i < daySegs_1.length; _i++) {
|
|
var seg = daySegs_1[_i];
|
|
innerNodes.push(createElement(ListViewEventRow, __assign({ key: dayStr + ':' + seg.eventRange.instance.instanceId /* are multiple segs for an instanceId */, seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: false, timeHeaderId: timeHeaderId, eventHeaderId: eventHeaderId, dateHeaderId: dateHeaderId }, getSegMeta(seg, todayRange, nowDate))));
|
|
}
|
|
}
|
|
}
|
|
return (createElement("table", { className: 'fc-list-table ' + theme.getClass('table') },
|
|
createElement("thead", null,
|
|
createElement("tr", null,
|
|
createElement("th", { scope: "col", id: timeHeaderId }, options.timeHint),
|
|
createElement("th", { scope: "col", "aria-hidden": true }),
|
|
createElement("th", { scope: "col", id: eventHeaderId }, options.eventHint))),
|
|
createElement("tbody", null, innerNodes)));
|
|
}));
|
|
};
|
|
ListView.prototype._eventStoreToSegs = function (eventStore, eventUiBases, dayRanges) {
|
|
return this.eventRangesToSegs(sliceEventStore(eventStore, eventUiBases, this.props.dateProfile.activeRange, this.context.options.nextDayThreshold).fg, dayRanges);
|
|
};
|
|
ListView.prototype.eventRangesToSegs = function (eventRanges, dayRanges) {
|
|
var segs = [];
|
|
for (var _i = 0, eventRanges_1 = eventRanges; _i < eventRanges_1.length; _i++) {
|
|
var eventRange = eventRanges_1[_i];
|
|
segs.push.apply(segs, this.eventRangeToSegs(eventRange, dayRanges));
|
|
}
|
|
return segs;
|
|
};
|
|
ListView.prototype.eventRangeToSegs = function (eventRange, dayRanges) {
|
|
var dateEnv = this.context.dateEnv;
|
|
var nextDayThreshold = this.context.options.nextDayThreshold;
|
|
var range = eventRange.range;
|
|
var allDay = eventRange.def.allDay;
|
|
var dayIndex;
|
|
var segRange;
|
|
var seg;
|
|
var segs = [];
|
|
for (dayIndex = 0; dayIndex < dayRanges.length; dayIndex += 1) {
|
|
segRange = intersectRanges(range, dayRanges[dayIndex]);
|
|
if (segRange) {
|
|
seg = {
|
|
component: this,
|
|
eventRange: eventRange,
|
|
start: segRange.start,
|
|
end: segRange.end,
|
|
isStart: eventRange.isStart && segRange.start.valueOf() === range.start.valueOf(),
|
|
isEnd: eventRange.isEnd && segRange.end.valueOf() === range.end.valueOf(),
|
|
dayIndex: dayIndex,
|
|
};
|
|
segs.push(seg);
|
|
// detect when range won't go fully into the next day,
|
|
// and mutate the latest seg to the be the end.
|
|
if (!seg.isEnd && !allDay &&
|
|
dayIndex + 1 < dayRanges.length &&
|
|
range.end <
|
|
dateEnv.add(dayRanges[dayIndex + 1].start, nextDayThreshold)) {
|
|
seg.end = range.end;
|
|
seg.isEnd = true;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
return segs;
|
|
};
|
|
return ListView;
|
|
}(DateComponent));
|
|
function renderNoEventsInner(hookProps) {
|
|
return hookProps.text;
|
|
}
|
|
function computeDateVars(dateProfile) {
|
|
var dayStart = startOfDay(dateProfile.renderRange.start);
|
|
var viewEnd = dateProfile.renderRange.end;
|
|
var dayDates = [];
|
|
var dayRanges = [];
|
|
while (dayStart < viewEnd) {
|
|
dayDates.push(dayStart);
|
|
dayRanges.push({
|
|
start: dayStart,
|
|
end: addDays(dayStart, 1),
|
|
});
|
|
dayStart = addDays(dayStart, 1);
|
|
}
|
|
return { dayDates: dayDates, dayRanges: dayRanges };
|
|
}
|
|
// Returns a sparse array of arrays, segs grouped by their dayIndex
|
|
function groupSegsByDay(segs) {
|
|
var segsByDay = []; // sparse array
|
|
var i;
|
|
var seg;
|
|
for (i = 0; i < segs.length; i += 1) {
|
|
seg = segs[i];
|
|
(segsByDay[seg.dayIndex] || (segsByDay[seg.dayIndex] = []))
|
|
.push(seg);
|
|
}
|
|
return segsByDay;
|
|
}
|
|
|
|
var OPTION_REFINERS$3 = {
|
|
listDayFormat: createFalsableFormatter,
|
|
listDaySideFormat: createFalsableFormatter,
|
|
noEventsClassNames: identity,
|
|
noEventsContent: identity,
|
|
noEventsDidMount: identity,
|
|
noEventsWillUnmount: identity,
|
|
// noEventsText is defined in base options
|
|
};
|
|
function createFalsableFormatter(input) {
|
|
return input === false ? null : createFormatter(input);
|
|
}
|
|
|
|
var listPlugin = createPlugin({
|
|
optionRefiners: OPTION_REFINERS$3,
|
|
views: {
|
|
list: {
|
|
component: ListView,
|
|
buttonTextKey: 'list',
|
|
listDayFormat: { month: 'long', day: 'numeric', year: 'numeric' }, // like "January 1, 2016"
|
|
},
|
|
listDay: {
|
|
type: 'list',
|
|
duration: { days: 1 },
|
|
listDayFormat: { weekday: 'long' }, // day-of-week is all we need. full date is probably in headerToolbar
|
|
},
|
|
listWeek: {
|
|
type: 'list',
|
|
duration: { weeks: 1 },
|
|
listDayFormat: { weekday: 'long' },
|
|
listDaySideFormat: { month: 'long', day: 'numeric', year: 'numeric' },
|
|
},
|
|
listMonth: {
|
|
type: 'list',
|
|
duration: { month: 1 },
|
|
listDaySideFormat: { weekday: 'long' }, // day-of-week is nice-to-have
|
|
},
|
|
listYear: {
|
|
type: 'list',
|
|
duration: { year: 1 },
|
|
listDaySideFormat: { weekday: 'long' }, // day-of-week is nice-to-have
|
|
},
|
|
},
|
|
});
|
|
|
|
var BootstrapTheme$1 = /** @class */ (function (_super) {
|
|
__extends(BootstrapTheme, _super);
|
|
function BootstrapTheme() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
return BootstrapTheme;
|
|
}(Theme));
|
|
BootstrapTheme$1.prototype.classes = {
|
|
root: 'fc-theme-bootstrap',
|
|
table: 'table-bordered',
|
|
tableCellShaded: 'table-active',
|
|
buttonGroup: 'btn-group',
|
|
button: 'btn btn-primary',
|
|
buttonActive: 'active',
|
|
popover: 'popover',
|
|
popoverHeader: 'popover-header',
|
|
popoverContent: 'popover-body',
|
|
};
|
|
BootstrapTheme$1.prototype.baseIconClass = 'fa';
|
|
BootstrapTheme$1.prototype.iconClasses = {
|
|
close: 'fa-times',
|
|
prev: 'fa-chevron-left',
|
|
next: 'fa-chevron-right',
|
|
prevYear: 'fa-angle-double-left',
|
|
nextYear: 'fa-angle-double-right',
|
|
};
|
|
BootstrapTheme$1.prototype.rtlIconClasses = {
|
|
prev: 'fa-chevron-right',
|
|
next: 'fa-chevron-left',
|
|
prevYear: 'fa-angle-double-right',
|
|
nextYear: 'fa-angle-double-left',
|
|
};
|
|
BootstrapTheme$1.prototype.iconOverrideOption = 'bootstrapFontAwesome'; // TODO: make TS-friendly. move the option-processing into this plugin
|
|
BootstrapTheme$1.prototype.iconOverrideCustomButtonOption = 'bootstrapFontAwesome';
|
|
BootstrapTheme$1.prototype.iconOverridePrefix = 'fa-';
|
|
var plugin$1 = createPlugin({
|
|
themeClasses: {
|
|
bootstrap: BootstrapTheme$1,
|
|
},
|
|
});
|
|
|
|
var BootstrapTheme = /** @class */ (function (_super) {
|
|
__extends(BootstrapTheme, _super);
|
|
function BootstrapTheme() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
return BootstrapTheme;
|
|
}(Theme));
|
|
BootstrapTheme.prototype.classes = {
|
|
root: 'fc-theme-bootstrap5',
|
|
tableCellShaded: 'fc-theme-bootstrap5-shaded',
|
|
buttonGroup: 'btn-group',
|
|
button: 'btn btn-primary',
|
|
buttonActive: 'active',
|
|
popover: 'popover',
|
|
popoverHeader: 'popover-header',
|
|
popoverContent: 'popover-body',
|
|
};
|
|
BootstrapTheme.prototype.baseIconClass = 'bi';
|
|
BootstrapTheme.prototype.iconClasses = {
|
|
close: 'bi-x-lg',
|
|
prev: 'bi-chevron-left',
|
|
next: 'bi-chevron-right',
|
|
prevYear: 'bi-chevron-double-left',
|
|
nextYear: 'bi-chevron-double-right',
|
|
};
|
|
BootstrapTheme.prototype.rtlIconClasses = {
|
|
prev: 'bi-chevron-right',
|
|
next: 'bi-chevron-left',
|
|
prevYear: 'bi-chevron-double-right',
|
|
nextYear: 'bi-chevron-double-left',
|
|
};
|
|
// wtf
|
|
BootstrapTheme.prototype.iconOverrideOption = 'buttonIcons'; // TODO: make TS-friendly
|
|
BootstrapTheme.prototype.iconOverrideCustomButtonOption = 'icon';
|
|
BootstrapTheme.prototype.iconOverridePrefix = 'bi-';
|
|
var plugin = createPlugin({
|
|
themeClasses: {
|
|
bootstrap5: BootstrapTheme,
|
|
},
|
|
});
|
|
|
|
// rename this file to options.ts like other packages?
|
|
var OPTION_REFINERS$2 = {
|
|
googleCalendarApiKey: String,
|
|
};
|
|
|
|
var EVENT_SOURCE_REFINERS = {
|
|
googleCalendarApiKey: String,
|
|
googleCalendarId: String,
|
|
googleCalendarApiBase: String,
|
|
extraParams: identity,
|
|
};
|
|
|
|
// TODO: expose somehow
|
|
var API_BASE = 'https://www.googleapis.com/calendar/v3/calendars';
|
|
var eventSourceDef = {
|
|
parseMeta: function (refined) {
|
|
var googleCalendarId = refined.googleCalendarId;
|
|
if (!googleCalendarId && refined.url) {
|
|
googleCalendarId = parseGoogleCalendarId(refined.url);
|
|
}
|
|
if (googleCalendarId) {
|
|
return {
|
|
googleCalendarId: googleCalendarId,
|
|
googleCalendarApiKey: refined.googleCalendarApiKey,
|
|
googleCalendarApiBase: refined.googleCalendarApiBase,
|
|
extraParams: refined.extraParams,
|
|
};
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, onSuccess, onFailure) {
|
|
var _a = arg.context, dateEnv = _a.dateEnv, options = _a.options;
|
|
var meta = arg.eventSource.meta;
|
|
var apiKey = meta.googleCalendarApiKey || options.googleCalendarApiKey;
|
|
if (!apiKey) {
|
|
onFailure({
|
|
message: 'Specify a googleCalendarApiKey. See http://fullcalendar.io/docs/google_calendar/',
|
|
});
|
|
}
|
|
else {
|
|
var url = buildUrl(meta);
|
|
// TODO: make DRY with json-feed-event-source
|
|
var extraParams = meta.extraParams;
|
|
var extraParamsObj = typeof extraParams === 'function' ? extraParams() : extraParams;
|
|
var requestParams_1 = buildRequestParams$1(arg.range, apiKey, extraParamsObj, dateEnv);
|
|
requestJson('GET', url, requestParams_1, function (body, xhr) {
|
|
if (body.error) {
|
|
onFailure({
|
|
message: 'Google Calendar API: ' + body.error.message,
|
|
errors: body.error.errors,
|
|
xhr: xhr,
|
|
});
|
|
}
|
|
else {
|
|
onSuccess({
|
|
rawEvents: gcalItemsToRawEventDefs(body.items, requestParams_1.timeZone),
|
|
xhr: xhr,
|
|
});
|
|
}
|
|
}, function (message, xhr) {
|
|
onFailure({ message: message, xhr: xhr });
|
|
});
|
|
}
|
|
},
|
|
};
|
|
function parseGoogleCalendarId(url) {
|
|
var match;
|
|
// detect if the ID was specified as a single string.
|
|
// will match calendars like "asdf1234@calendar.google.com" in addition to person email calendars.
|
|
if (/^[^/]+@([^/.]+\.)*(google|googlemail|gmail)\.com$/.test(url)) {
|
|
return url;
|
|
}
|
|
if ((match = /^https:\/\/www.googleapis.com\/calendar\/v3\/calendars\/([^/]*)/.exec(url)) ||
|
|
(match = /^https?:\/\/www.google.com\/calendar\/feeds\/([^/]*)/.exec(url))) {
|
|
return decodeURIComponent(match[1]);
|
|
}
|
|
return null;
|
|
}
|
|
function buildUrl(meta) {
|
|
var apiBase = meta.googleCalendarApiBase;
|
|
if (!apiBase) {
|
|
apiBase = API_BASE;
|
|
}
|
|
return apiBase + '/' + encodeURIComponent(meta.googleCalendarId) + '/events';
|
|
}
|
|
function buildRequestParams$1(range, apiKey, extraParams, dateEnv) {
|
|
var params;
|
|
var startStr;
|
|
var endStr;
|
|
if (dateEnv.canComputeOffset) {
|
|
// strings will naturally have offsets, which GCal needs
|
|
startStr = dateEnv.formatIso(range.start);
|
|
endStr = dateEnv.formatIso(range.end);
|
|
}
|
|
else {
|
|
// when timezone isn't known, we don't know what the UTC offset should be, so ask for +/- 1 day
|
|
// from the UTC day-start to guarantee we're getting all the events
|
|
// (start/end will be UTC-coerced dates, so toISOString is okay)
|
|
startStr = addDays(range.start, -1).toISOString();
|
|
endStr = addDays(range.end, 1).toISOString();
|
|
}
|
|
params = __assign(__assign({}, (extraParams || {})), { key: apiKey, timeMin: startStr, timeMax: endStr, singleEvents: true, maxResults: 9999 });
|
|
if (dateEnv.timeZone !== 'local') {
|
|
params.timeZone = dateEnv.timeZone;
|
|
}
|
|
return params;
|
|
}
|
|
function gcalItemsToRawEventDefs(items, gcalTimezone) {
|
|
return items.map(function (item) { return gcalItemToRawEventDef(item, gcalTimezone); });
|
|
}
|
|
function gcalItemToRawEventDef(item, gcalTimezone) {
|
|
var url = item.htmlLink || null;
|
|
// make the URLs for each event show times in the correct timezone
|
|
if (url && gcalTimezone) {
|
|
url = injectQsComponent(url, 'ctz=' + gcalTimezone);
|
|
}
|
|
return {
|
|
id: item.id,
|
|
title: item.summary,
|
|
start: item.start.dateTime || item.start.date,
|
|
end: item.end.dateTime || item.end.date,
|
|
url: url,
|
|
location: item.location,
|
|
description: item.description,
|
|
attachments: item.attachments || [],
|
|
extendedProps: (item.extendedProperties || {}).shared || {},
|
|
};
|
|
}
|
|
// Injects a string like "arg=value" into the querystring of a URL
|
|
// TODO: move to a general util file?
|
|
function injectQsComponent(url, component) {
|
|
// inject it after the querystring but before the fragment
|
|
return url.replace(/(\?.*?)?(#|$)/, function (whole, qs, hash) { return (qs ? qs + '&' : '?') + component + hash; });
|
|
}
|
|
var googleCalendarPlugin = createPlugin({
|
|
eventSourceDefs: [eventSourceDef],
|
|
optionRefiners: OPTION_REFINERS$2,
|
|
eventSourceRefiners: EVENT_SOURCE_REFINERS,
|
|
});
|
|
|
|
var RELEASE_DATE = '2023-05-08'; // for Scheduler
|
|
var UPGRADE_WINDOW = 365 + 7; // days. 1 week leeway, for tz shift reasons too
|
|
var INVALID_LICENSE_URL = 'http://fullcalendar.io/docs/schedulerLicenseKey#invalid';
|
|
var OUTDATED_LICENSE_URL = 'http://fullcalendar.io/docs/schedulerLicenseKey#outdated';
|
|
var PRESET_LICENSE_KEYS = [
|
|
'GPL-My-Project-Is-Open-Source',
|
|
'CC-Attribution-NonCommercial-NoDerivatives',
|
|
];
|
|
var CSS = {
|
|
position: 'absolute',
|
|
zIndex: 99999,
|
|
bottom: '1px',
|
|
left: '1px',
|
|
background: '#eee',
|
|
borderColor: '#ddd',
|
|
borderStyle: 'solid',
|
|
borderWidth: '1px 1px 0 0',
|
|
padding: '2px 4px',
|
|
fontSize: '12px',
|
|
borderTopRightRadius: '3px',
|
|
};
|
|
function buildLicenseWarning(context) {
|
|
var key = context.options.schedulerLicenseKey;
|
|
var currentUrl = typeof window !== 'undefined' ? window.location.href : '';
|
|
if (!isImmuneUrl(currentUrl)) {
|
|
var status_1 = processLicenseKey(key);
|
|
if (status_1 !== 'valid') {
|
|
return (createElement("div", { className: "fc-license-message", style: CSS }, (status_1 === 'outdated') ? (createElement(Fragment, null,
|
|
'Your license key is too old to work with this version. ',
|
|
createElement("a", { href: OUTDATED_LICENSE_URL }, "More Info"))) : (createElement(Fragment, null,
|
|
'Your license key is invalid. ',
|
|
createElement("a", { href: INVALID_LICENSE_URL }, "More Info")))));
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
/*
|
|
This decryption is not meant to be bulletproof. Just a way to remind about an upgrade.
|
|
*/
|
|
function processLicenseKey(key) {
|
|
if (PRESET_LICENSE_KEYS.indexOf(key) !== -1) {
|
|
return 'valid';
|
|
}
|
|
var parts = (key || '').match(/^(\d+)-fcs-(\d+)$/);
|
|
if (parts && (parts[1].length === 10)) {
|
|
var purchaseDate = new Date(parseInt(parts[2], 10) * 1000);
|
|
var releaseDate = new Date(config.mockSchedulerReleaseDate || RELEASE_DATE);
|
|
if (isValidDate$1(releaseDate)) { // token won't be replaced in dev mode
|
|
var minPurchaseDate = addDays(releaseDate, -UPGRADE_WINDOW);
|
|
if (minPurchaseDate < purchaseDate) {
|
|
return 'valid';
|
|
}
|
|
return 'outdated';
|
|
}
|
|
}
|
|
return 'invalid';
|
|
}
|
|
function isImmuneUrl(url) {
|
|
return /\w+:\/\/fullcalendar\.io\/|\/examples\/[\w-]+\.html$/.test(url);
|
|
}
|
|
|
|
var OPTION_REFINERS$1 = {
|
|
schedulerLicenseKey: String,
|
|
};
|
|
|
|
var premiumCommonPlugin = createPlugin({
|
|
optionRefiners: OPTION_REFINERS$1,
|
|
viewContainerAppends: [buildLicenseWarning],
|
|
});
|
|
|
|
var WHEEL_EVENT_NAMES = 'wheel mousewheel DomMouseScroll MozMousePixelScroll'.split(' ');
|
|
/*
|
|
ALSO, with the ability to disable touch
|
|
*/
|
|
var ScrollListener = /** @class */ (function () {
|
|
function ScrollListener(el) {
|
|
var _this = this;
|
|
this.el = el;
|
|
this.emitter = new Emitter();
|
|
this.isScrolling = false;
|
|
this.isTouching = false; // user currently has finger down?
|
|
this.isRecentlyWheeled = false;
|
|
this.isRecentlyScrolled = false;
|
|
this.wheelWaiter = new DelayedRunner(this._handleWheelWaited.bind(this));
|
|
this.scrollWaiter = new DelayedRunner(this._handleScrollWaited.bind(this));
|
|
// Handlers
|
|
// ----------------------------------------------------------------------------------------------
|
|
this.handleScroll = function () {
|
|
_this.startScroll();
|
|
_this.emitter.trigger('scroll', _this.isRecentlyWheeled, _this.isTouching);
|
|
_this.isRecentlyScrolled = true;
|
|
_this.scrollWaiter.request(500);
|
|
};
|
|
// will fire *before* the scroll event is fired (might not cause a scroll)
|
|
this.handleWheel = function () {
|
|
_this.isRecentlyWheeled = true;
|
|
_this.wheelWaiter.request(500);
|
|
};
|
|
// will fire *before* the scroll event is fired (might not cause a scroll)
|
|
this.handleTouchStart = function () {
|
|
_this.isTouching = true;
|
|
};
|
|
this.handleTouchEnd = function () {
|
|
_this.isTouching = false;
|
|
// if the user ended their touch, and the scroll area wasn't moving,
|
|
// we consider this to be the end of the scroll.
|
|
if (!_this.isRecentlyScrolled) {
|
|
_this.endScroll(); // won't fire if already ended
|
|
}
|
|
};
|
|
el.addEventListener('scroll', this.handleScroll);
|
|
el.addEventListener('touchstart', this.handleTouchStart, { passive: true });
|
|
el.addEventListener('touchend', this.handleTouchEnd);
|
|
for (var _i = 0, WHEEL_EVENT_NAMES_1 = WHEEL_EVENT_NAMES; _i < WHEEL_EVENT_NAMES_1.length; _i++) {
|
|
var eventName = WHEEL_EVENT_NAMES_1[_i];
|
|
el.addEventListener(eventName, this.handleWheel);
|
|
}
|
|
}
|
|
ScrollListener.prototype.destroy = function () {
|
|
var el = this.el;
|
|
el.removeEventListener('scroll', this.handleScroll);
|
|
el.removeEventListener('touchstart', this.handleTouchStart, { passive: true });
|
|
el.removeEventListener('touchend', this.handleTouchEnd);
|
|
for (var _i = 0, WHEEL_EVENT_NAMES_2 = WHEEL_EVENT_NAMES; _i < WHEEL_EVENT_NAMES_2.length; _i++) {
|
|
var eventName = WHEEL_EVENT_NAMES_2[_i];
|
|
el.removeEventListener(eventName, this.handleWheel);
|
|
}
|
|
};
|
|
// Start / Stop
|
|
// ----------------------------------------------------------------------------------------------
|
|
ScrollListener.prototype.startScroll = function () {
|
|
if (!this.isScrolling) {
|
|
this.isScrolling = true;
|
|
this.emitter.trigger('scrollStart', this.isRecentlyWheeled, this.isTouching);
|
|
}
|
|
};
|
|
ScrollListener.prototype.endScroll = function () {
|
|
if (this.isScrolling) {
|
|
this.emitter.trigger('scrollEnd');
|
|
this.isScrolling = false;
|
|
this.isRecentlyScrolled = true;
|
|
this.isRecentlyWheeled = false;
|
|
this.scrollWaiter.clear();
|
|
this.wheelWaiter.clear();
|
|
}
|
|
};
|
|
ScrollListener.prototype._handleScrollWaited = function () {
|
|
this.isRecentlyScrolled = false;
|
|
// only end the scroll if not currently touching.
|
|
// if touching, the scrolling will end later, on touchend.
|
|
if (!this.isTouching) {
|
|
this.endScroll(); // won't fire if already ended
|
|
}
|
|
};
|
|
ScrollListener.prototype._handleWheelWaited = function () {
|
|
this.isRecentlyWheeled = false;
|
|
};
|
|
return ScrollListener;
|
|
}());
|
|
|
|
// TODO: assume the el has no borders?
|
|
function getScrollCanvasOrigin(scrollEl) {
|
|
var rect = scrollEl.getBoundingClientRect();
|
|
var edges = computeEdges(scrollEl); // TODO: pass in isRtl?
|
|
return {
|
|
left: rect.left + edges.borderLeft + edges.scrollbarLeft - getScrollFromLeftEdge(scrollEl),
|
|
top: rect.top + edges.borderTop - scrollEl.scrollTop,
|
|
};
|
|
}
|
|
function getScrollFromLeftEdge(el) {
|
|
var scrollLeft = el.scrollLeft;
|
|
var computedStyles = window.getComputedStyle(el); // TODO: pass in isRtl instead?
|
|
if (computedStyles.direction === 'rtl') {
|
|
switch (getRtlScrollSystem()) {
|
|
case 'negative':
|
|
scrollLeft *= -1; // convert to 'reverse'. fall through...
|
|
case 'reverse': // scrollLeft is distance between scrollframe's right edge scrollcanvas's right edge
|
|
scrollLeft = el.scrollWidth - scrollLeft - el.clientWidth;
|
|
}
|
|
}
|
|
return scrollLeft;
|
|
}
|
|
function setScrollFromLeftEdge(el, scrollLeft) {
|
|
var computedStyles = window.getComputedStyle(el); // TODO: pass in isRtl instead?
|
|
if (computedStyles.direction === 'rtl') {
|
|
switch (getRtlScrollSystem()) {
|
|
case 'reverse':
|
|
scrollLeft = el.scrollWidth - scrollLeft;
|
|
break;
|
|
case 'negative':
|
|
scrollLeft = -(el.scrollWidth - scrollLeft);
|
|
break;
|
|
}
|
|
}
|
|
el.scrollLeft = scrollLeft;
|
|
}
|
|
// Horizontal Scroll System Detection
|
|
// ----------------------------------------------------------------------------------------------
|
|
var _rtlScrollSystem;
|
|
function getRtlScrollSystem() {
|
|
return _rtlScrollSystem || (_rtlScrollSystem = detectRtlScrollSystem());
|
|
}
|
|
function detectRtlScrollSystem() {
|
|
var el = document.createElement('div');
|
|
el.style.position = 'absolute';
|
|
el.style.top = '-1000px';
|
|
el.style.width = '1px';
|
|
el.style.height = '1px';
|
|
el.style.overflow = 'scroll';
|
|
el.style.direction = 'rtl';
|
|
el.style.fontSize = '100px';
|
|
el.innerHTML = 'A';
|
|
document.body.appendChild(el);
|
|
var system;
|
|
if (el.scrollLeft > 0) {
|
|
system = 'positive'; // scroll is a positive number from the left edge
|
|
}
|
|
else {
|
|
el.scrollLeft = 1;
|
|
if (el.scrollLeft > 0) {
|
|
system = 'reverse'; // scroll is a positive number from the right edge
|
|
}
|
|
else {
|
|
system = 'negative'; // scroll is a negative number from the right edge
|
|
}
|
|
}
|
|
removeElement(el);
|
|
return system;
|
|
}
|
|
|
|
var IS_MS_EDGE = typeof navigator !== 'undefined' && /Edge/.test(navigator.userAgent); // TODO: what about Chromeum-based Edge?
|
|
var STICKY_SELECTOR = '.fc-sticky';
|
|
/*
|
|
useful beyond the native position:sticky for these reasons:
|
|
- support in IE11
|
|
- nice centering support
|
|
|
|
REQUIREMENT: fc-sticky elements, if the fc-sticky className is taken away, should NOT have relative or absolute positioning.
|
|
This is because we attach the coords with JS, and the VDOM might take away the fc-sticky class but doesn't know kill the positioning.
|
|
|
|
TODO: don't query text-align:center. isn't compatible with flexbox centering. instead, check natural X coord within parent container
|
|
*/
|
|
var StickyScrolling = /** @class */ (function () {
|
|
function StickyScrolling(scrollEl, isRtl) {
|
|
var _this = this;
|
|
this.scrollEl = scrollEl;
|
|
this.isRtl = isRtl;
|
|
this.usingRelative = null;
|
|
this.updateSize = function () {
|
|
var scrollEl = _this.scrollEl;
|
|
var els = findElements(scrollEl, STICKY_SELECTOR);
|
|
var elGeoms = _this.queryElGeoms(els);
|
|
var viewportWidth = scrollEl.clientWidth;
|
|
var viewportHeight = scrollEl.clientHeight;
|
|
if (_this.usingRelative) {
|
|
var elDestinations = _this.computeElDestinations(elGeoms, viewportWidth); // read before prepPositioning
|
|
assignRelativePositions(els, elGeoms, elDestinations, viewportWidth, viewportHeight);
|
|
}
|
|
else {
|
|
assignStickyPositions(els, elGeoms, viewportWidth);
|
|
}
|
|
};
|
|
this.usingRelative =
|
|
!getStickySupported() || // IE11
|
|
// https://stackoverflow.com/questions/56835658/in-microsoft-edge-sticky-positioning-doesnt-work-when-combined-with-dir-rtl
|
|
(IS_MS_EDGE && isRtl);
|
|
if (this.usingRelative) {
|
|
this.listener = new ScrollListener(scrollEl);
|
|
this.listener.emitter.on('scrollEnd', this.updateSize);
|
|
}
|
|
}
|
|
StickyScrolling.prototype.destroy = function () {
|
|
if (this.listener) {
|
|
this.listener.destroy();
|
|
}
|
|
};
|
|
StickyScrolling.prototype.queryElGeoms = function (els) {
|
|
var _a = this, scrollEl = _a.scrollEl, isRtl = _a.isRtl;
|
|
var canvasOrigin = getScrollCanvasOrigin(scrollEl);
|
|
var elGeoms = [];
|
|
for (var _i = 0, els_1 = els; _i < els_1.length; _i++) {
|
|
var el = els_1[_i];
|
|
var parentBound = translateRect(computeInnerRect(el.parentNode, true, true), // weird way to call this!!!
|
|
-canvasOrigin.left, -canvasOrigin.top);
|
|
var elRect = el.getBoundingClientRect();
|
|
var computedStyles = window.getComputedStyle(el);
|
|
var textAlign = window.getComputedStyle(el.parentNode).textAlign; // ask the parent
|
|
var naturalBound = null;
|
|
if (textAlign === 'start') {
|
|
textAlign = isRtl ? 'right' : 'left';
|
|
}
|
|
else if (textAlign === 'end') {
|
|
textAlign = isRtl ? 'left' : 'right';
|
|
}
|
|
if (computedStyles.position !== 'sticky') {
|
|
naturalBound = translateRect(elRect, -canvasOrigin.left - (parseFloat(computedStyles.left) || 0), // could be 'auto'
|
|
-canvasOrigin.top - (parseFloat(computedStyles.top) || 0));
|
|
}
|
|
elGeoms.push({
|
|
parentBound: parentBound,
|
|
naturalBound: naturalBound,
|
|
elWidth: elRect.width,
|
|
elHeight: elRect.height,
|
|
textAlign: textAlign,
|
|
});
|
|
}
|
|
return elGeoms;
|
|
};
|
|
// only for IE
|
|
StickyScrolling.prototype.computeElDestinations = function (elGeoms, viewportWidth) {
|
|
var scrollEl = this.scrollEl;
|
|
var viewportTop = scrollEl.scrollTop;
|
|
var viewportLeft = getScrollFromLeftEdge(scrollEl);
|
|
var viewportRight = viewportLeft + viewportWidth;
|
|
return elGeoms.map(function (elGeom) {
|
|
var elWidth = elGeom.elWidth, elHeight = elGeom.elHeight, parentBound = elGeom.parentBound, naturalBound = elGeom.naturalBound;
|
|
var destLeft; // relative to canvas topleft
|
|
var destTop; // "
|
|
switch (elGeom.textAlign) {
|
|
case 'left':
|
|
destLeft = viewportLeft;
|
|
break;
|
|
case 'right':
|
|
destLeft = viewportRight - elWidth;
|
|
break;
|
|
case 'center':
|
|
destLeft = (viewportLeft + viewportRight) / 2 - elWidth / 2; /// noooo, use half-width insteadddddddd
|
|
break;
|
|
}
|
|
destLeft = Math.min(destLeft, parentBound.right - elWidth);
|
|
destLeft = Math.max(destLeft, parentBound.left);
|
|
destTop = viewportTop;
|
|
destTop = Math.min(destTop, parentBound.bottom - elHeight);
|
|
destTop = Math.max(destTop, naturalBound.top); // better to use natural top for upper bound
|
|
return { left: destLeft, top: destTop };
|
|
});
|
|
};
|
|
return StickyScrolling;
|
|
}());
|
|
function assignRelativePositions(els, elGeoms, elDestinations, viewportWidth, viewportHeight) {
|
|
els.forEach(function (el, i) {
|
|
var _a = elGeoms[i], naturalBound = _a.naturalBound, parentBound = _a.parentBound;
|
|
var parentWidth = parentBound.right - parentBound.left;
|
|
var parentHeight = parentBound.bottom - parentBound.bottom;
|
|
var left;
|
|
var top;
|
|
if (parentWidth > viewportWidth ||
|
|
parentHeight > viewportHeight) {
|
|
left = elDestinations[i].left - naturalBound.left;
|
|
top = elDestinations[i].top - naturalBound.top;
|
|
}
|
|
else { // if parent container can be completely in view, we don't need stickiness
|
|
left = '';
|
|
top = '';
|
|
}
|
|
applyStyle(el, {
|
|
position: 'relative',
|
|
left: left,
|
|
right: -left,
|
|
top: top,
|
|
});
|
|
});
|
|
}
|
|
function assignStickyPositions(els, elGeoms, viewportWidth) {
|
|
els.forEach(function (el, i) {
|
|
var _a = elGeoms[i], textAlign = _a.textAlign, elWidth = _a.elWidth, parentBound = _a.parentBound;
|
|
var parentWidth = parentBound.right - parentBound.left;
|
|
var left;
|
|
if (textAlign === 'center' &&
|
|
parentWidth > viewportWidth) {
|
|
left = (viewportWidth - elWidth) / 2;
|
|
}
|
|
else { // if parent container can be completely in view, we don't need stickiness
|
|
left = '';
|
|
}
|
|
applyStyle(el, {
|
|
left: left,
|
|
right: left,
|
|
top: 0,
|
|
});
|
|
});
|
|
}
|
|
var _isStickySupported;
|
|
function getStickySupported() {
|
|
if (_isStickySupported == null) {
|
|
_isStickySupported = computeStickySupported();
|
|
}
|
|
return _isStickySupported;
|
|
}
|
|
function computeStickySupported() {
|
|
var el = document.createElement('div');
|
|
el.style.position = 'sticky';
|
|
document.body.appendChild(el);
|
|
var val = window.getComputedStyle(el).position;
|
|
removeElement(el);
|
|
return val === 'sticky';
|
|
}
|
|
|
|
var ClippedScroller = /** @class */ (function (_super) {
|
|
__extends(ClippedScroller, _super);
|
|
function ClippedScroller() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.elRef = createRef();
|
|
_this.state = {
|
|
xScrollbarWidth: 0,
|
|
yScrollbarWidth: 0,
|
|
};
|
|
_this.handleScroller = function (scroller) {
|
|
_this.scroller = scroller;
|
|
setRef(_this.props.scrollerRef, scroller);
|
|
};
|
|
_this.handleSizing = function () {
|
|
var props = _this.props;
|
|
if (props.overflowY === 'scroll-hidden') {
|
|
_this.setState({ yScrollbarWidth: _this.scroller.getYScrollbarWidth() });
|
|
}
|
|
if (props.overflowX === 'scroll-hidden') {
|
|
_this.setState({ xScrollbarWidth: _this.scroller.getXScrollbarWidth() });
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
ClippedScroller.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var isScrollbarOnLeft = context.isRtl && getIsRtlScrollbarOnLeft();
|
|
var overcomeLeft = 0;
|
|
var overcomeRight = 0;
|
|
var overcomeBottom = 0;
|
|
if (props.overflowX === 'scroll-hidden') {
|
|
overcomeBottom = state.xScrollbarWidth;
|
|
}
|
|
if (props.overflowY === 'scroll-hidden') {
|
|
if (state.yScrollbarWidth != null) {
|
|
if (isScrollbarOnLeft) {
|
|
overcomeLeft = state.yScrollbarWidth;
|
|
}
|
|
else {
|
|
overcomeRight = state.yScrollbarWidth;
|
|
}
|
|
}
|
|
}
|
|
return (createElement("div", { ref: this.elRef, className: 'fc-scroller-harness' + (props.liquid ? ' fc-scroller-harness-liquid' : '') },
|
|
createElement(Scroller, { ref: this.handleScroller, elRef: this.props.scrollerElRef, overflowX: props.overflowX === 'scroll-hidden' ? 'scroll' : props.overflowX, overflowY: props.overflowY === 'scroll-hidden' ? 'scroll' : props.overflowY, overcomeLeft: overcomeLeft, overcomeRight: overcomeRight, overcomeBottom: overcomeBottom, maxHeight: typeof props.maxHeight === 'number'
|
|
? (props.maxHeight + (props.overflowX === 'scroll-hidden' ? state.xScrollbarWidth : 0))
|
|
: '', liquid: props.liquid, liquidIsAbsolute: true }, props.children)));
|
|
};
|
|
ClippedScroller.prototype.componentDidMount = function () {
|
|
this.handleSizing();
|
|
this.context.addResizeHandler(this.handleSizing);
|
|
};
|
|
ClippedScroller.prototype.componentDidUpdate = function (prevProps) {
|
|
if (!isPropsEqual(prevProps, this.props)) { // an external change?
|
|
this.handleSizing();
|
|
}
|
|
};
|
|
ClippedScroller.prototype.componentWillUnmount = function () {
|
|
this.context.removeResizeHandler(this.handleSizing);
|
|
};
|
|
ClippedScroller.prototype.needsXScrolling = function () {
|
|
return this.scroller.needsXScrolling();
|
|
};
|
|
ClippedScroller.prototype.needsYScrolling = function () {
|
|
return this.scroller.needsYScrolling();
|
|
};
|
|
return ClippedScroller;
|
|
}(BaseComponent));
|
|
|
|
var ScrollSyncer = /** @class */ (function () {
|
|
function ScrollSyncer(isVertical, scrollEls) {
|
|
var _this = this;
|
|
this.isVertical = isVertical;
|
|
this.scrollEls = scrollEls;
|
|
this.isPaused = false;
|
|
this.scrollListeners = scrollEls.map(function (el) { return _this.bindScroller(el); });
|
|
}
|
|
ScrollSyncer.prototype.destroy = function () {
|
|
for (var _i = 0, _a = this.scrollListeners; _i < _a.length; _i++) {
|
|
var scrollListener = _a[_i];
|
|
scrollListener.destroy();
|
|
}
|
|
};
|
|
ScrollSyncer.prototype.bindScroller = function (el) {
|
|
var _this = this;
|
|
var _a = this, scrollEls = _a.scrollEls, isVertical = _a.isVertical;
|
|
var scrollListener = new ScrollListener(el);
|
|
var onScroll = function (isWheel, isTouch) {
|
|
if (!_this.isPaused) {
|
|
if (!_this.masterEl || (_this.masterEl !== el && (isWheel || isTouch))) {
|
|
_this.assignMaster(el);
|
|
}
|
|
if (_this.masterEl === el) { // dealing with current
|
|
for (var _i = 0, scrollEls_1 = scrollEls; _i < scrollEls_1.length; _i++) {
|
|
var otherEl = scrollEls_1[_i];
|
|
if (otherEl !== el) {
|
|
if (isVertical) {
|
|
otherEl.scrollTop = el.scrollTop;
|
|
}
|
|
else {
|
|
otherEl.scrollLeft = el.scrollLeft;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
}
|
|
};
|
|
var onScrollEnd = function () {
|
|
if (_this.masterEl === el) {
|
|
_this.masterEl = null;
|
|
}
|
|
};
|
|
scrollListener.emitter.on('scroll', onScroll);
|
|
scrollListener.emitter.on('scrollEnd', onScrollEnd);
|
|
return scrollListener;
|
|
};
|
|
ScrollSyncer.prototype.assignMaster = function (el) {
|
|
this.masterEl = el;
|
|
for (var _i = 0, _a = this.scrollListeners; _i < _a.length; _i++) {
|
|
var scrollListener = _a[_i];
|
|
if (scrollListener.el !== el) {
|
|
scrollListener.endScroll(); // to prevent residual scrolls from reclaiming master
|
|
}
|
|
}
|
|
};
|
|
/*
|
|
will normalize the scrollLeft value
|
|
*/
|
|
ScrollSyncer.prototype.forceScrollLeft = function (scrollLeft) {
|
|
this.isPaused = true;
|
|
for (var _i = 0, _a = this.scrollListeners; _i < _a.length; _i++) {
|
|
var listener = _a[_i];
|
|
setScrollFromLeftEdge(listener.el, scrollLeft);
|
|
}
|
|
this.isPaused = false;
|
|
};
|
|
ScrollSyncer.prototype.forceScrollTop = function (top) {
|
|
this.isPaused = true;
|
|
for (var _i = 0, _a = this.scrollListeners; _i < _a.length; _i++) {
|
|
var listener = _a[_i];
|
|
listener.el.scrollTop = top;
|
|
}
|
|
this.isPaused = false;
|
|
};
|
|
return ScrollSyncer;
|
|
}());
|
|
|
|
/*
|
|
TODO: make <ScrollGridSection> subcomponent
|
|
NOTE: doesn't support collapsibleWidth (which is sortof a hack anyway)
|
|
*/
|
|
var ScrollGrid = /** @class */ (function (_super) {
|
|
__extends(ScrollGrid, _super);
|
|
function ScrollGrid() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.compileColGroupStats = memoizeArraylike(compileColGroupStat, isColGroupStatsEqual);
|
|
_this.renderMicroColGroups = memoizeArraylike(renderMicroColGroup); // yucky to memoize VNodes, but much more efficient for consumers
|
|
_this.clippedScrollerRefs = new RefMap();
|
|
// doesn't hold non-scrolling els used just for padding
|
|
_this.scrollerElRefs = new RefMap(_this._handleScrollerEl.bind(_this));
|
|
_this.chunkElRefs = new RefMap(_this._handleChunkEl.bind(_this));
|
|
_this.stickyScrollings = [];
|
|
_this.scrollSyncersBySection = {};
|
|
_this.scrollSyncersByColumn = {};
|
|
// for row-height-syncing
|
|
_this.rowUnstableMap = new Map(); // no need to groom. always self-cancels
|
|
_this.rowInnerMaxHeightMap = new Map();
|
|
_this.anyRowHeightsChanged = false;
|
|
_this.recentSizingCnt = 0;
|
|
_this.state = {
|
|
shrinkWidths: [],
|
|
forceYScrollbars: false,
|
|
forceXScrollbars: false,
|
|
scrollerClientWidths: {},
|
|
scrollerClientHeights: {},
|
|
sectionRowMaxHeights: [],
|
|
};
|
|
_this.handleSizing = function (isForcedResize, sectionRowMaxHeightsChanged) {
|
|
if (!_this.allowSizing()) {
|
|
return;
|
|
}
|
|
if (!sectionRowMaxHeightsChanged) { // something else changed, probably external
|
|
_this.anyRowHeightsChanged = true;
|
|
}
|
|
var otherState = {};
|
|
// if reacting to self-change of sectionRowMaxHeightsChanged, or not stable, don't do anything
|
|
if (isForcedResize || (!sectionRowMaxHeightsChanged && !_this.rowUnstableMap.size)) {
|
|
otherState.sectionRowMaxHeights = _this.computeSectionRowMaxHeights();
|
|
}
|
|
_this.setState(__assign(__assign({ shrinkWidths: _this.computeShrinkWidths() }, _this.computeScrollerDims()), otherState), function () {
|
|
if (!_this.rowUnstableMap.size) {
|
|
_this.updateStickyScrolling(); // needs to happen AFTER final positioning committed to DOM
|
|
}
|
|
});
|
|
};
|
|
_this.handleRowHeightChange = function (rowEl, isStable) {
|
|
var _a = _this, rowUnstableMap = _a.rowUnstableMap, rowInnerMaxHeightMap = _a.rowInnerMaxHeightMap;
|
|
if (!isStable) {
|
|
rowUnstableMap.set(rowEl, true);
|
|
}
|
|
else {
|
|
rowUnstableMap.delete(rowEl);
|
|
var innerMaxHeight = getRowInnerMaxHeight(rowEl);
|
|
if (!rowInnerMaxHeightMap.has(rowEl) || rowInnerMaxHeightMap.get(rowEl) !== innerMaxHeight) {
|
|
rowInnerMaxHeightMap.set(rowEl, innerMaxHeight);
|
|
_this.anyRowHeightsChanged = true;
|
|
}
|
|
if (!rowUnstableMap.size && _this.anyRowHeightsChanged) {
|
|
_this.anyRowHeightsChanged = false;
|
|
_this.setState({
|
|
sectionRowMaxHeights: _this.computeSectionRowMaxHeights(),
|
|
});
|
|
}
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
ScrollGrid.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var shrinkWidths = state.shrinkWidths;
|
|
var colGroupStats = this.compileColGroupStats(props.colGroups.map(function (colGroup) { return [colGroup]; }));
|
|
var microColGroupNodes = this.renderMicroColGroups(colGroupStats.map(function (stat, i) { return [stat.cols, shrinkWidths[i]]; }));
|
|
var classNames = getScrollGridClassNames(props.liquid, context);
|
|
var _b = this.getDims(); _b[0]; _b[1];
|
|
// TODO: make DRY
|
|
var sectionConfigs = props.sections;
|
|
var configCnt = sectionConfigs.length;
|
|
var configI = 0;
|
|
var currentConfig;
|
|
var headSectionNodes = [];
|
|
var bodySectionNodes = [];
|
|
var footSectionNodes = [];
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'header') {
|
|
headSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, true));
|
|
configI += 1;
|
|
}
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'body') {
|
|
bodySectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, false));
|
|
configI += 1;
|
|
}
|
|
while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'footer') {
|
|
footSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, true));
|
|
configI += 1;
|
|
}
|
|
var isBuggy = !getCanVGrowWithinCell(); // see NOTE in SimpleScrollGrid
|
|
var roleAttrs = { role: 'rowgroup' };
|
|
return createElement('table', {
|
|
ref: props.elRef,
|
|
role: 'grid',
|
|
className: classNames.join(' '),
|
|
}, renderMacroColGroup(colGroupStats, shrinkWidths), Boolean(!isBuggy && headSectionNodes.length) && createElement.apply(void 0, __spreadArray(['thead', roleAttrs], headSectionNodes)), Boolean(!isBuggy && bodySectionNodes.length) && createElement.apply(void 0, __spreadArray(['tbody', roleAttrs], bodySectionNodes)), Boolean(!isBuggy && footSectionNodes.length) && createElement.apply(void 0, __spreadArray(['tfoot', roleAttrs], footSectionNodes)), isBuggy && createElement.apply(void 0, __spreadArray(__spreadArray(__spreadArray(['tbody', roleAttrs], headSectionNodes), bodySectionNodes), footSectionNodes)));
|
|
};
|
|
ScrollGrid.prototype.renderSection = function (sectionConfig, sectionIndex, colGroupStats, microColGroupNodes, sectionRowMaxHeights, isHeader) {
|
|
var _this = this;
|
|
if ('outerContent' in sectionConfig) {
|
|
return (createElement(Fragment, { key: sectionConfig.key }, sectionConfig.outerContent));
|
|
}
|
|
return (createElement("tr", { key: sectionConfig.key, role: "presentation", className: getSectionClassNames(sectionConfig, this.props.liquid).join(' ') }, sectionConfig.chunks.map(function (chunkConfig, i) { return _this.renderChunk(sectionConfig, sectionIndex, colGroupStats[i], microColGroupNodes[i], chunkConfig, i, (sectionRowMaxHeights[sectionIndex] || [])[i] || [], isHeader); })));
|
|
};
|
|
ScrollGrid.prototype.renderChunk = function (sectionConfig, sectionIndex, colGroupStat, microColGroupNode, chunkConfig, chunkIndex, rowHeights, isHeader) {
|
|
if ('outerContent' in chunkConfig) {
|
|
return (createElement(Fragment, { key: chunkConfig.key }, chunkConfig.outerContent));
|
|
}
|
|
var state = this.state;
|
|
var scrollerClientWidths = state.scrollerClientWidths, scrollerClientHeights = state.scrollerClientHeights;
|
|
var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
|
|
var index = sectionIndex * chunksPerSection + chunkIndex;
|
|
var sideScrollIndex = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
|
|
var isVScrollSide = chunkIndex === sideScrollIndex;
|
|
var isLastSection = sectionIndex === sectionCnt - 1;
|
|
var forceXScrollbars = isLastSection && state.forceXScrollbars; // NOOOO can result in `null`
|
|
var forceYScrollbars = isVScrollSide && state.forceYScrollbars; // NOOOO can result in `null`
|
|
var allowXScrolling = colGroupStat && colGroupStat.allowXScrolling; // rename?
|
|
var allowYScrolling = getAllowYScrolling(this.props, sectionConfig); // rename? do in section func?
|
|
var chunkVGrow = getSectionHasLiquidHeight(this.props, sectionConfig); // do in section func?
|
|
var expandRows = sectionConfig.expandRows && chunkVGrow;
|
|
var tableMinWidth = (colGroupStat && colGroupStat.totalColMinWidth) || '';
|
|
var content = renderChunkContent(sectionConfig, chunkConfig, {
|
|
tableColGroupNode: microColGroupNode,
|
|
tableMinWidth: tableMinWidth,
|
|
clientWidth: scrollerClientWidths[index] !== undefined ? scrollerClientWidths[index] : null,
|
|
clientHeight: scrollerClientHeights[index] !== undefined ? scrollerClientHeights[index] : null,
|
|
expandRows: expandRows,
|
|
syncRowHeights: Boolean(sectionConfig.syncRowHeights),
|
|
rowSyncHeights: rowHeights,
|
|
reportRowHeightChange: this.handleRowHeightChange,
|
|
}, isHeader);
|
|
var overflowX = forceXScrollbars ? (isLastSection ? 'scroll' : 'scroll-hidden') :
|
|
!allowXScrolling ? 'hidden' :
|
|
(isLastSection ? 'auto' : 'scroll-hidden');
|
|
var overflowY = forceYScrollbars ? (isVScrollSide ? 'scroll' : 'scroll-hidden') :
|
|
!allowYScrolling ? 'hidden' :
|
|
(isVScrollSide ? 'auto' : 'scroll-hidden');
|
|
// it *could* be possible to reduce DOM wrappers by only doing a ClippedScroller when allowXScrolling or allowYScrolling,
|
|
// but if these values were to change, the inner components would be unmounted/remounted because of the parent change.
|
|
content = (createElement(ClippedScroller, { ref: this.clippedScrollerRefs.createRef(index), scrollerElRef: this.scrollerElRefs.createRef(index), overflowX: overflowX, overflowY: overflowY, liquid: chunkVGrow, maxHeight: sectionConfig.maxHeight }, content));
|
|
return createElement(isHeader ? 'th' : 'td', {
|
|
key: chunkConfig.key,
|
|
ref: this.chunkElRefs.createRef(index),
|
|
role: 'presentation',
|
|
}, content);
|
|
};
|
|
ScrollGrid.prototype.componentDidMount = function () {
|
|
this.getStickyScrolling = memoizeArraylike(initStickyScrolling, null, destroyStickyScrolling);
|
|
this.getScrollSyncersBySection = memoizeHashlike(initScrollSyncer.bind(this, true), null, destroyScrollSyncer);
|
|
this.getScrollSyncersByColumn = memoizeHashlike(initScrollSyncer.bind(this, false), null, destroyScrollSyncer);
|
|
this.updateScrollSyncers();
|
|
this.handleSizing(false);
|
|
this.context.addResizeHandler(this.handleSizing);
|
|
};
|
|
ScrollGrid.prototype.componentDidUpdate = function (prevProps, prevState) {
|
|
this.updateScrollSyncers();
|
|
// TODO: need better solution when state contains non-sizing things
|
|
this.handleSizing(false, prevState.sectionRowMaxHeights !== this.state.sectionRowMaxHeights);
|
|
};
|
|
ScrollGrid.prototype.componentWillUnmount = function () {
|
|
this.context.removeResizeHandler(this.handleSizing);
|
|
this.destroyStickyScrolling();
|
|
this.destroyScrollSyncers();
|
|
};
|
|
ScrollGrid.prototype.allowSizing = function () {
|
|
var now = new Date();
|
|
if (!this.lastSizingDate ||
|
|
now.valueOf() > this.lastSizingDate.valueOf() + config.SCROLLGRID_RESIZE_INTERVAL) {
|
|
this.lastSizingDate = now;
|
|
this.recentSizingCnt = 0;
|
|
return true;
|
|
}
|
|
return (this.recentSizingCnt += 1) <= 10;
|
|
};
|
|
ScrollGrid.prototype.computeShrinkWidths = function () {
|
|
var _this = this;
|
|
var colGroupStats = this.compileColGroupStats(this.props.colGroups.map(function (colGroup) { return [colGroup]; }));
|
|
var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
|
|
var cnt = sectionCnt * chunksPerSection;
|
|
var shrinkWidths = [];
|
|
colGroupStats.forEach(function (colGroupStat, i) {
|
|
if (colGroupStat.hasShrinkCol) {
|
|
var chunkEls = _this.chunkElRefs.collect(i, cnt, chunksPerSection); // in one col
|
|
shrinkWidths[i] = computeShrinkWidth(chunkEls);
|
|
}
|
|
});
|
|
return shrinkWidths;
|
|
};
|
|
// has the side effect of grooming rowInnerMaxHeightMap
|
|
// TODO: somehow short-circuit if there are no new height changes
|
|
ScrollGrid.prototype.computeSectionRowMaxHeights = function () {
|
|
var newHeightMap = new Map();
|
|
var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
|
|
var sectionRowMaxHeights = [];
|
|
for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
|
|
var sectionConfig = this.props.sections[sectionI];
|
|
var assignableHeights = []; // chunk, row
|
|
if (sectionConfig && sectionConfig.syncRowHeights) {
|
|
var rowHeightsByChunk = [];
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
var index = sectionI * chunksPerSection + chunkI;
|
|
var rowHeights = [];
|
|
var chunkEl = this.chunkElRefs.currentMap[index];
|
|
if (chunkEl) {
|
|
rowHeights = findElements(chunkEl, '.fc-scrollgrid-sync-table tr').map(function (rowEl) {
|
|
var max = getRowInnerMaxHeight(rowEl);
|
|
newHeightMap.set(rowEl, max);
|
|
return max;
|
|
});
|
|
}
|
|
else {
|
|
rowHeights = [];
|
|
}
|
|
rowHeightsByChunk.push(rowHeights);
|
|
}
|
|
var rowCnt = rowHeightsByChunk[0].length;
|
|
var isEqualRowCnt = true;
|
|
for (var chunkI = 1; chunkI < chunksPerSection; chunkI += 1) {
|
|
var isOuterContent = sectionConfig.chunks[chunkI] && sectionConfig.chunks[chunkI].outerContent !== undefined; // can be null
|
|
if (!isOuterContent && rowHeightsByChunk[chunkI].length !== rowCnt) { // skip outer content
|
|
isEqualRowCnt = false;
|
|
break;
|
|
}
|
|
}
|
|
if (!isEqualRowCnt) {
|
|
var chunkHeightSums = [];
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
chunkHeightSums.push(sumNumbers(rowHeightsByChunk[chunkI]) + rowHeightsByChunk[chunkI].length);
|
|
}
|
|
var maxTotalSum = Math.max.apply(Math, chunkHeightSums);
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
var rowInChunkCnt = rowHeightsByChunk[chunkI].length;
|
|
var rowInChunkTotalHeight = maxTotalSum - rowInChunkCnt; // subtract border
|
|
// height of non-first row. we do this to avoid rounding, because it's unreliable within a table
|
|
var rowInChunkHeightOthers = Math.floor(rowInChunkTotalHeight / rowInChunkCnt);
|
|
// whatever is leftover goes to the first row
|
|
var rowInChunkHeightFirst = rowInChunkTotalHeight - rowInChunkHeightOthers * (rowInChunkCnt - 1);
|
|
var rowInChunkHeights = [];
|
|
var row = 0;
|
|
if (row < rowInChunkCnt) {
|
|
rowInChunkHeights.push(rowInChunkHeightFirst);
|
|
row += 1;
|
|
}
|
|
while (row < rowInChunkCnt) {
|
|
rowInChunkHeights.push(rowInChunkHeightOthers);
|
|
row += 1;
|
|
}
|
|
assignableHeights.push(rowInChunkHeights);
|
|
}
|
|
}
|
|
else {
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
assignableHeights.push([]);
|
|
}
|
|
for (var row = 0; row < rowCnt; row += 1) {
|
|
var rowHeightsAcrossChunks = [];
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
var h = rowHeightsByChunk[chunkI][row];
|
|
if (h != null) { // protect against outerContent
|
|
rowHeightsAcrossChunks.push(h);
|
|
}
|
|
}
|
|
var maxHeight = Math.max.apply(Math, rowHeightsAcrossChunks);
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
assignableHeights[chunkI].push(maxHeight);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
sectionRowMaxHeights.push(assignableHeights);
|
|
}
|
|
this.rowInnerMaxHeightMap = newHeightMap;
|
|
return sectionRowMaxHeights;
|
|
};
|
|
ScrollGrid.prototype.computeScrollerDims = function () {
|
|
var scrollbarWidth = getScrollbarWidths();
|
|
var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
|
|
var sideScrollI = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
|
|
var lastSectionI = sectionCnt - 1;
|
|
var currentScrollers = this.clippedScrollerRefs.currentMap;
|
|
var scrollerEls = this.scrollerElRefs.currentMap;
|
|
var forceYScrollbars = false;
|
|
var forceXScrollbars = false;
|
|
var scrollerClientWidths = {};
|
|
var scrollerClientHeights = {};
|
|
for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) { // along edge
|
|
var index = sectionI * chunksPerSection + sideScrollI;
|
|
var scroller = currentScrollers[index];
|
|
if (scroller && scroller.needsYScrolling()) {
|
|
forceYScrollbars = true;
|
|
break;
|
|
}
|
|
}
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) { // along last row
|
|
var index = lastSectionI * chunksPerSection + chunkI;
|
|
var scroller = currentScrollers[index];
|
|
if (scroller && scroller.needsXScrolling()) {
|
|
forceXScrollbars = true;
|
|
break;
|
|
}
|
|
}
|
|
for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
|
|
for (var chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
|
|
var index = sectionI * chunksPerSection + chunkI;
|
|
var scrollerEl = scrollerEls[index];
|
|
if (scrollerEl) {
|
|
// TODO: weird way to get this. need harness b/c doesn't include table borders
|
|
var harnessEl = scrollerEl.parentNode;
|
|
scrollerClientWidths[index] = Math.floor(harnessEl.getBoundingClientRect().width - ((chunkI === sideScrollI && forceYScrollbars)
|
|
? scrollbarWidth.y // use global because scroller might not have scrollbars yet but will need them in future
|
|
: 0));
|
|
scrollerClientHeights[index] = Math.floor(harnessEl.getBoundingClientRect().height - ((sectionI === lastSectionI && forceXScrollbars)
|
|
? scrollbarWidth.x // use global because scroller might not have scrollbars yet but will need them in future
|
|
: 0));
|
|
}
|
|
}
|
|
}
|
|
return { forceYScrollbars: forceYScrollbars, forceXScrollbars: forceXScrollbars, scrollerClientWidths: scrollerClientWidths, scrollerClientHeights: scrollerClientHeights };
|
|
};
|
|
ScrollGrid.prototype.updateStickyScrolling = function () {
|
|
var isRtl = this.context.isRtl;
|
|
var argsByKey = this.scrollerElRefs.getAll().map(function (scrollEl) { return [scrollEl, isRtl]; });
|
|
var stickyScrollings = this.getStickyScrolling(argsByKey);
|
|
stickyScrollings.forEach(function (stickyScrolling) { return stickyScrolling.updateSize(); });
|
|
this.stickyScrollings = stickyScrollings;
|
|
};
|
|
ScrollGrid.prototype.destroyStickyScrolling = function () {
|
|
this.stickyScrollings.forEach(destroyStickyScrolling);
|
|
};
|
|
ScrollGrid.prototype.updateScrollSyncers = function () {
|
|
var _a = this.getDims(), sectionCnt = _a[0], chunksPerSection = _a[1];
|
|
var cnt = sectionCnt * chunksPerSection;
|
|
var scrollElsBySection = {};
|
|
var scrollElsByColumn = {};
|
|
var scrollElMap = this.scrollerElRefs.currentMap;
|
|
for (var sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
|
|
var startIndex = sectionI * chunksPerSection;
|
|
var endIndex = startIndex + chunksPerSection;
|
|
scrollElsBySection[sectionI] = collectFromHash(scrollElMap, startIndex, endIndex, 1); // use the filtered
|
|
}
|
|
for (var col = 0; col < chunksPerSection; col += 1) {
|
|
scrollElsByColumn[col] = this.scrollerElRefs.collect(col, cnt, chunksPerSection); // DON'T use the filtered
|
|
}
|
|
this.scrollSyncersBySection = this.getScrollSyncersBySection(scrollElsBySection);
|
|
this.scrollSyncersByColumn = this.getScrollSyncersByColumn(scrollElsByColumn);
|
|
};
|
|
ScrollGrid.prototype.destroyScrollSyncers = function () {
|
|
mapHash(this.scrollSyncersBySection, destroyScrollSyncer);
|
|
mapHash(this.scrollSyncersByColumn, destroyScrollSyncer);
|
|
};
|
|
ScrollGrid.prototype.getChunkConfigByIndex = function (index) {
|
|
var chunksPerSection = this.getDims()[1];
|
|
var sectionI = Math.floor(index / chunksPerSection);
|
|
var chunkI = index % chunksPerSection;
|
|
var sectionConfig = this.props.sections[sectionI];
|
|
return sectionConfig && sectionConfig.chunks[chunkI];
|
|
};
|
|
ScrollGrid.prototype.forceScrollLeft = function (col, scrollLeft) {
|
|
var scrollSyncer = this.scrollSyncersByColumn[col];
|
|
if (scrollSyncer) {
|
|
scrollSyncer.forceScrollLeft(scrollLeft);
|
|
}
|
|
};
|
|
ScrollGrid.prototype.forceScrollTop = function (sectionI, scrollTop) {
|
|
var scrollSyncer = this.scrollSyncersBySection[sectionI];
|
|
if (scrollSyncer) {
|
|
scrollSyncer.forceScrollTop(scrollTop);
|
|
}
|
|
};
|
|
ScrollGrid.prototype._handleChunkEl = function (chunkEl, key) {
|
|
var chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
|
|
if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
|
|
setRef(chunkConfig.elRef, chunkEl);
|
|
}
|
|
};
|
|
ScrollGrid.prototype._handleScrollerEl = function (scrollerEl, key) {
|
|
var chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
|
|
if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
|
|
setRef(chunkConfig.scrollerElRef, scrollerEl);
|
|
}
|
|
};
|
|
ScrollGrid.prototype.getDims = function () {
|
|
var sectionCnt = this.props.sections.length;
|
|
var chunksPerSection = sectionCnt ? this.props.sections[0].chunks.length : 0;
|
|
return [sectionCnt, chunksPerSection];
|
|
};
|
|
return ScrollGrid;
|
|
}(BaseComponent));
|
|
ScrollGrid.addStateEquality({
|
|
shrinkWidths: isArraysEqual,
|
|
scrollerClientWidths: isPropsEqual,
|
|
scrollerClientHeights: isPropsEqual,
|
|
});
|
|
function sumNumbers(numbers) {
|
|
var sum = 0;
|
|
for (var _i = 0, numbers_1 = numbers; _i < numbers_1.length; _i++) {
|
|
var n = numbers_1[_i];
|
|
sum += n;
|
|
}
|
|
return sum;
|
|
}
|
|
function getRowInnerMaxHeight(rowEl) {
|
|
var innerHeights = findElements(rowEl, '.fc-scrollgrid-sync-inner').map(getElHeight);
|
|
if (innerHeights.length) {
|
|
return Math.max.apply(Math, innerHeights);
|
|
}
|
|
return 0;
|
|
}
|
|
function getElHeight(el) {
|
|
return el.offsetHeight; // better to deal with integers, for rounding, for PureComponent
|
|
}
|
|
function renderMacroColGroup(colGroupStats, shrinkWidths) {
|
|
var children = colGroupStats.map(function (colGroupStat, i) {
|
|
var width = colGroupStat.width;
|
|
if (width === 'shrink') {
|
|
width = colGroupStat.totalColWidth + sanitizeShrinkWidth(shrinkWidths[i]) + 1; // +1 for border :(
|
|
}
|
|
return ( // eslint-disable-next-line react/jsx-key
|
|
createElement("col", { style: { width: width } }));
|
|
});
|
|
return createElement.apply(void 0, __spreadArray(['colgroup', {}], children));
|
|
}
|
|
function compileColGroupStat(colGroupConfig) {
|
|
var totalColWidth = sumColProp(colGroupConfig.cols, 'width'); // excludes "shrink"
|
|
var totalColMinWidth = sumColProp(colGroupConfig.cols, 'minWidth');
|
|
var hasShrinkCol = hasShrinkWidth(colGroupConfig.cols);
|
|
var allowXScrolling = colGroupConfig.width !== 'shrink' && Boolean(totalColWidth || totalColMinWidth || hasShrinkCol);
|
|
return {
|
|
hasShrinkCol: hasShrinkCol,
|
|
totalColWidth: totalColWidth,
|
|
totalColMinWidth: totalColMinWidth,
|
|
allowXScrolling: allowXScrolling,
|
|
cols: colGroupConfig.cols,
|
|
width: colGroupConfig.width,
|
|
};
|
|
}
|
|
function sumColProp(cols, propName) {
|
|
var total = 0;
|
|
for (var _i = 0, cols_1 = cols; _i < cols_1.length; _i++) {
|
|
var col = cols_1[_i];
|
|
var val = col[propName];
|
|
if (typeof val === 'number') {
|
|
total += val * (col.span || 1);
|
|
}
|
|
}
|
|
return total;
|
|
}
|
|
var COL_GROUP_STAT_EQUALITY = {
|
|
cols: isColPropsEqual,
|
|
};
|
|
function isColGroupStatsEqual(stat0, stat1) {
|
|
return compareObjs(stat0, stat1, COL_GROUP_STAT_EQUALITY);
|
|
}
|
|
// for memoizers...
|
|
function initScrollSyncer(isVertical) {
|
|
var scrollEls = [];
|
|
for (var _i = 1; _i < arguments.length; _i++) {
|
|
scrollEls[_i - 1] = arguments[_i];
|
|
}
|
|
return new ScrollSyncer(isVertical, scrollEls);
|
|
}
|
|
function destroyScrollSyncer(scrollSyncer) {
|
|
scrollSyncer.destroy();
|
|
}
|
|
function initStickyScrolling(scrollEl, isRtl) {
|
|
return new StickyScrolling(scrollEl, isRtl);
|
|
}
|
|
function destroyStickyScrolling(stickyScrolling) {
|
|
stickyScrolling.destroy();
|
|
}
|
|
|
|
var scrollGridPlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
],
|
|
scrollGridImpl: ScrollGrid,
|
|
});
|
|
config.SCROLLGRID_RESIZE_INTERVAL = 500;
|
|
|
|
config.COLLAPSIBLE_WIDTH_THRESHOLD = 1200;
|
|
var contexts = [];
|
|
var undoFuncs = [];
|
|
var adaptivePlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
],
|
|
contextInit: function (context) {
|
|
if (!contexts.length) {
|
|
attachGlobalHandlers();
|
|
}
|
|
contexts.push(context);
|
|
context.calendarApi.on('_unmount', function () {
|
|
removeExact(contexts, context);
|
|
if (!contexts.length) {
|
|
removeGlobalHandlers();
|
|
}
|
|
});
|
|
},
|
|
});
|
|
function attachGlobalHandlers() {
|
|
window.addEventListener('beforeprint', handleBeforePrint);
|
|
window.addEventListener('afterprint', handleAfterPrint);
|
|
// // for testing
|
|
// let forPrint = false
|
|
// document.addEventListener('keypress', (ev) => {
|
|
// if (ev.key === 'p') {
|
|
// forPrint = !forPrint
|
|
// if (forPrint) {
|
|
// handleBeforePrint()
|
|
// } else {
|
|
// handleAfterPrint()
|
|
// }
|
|
// }
|
|
// })
|
|
}
|
|
function removeGlobalHandlers() {
|
|
window.removeEventListener('beforeprint', handleBeforePrint);
|
|
window.removeEventListener('afterprint', handleAfterPrint);
|
|
}
|
|
function handleBeforePrint() {
|
|
var scrollEls = queryScrollerEls();
|
|
var scrollCoords = queryScrollerCoords(scrollEls);
|
|
for (var _i = 0, contexts_1 = contexts; _i < contexts_1.length; _i++) {
|
|
var context = contexts_1[_i];
|
|
context.emitter.trigger('_beforeprint');
|
|
}
|
|
flushSync(function () {
|
|
killHorizontalScrolling(scrollEls, scrollCoords);
|
|
undoFuncs.push(function () { return restoreScrollerCoords(scrollEls, scrollCoords); });
|
|
undoFuncs.push(freezeScrollgridWidths());
|
|
});
|
|
}
|
|
function handleAfterPrint() {
|
|
for (var _i = 0, contexts_2 = contexts; _i < contexts_2.length; _i++) {
|
|
var context = contexts_2[_i];
|
|
context.emitter.trigger('_afterprint');
|
|
}
|
|
flushSync(function () {
|
|
while (undoFuncs.length) {
|
|
undoFuncs.shift()();
|
|
}
|
|
});
|
|
}
|
|
// scrollgrid widths
|
|
function freezeScrollgridWidths() {
|
|
var els = findElements(document.body, '.fc-scrollgrid');
|
|
els.forEach(freezeScrollGridWidth);
|
|
return function () { return els.forEach(unfreezeScrollGridWidth); };
|
|
}
|
|
function freezeScrollGridWidth(el) {
|
|
var elWidth = el.getBoundingClientRect().width;
|
|
// along with collapsibleWidth, this is a hack for #5707
|
|
if (!el.classList.contains('fc-scrollgrid-collapsible') || elWidth < config.COLLAPSIBLE_WIDTH_THRESHOLD) {
|
|
el.style.width = elWidth + 'px';
|
|
}
|
|
}
|
|
function unfreezeScrollGridWidth(el) {
|
|
el.style.width = '';
|
|
}
|
|
// scrollers
|
|
// TODO: use scroll normalization!? yes
|
|
function queryScrollerEls() {
|
|
return findElements(document.body, '.fc-scroller-harness > .fc-scroller');
|
|
}
|
|
function queryScrollerCoords(els) {
|
|
return els.map(function (el) {
|
|
var computedStyle = window.getComputedStyle(el);
|
|
return {
|
|
scrollLeft: el.scrollLeft,
|
|
scrollTop: el.scrollTop,
|
|
overflowX: computedStyle.overflowX,
|
|
overflowY: computedStyle.overflowY,
|
|
marginBottom: computedStyle.marginBottom,
|
|
};
|
|
});
|
|
}
|
|
function killHorizontalScrolling(els, coords) {
|
|
els.forEach(function (el, i) {
|
|
el.style.overflowX = 'visible'; // need to clear X/Y to get true overflow
|
|
el.style.overflowY = 'visible'; // "
|
|
el.style.marginBottom = ''; // for clipping away scrollbar. disable
|
|
el.style.left = -coords[i].scrollLeft + 'px'; // simulate scrollLeft! will be position:relative
|
|
});
|
|
}
|
|
function restoreScrollerCoords(els, coords) {
|
|
els.forEach(function (el, i) {
|
|
var c = coords[i];
|
|
el.style.overflowX = c.overflowX;
|
|
el.style.overflowY = c.overflowY;
|
|
el.style.marginBottom = c.marginBottom;
|
|
el.style.left = '';
|
|
el.scrollLeft = c.scrollLeft;
|
|
el.scrollTop = c.scrollTop;
|
|
});
|
|
}
|
|
|
|
var MIN_AUTO_LABELS = 18; // more than `12` months but less that `24` hours
|
|
var MAX_AUTO_SLOTS_PER_LABEL = 6; // allows 6 10-min slots in an hour
|
|
var MAX_AUTO_CELLS = 200; // allows 4-days to have a :30 slot duration
|
|
config.MAX_TIMELINE_SLOTS = 1000;
|
|
// potential nice values for slot-duration and interval-duration
|
|
var STOCK_SUB_DURATIONS = [
|
|
{ years: 1 },
|
|
{ months: 1 },
|
|
{ days: 1 },
|
|
{ hours: 1 },
|
|
{ minutes: 30 },
|
|
{ minutes: 15 },
|
|
{ minutes: 10 },
|
|
{ minutes: 5 },
|
|
{ minutes: 1 },
|
|
{ seconds: 30 },
|
|
{ seconds: 15 },
|
|
{ seconds: 10 },
|
|
{ seconds: 5 },
|
|
{ seconds: 1 },
|
|
{ milliseconds: 500 },
|
|
{ milliseconds: 100 },
|
|
{ milliseconds: 10 },
|
|
{ milliseconds: 1 },
|
|
];
|
|
function buildTimelineDateProfile(dateProfile, dateEnv, allOptions, dateProfileGenerator) {
|
|
var tDateProfile = {
|
|
labelInterval: allOptions.slotLabelInterval,
|
|
slotDuration: allOptions.slotDuration,
|
|
};
|
|
validateLabelAndSlot(tDateProfile, dateProfile, dateEnv); // validate after computed grid duration
|
|
ensureLabelInterval(tDateProfile, dateProfile, dateEnv);
|
|
ensureSlotDuration(tDateProfile, dateProfile, dateEnv);
|
|
var input = allOptions.slotLabelFormat;
|
|
var rawFormats = Array.isArray(input) ? input :
|
|
(input != null) ? [input] :
|
|
computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions);
|
|
tDateProfile.headerFormats = rawFormats.map(function (rawFormat) { return createFormatter(rawFormat); });
|
|
tDateProfile.isTimeScale = Boolean(tDateProfile.slotDuration.milliseconds);
|
|
var largeUnit = null;
|
|
if (!tDateProfile.isTimeScale) {
|
|
var slotUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
|
|
if (/year|month|week/.test(slotUnit)) {
|
|
largeUnit = slotUnit;
|
|
}
|
|
}
|
|
tDateProfile.largeUnit = largeUnit;
|
|
tDateProfile.emphasizeWeeks =
|
|
asCleanDays(tDateProfile.slotDuration) === 1 &&
|
|
currentRangeAs('weeks', dateProfile, dateEnv) >= 2 &&
|
|
!allOptions.businessHours;
|
|
/*
|
|
console.log('label interval =', timelineView.labelInterval.humanize())
|
|
console.log('slot duration =', timelineView.slotDuration.humanize())
|
|
console.log('header formats =', timelineView.headerFormats)
|
|
console.log('isTimeScale', timelineView.isTimeScale)
|
|
console.log('largeUnit', timelineView.largeUnit)
|
|
*/
|
|
var rawSnapDuration = allOptions.snapDuration;
|
|
var snapDuration;
|
|
var snapsPerSlot;
|
|
if (rawSnapDuration) {
|
|
snapDuration = createDuration(rawSnapDuration);
|
|
snapsPerSlot = wholeDivideDurations(tDateProfile.slotDuration, snapDuration);
|
|
// ^ TODO: warning if not whole?
|
|
}
|
|
if (snapsPerSlot == null) {
|
|
snapDuration = tDateProfile.slotDuration;
|
|
snapsPerSlot = 1;
|
|
}
|
|
tDateProfile.snapDuration = snapDuration;
|
|
tDateProfile.snapsPerSlot = snapsPerSlot;
|
|
// more...
|
|
var timeWindowMs = asRoughMs(dateProfile.slotMaxTime) - asRoughMs(dateProfile.slotMinTime);
|
|
// TODO: why not use normalizeRange!?
|
|
var normalizedStart = normalizeDate(dateProfile.renderRange.start, tDateProfile, dateEnv);
|
|
var normalizedEnd = normalizeDate(dateProfile.renderRange.end, tDateProfile, dateEnv);
|
|
// apply slotMinTime/slotMaxTime
|
|
// TODO: View should be responsible.
|
|
if (tDateProfile.isTimeScale) {
|
|
normalizedStart = dateEnv.add(normalizedStart, dateProfile.slotMinTime);
|
|
normalizedEnd = dateEnv.add(addDays(normalizedEnd, -1), dateProfile.slotMaxTime);
|
|
}
|
|
tDateProfile.timeWindowMs = timeWindowMs;
|
|
tDateProfile.normalizedRange = { start: normalizedStart, end: normalizedEnd };
|
|
var slotDates = [];
|
|
var date = normalizedStart;
|
|
while (date < normalizedEnd) {
|
|
if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
|
|
slotDates.push(date);
|
|
}
|
|
date = dateEnv.add(date, tDateProfile.slotDuration);
|
|
}
|
|
tDateProfile.slotDates = slotDates;
|
|
// more...
|
|
var snapIndex = -1;
|
|
var snapDiff = 0; // index of the diff :(
|
|
var snapDiffToIndex = [];
|
|
var snapIndexToDiff = [];
|
|
date = normalizedStart;
|
|
while (date < normalizedEnd) {
|
|
if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
|
|
snapIndex += 1;
|
|
snapDiffToIndex.push(snapIndex);
|
|
snapIndexToDiff.push(snapDiff);
|
|
}
|
|
else {
|
|
snapDiffToIndex.push(snapIndex + 0.5);
|
|
}
|
|
date = dateEnv.add(date, tDateProfile.snapDuration);
|
|
snapDiff += 1;
|
|
}
|
|
tDateProfile.snapDiffToIndex = snapDiffToIndex;
|
|
tDateProfile.snapIndexToDiff = snapIndexToDiff;
|
|
tDateProfile.snapCnt = snapIndex + 1; // is always one behind
|
|
tDateProfile.slotCnt = tDateProfile.snapCnt / tDateProfile.snapsPerSlot;
|
|
// more...
|
|
tDateProfile.isWeekStarts = buildIsWeekStarts(tDateProfile, dateEnv);
|
|
tDateProfile.cellRows = buildCellRows(tDateProfile, dateEnv);
|
|
tDateProfile.slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
|
|
return tDateProfile;
|
|
}
|
|
/*
|
|
snaps to appropriate unit
|
|
*/
|
|
function normalizeDate(date, tDateProfile, dateEnv) {
|
|
var normalDate = date;
|
|
if (!tDateProfile.isTimeScale) {
|
|
normalDate = startOfDay(normalDate);
|
|
if (tDateProfile.largeUnit) {
|
|
normalDate = dateEnv.startOf(normalDate, tDateProfile.largeUnit);
|
|
}
|
|
}
|
|
return normalDate;
|
|
}
|
|
/*
|
|
snaps to appropriate unit
|
|
*/
|
|
function normalizeRange(range, tDateProfile, dateEnv) {
|
|
if (!tDateProfile.isTimeScale) {
|
|
range = computeVisibleDayRange(range);
|
|
if (tDateProfile.largeUnit) {
|
|
var dayRange = range; // preserve original result
|
|
range = {
|
|
start: dateEnv.startOf(range.start, tDateProfile.largeUnit),
|
|
end: dateEnv.startOf(range.end, tDateProfile.largeUnit),
|
|
};
|
|
// if date is partially through the interval, or is in the same interval as the start,
|
|
// make the exclusive end be the *next* interval
|
|
if (range.end.valueOf() !== dayRange.end.valueOf() || range.end <= range.start) {
|
|
range = {
|
|
start: range.start,
|
|
end: dateEnv.add(range.end, tDateProfile.slotDuration),
|
|
};
|
|
}
|
|
}
|
|
}
|
|
return range;
|
|
}
|
|
function isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator) {
|
|
if (dateProfileGenerator.isHiddenDay(date)) {
|
|
return false;
|
|
}
|
|
if (tDateProfile.isTimeScale) {
|
|
// determine if the time is within slotMinTime/slotMaxTime, which may have wacky values
|
|
var day = startOfDay(date);
|
|
var timeMs = date.valueOf() - day.valueOf();
|
|
var ms = timeMs - asRoughMs(dateProfile.slotMinTime); // milliseconds since slotMinTime
|
|
ms = ((ms % 86400000) + 86400000) % 86400000; // make negative values wrap to 24hr clock
|
|
return ms < tDateProfile.timeWindowMs; // before the slotMaxTime?
|
|
}
|
|
return true;
|
|
}
|
|
function validateLabelAndSlot(tDateProfile, dateProfile, dateEnv) {
|
|
var currentRange = dateProfile.currentRange;
|
|
// make sure labelInterval doesn't exceed the max number of cells
|
|
if (tDateProfile.labelInterval) {
|
|
var labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.labelInterval);
|
|
if (labelCnt > config.MAX_TIMELINE_SLOTS) {
|
|
console.warn('slotLabelInterval results in too many cells');
|
|
tDateProfile.labelInterval = null;
|
|
}
|
|
}
|
|
// make sure slotDuration doesn't exceed the maximum number of cells
|
|
if (tDateProfile.slotDuration) {
|
|
var slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.slotDuration);
|
|
if (slotCnt > config.MAX_TIMELINE_SLOTS) {
|
|
console.warn('slotDuration results in too many cells');
|
|
tDateProfile.slotDuration = null;
|
|
}
|
|
}
|
|
// make sure labelInterval is a multiple of slotDuration
|
|
if (tDateProfile.labelInterval && tDateProfile.slotDuration) {
|
|
var slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
|
|
if (slotsPerLabel === null || slotsPerLabel < 1) {
|
|
console.warn('slotLabelInterval must be a multiple of slotDuration');
|
|
tDateProfile.slotDuration = null;
|
|
}
|
|
}
|
|
}
|
|
function ensureLabelInterval(tDateProfile, dateProfile, dateEnv) {
|
|
var currentRange = dateProfile.currentRange;
|
|
var labelInterval = tDateProfile.labelInterval;
|
|
if (!labelInterval) {
|
|
// compute based off the slot duration
|
|
// find the largest label interval with an acceptable slots-per-label
|
|
var input = void 0;
|
|
if (tDateProfile.slotDuration) {
|
|
for (var _i = 0, STOCK_SUB_DURATIONS_1 = STOCK_SUB_DURATIONS; _i < STOCK_SUB_DURATIONS_1.length; _i++) {
|
|
input = STOCK_SUB_DURATIONS_1[_i];
|
|
var tryLabelInterval = createDuration(input);
|
|
var slotsPerLabel = wholeDivideDurations(tryLabelInterval, tDateProfile.slotDuration);
|
|
if (slotsPerLabel !== null && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
|
|
labelInterval = tryLabelInterval;
|
|
break;
|
|
}
|
|
}
|
|
// use the slot duration as a last resort
|
|
if (!labelInterval) {
|
|
labelInterval = tDateProfile.slotDuration;
|
|
}
|
|
// compute based off the view's duration
|
|
// find the largest label interval that yields the minimum number of labels
|
|
}
|
|
else {
|
|
for (var _a = 0, STOCK_SUB_DURATIONS_2 = STOCK_SUB_DURATIONS; _a < STOCK_SUB_DURATIONS_2.length; _a++) {
|
|
input = STOCK_SUB_DURATIONS_2[_a];
|
|
labelInterval = createDuration(input);
|
|
var labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, labelInterval);
|
|
if (labelCnt >= MIN_AUTO_LABELS) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
tDateProfile.labelInterval = labelInterval;
|
|
}
|
|
return labelInterval;
|
|
}
|
|
function ensureSlotDuration(tDateProfile, dateProfile, dateEnv) {
|
|
var currentRange = dateProfile.currentRange;
|
|
var slotDuration = tDateProfile.slotDuration;
|
|
if (!slotDuration) {
|
|
var labelInterval = ensureLabelInterval(tDateProfile, dateProfile, dateEnv); // will compute if necessary
|
|
// compute based off the label interval
|
|
// find the largest slot duration that is different from labelInterval, but still acceptable
|
|
for (var _i = 0, STOCK_SUB_DURATIONS_3 = STOCK_SUB_DURATIONS; _i < STOCK_SUB_DURATIONS_3.length; _i++) {
|
|
var input = STOCK_SUB_DURATIONS_3[_i];
|
|
var trySlotDuration = createDuration(input);
|
|
var slotsPerLabel = wholeDivideDurations(labelInterval, trySlotDuration);
|
|
if (slotsPerLabel !== null && slotsPerLabel > 1 && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
|
|
slotDuration = trySlotDuration;
|
|
break;
|
|
}
|
|
}
|
|
// only allow the value if it won't exceed the view's # of slots limit
|
|
if (slotDuration) {
|
|
var slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, slotDuration);
|
|
if (slotCnt > MAX_AUTO_CELLS) {
|
|
slotDuration = null;
|
|
}
|
|
}
|
|
// use the label interval as a last resort
|
|
if (!slotDuration) {
|
|
slotDuration = labelInterval;
|
|
}
|
|
tDateProfile.slotDuration = slotDuration;
|
|
}
|
|
return slotDuration;
|
|
}
|
|
function computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions) {
|
|
var format1;
|
|
var format2;
|
|
var labelInterval = tDateProfile.labelInterval;
|
|
var unit = greatestDurationDenominator(labelInterval).unit;
|
|
var weekNumbersVisible = allOptions.weekNumbers;
|
|
var format0 = (format1 = (format2 = null));
|
|
// NOTE: weekNumber computation function wont work
|
|
if ((unit === 'week') && !weekNumbersVisible) {
|
|
unit = 'day';
|
|
}
|
|
switch (unit) {
|
|
case 'year':
|
|
format0 = { year: 'numeric' }; // '2015'
|
|
break;
|
|
case 'month':
|
|
if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
|
|
format0 = { year: 'numeric' }; // '2015'
|
|
}
|
|
format1 = { month: 'short' }; // 'Jan'
|
|
break;
|
|
case 'week':
|
|
if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
|
|
format0 = { year: 'numeric' }; // '2015'
|
|
}
|
|
format1 = { week: 'narrow' }; // 'Wk4'
|
|
break;
|
|
case 'day':
|
|
if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
|
|
format0 = { year: 'numeric', month: 'long' }; // 'January 2014'
|
|
}
|
|
else if (currentRangeAs('months', dateProfile, dateEnv) > 1) {
|
|
format0 = { month: 'long' }; // 'January'
|
|
}
|
|
if (weekNumbersVisible) {
|
|
format1 = { week: 'short' }; // 'Wk 4'
|
|
}
|
|
format2 = { weekday: 'narrow', day: 'numeric' }; // 'Su 9'
|
|
break;
|
|
case 'hour':
|
|
if (weekNumbersVisible) {
|
|
format0 = { week: 'short' }; // 'Wk 4'
|
|
}
|
|
if (currentRangeAs('days', dateProfile, dateEnv) > 1) {
|
|
format1 = { weekday: 'short', day: 'numeric', month: 'numeric', omitCommas: true }; // Sat 4/7
|
|
}
|
|
format2 = {
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
omitZeroMinute: true,
|
|
meridiem: 'short',
|
|
};
|
|
break;
|
|
case 'minute':
|
|
// sufficiently large number of different minute cells?
|
|
if ((asRoughMinutes(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
|
|
format0 = {
|
|
hour: 'numeric',
|
|
meridiem: 'short',
|
|
};
|
|
format1 = function (params) { return (':' + padStart(params.date.minute, 2) // ':30'
|
|
); };
|
|
}
|
|
else {
|
|
format0 = {
|
|
hour: 'numeric',
|
|
minute: 'numeric',
|
|
meridiem: 'short',
|
|
};
|
|
}
|
|
break;
|
|
case 'second':
|
|
// sufficiently large number of different second cells?
|
|
if ((asRoughSeconds(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
|
|
format0 = { hour: 'numeric', minute: '2-digit', meridiem: 'lowercase' }; // '8:30 PM'
|
|
format1 = function (params) { return (':' + padStart(params.date.second, 2) // ':30'
|
|
); };
|
|
}
|
|
else {
|
|
format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
|
|
}
|
|
break;
|
|
case 'millisecond':
|
|
format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
|
|
format1 = function (params) { return ('.' + padStart(params.millisecond, 3)); };
|
|
break;
|
|
}
|
|
return [].concat(format0 || [], format1 || [], format2 || []);
|
|
}
|
|
// Compute the number of the give units in the "current" range.
|
|
// Won't go more precise than days.
|
|
// Will return `0` if there's not a clean whole interval.
|
|
function currentRangeAs(unit, dateProfile, dateEnv) {
|
|
var range = dateProfile.currentRange;
|
|
var res = null;
|
|
if (unit === 'years') {
|
|
res = dateEnv.diffWholeYears(range.start, range.end);
|
|
}
|
|
else if (unit === 'months') {
|
|
res = dateEnv.diffWholeMonths(range.start, range.end);
|
|
}
|
|
else if (unit === 'weeks') {
|
|
res = dateEnv.diffWholeMonths(range.start, range.end);
|
|
}
|
|
else if (unit === 'days') {
|
|
res = diffWholeDays(range.start, range.end);
|
|
}
|
|
return res || 0;
|
|
}
|
|
function buildIsWeekStarts(tDateProfile, dateEnv) {
|
|
var slotDates = tDateProfile.slotDates, emphasizeWeeks = tDateProfile.emphasizeWeeks;
|
|
var prevWeekNumber = null;
|
|
var isWeekStarts = [];
|
|
for (var _i = 0, slotDates_1 = slotDates; _i < slotDates_1.length; _i++) {
|
|
var slotDate = slotDates_1[_i];
|
|
var weekNumber = dateEnv.computeWeekNumber(slotDate);
|
|
var isWeekStart = emphasizeWeeks && (prevWeekNumber !== null) && (prevWeekNumber !== weekNumber);
|
|
prevWeekNumber = weekNumber;
|
|
isWeekStarts.push(isWeekStart);
|
|
}
|
|
return isWeekStarts;
|
|
}
|
|
function buildCellRows(tDateProfile, dateEnv) {
|
|
var slotDates = tDateProfile.slotDates;
|
|
var formats = tDateProfile.headerFormats;
|
|
var cellRows = formats.map(function () { return []; }); // indexed by row,col
|
|
var slotAsDays = asCleanDays(tDateProfile.slotDuration);
|
|
var guessedSlotUnit = slotAsDays === 7 ? 'week' :
|
|
slotAsDays === 1 ? 'day' :
|
|
null;
|
|
// specifically for navclicks
|
|
var rowUnitsFromFormats = formats.map(function (format) { return (format.getLargestUnit ? format.getLargestUnit() : null); });
|
|
// builds cellRows and slotCells
|
|
for (var i = 0; i < slotDates.length; i += 1) {
|
|
var date = slotDates[i];
|
|
var isWeekStart = tDateProfile.isWeekStarts[i];
|
|
for (var row = 0; row < formats.length; row += 1) {
|
|
var format = formats[row];
|
|
var rowCells = cellRows[row];
|
|
var leadingCell = rowCells[rowCells.length - 1];
|
|
var isLastRow = row === formats.length - 1;
|
|
var isSuperRow = formats.length > 1 && !isLastRow; // more than one row and not the last
|
|
var newCell = null;
|
|
var rowUnit = rowUnitsFromFormats[row] || (isLastRow ? guessedSlotUnit : null);
|
|
if (isSuperRow) {
|
|
var text = dateEnv.format(date, format);
|
|
if (!leadingCell || (leadingCell.text !== text)) {
|
|
newCell = buildCellObject(date, text, rowUnit);
|
|
}
|
|
else {
|
|
leadingCell.colspan += 1;
|
|
}
|
|
}
|
|
else if (!leadingCell ||
|
|
isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.labelInterval))) {
|
|
var text = dateEnv.format(date, format);
|
|
newCell = buildCellObject(date, text, rowUnit);
|
|
}
|
|
else {
|
|
leadingCell.colspan += 1;
|
|
}
|
|
if (newCell) {
|
|
newCell.weekStart = isWeekStart;
|
|
rowCells.push(newCell);
|
|
}
|
|
}
|
|
}
|
|
return cellRows;
|
|
}
|
|
function buildCellObject(date, text, rowUnit) {
|
|
return { date: date, text: text, rowUnit: rowUnit, colspan: 1, isWeekStart: false };
|
|
}
|
|
|
|
var TimelineHeaderThInner = /** @class */ (function (_super) {
|
|
__extends(TimelineHeaderThInner, _super);
|
|
function TimelineHeaderThInner() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineHeaderThInner.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
return (createElement(ContentHook, { hookProps: props.hookProps, content: context.options.slotLabelContent, defaultContent: renderInnerContent$1 }, function (innerElRef, innerContent) { return (createElement("a", __assign({ ref: innerElRef, className: 'fc-timeline-slot-cushion fc-scrollgrid-sync-inner' + (props.isSticky ? ' fc-sticky' : '') }, props.navLinkAttrs), innerContent)); }));
|
|
};
|
|
return TimelineHeaderThInner;
|
|
}(BaseComponent));
|
|
function renderInnerContent$1(props) {
|
|
return props.text;
|
|
}
|
|
function refineHookProps$2(input) {
|
|
return {
|
|
level: input.level,
|
|
date: input.dateEnv.toDate(input.dateMarker),
|
|
view: input.viewApi,
|
|
text: input.text,
|
|
};
|
|
}
|
|
|
|
var TimelineHeaderTh = /** @class */ (function (_super) {
|
|
__extends(TimelineHeaderTh, _super);
|
|
function TimelineHeaderTh() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.refineHookProps = memoizeObjArg(refineHookProps$2);
|
|
_this.normalizeClassNames = buildClassNameNormalizer();
|
|
_this.buildCellNavLinkAttrs = memoize(buildCellNavLinkAttrs);
|
|
return _this;
|
|
}
|
|
TimelineHeaderTh.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var cell = props.cell, dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
|
|
// the cell.rowUnit is f'd
|
|
// giving 'month' for a 3-day view
|
|
// workaround: to infer day, do NOT time
|
|
var dateMeta = getDateMeta(cell.date, props.todayRange, props.nowDate, dateProfile);
|
|
var classNames = ['fc-timeline-slot', 'fc-timeline-slot-label'].concat(cell.rowUnit === 'time' // TODO: so slot classnames for week/month/bigger. see note above about rowUnit
|
|
? getSlotClassNames(dateMeta, context.theme)
|
|
: getDayClassNames(dateMeta, context.theme));
|
|
if (cell.isWeekStart) {
|
|
classNames.push('fc-timeline-slot-em');
|
|
}
|
|
var hookProps = this.refineHookProps({
|
|
level: props.rowLevel,
|
|
dateMarker: cell.date,
|
|
text: cell.text,
|
|
dateEnv: context.dateEnv,
|
|
viewApi: context.viewApi,
|
|
});
|
|
var customClassNames = this.normalizeClassNames(options.slotLabelClassNames, hookProps);
|
|
return (createElement(MountHook, { hookProps: hookProps, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, function (rootElRef) { return (createElement("th", { ref: rootElRef, className: classNames.concat(customClassNames).join(' '), "data-date": dateEnv.formatIso(cell.date, { omitTime: !tDateProfile.isTimeScale, omitTimeZoneOffset: true }), colSpan: cell.colspan },
|
|
createElement("div", { className: "fc-timeline-slot-frame", style: { height: props.rowInnerHeight } },
|
|
createElement(TimelineHeaderThInner, { hookProps: hookProps, isSticky: props.isSticky, navLinkAttrs: _this.buildCellNavLinkAttrs(context, cell.date, cell.rowUnit) })))); }));
|
|
};
|
|
return TimelineHeaderTh;
|
|
}(BaseComponent));
|
|
function buildCellNavLinkAttrs(context, cellDate, rowUnit) {
|
|
return (rowUnit && rowUnit !== 'time')
|
|
? buildNavLinkAttrs(context, cellDate, rowUnit)
|
|
: {};
|
|
}
|
|
|
|
var TimelineHeaderRows = /** @class */ (function (_super) {
|
|
__extends(TimelineHeaderRows, _super);
|
|
function TimelineHeaderRows() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineHeaderRows.prototype.render = function () {
|
|
var _a = this.props, dateProfile = _a.dateProfile, tDateProfile = _a.tDateProfile, rowInnerHeights = _a.rowInnerHeights, todayRange = _a.todayRange, nowDate = _a.nowDate;
|
|
var cellRows = tDateProfile.cellRows;
|
|
return (createElement(Fragment, null, cellRows.map(function (rowCells, rowLevel) {
|
|
var isLast = rowLevel === cellRows.length - 1;
|
|
var isChrono = tDateProfile.isTimeScale && isLast; // the final row, with times?
|
|
var classNames = [
|
|
'fc-timeline-header-row',
|
|
isChrono ? 'fc-timeline-header-row-chrono' : '',
|
|
];
|
|
return ( // eslint-disable-next-line react/no-array-index-key
|
|
createElement("tr", { key: rowLevel, className: classNames.join(' ') }, rowCells.map(function (cell) { return (createElement(TimelineHeaderTh, { key: cell.date.toISOString(), cell: cell, rowLevel: rowLevel, dateProfile: dateProfile, tDateProfile: tDateProfile, todayRange: todayRange, nowDate: nowDate, rowInnerHeight: rowInnerHeights && rowInnerHeights[rowLevel], isSticky: !isLast })); })));
|
|
})));
|
|
};
|
|
return TimelineHeaderRows;
|
|
}(BaseComponent));
|
|
|
|
var TimelineCoords = /** @class */ (function () {
|
|
function TimelineCoords(slatRootEl, // okay to expose?
|
|
slatEls, dateProfile, tDateProfile, dateEnv, isRtl) {
|
|
this.slatRootEl = slatRootEl;
|
|
this.dateProfile = dateProfile;
|
|
this.tDateProfile = tDateProfile;
|
|
this.dateEnv = dateEnv;
|
|
this.isRtl = isRtl;
|
|
this.outerCoordCache = new PositionCache(slatRootEl, slatEls, true, // isHorizontal
|
|
false);
|
|
// for the inner divs within the slats
|
|
// used for event rendering and scrollTime, to disregard slat border
|
|
this.innerCoordCache = new PositionCache(slatRootEl, findDirectChildren(slatEls, 'div'), true, // isHorizontal
|
|
false);
|
|
}
|
|
TimelineCoords.prototype.isDateInRange = function (date) {
|
|
return rangeContainsMarker(this.dateProfile.currentRange, date);
|
|
};
|
|
// results range from negative width of area to 0
|
|
TimelineCoords.prototype.dateToCoord = function (date) {
|
|
var tDateProfile = this.tDateProfile;
|
|
var snapCoverage = this.computeDateSnapCoverage(date);
|
|
var slotCoverage = snapCoverage / tDateProfile.snapsPerSlot;
|
|
var slotIndex = Math.floor(slotCoverage);
|
|
slotIndex = Math.min(slotIndex, tDateProfile.slotCnt - 1);
|
|
var partial = slotCoverage - slotIndex;
|
|
var _a = this, innerCoordCache = _a.innerCoordCache, outerCoordCache = _a.outerCoordCache;
|
|
if (this.isRtl) {
|
|
return outerCoordCache.originClientRect.width - (outerCoordCache.rights[slotIndex] -
|
|
(innerCoordCache.getWidth(slotIndex) * partial));
|
|
}
|
|
return (outerCoordCache.lefts[slotIndex] +
|
|
(innerCoordCache.getWidth(slotIndex) * partial));
|
|
};
|
|
TimelineCoords.prototype.rangeToCoords = function (range) {
|
|
return {
|
|
start: this.dateToCoord(range.start),
|
|
end: this.dateToCoord(range.end),
|
|
};
|
|
};
|
|
TimelineCoords.prototype.durationToCoord = function (duration) {
|
|
var _a = this, dateProfile = _a.dateProfile, tDateProfile = _a.tDateProfile, dateEnv = _a.dateEnv, isRtl = _a.isRtl;
|
|
var coord = 0;
|
|
if (dateProfile) {
|
|
var date = dateEnv.add(dateProfile.activeRange.start, duration);
|
|
if (!tDateProfile.isTimeScale) {
|
|
date = startOfDay(date);
|
|
}
|
|
coord = this.dateToCoord(date);
|
|
// hack to overcome the left borders of non-first slat
|
|
if (!isRtl && coord) {
|
|
coord += 1;
|
|
}
|
|
}
|
|
return coord;
|
|
};
|
|
TimelineCoords.prototype.coordFromLeft = function (coord) {
|
|
if (this.isRtl) {
|
|
return this.outerCoordCache.originClientRect.width - coord;
|
|
}
|
|
return coord;
|
|
};
|
|
// returned value is between 0 and the number of snaps
|
|
TimelineCoords.prototype.computeDateSnapCoverage = function (date) {
|
|
return computeDateSnapCoverage(date, this.tDateProfile, this.dateEnv);
|
|
};
|
|
return TimelineCoords;
|
|
}());
|
|
// returned value is between 0 and the number of snaps
|
|
function computeDateSnapCoverage(date, tDateProfile, dateEnv) {
|
|
var snapDiff = dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.snapDuration);
|
|
if (snapDiff < 0) {
|
|
return 0;
|
|
}
|
|
if (snapDiff >= tDateProfile.snapDiffToIndex.length) {
|
|
return tDateProfile.snapCnt;
|
|
}
|
|
var snapDiffInt = Math.floor(snapDiff);
|
|
var snapCoverage = tDateProfile.snapDiffToIndex[snapDiffInt];
|
|
if (isInt(snapCoverage)) { // not an in-between value
|
|
snapCoverage += snapDiff - snapDiffInt; // add the remainder
|
|
}
|
|
else {
|
|
// a fractional value, meaning the date is not visible
|
|
// always round up in this case. works for start AND end dates in a range.
|
|
snapCoverage = Math.ceil(snapCoverage);
|
|
}
|
|
return snapCoverage;
|
|
}
|
|
function coordToCss(hcoord, isRtl) {
|
|
if (hcoord === null) {
|
|
return { left: '', right: '' };
|
|
}
|
|
if (isRtl) {
|
|
return { right: hcoord, left: '' };
|
|
}
|
|
return { left: hcoord, right: '' };
|
|
}
|
|
function coordsToCss(hcoords, isRtl) {
|
|
if (!hcoords) {
|
|
return { left: '', right: '' };
|
|
}
|
|
if (isRtl) {
|
|
return { right: hcoords.start, left: -hcoords.end };
|
|
}
|
|
return { left: hcoords.start, right: -hcoords.end };
|
|
}
|
|
|
|
var TimelineHeader = /** @class */ (function (_super) {
|
|
__extends(TimelineHeader, _super);
|
|
function TimelineHeader() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
return _this;
|
|
}
|
|
TimelineHeader.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
// TODO: very repetitive
|
|
// TODO: make part of tDateProfile?
|
|
var timerUnit = greatestDurationDenominator(props.tDateProfile.slotDuration).unit;
|
|
// WORKAROUND: make ignore slatCoords when out of sync with dateProfile
|
|
var slatCoords = props.slatCoords && props.slatCoords.dateProfile === props.dateProfile ? props.slatCoords : null;
|
|
return (createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement("div", { className: "fc-timeline-header", ref: _this.rootElRef },
|
|
createElement("table", { "aria-hidden": true, className: "fc-scrollgrid-sync-table", style: { minWidth: props.tableMinWidth, width: props.clientWidth } },
|
|
props.tableColGroupNode,
|
|
createElement("tbody", null,
|
|
createElement(TimelineHeaderRows, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, rowInnerHeights: props.rowInnerHeights }))),
|
|
context.options.nowIndicator && (
|
|
// need to have a container regardless of whether the current view has a visible now indicator
|
|
// because apparently removal of the element resets the scroll for some reasons (issue #5351).
|
|
// this issue doesn't happen for the timeline body however (
|
|
createElement("div", { className: "fc-timeline-now-indicator-container" }, (slatCoords && slatCoords.isDateInRange(nowDate)) && (createElement(NowIndicatorRoot, { isAxis: true, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-arrow'].concat(classNames).join(' '), style: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl) }, innerContent)); })))))); }));
|
|
};
|
|
TimelineHeader.prototype.componentDidMount = function () {
|
|
this.updateSize();
|
|
};
|
|
TimelineHeader.prototype.componentDidUpdate = function () {
|
|
this.updateSize();
|
|
};
|
|
TimelineHeader.prototype.updateSize = function () {
|
|
if (this.props.onMaxCushionWidth) {
|
|
this.props.onMaxCushionWidth(this.computeMaxCushionWidth());
|
|
}
|
|
};
|
|
TimelineHeader.prototype.computeMaxCushionWidth = function () {
|
|
return Math.max.apply(Math, findElements(this.rootElRef.current, '.fc-timeline-header-row:last-child .fc-timeline-slot-cushion').map(function (el) { return el.getBoundingClientRect().width; }));
|
|
};
|
|
return TimelineHeader;
|
|
}(BaseComponent));
|
|
|
|
var TimelineSlatCell = /** @class */ (function (_super) {
|
|
__extends(TimelineSlatCell, _super);
|
|
function TimelineSlatCell() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineSlatCell.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var dateEnv = context.dateEnv, options = context.options, theme = context.theme;
|
|
var date = props.date, tDateProfile = props.tDateProfile, isEm = props.isEm;
|
|
var dateMeta = getDateMeta(props.date, props.todayRange, props.nowDate, props.dateProfile);
|
|
var classNames = ['fc-timeline-slot', 'fc-timeline-slot-lane'];
|
|
var dataAttrs = { 'data-date': dateEnv.formatIso(date, { omitTimeZoneOffset: true, omitTime: !tDateProfile.isTimeScale }) };
|
|
var hookProps = __assign(__assign({ date: dateEnv.toDate(props.date) }, dateMeta), { view: context.viewApi });
|
|
if (isEm) {
|
|
classNames.push('fc-timeline-slot-em');
|
|
}
|
|
if (tDateProfile.isTimeScale) {
|
|
classNames.push(isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, props.date, tDateProfile.labelInterval)) ?
|
|
'fc-timeline-slot-major' :
|
|
'fc-timeline-slot-minor');
|
|
}
|
|
classNames.push.apply(classNames, (props.isDay
|
|
? getDayClassNames(dateMeta, theme)
|
|
: getSlotClassNames(dateMeta, theme)));
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.slotLaneClassNames, content: options.slotLaneContent, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount, elRef: props.elRef }, function (rootElRef, customClassNames, innerElRef, innerContent) { return (createElement("td", __assign({ ref: rootElRef, className: classNames.concat(customClassNames).join(' ') }, dataAttrs),
|
|
createElement("div", { ref: innerElRef }, innerContent))); }));
|
|
};
|
|
return TimelineSlatCell;
|
|
}(BaseComponent));
|
|
|
|
var TimelineSlatsBody = /** @class */ (function (_super) {
|
|
__extends(TimelineSlatsBody, _super);
|
|
function TimelineSlatsBody() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineSlatsBody.prototype.render = function () {
|
|
var props = this.props;
|
|
var tDateProfile = props.tDateProfile, cellElRefs = props.cellElRefs;
|
|
var slotDates = tDateProfile.slotDates, isWeekStarts = tDateProfile.isWeekStarts;
|
|
var isDay = !tDateProfile.isTimeScale && !tDateProfile.largeUnit;
|
|
return (createElement("tbody", null,
|
|
createElement("tr", null, slotDates.map(function (slotDate, i) {
|
|
var key = slotDate.toISOString();
|
|
return (createElement(TimelineSlatCell, { key: key, elRef: cellElRefs.createRef(key), date: slotDate, dateProfile: props.dateProfile, tDateProfile: tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isEm: isWeekStarts[i], isDay: isDay }));
|
|
}))));
|
|
};
|
|
return TimelineSlatsBody;
|
|
}(BaseComponent));
|
|
|
|
var TimelineSlats = /** @class */ (function (_super) {
|
|
__extends(TimelineSlats, _super);
|
|
function TimelineSlats() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
_this.cellElRefs = new RefMap();
|
|
_this.handleScrollRequest = function (request) {
|
|
var onScrollLeftRequest = _this.props.onScrollLeftRequest;
|
|
var coords = _this.coords;
|
|
if (onScrollLeftRequest && coords) {
|
|
if (request.time) {
|
|
var scrollLeft = coords.coordFromLeft(coords.durationToCoord(request.time));
|
|
onScrollLeftRequest(scrollLeft);
|
|
}
|
|
return true;
|
|
}
|
|
return null; // best?
|
|
};
|
|
return _this;
|
|
}
|
|
TimelineSlats.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
return (createElement("div", { className: "fc-timeline-slots", ref: this.rootElRef },
|
|
createElement("table", { "aria-hidden": true, className: context.theme.getClass('table'), style: {
|
|
minWidth: props.tableMinWidth,
|
|
width: props.clientWidth,
|
|
} },
|
|
props.tableColGroupNode,
|
|
createElement(TimelineSlatsBody, { cellElRefs: this.cellElRefs, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange }))));
|
|
};
|
|
TimelineSlats.prototype.componentDidMount = function () {
|
|
this.updateSizing();
|
|
this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
|
|
};
|
|
TimelineSlats.prototype.componentDidUpdate = function (prevProps) {
|
|
this.updateSizing();
|
|
this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
|
|
};
|
|
TimelineSlats.prototype.componentWillUnmount = function () {
|
|
this.scrollResponder.detach();
|
|
if (this.props.onCoords) {
|
|
this.props.onCoords(null);
|
|
}
|
|
};
|
|
TimelineSlats.prototype.updateSizing = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
if (props.clientWidth !== null && // is sizing stable?
|
|
this.scrollResponder
|
|
// ^it's possible to have clientWidth immediately after mount (when returning from print view), but w/o scrollResponder
|
|
) {
|
|
var rootEl = this.rootElRef.current;
|
|
if (rootEl.offsetWidth) { // not hidden by css
|
|
this.coords = new TimelineCoords(this.rootElRef.current, collectCellEls(this.cellElRefs.currentMap, props.tDateProfile.slotDates), props.dateProfile, props.tDateProfile, context.dateEnv, context.isRtl);
|
|
if (props.onCoords) {
|
|
props.onCoords(this.coords);
|
|
}
|
|
this.scrollResponder.update(false); // TODO: wouldn't have to do this if coords were in state
|
|
}
|
|
}
|
|
};
|
|
TimelineSlats.prototype.positionToHit = function (leftPosition) {
|
|
var outerCoordCache = this.coords.outerCoordCache;
|
|
var _a = this.context, dateEnv = _a.dateEnv, isRtl = _a.isRtl;
|
|
var tDateProfile = this.props.tDateProfile;
|
|
var slatIndex = outerCoordCache.leftToIndex(leftPosition);
|
|
if (slatIndex != null) {
|
|
// somewhat similar to what TimeGrid does. consolidate?
|
|
var slatWidth = outerCoordCache.getWidth(slatIndex);
|
|
var partial = isRtl ?
|
|
(outerCoordCache.rights[slatIndex] - leftPosition) / slatWidth :
|
|
(leftPosition - outerCoordCache.lefts[slatIndex]) / slatWidth;
|
|
var localSnapIndex = Math.floor(partial * tDateProfile.snapsPerSlot);
|
|
var start = dateEnv.add(tDateProfile.slotDates[slatIndex], multiplyDuration(tDateProfile.snapDuration, localSnapIndex));
|
|
var end = dateEnv.add(start, tDateProfile.snapDuration);
|
|
return {
|
|
dateSpan: {
|
|
range: { start: start, end: end },
|
|
allDay: !this.props.tDateProfile.isTimeScale,
|
|
},
|
|
dayEl: this.cellElRefs.currentMap[slatIndex],
|
|
left: outerCoordCache.lefts[slatIndex],
|
|
right: outerCoordCache.rights[slatIndex],
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return TimelineSlats;
|
|
}(BaseComponent));
|
|
function collectCellEls(elMap, slotDates) {
|
|
return slotDates.map(function (slotDate) {
|
|
var key = slotDate.toISOString();
|
|
return elMap[key];
|
|
});
|
|
}
|
|
|
|
function computeSegHCoords(segs, minWidth, timelineCoords) {
|
|
var hcoords = [];
|
|
if (timelineCoords) {
|
|
for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
|
|
var seg = segs_1[_i];
|
|
var res = timelineCoords.rangeToCoords(seg);
|
|
var start = Math.round(res.start); // for barely-overlapping collisions
|
|
var end = Math.round(res.end); //
|
|
if (end - start < minWidth) {
|
|
end = start + minWidth;
|
|
}
|
|
hcoords.push({ start: start, end: end });
|
|
}
|
|
}
|
|
return hcoords;
|
|
}
|
|
function computeFgSegPlacements(segs, segHCoords, // might not have for every seg
|
|
eventInstanceHeights, // might not have for every seg
|
|
moreLinkHeights, // might not have for every more-link
|
|
strictOrder, maxStackCnt) {
|
|
var segInputs = [];
|
|
var crudePlacements = []; // when we don't know dims
|
|
for (var i = 0; i < segs.length; i += 1) {
|
|
var seg = segs[i];
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
var height = eventInstanceHeights[instanceId];
|
|
var hcoords = segHCoords[i];
|
|
if (height && hcoords) {
|
|
segInputs.push({
|
|
index: i,
|
|
span: hcoords,
|
|
thickness: height,
|
|
});
|
|
}
|
|
else {
|
|
crudePlacements.push({
|
|
seg: seg,
|
|
hcoords: hcoords,
|
|
top: null,
|
|
});
|
|
}
|
|
}
|
|
var hierarchy = new SegHierarchy();
|
|
if (strictOrder != null) {
|
|
hierarchy.strictOrder = strictOrder;
|
|
}
|
|
if (maxStackCnt != null) {
|
|
hierarchy.maxStackCnt = maxStackCnt;
|
|
}
|
|
var hiddenEntries = hierarchy.addSegs(segInputs);
|
|
var hiddenPlacements = hiddenEntries.map(function (entry) { return ({
|
|
seg: segs[entry.index],
|
|
hcoords: entry.span,
|
|
top: null,
|
|
}); });
|
|
var hiddenGroups = groupIntersectingEntries(hiddenEntries);
|
|
var moreLinkInputs = [];
|
|
var moreLinkCrudePlacements = [];
|
|
var extractSeg = function (entry) { return segs[entry.index]; };
|
|
for (var i = 0; i < hiddenGroups.length; i += 1) {
|
|
var hiddenGroup = hiddenGroups[i];
|
|
var sortedSegs = hiddenGroup.entries.map(extractSeg);
|
|
var height = moreLinkHeights[buildIsoString(computeEarliestSegStart(sortedSegs))]; // not optimal :(
|
|
if (height != null) {
|
|
// NOTE: the hiddenGroup's spanStart/spanEnd are already computed by rangeToCoords. computed during input.
|
|
moreLinkInputs.push({
|
|
index: segs.length + i,
|
|
thickness: height,
|
|
span: hiddenGroup.span,
|
|
});
|
|
}
|
|
else {
|
|
moreLinkCrudePlacements.push({
|
|
seg: sortedSegs,
|
|
hcoords: hiddenGroup.span,
|
|
top: null,
|
|
});
|
|
}
|
|
}
|
|
// add more-links into the hierarchy, but don't limit
|
|
hierarchy.maxStackCnt = -1;
|
|
hierarchy.addSegs(moreLinkInputs);
|
|
var visibleRects = hierarchy.toRects();
|
|
var visiblePlacements = [];
|
|
var maxHeight = 0;
|
|
for (var _i = 0, visibleRects_1 = visibleRects; _i < visibleRects_1.length; _i++) {
|
|
var rect = visibleRects_1[_i];
|
|
var segIndex = rect.index;
|
|
visiblePlacements.push({
|
|
seg: segIndex < segs.length
|
|
? segs[segIndex] // a real seg
|
|
: hiddenGroups[segIndex - segs.length].entries.map(extractSeg),
|
|
hcoords: rect.span,
|
|
top: rect.levelCoord,
|
|
});
|
|
maxHeight = Math.max(maxHeight, rect.levelCoord + rect.thickness);
|
|
}
|
|
return [
|
|
visiblePlacements.concat(crudePlacements, hiddenPlacements, moreLinkCrudePlacements),
|
|
maxHeight,
|
|
];
|
|
}
|
|
|
|
var TimelineLaneBg = /** @class */ (function (_super) {
|
|
__extends(TimelineLaneBg, _super);
|
|
function TimelineLaneBg() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineLaneBg.prototype.render = function () {
|
|
var props = this.props;
|
|
var highlightSeg = [].concat(props.eventResizeSegs, props.dateSelectionSegs);
|
|
return props.timelineCoords && (createElement("div", { className: "fc-timeline-bg" },
|
|
this.renderSegs(props.businessHourSegs || [], props.timelineCoords, 'non-business'),
|
|
this.renderSegs(props.bgEventSegs || [], props.timelineCoords, 'bg-event'),
|
|
this.renderSegs(highlightSeg, props.timelineCoords, 'highlight')));
|
|
};
|
|
TimelineLaneBg.prototype.renderSegs = function (segs, timelineCoords, fillType) {
|
|
var _a = this.props, todayRange = _a.todayRange, nowDate = _a.nowDate;
|
|
var isRtl = this.context.isRtl;
|
|
var segHCoords = computeSegHCoords(segs, 0, timelineCoords);
|
|
var children = segs.map(function (seg, i) {
|
|
var hcoords = segHCoords[i];
|
|
var hStyle = coordsToCss(hcoords, isRtl);
|
|
return (createElement("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-timeline-bg-harness", style: hStyle }, fillType === 'bg-event' ?
|
|
createElement(BgEvent, __assign({ seg: seg }, getSegMeta(seg, todayRange, nowDate))) :
|
|
renderFill(fillType)));
|
|
});
|
|
return createElement(Fragment, null, children);
|
|
};
|
|
return TimelineLaneBg;
|
|
}(BaseComponent));
|
|
|
|
var TimelineLaneSlicer = /** @class */ (function (_super) {
|
|
__extends(TimelineLaneSlicer, _super);
|
|
function TimelineLaneSlicer() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineLaneSlicer.prototype.sliceRange = function (origRange, dateProfile, dateProfileGenerator, tDateProfile, dateEnv) {
|
|
var normalRange = normalizeRange(origRange, tDateProfile, dateEnv);
|
|
var segs = [];
|
|
// protect against when the span is entirely in an invalid date region
|
|
if (computeDateSnapCoverage(normalRange.start, tDateProfile, dateEnv)
|
|
< computeDateSnapCoverage(normalRange.end, tDateProfile, dateEnv)) {
|
|
// intersect the footprint's range with the grid's range
|
|
var slicedRange = intersectRanges(normalRange, tDateProfile.normalizedRange);
|
|
if (slicedRange) {
|
|
segs.push({
|
|
start: slicedRange.start,
|
|
end: slicedRange.end,
|
|
isStart: slicedRange.start.valueOf() === normalRange.start.valueOf()
|
|
&& isValidDate(slicedRange.start, tDateProfile, dateProfile, dateProfileGenerator),
|
|
isEnd: slicedRange.end.valueOf() === normalRange.end.valueOf()
|
|
&& isValidDate(addMs(slicedRange.end, -1), tDateProfile, dateProfile, dateProfileGenerator),
|
|
});
|
|
}
|
|
}
|
|
return segs;
|
|
};
|
|
return TimelineLaneSlicer;
|
|
}(Slicer));
|
|
|
|
var DEFAULT_TIME_FORMAT = createFormatter({
|
|
hour: 'numeric',
|
|
minute: '2-digit',
|
|
omitZeroMinute: true,
|
|
meridiem: 'narrow',
|
|
});
|
|
var TimelineEvent = /** @class */ (function (_super) {
|
|
__extends(TimelineEvent, _super);
|
|
function TimelineEvent() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
TimelineEvent.prototype.render = function () {
|
|
var props = this.props;
|
|
return (createElement(StandardEvent, __assign({}, props, { extraClassNames: ['fc-timeline-event', 'fc-h-event'], defaultTimeFormat: DEFAULT_TIME_FORMAT, defaultDisplayEventTime: !props.isTimeScale })));
|
|
};
|
|
return TimelineEvent;
|
|
}(BaseComponent));
|
|
|
|
var TimelineLaneMoreLink = /** @class */ (function (_super) {
|
|
__extends(TimelineLaneMoreLink, _super);
|
|
function TimelineLaneMoreLink() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
return _this;
|
|
}
|
|
TimelineLaneMoreLink.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var hiddenSegs = props.hiddenSegs, elRef = props.elRef, placement = props.placement, resourceId = props.resourceId;
|
|
var top = placement.top, hcoords = placement.hcoords;
|
|
var isVisible = hcoords && top !== null;
|
|
var hStyle = coordsToCss(hcoords, context.isRtl);
|
|
var extraDateSpan = resourceId ? { resourceId: resourceId } : {};
|
|
return (createElement(MoreLinkRoot, { allDayDate: null, moreCnt: hiddenSegs.length, allSegs: hiddenSegs, hiddenSegs: hiddenSegs, alignmentElRef: this.rootElRef, dateProfile: props.dateProfile, todayRange: props.todayRange, extraDateSpan: extraDateSpan, popoverContent: function () { return (createElement(Fragment, null, hiddenSegs.map(function (seg) {
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
return (createElement("div", { key: instanceId, style: { visibility: props.isForcedInvisible[instanceId] ? 'hidden' : '' } },
|
|
createElement(TimelineEvent, __assign({ isTimeScale: props.isTimeScale, seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === props.eventSelection }, getSegMeta(seg, props.todayRange, props.nowDate)))));
|
|
}))); } }, function (rootElRef, classNames, innerElRef, innerContent, handleClick, title, isExpanded, popoverId) { return (createElement("a", { ref: function (el) {
|
|
setRef(rootElRef, el); // for MoreLinkRoot
|
|
setRef(elRef, el); // for props props
|
|
setRef(_this.rootElRef, el); // for this component
|
|
}, className: ['fc-timeline-more-link'].concat(classNames).join(' '), style: __assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle), onClick: handleClick, title: title, "aria-expanded": isExpanded, "aria-controls": popoverId },
|
|
createElement("div", { ref: innerElRef, className: "fc-timeline-more-link-inner fc-sticky" }, innerContent))); }));
|
|
};
|
|
return TimelineLaneMoreLink;
|
|
}(BaseComponent));
|
|
|
|
var TimelineLane = /** @class */ (function (_super) {
|
|
__extends(TimelineLane, _super);
|
|
function TimelineLane() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.slicer = new TimelineLaneSlicer();
|
|
_this.sortEventSegs = memoize(sortEventSegs);
|
|
_this.harnessElRefs = new RefMap();
|
|
_this.moreElRefs = new RefMap();
|
|
_this.innerElRef = createRef();
|
|
// TODO: memoize event positioning
|
|
_this.state = {
|
|
eventInstanceHeights: {},
|
|
moreLinkHeights: {},
|
|
};
|
|
return _this;
|
|
}
|
|
TimelineLane.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options;
|
|
var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
|
|
var slicedProps = this.slicer.sliceProps(props, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't have to pass in the rest of the args...
|
|
dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
|
|
var mirrorSegs = (slicedProps.eventDrag ? slicedProps.eventDrag.segs : null) ||
|
|
(slicedProps.eventResize ? slicedProps.eventResize.segs : null) ||
|
|
[];
|
|
var fgSegs = this.sortEventSegs(slicedProps.fgEventSegs, options.eventOrder);
|
|
var fgSegHCoords = computeSegHCoords(fgSegs, options.eventMinWidth, props.timelineCoords);
|
|
var _b = computeFgSegPlacements(fgSegs, fgSegHCoords, state.eventInstanceHeights, state.moreLinkHeights, options.eventOrderStrict, options.eventMaxStack), fgPlacements = _b[0], fgHeight = _b[1];
|
|
var isForcedInvisible = // TODO: more convenient
|
|
(slicedProps.eventDrag ? slicedProps.eventDrag.affectedInstances : null) ||
|
|
(slicedProps.eventResize ? slicedProps.eventResize.affectedInstances : null) ||
|
|
{};
|
|
return (createElement(Fragment, null,
|
|
createElement(TimelineLaneBg, { businessHourSegs: slicedProps.businessHourSegs, bgEventSegs: slicedProps.bgEventSegs, timelineCoords: props.timelineCoords, eventResizeSegs: slicedProps.eventResize ? slicedProps.eventResize.segs : [] /* bad new empty array? */, dateSelectionSegs: slicedProps.dateSelectionSegs, nowDate: props.nowDate, todayRange: props.todayRange }),
|
|
createElement("div", { className: "fc-timeline-events fc-scrollgrid-sync-inner", ref: this.innerElRef, style: { height: fgHeight } },
|
|
this.renderFgSegs(fgPlacements, isForcedInvisible, false, false, false),
|
|
this.renderFgSegs(buildMirrorPlacements(mirrorSegs, props.timelineCoords, fgPlacements), {}, Boolean(slicedProps.eventDrag), Boolean(slicedProps.eventResize), false))));
|
|
};
|
|
TimelineLane.prototype.componentDidMount = function () {
|
|
this.updateSize();
|
|
};
|
|
TimelineLane.prototype.componentDidUpdate = function (prevProps, prevState) {
|
|
if (prevProps.eventStore !== this.props.eventStore || // external thing changed?
|
|
prevProps.timelineCoords !== this.props.timelineCoords || // external thing changed?
|
|
prevState.moreLinkHeights !== this.state.moreLinkHeights // HACK. see addStateEquality
|
|
) {
|
|
this.updateSize();
|
|
}
|
|
};
|
|
TimelineLane.prototype.updateSize = function () {
|
|
var props = this.props;
|
|
var timelineCoords = props.timelineCoords;
|
|
var innerEl = this.innerElRef.current;
|
|
if (props.onHeightChange) {
|
|
props.onHeightChange(innerEl, false);
|
|
}
|
|
if (timelineCoords) {
|
|
this.setState({
|
|
eventInstanceHeights: mapHash(this.harnessElRefs.currentMap, function (harnessEl) { return (Math.round(harnessEl.getBoundingClientRect().height)); }),
|
|
moreLinkHeights: mapHash(this.moreElRefs.currentMap, function (moreEl) { return (Math.round(moreEl.getBoundingClientRect().height)); }),
|
|
}, function () {
|
|
if (props.onHeightChange) {
|
|
props.onHeightChange(innerEl, true);
|
|
}
|
|
});
|
|
}
|
|
// hack
|
|
if (props.syncParentMinHeight) {
|
|
innerEl.parentElement.style.minHeight = innerEl.style.height;
|
|
}
|
|
};
|
|
TimelineLane.prototype.renderFgSegs = function (segPlacements, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
|
|
var _a = this, harnessElRefs = _a.harnessElRefs, moreElRefs = _a.moreElRefs, props = _a.props, context = _a.context;
|
|
var isMirror = isDragging || isResizing || isDateSelecting;
|
|
return (createElement(Fragment, null, segPlacements.map(function (segPlacement) {
|
|
var seg = segPlacement.seg, hcoords = segPlacement.hcoords, top = segPlacement.top;
|
|
if (Array.isArray(seg)) { // a more-link
|
|
var isoStr = buildIsoString(computeEarliestSegStart(seg));
|
|
return (createElement(TimelineLaneMoreLink, { key: 'm:' + isoStr /* "m" for "more" */, elRef: moreElRefs.createRef(isoStr), hiddenSegs: seg, placement: segPlacement, dateProfile: props.dateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isTimeScale: props.tDateProfile.isTimeScale, eventSelection: props.eventSelection, resourceId: props.resourceId, isForcedInvisible: isForcedInvisible }));
|
|
}
|
|
var instanceId = seg.eventRange.instance.instanceId;
|
|
var isVisible = isMirror || Boolean(!isForcedInvisible[instanceId] && hcoords && top !== null);
|
|
var hStyle = coordsToCss(hcoords, context.isRtl);
|
|
return (createElement("div", { key: 'e:' + instanceId /* "e" for "event" */, ref: isMirror ? null : harnessElRefs.createRef(instanceId), className: "fc-timeline-event-harness", style: __assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle) },
|
|
createElement(TimelineEvent, __assign({ isTimeScale: props.tDateProfile.isTimeScale, seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === props.eventSelection /* TODO: bad for mirror? */ }, getSegMeta(seg, props.todayRange, props.nowDate)))));
|
|
})));
|
|
};
|
|
return TimelineLane;
|
|
}(BaseComponent));
|
|
TimelineLane.addStateEquality({
|
|
eventInstanceHeights: isPropsEqual,
|
|
moreLinkHeights: isPropsEqual,
|
|
});
|
|
function buildMirrorPlacements(mirrorSegs, timelineCoords, fgPlacements) {
|
|
if (!mirrorSegs.length || !timelineCoords) {
|
|
return [];
|
|
}
|
|
var topsByInstanceId = buildAbsoluteTopHash(fgPlacements); // TODO: cache this at first render?
|
|
return mirrorSegs.map(function (seg) { return ({
|
|
seg: seg,
|
|
hcoords: timelineCoords.rangeToCoords(seg),
|
|
top: topsByInstanceId[seg.eventRange.instance.instanceId],
|
|
}); });
|
|
}
|
|
function buildAbsoluteTopHash(placements) {
|
|
var topsByInstanceId = {};
|
|
for (var _i = 0, placements_1 = placements; _i < placements_1.length; _i++) {
|
|
var placement = placements_1[_i];
|
|
var seg = placement.seg;
|
|
if (!Array.isArray(seg)) { // doesn't represent a more-link
|
|
topsByInstanceId[seg.eventRange.instance.instanceId] = placement.top;
|
|
}
|
|
}
|
|
return topsByInstanceId;
|
|
}
|
|
|
|
var TimelineGrid = /** @class */ (function (_super) {
|
|
__extends(TimelineGrid, _super);
|
|
function TimelineGrid() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.slatsRef = createRef();
|
|
_this.state = {
|
|
coords: null,
|
|
};
|
|
_this.handeEl = function (el) {
|
|
if (el) {
|
|
_this.context.registerInteractiveComponent(_this, { el: el });
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
_this.handleCoords = function (coords) {
|
|
_this.setState({ coords: coords });
|
|
if (_this.props.onSlatCoords) {
|
|
_this.props.onSlatCoords(coords);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
TimelineGrid.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options;
|
|
var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
|
|
var timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
|
|
return (createElement("div", { className: "fc-timeline-body", ref: this.handeEl, style: {
|
|
minWidth: props.tableMinWidth,
|
|
height: props.clientHeight,
|
|
width: props.clientWidth,
|
|
} },
|
|
createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement(Fragment, null,
|
|
createElement(TimelineSlats, { ref: _this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: _this.handleCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
|
|
createElement(TimelineLane, { dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, nextDayThreshold: options.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: state.coords, syncParentMinHeight: true }),
|
|
(options.nowIndicator && state.coords && state.coords.isDateInRange(nowDate)) && (createElement("div", { className: "fc-timeline-now-indicator-container" },
|
|
createElement(NowIndicatorRoot, { isAxis: false, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-line'].concat(classNames).join(' '), style: coordToCss(state.coords.dateToCoord(nowDate), context.isRtl) }, innerContent)); }))))); })));
|
|
};
|
|
// Hit System
|
|
// ------------------------------------------------------------------------------------------
|
|
TimelineGrid.prototype.queryHit = function (positionLeft, positionTop, elWidth, elHeight) {
|
|
var slats = this.slatsRef.current;
|
|
var slatHit = slats.positionToHit(positionLeft);
|
|
if (slatHit) {
|
|
return {
|
|
dateProfile: this.props.dateProfile,
|
|
dateSpan: slatHit.dateSpan,
|
|
rect: {
|
|
left: slatHit.left,
|
|
right: slatHit.right,
|
|
top: 0,
|
|
bottom: elHeight,
|
|
},
|
|
dayEl: slatHit.dayEl,
|
|
layer: 0,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return TimelineGrid;
|
|
}(DateComponent));
|
|
|
|
var TimelineView = /** @class */ (function (_super) {
|
|
__extends(TimelineView, _super);
|
|
function TimelineView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
|
|
_this.scrollGridRef = createRef();
|
|
_this.state = {
|
|
slatCoords: null,
|
|
slotCushionMaxWidth: null,
|
|
};
|
|
_this.handleSlatCoords = function (slatCoords) {
|
|
_this.setState({ slatCoords: slatCoords });
|
|
};
|
|
_this.handleScrollLeftRequest = function (scrollLeft) {
|
|
var scrollGrid = _this.scrollGridRef.current;
|
|
scrollGrid.forceScrollLeft(0, scrollLeft);
|
|
};
|
|
_this.handleMaxCushionWidth = function (slotCushionMaxWidth) {
|
|
_this.setState({
|
|
slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
|
|
});
|
|
};
|
|
return _this;
|
|
}
|
|
TimelineView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options;
|
|
var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
|
|
var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
|
|
var tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
|
|
var extraClassNames = [
|
|
'fc-timeline',
|
|
options.eventOverlap === false ? 'fc-timeline-overlap-disabled' : '',
|
|
];
|
|
var slotMinWidth = options.slotMinWidth;
|
|
var slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
|
|
var sections = [
|
|
{
|
|
type: 'header',
|
|
key: 'header',
|
|
isSticky: stickyHeaderDates,
|
|
chunks: [{
|
|
key: 'timeline',
|
|
content: function (contentArg) { return (createElement(TimelineHeader, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, slatCoords: state.slatCoords, onMaxCushionWidth: slotMinWidth ? null : _this.handleMaxCushionWidth })); },
|
|
}],
|
|
},
|
|
{
|
|
type: 'body',
|
|
key: 'body',
|
|
liquid: true,
|
|
chunks: [{
|
|
key: 'timeline',
|
|
content: function (contentArg) { return (createElement(TimelineGrid, __assign({}, props, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, onSlatCoords: _this.handleSlatCoords, onScrollLeftRequest: _this.handleScrollLeftRequest }))); },
|
|
}],
|
|
},
|
|
];
|
|
if (stickyFooterScrollbar) {
|
|
sections.push({
|
|
type: 'footer',
|
|
key: 'footer',
|
|
isSticky: true,
|
|
chunks: [{
|
|
key: 'timeline',
|
|
content: renderScrollShim,
|
|
}],
|
|
});
|
|
}
|
|
return (createElement(ViewRoot, { viewSpec: context.viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: extraClassNames.concat(classNames).join(' ') },
|
|
createElement(ScrollGrid, { ref: _this.scrollGridRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
|
|
{ cols: slatCols },
|
|
], sections: sections }))); }));
|
|
};
|
|
TimelineView.prototype.computeFallbackSlotMinWidth = function (tDateProfile) {
|
|
return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
|
|
};
|
|
return TimelineView;
|
|
}(DateComponent));
|
|
function buildSlatCols(tDateProfile, slotMinWidth) {
|
|
return [{
|
|
span: tDateProfile.slotCnt,
|
|
minWidth: slotMinWidth || 1, // needs to be a non-zero number to trigger horizontal scrollbars!??????
|
|
}];
|
|
}
|
|
|
|
var timelinePlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
],
|
|
initialView: 'timelineDay',
|
|
views: {
|
|
timeline: {
|
|
component: TimelineView,
|
|
usesMinMaxTime: true,
|
|
eventResizableFromStart: true, // how is this consumed for TimelineView tho?
|
|
},
|
|
timelineDay: {
|
|
type: 'timeline',
|
|
duration: { days: 1 },
|
|
},
|
|
timelineWeek: {
|
|
type: 'timeline',
|
|
duration: { weeks: 1 },
|
|
},
|
|
timelineMonth: {
|
|
type: 'timeline',
|
|
duration: { months: 1 },
|
|
},
|
|
timelineYear: {
|
|
type: 'timeline',
|
|
duration: { years: 1 },
|
|
},
|
|
},
|
|
});
|
|
|
|
function massageEventDragMutation(eventMutation, hit0, hit1) {
|
|
var resource0 = hit0.dateSpan.resourceId;
|
|
var resource1 = hit1.dateSpan.resourceId;
|
|
if (resource0 && resource1 &&
|
|
resource0 !== resource1) {
|
|
eventMutation.resourceMutation = {
|
|
matchResourceId: resource0,
|
|
setResourceId: resource1,
|
|
};
|
|
}
|
|
}
|
|
/*
|
|
TODO: all this would be much easier if we were using a hash!
|
|
*/
|
|
function applyEventDefMutation(eventDef, mutation, context) {
|
|
var resourceMutation = mutation.resourceMutation;
|
|
if (resourceMutation && computeResourceEditable(eventDef, context)) {
|
|
var index = eventDef.resourceIds.indexOf(resourceMutation.matchResourceId);
|
|
if (index !== -1) {
|
|
var resourceIds = eventDef.resourceIds.slice(); // copy
|
|
resourceIds.splice(index, 1); // remove
|
|
if (resourceIds.indexOf(resourceMutation.setResourceId) === -1) { // not already in there
|
|
resourceIds.push(resourceMutation.setResourceId); // add
|
|
}
|
|
eventDef.resourceIds = resourceIds;
|
|
}
|
|
}
|
|
}
|
|
/*
|
|
HACK
|
|
TODO: use EventUi system instead of this
|
|
*/
|
|
function computeResourceEditable(eventDef, context) {
|
|
var resourceEditable = eventDef.resourceEditable;
|
|
if (resourceEditable == null) {
|
|
var source = eventDef.sourceId && context.getCurrentData().eventSources[eventDef.sourceId];
|
|
if (source) {
|
|
resourceEditable = source.extendedProps.resourceEditable; // used the Source::extendedProps hack
|
|
}
|
|
if (resourceEditable == null) {
|
|
resourceEditable = context.options.eventResourceEditable;
|
|
if (resourceEditable == null) {
|
|
resourceEditable = context.options.editable; // TODO: use defaults system instead
|
|
}
|
|
}
|
|
}
|
|
return resourceEditable;
|
|
}
|
|
function transformEventDrop(mutation, context) {
|
|
var resourceMutation = mutation.resourceMutation;
|
|
if (resourceMutation) {
|
|
var calendarApi = context.calendarApi;
|
|
return {
|
|
oldResource: calendarApi.getResourceById(resourceMutation.matchResourceId),
|
|
newResource: calendarApi.getResourceById(resourceMutation.setResourceId),
|
|
};
|
|
}
|
|
return {
|
|
oldResource: null,
|
|
newResource: null,
|
|
};
|
|
}
|
|
|
|
var ResourceDataAdder = /** @class */ (function () {
|
|
function ResourceDataAdder() {
|
|
this.filterResources = memoize(filterResources);
|
|
}
|
|
ResourceDataAdder.prototype.transform = function (viewProps, calendarProps) {
|
|
if (calendarProps.viewSpec.optionDefaults.needsResourceData) {
|
|
return {
|
|
resourceStore: this.filterResources(calendarProps.resourceStore, calendarProps.options.filterResourcesWithEvents, calendarProps.eventStore, calendarProps.dateProfile.activeRange),
|
|
resourceEntityExpansions: calendarProps.resourceEntityExpansions,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return ResourceDataAdder;
|
|
}());
|
|
function filterResources(resourceStore, doFilterResourcesWithEvents, eventStore, activeRange) {
|
|
if (doFilterResourcesWithEvents) {
|
|
var instancesInRange = filterEventInstancesInRange(eventStore.instances, activeRange);
|
|
var hasEvents_1 = computeHasEvents(instancesInRange, eventStore.defs);
|
|
__assign(hasEvents_1, computeAncestorHasEvents(hasEvents_1, resourceStore));
|
|
return filterHash(resourceStore, function (resource, resourceId) { return hasEvents_1[resourceId]; });
|
|
}
|
|
return resourceStore;
|
|
}
|
|
function filterEventInstancesInRange(eventInstances, activeRange) {
|
|
return filterHash(eventInstances, function (eventInstance) { return rangesIntersect(eventInstance.range, activeRange); });
|
|
}
|
|
function computeHasEvents(eventInstances, eventDefs) {
|
|
var hasEvents = {};
|
|
for (var instanceId in eventInstances) {
|
|
var instance = eventInstances[instanceId];
|
|
for (var _i = 0, _a = eventDefs[instance.defId].resourceIds; _i < _a.length; _i++) {
|
|
var resourceId = _a[_i];
|
|
hasEvents[resourceId] = true;
|
|
}
|
|
}
|
|
return hasEvents;
|
|
}
|
|
/*
|
|
mark resources as having events if any of their ancestors have them
|
|
NOTE: resourceStore might not have all the resources that hasEvents{} has keyed
|
|
*/
|
|
function computeAncestorHasEvents(hasEvents, resourceStore) {
|
|
var res = {};
|
|
for (var resourceId in hasEvents) {
|
|
var resource = void 0;
|
|
while ((resource = resourceStore[resourceId])) {
|
|
resourceId = resource.parentId; // now functioning as the parentId
|
|
if (resourceId) {
|
|
res[resourceId] = true;
|
|
}
|
|
else {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
return res;
|
|
}
|
|
/*
|
|
for making sure events that have editable resources are always draggable in resource views
|
|
*/
|
|
function transformIsDraggable(val, eventDef, eventUi, context) {
|
|
if (!val) {
|
|
var state = context.getCurrentData();
|
|
var viewSpec = state.viewSpecs[state.currentViewType];
|
|
if (viewSpec.optionDefaults.needsResourceData) {
|
|
if (computeResourceEditable(eventDef, context)) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
return val;
|
|
}
|
|
|
|
// for when non-resource view should be given EventUi info (for event coloring/constraints based off of resource data)
|
|
var ResourceEventConfigAdder = /** @class */ (function () {
|
|
function ResourceEventConfigAdder() {
|
|
this.buildResourceEventUis = memoize(buildResourceEventUis, isPropsEqual);
|
|
this.injectResourceEventUis = memoize(injectResourceEventUis);
|
|
}
|
|
ResourceEventConfigAdder.prototype.transform = function (viewProps, calendarProps) {
|
|
if (!calendarProps.viewSpec.optionDefaults.needsResourceData) {
|
|
return {
|
|
eventUiBases: this.injectResourceEventUis(viewProps.eventUiBases, viewProps.eventStore.defs, this.buildResourceEventUis(calendarProps.resourceStore)),
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return ResourceEventConfigAdder;
|
|
}());
|
|
function buildResourceEventUis(resourceStore) {
|
|
return mapHash(resourceStore, function (resource) { return resource.ui; });
|
|
}
|
|
function injectResourceEventUis(eventUiBases, eventDefs, resourceEventUis) {
|
|
return mapHash(eventUiBases, function (eventUi, defId) {
|
|
if (defId) { // not the '' key
|
|
return injectResourceEventUi(eventUi, eventDefs[defId], resourceEventUis);
|
|
}
|
|
return eventUi;
|
|
});
|
|
}
|
|
function injectResourceEventUi(origEventUi, eventDef, resourceEventUis) {
|
|
var parts = [];
|
|
// first resource takes precedence, which fights with the ordering of combineEventUis, thus the unshifts
|
|
for (var _i = 0, _a = eventDef.resourceIds; _i < _a.length; _i++) {
|
|
var resourceId = _a[_i];
|
|
if (resourceEventUis[resourceId]) {
|
|
parts.unshift(resourceEventUis[resourceId]);
|
|
}
|
|
}
|
|
parts.unshift(origEventUi);
|
|
return combineEventUis(parts);
|
|
}
|
|
|
|
var defs = []; // TODO: use plugin system
|
|
function registerResourceSourceDef(def) {
|
|
defs.push(def);
|
|
}
|
|
function getResourceSourceDef(id) {
|
|
return defs[id];
|
|
}
|
|
function getResourceSourceDefs() {
|
|
return defs;
|
|
}
|
|
|
|
// TODO: make this a plugin-able parser
|
|
// TODO: success/failure
|
|
var RESOURCE_SOURCE_REFINERS = {
|
|
id: String,
|
|
// for array. TODO: move to resource-array
|
|
resources: identity,
|
|
// for json feed. TODO: move to resource-json-feed
|
|
url: String,
|
|
method: String,
|
|
startParam: String,
|
|
endParam: String,
|
|
timeZoneParam: String,
|
|
extraParams: identity,
|
|
};
|
|
function parseResourceSource(input) {
|
|
var inputObj;
|
|
if (typeof input === 'string') {
|
|
inputObj = { url: input };
|
|
}
|
|
else if (typeof input === 'function' || Array.isArray(input)) {
|
|
inputObj = { resources: input };
|
|
}
|
|
else if (typeof input === 'object' && input) { // non-null object
|
|
inputObj = input;
|
|
}
|
|
if (inputObj) {
|
|
var _a = refineProps(inputObj, RESOURCE_SOURCE_REFINERS), refined = _a.refined, extra = _a.extra;
|
|
warnUnknownProps(extra);
|
|
var metaRes = buildResourceSourceMeta(refined);
|
|
if (metaRes) {
|
|
return {
|
|
_raw: input,
|
|
sourceId: guid(),
|
|
sourceDefId: metaRes.sourceDefId,
|
|
meta: metaRes.meta,
|
|
publicId: refined.id || '',
|
|
isFetching: false,
|
|
latestFetchId: '',
|
|
fetchRange: null,
|
|
};
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function buildResourceSourceMeta(refined) {
|
|
var defs = getResourceSourceDefs();
|
|
for (var i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
|
|
var def = defs[i];
|
|
var meta = def.parseMeta(refined);
|
|
if (meta) {
|
|
return { meta: meta, sourceDefId: i };
|
|
}
|
|
}
|
|
return null;
|
|
}
|
|
function warnUnknownProps(props) {
|
|
for (var propName in props) {
|
|
console.warn("Unknown resource prop '" + propName + "'");
|
|
}
|
|
}
|
|
|
|
function reduceResourceSource(source, action, context) {
|
|
var options = context.options, dateProfile = context.dateProfile;
|
|
if (!source || !action) {
|
|
return createSource(options.initialResources || options.resources, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
|
|
}
|
|
switch (action.type) {
|
|
case 'RESET_RESOURCE_SOURCE':
|
|
return createSource(action.resourceSourceInput, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
|
|
case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
|
|
case 'NEXT':
|
|
case 'CHANGE_DATE':
|
|
case 'CHANGE_VIEW_TYPE':
|
|
return handleRangeChange(source, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
|
|
case 'RECEIVE_RESOURCES':
|
|
case 'RECEIVE_RESOURCE_ERROR':
|
|
return receiveResponse(source, action.fetchId, action.fetchRange);
|
|
case 'REFETCH_RESOURCES':
|
|
return fetchSource(source, dateProfile.activeRange, context);
|
|
default:
|
|
return source;
|
|
}
|
|
}
|
|
function createSource(input, activeRange, refetchResourcesOnNavigate, context) {
|
|
if (input) {
|
|
var source = parseResourceSource(input);
|
|
source = fetchSource(source, refetchResourcesOnNavigate ? activeRange : null, context);
|
|
return source;
|
|
}
|
|
return null;
|
|
}
|
|
function handleRangeChange(source, activeRange, refetchResourcesOnNavigate, context) {
|
|
if (refetchResourcesOnNavigate &&
|
|
!doesSourceIgnoreRange(source) &&
|
|
(!source.fetchRange || !rangesEqual(source.fetchRange, activeRange))) {
|
|
return fetchSource(source, activeRange, context);
|
|
}
|
|
return source;
|
|
}
|
|
function doesSourceIgnoreRange(source) {
|
|
return Boolean(getResourceSourceDef(source.sourceDefId).ignoreRange);
|
|
}
|
|
function fetchSource(source, fetchRange, context) {
|
|
var sourceDef = getResourceSourceDef(source.sourceDefId);
|
|
var fetchId = guid();
|
|
sourceDef.fetch({
|
|
resourceSource: source,
|
|
range: fetchRange,
|
|
context: context,
|
|
}, function (res) {
|
|
context.dispatch({
|
|
type: 'RECEIVE_RESOURCES',
|
|
fetchId: fetchId,
|
|
fetchRange: fetchRange,
|
|
rawResources: res.rawResources,
|
|
});
|
|
}, function (error) {
|
|
context.dispatch({
|
|
type: 'RECEIVE_RESOURCE_ERROR',
|
|
fetchId: fetchId,
|
|
fetchRange: fetchRange,
|
|
error: error,
|
|
});
|
|
});
|
|
return __assign(__assign({}, source), { isFetching: true, latestFetchId: fetchId });
|
|
}
|
|
function receiveResponse(source, fetchId, fetchRange) {
|
|
if (fetchId === source.latestFetchId) {
|
|
return __assign(__assign({}, source), { isFetching: false, fetchRange: fetchRange });
|
|
}
|
|
return source;
|
|
}
|
|
|
|
var PRIVATE_ID_PREFIX = '_fc:';
|
|
var RESOURCE_REFINERS = {
|
|
id: String,
|
|
parentId: String,
|
|
children: identity,
|
|
title: String,
|
|
businessHours: identity,
|
|
extendedProps: identity,
|
|
// event-ui
|
|
eventEditable: Boolean,
|
|
eventStartEditable: Boolean,
|
|
eventDurationEditable: Boolean,
|
|
eventConstraint: identity,
|
|
eventOverlap: Boolean,
|
|
eventAllow: identity,
|
|
eventClassNames: parseClassNames,
|
|
eventBackgroundColor: String,
|
|
eventBorderColor: String,
|
|
eventTextColor: String,
|
|
eventColor: String,
|
|
};
|
|
/*
|
|
needs a full store so that it can populate children too
|
|
*/
|
|
function parseResource(raw, parentId, store, context) {
|
|
if (parentId === void 0) { parentId = ''; }
|
|
var _a = refineProps(raw, RESOURCE_REFINERS), refined = _a.refined, extra = _a.extra;
|
|
var resource = {
|
|
id: refined.id || (PRIVATE_ID_PREFIX + guid()),
|
|
parentId: refined.parentId || parentId,
|
|
title: refined.title || '',
|
|
businessHours: refined.businessHours ? parseBusinessHours(refined.businessHours, context) : null,
|
|
ui: createEventUi({
|
|
editable: refined.eventEditable,
|
|
startEditable: refined.eventStartEditable,
|
|
durationEditable: refined.eventDurationEditable,
|
|
constraint: refined.eventConstraint,
|
|
overlap: refined.eventOverlap,
|
|
allow: refined.eventAllow,
|
|
classNames: refined.eventClassNames,
|
|
backgroundColor: refined.eventBackgroundColor,
|
|
borderColor: refined.eventBorderColor,
|
|
textColor: refined.eventTextColor,
|
|
color: refined.eventColor,
|
|
}, context),
|
|
extendedProps: __assign(__assign({}, extra), refined.extendedProps),
|
|
};
|
|
// help out ResourceApi from having user modify props
|
|
Object.freeze(resource.ui.classNames);
|
|
Object.freeze(resource.extendedProps);
|
|
if (store[resource.id]) ;
|
|
else {
|
|
store[resource.id] = resource;
|
|
if (refined.children) {
|
|
for (var _i = 0, _b = refined.children; _i < _b.length; _i++) {
|
|
var childInput = _b[_i];
|
|
parseResource(childInput, resource.id, store, context);
|
|
}
|
|
}
|
|
}
|
|
return resource;
|
|
}
|
|
/*
|
|
TODO: use this in more places
|
|
*/
|
|
function getPublicId(id) {
|
|
if (id.indexOf(PRIVATE_ID_PREFIX) === 0) {
|
|
return '';
|
|
}
|
|
return id;
|
|
}
|
|
|
|
function reduceResourceStore(store, action, source, context) {
|
|
if (!store || !action) {
|
|
return {};
|
|
}
|
|
switch (action.type) {
|
|
case 'RECEIVE_RESOURCES':
|
|
return receiveRawResources(store, action.rawResources, action.fetchId, source, context);
|
|
case 'ADD_RESOURCE':
|
|
return addResource(store, action.resourceHash);
|
|
case 'REMOVE_RESOURCE':
|
|
return removeResource(store, action.resourceId);
|
|
case 'SET_RESOURCE_PROP':
|
|
return setResourceProp(store, action.resourceId, action.propName, action.propValue);
|
|
case 'SET_RESOURCE_EXTENDED_PROP':
|
|
return setResourceExtendedProp(store, action.resourceId, action.propName, action.propValue);
|
|
default:
|
|
return store;
|
|
}
|
|
}
|
|
function receiveRawResources(existingStore, inputs, fetchId, source, context) {
|
|
if (source.latestFetchId === fetchId) {
|
|
var nextStore = {};
|
|
for (var _i = 0, inputs_1 = inputs; _i < inputs_1.length; _i++) {
|
|
var input = inputs_1[_i];
|
|
parseResource(input, '', nextStore, context);
|
|
}
|
|
return nextStore;
|
|
}
|
|
return existingStore;
|
|
}
|
|
function addResource(existingStore, additions) {
|
|
// TODO: warn about duplicate IDs
|
|
return __assign(__assign({}, existingStore), additions);
|
|
}
|
|
function removeResource(existingStore, resourceId) {
|
|
var newStore = __assign({}, existingStore);
|
|
delete newStore[resourceId];
|
|
// promote children
|
|
for (var childResourceId in newStore) { // a child, *maybe* but probably not
|
|
if (newStore[childResourceId].parentId === resourceId) {
|
|
newStore[childResourceId] = __assign(__assign({}, newStore[childResourceId]), { parentId: '' });
|
|
}
|
|
}
|
|
return newStore;
|
|
}
|
|
function setResourceProp(existingStore, resourceId, name, value) {
|
|
var _a, _b;
|
|
var existingResource = existingStore[resourceId];
|
|
// TODO: sanitization
|
|
if (existingResource) {
|
|
return __assign(__assign({}, existingStore), (_a = {}, _a[resourceId] = __assign(__assign({}, existingResource), (_b = {}, _b[name] = value, _b)), _a));
|
|
}
|
|
return existingStore;
|
|
}
|
|
function setResourceExtendedProp(existingStore, resourceId, name, value) {
|
|
var _a, _b;
|
|
var existingResource = existingStore[resourceId];
|
|
if (existingResource) {
|
|
return __assign(__assign({}, existingStore), (_a = {}, _a[resourceId] = __assign(__assign({}, existingResource), { extendedProps: __assign(__assign({}, existingResource.extendedProps), (_b = {}, _b[name] = value, _b)) }), _a));
|
|
}
|
|
return existingStore;
|
|
}
|
|
|
|
function reduceResourceEntityExpansions(expansions, action) {
|
|
var _a;
|
|
if (!expansions || !action) {
|
|
return {};
|
|
}
|
|
switch (action.type) {
|
|
case 'SET_RESOURCE_ENTITY_EXPANDED':
|
|
return __assign(__assign({}, expansions), (_a = {}, _a[action.id] = action.isExpanded, _a));
|
|
default:
|
|
return expansions;
|
|
}
|
|
}
|
|
|
|
function reduceResources(state, action, context) {
|
|
var resourceSource = reduceResourceSource(state && state.resourceSource, action, context);
|
|
var resourceStore = reduceResourceStore(state && state.resourceStore, action, resourceSource, context);
|
|
var resourceEntityExpansions = reduceResourceEntityExpansions(state && state.resourceEntityExpansions, action);
|
|
return {
|
|
resourceSource: resourceSource,
|
|
resourceStore: resourceStore,
|
|
resourceEntityExpansions: resourceEntityExpansions,
|
|
};
|
|
}
|
|
|
|
var EVENT_REFINERS = {
|
|
resourceId: String,
|
|
resourceIds: identity,
|
|
resourceEditable: Boolean,
|
|
};
|
|
function generateEventDefResourceMembers(refined) {
|
|
return {
|
|
resourceIds: ensureStringArray(refined.resourceIds)
|
|
.concat(refined.resourceId ? [refined.resourceId] : []),
|
|
resourceEditable: refined.resourceEditable,
|
|
};
|
|
}
|
|
function ensureStringArray(items) {
|
|
return (items || []).map(function (item) { return String(item); });
|
|
}
|
|
|
|
function transformDateSelectionJoin(hit0, hit1) {
|
|
var resourceId0 = hit0.dateSpan.resourceId;
|
|
var resourceId1 = hit1.dateSpan.resourceId;
|
|
if (resourceId0 && resourceId1) {
|
|
return { resourceId: resourceId0 };
|
|
}
|
|
return null;
|
|
}
|
|
|
|
var ResourceApi = /** @class */ (function () {
|
|
function ResourceApi(_context, _resource) {
|
|
this._context = _context;
|
|
this._resource = _resource;
|
|
}
|
|
ResourceApi.prototype.setProp = function (name, value) {
|
|
var oldResource = this._resource;
|
|
this._context.dispatch({
|
|
type: 'SET_RESOURCE_PROP',
|
|
resourceId: oldResource.id,
|
|
propName: name,
|
|
propValue: value,
|
|
});
|
|
this.sync(oldResource);
|
|
};
|
|
ResourceApi.prototype.setExtendedProp = function (name, value) {
|
|
var oldResource = this._resource;
|
|
this._context.dispatch({
|
|
type: 'SET_RESOURCE_EXTENDED_PROP',
|
|
resourceId: oldResource.id,
|
|
propName: name,
|
|
propValue: value,
|
|
});
|
|
this.sync(oldResource);
|
|
};
|
|
ResourceApi.prototype.sync = function (oldResource) {
|
|
var context = this._context;
|
|
var resourceId = oldResource.id;
|
|
// TODO: what if dispatch didn't complete synchronously?
|
|
this._resource = context.getCurrentData().resourceStore[resourceId];
|
|
context.emitter.trigger('resourceChange', {
|
|
oldResource: new ResourceApi(context, oldResource),
|
|
resource: this,
|
|
revert: function () {
|
|
var _a;
|
|
context.dispatch({
|
|
type: 'ADD_RESOURCE',
|
|
resourceHash: (_a = {},
|
|
_a[resourceId] = oldResource,
|
|
_a),
|
|
});
|
|
},
|
|
});
|
|
};
|
|
ResourceApi.prototype.remove = function () {
|
|
var context = this._context;
|
|
var internalResource = this._resource;
|
|
var resourceId = internalResource.id;
|
|
context.dispatch({
|
|
type: 'REMOVE_RESOURCE',
|
|
resourceId: resourceId,
|
|
});
|
|
context.emitter.trigger('resourceRemove', {
|
|
resource: this,
|
|
revert: function () {
|
|
var _a;
|
|
context.dispatch({
|
|
type: 'ADD_RESOURCE',
|
|
resourceHash: (_a = {},
|
|
_a[resourceId] = internalResource,
|
|
_a),
|
|
});
|
|
},
|
|
});
|
|
};
|
|
ResourceApi.prototype.getParent = function () {
|
|
var context = this._context;
|
|
var parentId = this._resource.parentId;
|
|
if (parentId) {
|
|
return new ResourceApi(context, context.getCurrentData().resourceSource[parentId]);
|
|
}
|
|
return null;
|
|
};
|
|
ResourceApi.prototype.getChildren = function () {
|
|
var thisResourceId = this._resource.id;
|
|
var context = this._context;
|
|
var resourceStore = context.getCurrentData().resourceStore;
|
|
var childApis = [];
|
|
for (var resourceId in resourceStore) {
|
|
if (resourceStore[resourceId].parentId === thisResourceId) {
|
|
childApis.push(new ResourceApi(context, resourceStore[resourceId]));
|
|
}
|
|
}
|
|
return childApis;
|
|
};
|
|
/*
|
|
this is really inefficient!
|
|
TODO: make EventApi::resourceIds a hash or keep an index in the Calendar's state
|
|
*/
|
|
ResourceApi.prototype.getEvents = function () {
|
|
var thisResourceId = this._resource.id;
|
|
var context = this._context;
|
|
var _a = context.getCurrentData().eventStore, defs = _a.defs, instances = _a.instances;
|
|
var eventApis = [];
|
|
for (var instanceId in instances) {
|
|
var instance = instances[instanceId];
|
|
var def = defs[instance.defId];
|
|
if (def.resourceIds.indexOf(thisResourceId) !== -1) { // inefficient!!!
|
|
eventApis.push(new EventApi(context, def, instance));
|
|
}
|
|
}
|
|
return eventApis;
|
|
};
|
|
Object.defineProperty(ResourceApi.prototype, "id", {
|
|
get: function () { return getPublicId(this._resource.id); },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "title", {
|
|
get: function () { return this._resource.title; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventConstraint", {
|
|
get: function () { return this._resource.ui.constraints[0] || null; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventOverlap", {
|
|
get: function () { return this._resource.ui.overlap; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventAllow", {
|
|
get: function () { return this._resource.ui.allows[0] || null; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventBackgroundColor", {
|
|
get: function () { return this._resource.ui.backgroundColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventBorderColor", {
|
|
get: function () { return this._resource.ui.borderColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventTextColor", {
|
|
get: function () { return this._resource.ui.textColor; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "eventClassNames", {
|
|
// NOTE: user can't modify these because Object.freeze was called in event-def parsing
|
|
get: function () { return this._resource.ui.classNames; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
Object.defineProperty(ResourceApi.prototype, "extendedProps", {
|
|
get: function () { return this._resource.extendedProps; },
|
|
enumerable: false,
|
|
configurable: true
|
|
});
|
|
ResourceApi.prototype.toPlainObject = function (settings) {
|
|
if (settings === void 0) { settings = {}; }
|
|
var internal = this._resource;
|
|
var ui = internal.ui;
|
|
var publicId = this.id;
|
|
var res = {};
|
|
if (publicId) {
|
|
res.id = publicId;
|
|
}
|
|
if (internal.title) {
|
|
res.title = internal.title;
|
|
}
|
|
if (settings.collapseEventColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
|
|
res.eventColor = ui.backgroundColor;
|
|
}
|
|
else {
|
|
if (ui.backgroundColor) {
|
|
res.eventBackgroundColor = ui.backgroundColor;
|
|
}
|
|
if (ui.borderColor) {
|
|
res.eventBorderColor = ui.borderColor;
|
|
}
|
|
}
|
|
if (ui.textColor) {
|
|
res.eventTextColor = ui.textColor;
|
|
}
|
|
if (ui.classNames.length) {
|
|
res.eventClassNames = ui.classNames;
|
|
}
|
|
if (Object.keys(internal.extendedProps).length) {
|
|
if (settings.collapseExtendedProps) {
|
|
__assign(res, internal.extendedProps);
|
|
}
|
|
else {
|
|
res.extendedProps = internal.extendedProps;
|
|
}
|
|
}
|
|
return res;
|
|
};
|
|
ResourceApi.prototype.toJSON = function () {
|
|
return this.toPlainObject();
|
|
};
|
|
return ResourceApi;
|
|
}());
|
|
function buildResourceApis(resourceStore, context) {
|
|
var resourceApis = [];
|
|
for (var resourceId in resourceStore) {
|
|
resourceApis.push(new ResourceApi(context, resourceStore[resourceId]));
|
|
}
|
|
return resourceApis;
|
|
}
|
|
|
|
CalendarApi.prototype.addResource = function (input, scrollTo) {
|
|
var _a;
|
|
var _this = this;
|
|
if (scrollTo === void 0) { scrollTo = true; }
|
|
var currentState = this.getCurrentData();
|
|
var resourceHash;
|
|
var resource;
|
|
if (input instanceof ResourceApi) {
|
|
resource = input._resource;
|
|
resourceHash = (_a = {}, _a[resource.id] = resource, _a);
|
|
}
|
|
else {
|
|
resourceHash = {};
|
|
resource = parseResource(input, '', resourceHash, currentState);
|
|
}
|
|
this.dispatch({
|
|
type: 'ADD_RESOURCE',
|
|
resourceHash: resourceHash,
|
|
});
|
|
if (scrollTo) {
|
|
// TODO: wait til dispatch completes somehow
|
|
this.trigger('_scrollRequest', { resourceId: resource.id });
|
|
}
|
|
var resourceApi = new ResourceApi(currentState, resource);
|
|
currentState.emitter.trigger('resourceAdd', {
|
|
resource: resourceApi,
|
|
revert: function () {
|
|
_this.dispatch({
|
|
type: 'REMOVE_RESOURCE',
|
|
resourceId: resource.id,
|
|
});
|
|
},
|
|
});
|
|
return resourceApi;
|
|
};
|
|
CalendarApi.prototype.getResourceById = function (id) {
|
|
id = String(id);
|
|
var currentState = this.getCurrentData(); // eslint-disable-line react/no-this-in-sfc
|
|
if (currentState.resourceStore) { // guard against calendar with no resource functionality
|
|
var rawResource = currentState.resourceStore[id];
|
|
if (rawResource) {
|
|
return new ResourceApi(currentState, rawResource);
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
CalendarApi.prototype.getResources = function () {
|
|
var currentState = this.getCurrentData();
|
|
var resourceStore = currentState.resourceStore;
|
|
var resourceApis = [];
|
|
if (resourceStore) { // guard against calendar with no resource functionality
|
|
for (var resourceId in resourceStore) {
|
|
resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
|
|
}
|
|
}
|
|
return resourceApis;
|
|
};
|
|
CalendarApi.prototype.getTopLevelResources = function () {
|
|
var currentState = this.getCurrentData();
|
|
var resourceStore = currentState.resourceStore;
|
|
var resourceApis = [];
|
|
if (resourceStore) { // guard against calendar with no resource functionality
|
|
for (var resourceId in resourceStore) {
|
|
if (!resourceStore[resourceId].parentId) {
|
|
resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
|
|
}
|
|
}
|
|
}
|
|
return resourceApis;
|
|
};
|
|
CalendarApi.prototype.refetchResources = function () {
|
|
this.dispatch({
|
|
type: 'REFETCH_RESOURCES',
|
|
});
|
|
};
|
|
function transformDatePoint(dateSpan, context) {
|
|
return dateSpan.resourceId ?
|
|
{ resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
|
|
{};
|
|
}
|
|
function transformDateSpan(dateSpan, context) {
|
|
return dateSpan.resourceId ?
|
|
{ resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
|
|
{};
|
|
}
|
|
|
|
/*
|
|
splits things BASED OFF OF which resources they are associated with.
|
|
creates a '' entry which is when something has NO resource.
|
|
*/
|
|
var ResourceSplitter = /** @class */ (function (_super) {
|
|
__extends(ResourceSplitter, _super);
|
|
function ResourceSplitter() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceSplitter.prototype.getKeyInfo = function (props) {
|
|
return __assign({ '': {} }, props.resourceStore);
|
|
};
|
|
ResourceSplitter.prototype.getKeysForDateSpan = function (dateSpan) {
|
|
return [dateSpan.resourceId || ''];
|
|
};
|
|
ResourceSplitter.prototype.getKeysForEventDef = function (eventDef) {
|
|
var resourceIds = eventDef.resourceIds;
|
|
if (!resourceIds.length) {
|
|
return [''];
|
|
}
|
|
return resourceIds;
|
|
};
|
|
return ResourceSplitter;
|
|
}(Splitter));
|
|
|
|
function isPropsValidWithResources(combinedProps, context) {
|
|
var splitter = new ResourceSplitter();
|
|
var sets = splitter.splitProps(__assign(__assign({}, combinedProps), { resourceStore: context.getCurrentData().resourceStore }));
|
|
for (var resourceId in sets) {
|
|
var props = sets[resourceId];
|
|
// merge in event data from the non-resource segment
|
|
if (resourceId && sets['']) { // current segment is not the non-resource one, and there IS a non-resource one
|
|
props = __assign(__assign({}, props), { eventStore: mergeEventStores(sets[''].eventStore, props.eventStore), eventUiBases: __assign(__assign({}, sets[''].eventUiBases), props.eventUiBases) });
|
|
}
|
|
if (!isPropsValid(props, context, { resourceId: resourceId }, filterConfig.bind(null, resourceId))) {
|
|
return false;
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
function filterConfig(resourceId, config) {
|
|
return __assign(__assign({}, config), { constraints: filterConstraints(resourceId, config.constraints) });
|
|
}
|
|
function filterConstraints(resourceId, constraints) {
|
|
return constraints.map(function (constraint) {
|
|
var defs = constraint.defs;
|
|
if (defs) { // we are dealing with an EventStore
|
|
// if any of the events define constraints to resources that are NOT this resource,
|
|
// then this resource is unconditionally prohibited, which is what a `false` value does.
|
|
for (var defId in defs) {
|
|
var resourceIds = defs[defId].resourceIds;
|
|
if (resourceIds.length && resourceIds.indexOf(resourceId) === -1) { // TODO: use a hash?!!! (for other reasons too)
|
|
return false;
|
|
}
|
|
}
|
|
}
|
|
return constraint;
|
|
});
|
|
}
|
|
|
|
function transformExternalDef(dateSpan) {
|
|
return dateSpan.resourceId ?
|
|
{ resourceId: dateSpan.resourceId } :
|
|
{};
|
|
}
|
|
|
|
EventApi.prototype.getResources = function () {
|
|
var calendarApi = this._context.calendarApi;
|
|
return this._def.resourceIds.map(function (resourceId) { return calendarApi.getResourceById(resourceId); });
|
|
};
|
|
EventApi.prototype.setResources = function (resources) {
|
|
var resourceIds = [];
|
|
// massage resources -> resourceIds
|
|
for (var _i = 0, resources_1 = resources; _i < resources_1.length; _i++) {
|
|
var resource = resources_1[_i];
|
|
var resourceId = null;
|
|
if (typeof resource === 'string') {
|
|
resourceId = resource;
|
|
}
|
|
else if (typeof resource === 'number') {
|
|
resourceId = String(resource);
|
|
}
|
|
else if (resource instanceof ResourceApi) {
|
|
resourceId = resource.id; // guaranteed to always have an ID. hmmm
|
|
}
|
|
else {
|
|
console.warn('unknown resource type: ' + resource);
|
|
}
|
|
if (resourceId) {
|
|
resourceIds.push(resourceId);
|
|
}
|
|
}
|
|
this.mutate({
|
|
standardProps: {
|
|
resourceIds: resourceIds,
|
|
},
|
|
});
|
|
};
|
|
|
|
var optionChangeHandlers = {
|
|
resources: handleResources,
|
|
};
|
|
function handleResources(newSourceInput, context) {
|
|
var oldSourceInput = context.getCurrentData().resourceSource._raw;
|
|
if (oldSourceInput !== newSourceInput) {
|
|
context.dispatch({
|
|
type: 'RESET_RESOURCE_SOURCE',
|
|
resourceSourceInput: newSourceInput,
|
|
});
|
|
}
|
|
}
|
|
|
|
var DEFAULT_RESOURCE_ORDER = parseFieldSpecs('id,title');
|
|
function handleResourceStore(resourceStore, calendarData) {
|
|
var emitter = calendarData.emitter;
|
|
if (emitter.hasHandlers('resourcesSet')) {
|
|
emitter.trigger('resourcesSet', buildResourceApis(resourceStore, calendarData));
|
|
}
|
|
}
|
|
|
|
var OPTION_REFINERS = {
|
|
initialResources: identity,
|
|
resources: identity,
|
|
eventResourceEditable: Boolean,
|
|
refetchResourcesOnNavigate: Boolean,
|
|
resourceOrder: parseFieldSpecs,
|
|
filterResourcesWithEvents: Boolean,
|
|
resourceGroupField: String,
|
|
resourceAreaWidth: identity,
|
|
resourceAreaColumns: identity,
|
|
resourcesInitiallyExpanded: Boolean,
|
|
datesAboveResources: Boolean,
|
|
needsResourceData: Boolean,
|
|
resourceAreaHeaderClassNames: identity,
|
|
resourceAreaHeaderContent: identity,
|
|
resourceAreaHeaderDidMount: identity,
|
|
resourceAreaHeaderWillUnmount: identity,
|
|
resourceGroupLabelClassNames: identity,
|
|
resourceGroupLabelContent: identity,
|
|
resourceGroupLabelDidMount: identity,
|
|
resourceGroupLabelWillUnmount: identity,
|
|
resourceLabelClassNames: identity,
|
|
resourceLabelContent: identity,
|
|
resourceLabelDidMount: identity,
|
|
resourceLabelWillUnmount: identity,
|
|
resourceLaneClassNames: identity,
|
|
resourceLaneContent: identity,
|
|
resourceLaneDidMount: identity,
|
|
resourceLaneWillUnmount: identity,
|
|
resourceGroupLaneClassNames: identity,
|
|
resourceGroupLaneContent: identity,
|
|
resourceGroupLaneDidMount: identity,
|
|
resourceGroupLaneWillUnmount: identity,
|
|
};
|
|
var LISTENER_REFINERS = {
|
|
resourcesSet: identity,
|
|
resourceAdd: identity,
|
|
resourceChange: identity,
|
|
resourceRemove: identity,
|
|
};
|
|
|
|
registerResourceSourceDef({
|
|
ignoreRange: true,
|
|
parseMeta: function (refined) {
|
|
if (Array.isArray(refined.resources)) {
|
|
return refined.resources;
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, successCallback) {
|
|
successCallback({
|
|
rawResources: arg.resourceSource.meta,
|
|
});
|
|
},
|
|
});
|
|
|
|
registerResourceSourceDef({
|
|
parseMeta: function (refined) {
|
|
if (typeof refined.resources === 'function') {
|
|
return refined.resources;
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, success, failure) {
|
|
var dateEnv = arg.context.dateEnv;
|
|
var func = arg.resourceSource.meta;
|
|
var publicArg = arg.range ? {
|
|
start: dateEnv.toDate(arg.range.start),
|
|
end: dateEnv.toDate(arg.range.end),
|
|
startStr: dateEnv.formatIso(arg.range.start),
|
|
endStr: dateEnv.formatIso(arg.range.end),
|
|
timeZone: dateEnv.timeZone,
|
|
} : {};
|
|
// TODO: make more dry with EventSourceFunc
|
|
// TODO: accept a response?
|
|
unpromisify(func.bind(null, publicArg), function (rawResources) {
|
|
success({ rawResources: rawResources }); // needs an object response
|
|
}, failure);
|
|
},
|
|
});
|
|
|
|
registerResourceSourceDef({
|
|
parseMeta: function (refined) {
|
|
if (refined.url) {
|
|
return {
|
|
url: refined.url,
|
|
method: (refined.method || 'GET').toUpperCase(),
|
|
extraParams: refined.extraParams,
|
|
};
|
|
}
|
|
return null;
|
|
},
|
|
fetch: function (arg, successCallback, failureCallback) {
|
|
var meta = arg.resourceSource.meta;
|
|
var requestParams = buildRequestParams(meta, arg.range, arg.context);
|
|
requestJson(meta.method, meta.url, requestParams, function (rawResources, xhr) {
|
|
successCallback({ rawResources: rawResources, xhr: xhr });
|
|
}, function (message, xhr) {
|
|
failureCallback({ message: message, xhr: xhr });
|
|
});
|
|
},
|
|
});
|
|
// TODO: somehow consolidate with event json feed
|
|
function buildRequestParams(meta, range, context) {
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var startParam;
|
|
var endParam;
|
|
var timeZoneParam;
|
|
var customRequestParams;
|
|
var params = {};
|
|
if (range) {
|
|
startParam = meta.startParam;
|
|
if (startParam == null) {
|
|
startParam = options.startParam;
|
|
}
|
|
endParam = meta.endParam;
|
|
if (endParam == null) {
|
|
endParam = options.endParam;
|
|
}
|
|
timeZoneParam = meta.timeZoneParam;
|
|
if (timeZoneParam == null) {
|
|
timeZoneParam = options.timeZoneParam;
|
|
}
|
|
params[startParam] = dateEnv.formatIso(range.start);
|
|
params[endParam] = dateEnv.formatIso(range.end);
|
|
if (dateEnv.timeZone !== 'local') {
|
|
params[timeZoneParam] = dateEnv.timeZone;
|
|
}
|
|
}
|
|
// retrieve any outbound GET/POST data from the options
|
|
if (typeof meta.extraParams === 'function') {
|
|
// supplied as a function that returns a key/value object
|
|
customRequestParams = meta.extraParams();
|
|
}
|
|
else {
|
|
// probably supplied as a straight key/value object
|
|
customRequestParams = meta.extraParams || {};
|
|
}
|
|
__assign(params, customRequestParams);
|
|
return params;
|
|
}
|
|
|
|
// TODO: not used for Spreadsheet. START USING. difficult because of col-specific rendering props
|
|
function ResourceLabelRoot(props) {
|
|
return (createElement(ViewContextType.Consumer, null, function (context) {
|
|
var options = context.options;
|
|
var hookProps = {
|
|
resource: new ResourceApi(context, props.resource),
|
|
date: props.date ? context.dateEnv.toDate(props.date) : null,
|
|
view: context.viewApi,
|
|
};
|
|
var dataAttrs = {
|
|
'data-resource-id': props.resource.id,
|
|
'data-date': props.date ? formatDayString(props.date) : undefined,
|
|
};
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: options.resourceLabelClassNames, content: options.resourceLabelContent, defaultContent: renderInnerContent, didMount: options.resourceLabelDidMount, willUnmount: options.resourceLabelWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return props.children(rootElRef, classNames, // TODO: pass in 'fc-resource' ?
|
|
dataAttrs, innerElRef, innerContent); }));
|
|
}));
|
|
}
|
|
function renderInnerContent(props) {
|
|
return props.resource.title || props.resource.id;
|
|
}
|
|
|
|
var ResourceCell = /** @class */ (function (_super) {
|
|
__extends(ResourceCell, _super);
|
|
function ResourceCell() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceCell.prototype.render = function () {
|
|
var props = this.props;
|
|
return (createElement(ResourceLabelRoot, { resource: props.resource, date: props.date }, function (elRef, customClassNames, dataAttrs, innerElRef, innerContent) { return (createElement("th", __assign({ ref: elRef, role: "columnheader", className: ['fc-col-header-cell', 'fc-resource'].concat(customClassNames).join(' '), colSpan: props.colSpan }, dataAttrs),
|
|
createElement("div", { className: "fc-scrollgrid-sync-inner" },
|
|
createElement("span", { className: [
|
|
'fc-col-header-cell-cushion',
|
|
props.isSticky ? 'fc-sticky' : '',
|
|
].join(' '), ref: innerElRef }, innerContent)))); }));
|
|
};
|
|
return ResourceCell;
|
|
}(BaseComponent));
|
|
|
|
var ResourceDayHeader = /** @class */ (function (_super) {
|
|
__extends(ResourceDayHeader, _super);
|
|
function ResourceDayHeader() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildDateFormat = memoize(buildDateFormat);
|
|
return _this;
|
|
}
|
|
ResourceDayHeader.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var dateFormat = this.buildDateFormat(context.options.dayHeaderFormat, props.datesRepDistinctDays, props.dates.length);
|
|
return (createElement(NowTimer, { unit: "day" }, function (nowDate, todayRange) {
|
|
if (props.dates.length === 1) {
|
|
return _this.renderResourceRow(props.resources, props.dates[0]);
|
|
}
|
|
if (context.options.datesAboveResources) {
|
|
return _this.renderDayAndResourceRows(props.dates, dateFormat, todayRange, props.resources);
|
|
}
|
|
return _this.renderResourceAndDayRows(props.resources, props.dates, dateFormat, todayRange);
|
|
}));
|
|
};
|
|
ResourceDayHeader.prototype.renderResourceRow = function (resources, date) {
|
|
var resourceCells = resources.map(function (resource) { return (createElement(ResourceCell, { key: resource.id, resource: resource, colSpan: 1, date: date })); });
|
|
return this.buildTr(resourceCells, 'resources');
|
|
};
|
|
ResourceDayHeader.prototype.renderDayAndResourceRows = function (dates, dateFormat, todayRange, resources) {
|
|
var dateCells = [];
|
|
var resourceCells = [];
|
|
for (var _i = 0, dates_1 = dates; _i < dates_1.length; _i++) {
|
|
var date = dates_1[_i];
|
|
dateCells.push(this.renderDateCell(date, dateFormat, todayRange, resources.length, null, true));
|
|
for (var _a = 0, resources_1 = resources; _a < resources_1.length; _a++) {
|
|
var resource = resources_1[_a];
|
|
resourceCells.push(createElement(ResourceCell, { key: resource.id + ':' + date.toISOString(), resource: resource, colSpan: 1, date: date }));
|
|
}
|
|
}
|
|
return (createElement(Fragment, null,
|
|
this.buildTr(dateCells, 'day'),
|
|
this.buildTr(resourceCells, 'resources')));
|
|
};
|
|
ResourceDayHeader.prototype.renderResourceAndDayRows = function (resources, dates, dateFormat, todayRange) {
|
|
var resourceCells = [];
|
|
var dateCells = [];
|
|
for (var _i = 0, resources_2 = resources; _i < resources_2.length; _i++) {
|
|
var resource = resources_2[_i];
|
|
resourceCells.push(createElement(ResourceCell, { key: resource.id, resource: resource, colSpan: dates.length, isSticky: true }));
|
|
for (var _a = 0, dates_2 = dates; _a < dates_2.length; _a++) {
|
|
var date = dates_2[_a];
|
|
dateCells.push(this.renderDateCell(date, dateFormat, todayRange, 1, resource));
|
|
}
|
|
}
|
|
return (createElement(Fragment, null,
|
|
this.buildTr(resourceCells, 'resources'),
|
|
this.buildTr(dateCells, 'day')));
|
|
};
|
|
// a cell with date text. might have a resource associated with it
|
|
ResourceDayHeader.prototype.renderDateCell = function (date, dateFormat, todayRange, colSpan, resource, isSticky) {
|
|
var props = this.props;
|
|
var keyPostfix = resource ? ":" + resource.id : '';
|
|
var extraHookProps = resource ? { resource: new ResourceApi(this.context, resource) } : {};
|
|
var extraDataAttrs = resource ? { 'data-resource-id': resource.id } : {};
|
|
return props.datesRepDistinctDays ? (createElement(TableDateCell, { key: date.toISOString() + keyPostfix, date: date, dateProfile: props.dateProfile, todayRange: todayRange, colCnt: props.dates.length * props.resources.length, dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraHookProps: extraHookProps, extraDataAttrs: extraDataAttrs })) : (createElement(TableDowCell // we can't leverage the pure-componentness becausae the extra* props are new every time :(
|
|
, { key: date.getUTCDay() + keyPostfix, dow: date.getUTCDay(), dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraHookProps: extraHookProps, extraDataAttrs: extraDataAttrs }));
|
|
};
|
|
ResourceDayHeader.prototype.buildTr = function (cells, key) {
|
|
var renderIntro = this.props.renderIntro;
|
|
if (!cells.length) {
|
|
cells = [createElement("td", { key: 0 }, "\u00A0")];
|
|
}
|
|
return (createElement("tr", { key: key, role: "row" },
|
|
renderIntro && renderIntro(key),
|
|
cells));
|
|
};
|
|
return ResourceDayHeader;
|
|
}(BaseComponent));
|
|
function buildDateFormat(dayHeaderFormat, datesRepDistinctDays, dayCnt) {
|
|
return dayHeaderFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt);
|
|
}
|
|
|
|
var ResourceIndex = /** @class */ (function () {
|
|
function ResourceIndex(resources) {
|
|
var indicesById = {};
|
|
var ids = [];
|
|
for (var i = 0; i < resources.length; i += 1) {
|
|
var id = resources[i].id;
|
|
ids.push(id);
|
|
indicesById[id] = i;
|
|
}
|
|
this.ids = ids;
|
|
this.indicesById = indicesById;
|
|
this.length = resources.length;
|
|
}
|
|
return ResourceIndex;
|
|
}());
|
|
|
|
var AbstractResourceDayTableModel = /** @class */ (function () {
|
|
function AbstractResourceDayTableModel(dayTableModel, resources, context) {
|
|
this.dayTableModel = dayTableModel;
|
|
this.resources = resources;
|
|
this.context = context;
|
|
this.resourceIndex = new ResourceIndex(resources);
|
|
this.rowCnt = dayTableModel.rowCnt;
|
|
this.colCnt = dayTableModel.colCnt * resources.length;
|
|
this.cells = this.buildCells();
|
|
}
|
|
AbstractResourceDayTableModel.prototype.buildCells = function () {
|
|
var _a = this, rowCnt = _a.rowCnt, dayTableModel = _a.dayTableModel, resources = _a.resources;
|
|
var rows = [];
|
|
for (var row = 0; row < rowCnt; row += 1) {
|
|
var rowCells = [];
|
|
for (var dateCol = 0; dateCol < dayTableModel.colCnt; dateCol += 1) {
|
|
for (var resourceCol = 0; resourceCol < resources.length; resourceCol += 1) {
|
|
var resource = resources[resourceCol];
|
|
var extraHookProps = { resource: new ResourceApi(this.context, resource) };
|
|
var extraDataAttrs = { 'data-resource-id': resource.id };
|
|
var extraClassNames = ['fc-resource'];
|
|
var extraDateSpan = { resourceId: resource.id };
|
|
var date = dayTableModel.cells[row][dateCol].date;
|
|
rowCells[this.computeCol(dateCol, resourceCol)] = {
|
|
key: resource.id + ':' + date.toISOString(),
|
|
date: date,
|
|
extraHookProps: extraHookProps,
|
|
extraDataAttrs: extraDataAttrs,
|
|
extraClassNames: extraClassNames,
|
|
extraDateSpan: extraDateSpan,
|
|
};
|
|
}
|
|
}
|
|
rows.push(rowCells);
|
|
}
|
|
return rows;
|
|
};
|
|
return AbstractResourceDayTableModel;
|
|
}());
|
|
|
|
/*
|
|
resources over dates
|
|
*/
|
|
var ResourceDayTableModel = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTableModel, _super);
|
|
function ResourceDayTableModel() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceDayTableModel.prototype.computeCol = function (dateI, resourceI) {
|
|
return resourceI * this.dayTableModel.colCnt + dateI;
|
|
};
|
|
/*
|
|
all date ranges are intact
|
|
*/
|
|
ResourceDayTableModel.prototype.computeColRanges = function (dateStartI, dateEndI, resourceI) {
|
|
return [
|
|
{
|
|
firstCol: this.computeCol(dateStartI, resourceI),
|
|
lastCol: this.computeCol(dateEndI, resourceI),
|
|
isStart: true,
|
|
isEnd: true,
|
|
},
|
|
];
|
|
};
|
|
return ResourceDayTableModel;
|
|
}(AbstractResourceDayTableModel));
|
|
|
|
/*
|
|
dates over resources
|
|
*/
|
|
var DayResourceTableModel = /** @class */ (function (_super) {
|
|
__extends(DayResourceTableModel, _super);
|
|
function DayResourceTableModel() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
DayResourceTableModel.prototype.computeCol = function (dateI, resourceI) {
|
|
return dateI * this.resources.length + resourceI;
|
|
};
|
|
/*
|
|
every single day is broken up
|
|
*/
|
|
DayResourceTableModel.prototype.computeColRanges = function (dateStartI, dateEndI, resourceI) {
|
|
var segs = [];
|
|
for (var i = dateStartI; i <= dateEndI; i += 1) {
|
|
var col = this.computeCol(i, resourceI);
|
|
segs.push({
|
|
firstCol: col,
|
|
lastCol: col,
|
|
isStart: i === dateStartI,
|
|
isEnd: i === dateEndI,
|
|
});
|
|
}
|
|
return segs;
|
|
};
|
|
return DayResourceTableModel;
|
|
}(AbstractResourceDayTableModel));
|
|
|
|
var NO_SEGS = []; // for memoizing
|
|
var VResourceJoiner = /** @class */ (function () {
|
|
function VResourceJoiner() {
|
|
this.joinDateSelection = memoize(this.joinSegs);
|
|
this.joinBusinessHours = memoize(this.joinSegs);
|
|
this.joinFgEvents = memoize(this.joinSegs);
|
|
this.joinBgEvents = memoize(this.joinSegs);
|
|
this.joinEventDrags = memoize(this.joinInteractions);
|
|
this.joinEventResizes = memoize(this.joinInteractions);
|
|
}
|
|
/*
|
|
propSets also has a '' key for things with no resource
|
|
*/
|
|
VResourceJoiner.prototype.joinProps = function (propSets, resourceDayTable) {
|
|
var dateSelectionSets = [];
|
|
var businessHoursSets = [];
|
|
var fgEventSets = [];
|
|
var bgEventSets = [];
|
|
var eventDrags = [];
|
|
var eventResizes = [];
|
|
var eventSelection = '';
|
|
var keys = resourceDayTable.resourceIndex.ids.concat(['']); // add in the all-resource key
|
|
for (var _i = 0, keys_1 = keys; _i < keys_1.length; _i++) {
|
|
var key = keys_1[_i];
|
|
var props = propSets[key];
|
|
dateSelectionSets.push(props.dateSelectionSegs);
|
|
businessHoursSets.push(key ? props.businessHourSegs : NO_SEGS); // don't include redundant all-resource businesshours
|
|
fgEventSets.push(key ? props.fgEventSegs : NO_SEGS); // don't include fg all-resource segs
|
|
bgEventSets.push(props.bgEventSegs);
|
|
eventDrags.push(props.eventDrag);
|
|
eventResizes.push(props.eventResize);
|
|
eventSelection = eventSelection || props.eventSelection;
|
|
}
|
|
return {
|
|
dateSelectionSegs: this.joinDateSelection.apply(this, __spreadArray([resourceDayTable], dateSelectionSets)),
|
|
businessHourSegs: this.joinBusinessHours.apply(this, __spreadArray([resourceDayTable], businessHoursSets)),
|
|
fgEventSegs: this.joinFgEvents.apply(this, __spreadArray([resourceDayTable], fgEventSets)),
|
|
bgEventSegs: this.joinBgEvents.apply(this, __spreadArray([resourceDayTable], bgEventSets)),
|
|
eventDrag: this.joinEventDrags.apply(this, __spreadArray([resourceDayTable], eventDrags)),
|
|
eventResize: this.joinEventResizes.apply(this, __spreadArray([resourceDayTable], eventResizes)),
|
|
eventSelection: eventSelection,
|
|
};
|
|
};
|
|
VResourceJoiner.prototype.joinSegs = function (resourceDayTable) {
|
|
var segGroups = [];
|
|
for (var _i = 1; _i < arguments.length; _i++) {
|
|
segGroups[_i - 1] = arguments[_i];
|
|
}
|
|
var resourceCnt = resourceDayTable.resources.length;
|
|
var transformedSegs = [];
|
|
for (var i = 0; i < resourceCnt; i += 1) {
|
|
for (var _a = 0, _b = segGroups[i]; _a < _b.length; _a++) {
|
|
var seg = _b[_a];
|
|
transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
|
|
}
|
|
for (var _c = 0, _d = segGroups[resourceCnt]; _c < _d.length; _c++) { // one beyond. the all-resource
|
|
var seg = _d[_c];
|
|
transformedSegs.push.apply(// one beyond. the all-resource
|
|
transformedSegs, this.transformSeg(seg, resourceDayTable, i));
|
|
}
|
|
}
|
|
return transformedSegs;
|
|
};
|
|
/*
|
|
for expanding non-resource segs to all resources.
|
|
only for public use.
|
|
no memoizing.
|
|
*/
|
|
VResourceJoiner.prototype.expandSegs = function (resourceDayTable, segs) {
|
|
var resourceCnt = resourceDayTable.resources.length;
|
|
var transformedSegs = [];
|
|
for (var i = 0; i < resourceCnt; i += 1) {
|
|
for (var _i = 0, segs_1 = segs; _i < segs_1.length; _i++) {
|
|
var seg = segs_1[_i];
|
|
transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
|
|
}
|
|
}
|
|
return transformedSegs;
|
|
};
|
|
VResourceJoiner.prototype.joinInteractions = function (resourceDayTable) {
|
|
var interactions = [];
|
|
for (var _i = 1; _i < arguments.length; _i++) {
|
|
interactions[_i - 1] = arguments[_i];
|
|
}
|
|
var resourceCnt = resourceDayTable.resources.length;
|
|
var affectedInstances = {};
|
|
var transformedSegs = [];
|
|
var anyInteractions = false;
|
|
var isEvent = false;
|
|
for (var i = 0; i < resourceCnt; i += 1) {
|
|
var interaction = interactions[i];
|
|
if (interaction) {
|
|
anyInteractions = true;
|
|
for (var _a = 0, _b = interaction.segs; _a < _b.length; _a++) {
|
|
var seg = _b[_a];
|
|
transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
|
|
}
|
|
__assign(affectedInstances, interaction.affectedInstances);
|
|
isEvent = isEvent || interaction.isEvent;
|
|
}
|
|
if (interactions[resourceCnt]) { // one beyond. the all-resource
|
|
for (var _c = 0, _d = interactions[resourceCnt].segs; _c < _d.length; _c++) {
|
|
var seg = _d[_c];
|
|
transformedSegs.push.apply(transformedSegs, this.transformSeg(seg, resourceDayTable, i));
|
|
}
|
|
}
|
|
}
|
|
if (anyInteractions) {
|
|
return {
|
|
affectedInstances: affectedInstances,
|
|
segs: transformedSegs,
|
|
isEvent: isEvent,
|
|
};
|
|
}
|
|
return null;
|
|
};
|
|
return VResourceJoiner;
|
|
}());
|
|
|
|
/*
|
|
TODO: just use ResourceHash somehow? could then use the generic ResourceSplitter
|
|
*/
|
|
var VResourceSplitter = /** @class */ (function (_super) {
|
|
__extends(VResourceSplitter, _super);
|
|
function VResourceSplitter() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
VResourceSplitter.prototype.getKeyInfo = function (props) {
|
|
var resourceDayTableModel = props.resourceDayTableModel;
|
|
var hash = mapHash(resourceDayTableModel.resourceIndex.indicesById, function (i) { return resourceDayTableModel.resources[i]; }); // :(
|
|
hash[''] = {};
|
|
return hash;
|
|
};
|
|
VResourceSplitter.prototype.getKeysForDateSpan = function (dateSpan) {
|
|
return [dateSpan.resourceId || ''];
|
|
};
|
|
VResourceSplitter.prototype.getKeysForEventDef = function (eventDef) {
|
|
var resourceIds = eventDef.resourceIds;
|
|
if (!resourceIds.length) {
|
|
return [''];
|
|
}
|
|
return resourceIds;
|
|
};
|
|
return VResourceSplitter;
|
|
}(Splitter));
|
|
|
|
/*
|
|
doesn't accept grouping
|
|
*/
|
|
function flattenResources(resourceStore, orderSpecs) {
|
|
return buildRowNodes(resourceStore, [], orderSpecs, false, {}, true)
|
|
.map(function (node) { return node.resource; });
|
|
}
|
|
function buildRowNodes(resourceStore, groupSpecs, orderSpecs, isVGrouping, expansions, expansionDefault) {
|
|
var complexNodes = buildHierarchy(resourceStore, isVGrouping ? -1 : 1, groupSpecs, orderSpecs);
|
|
var flatNodes = [];
|
|
flattenNodes(complexNodes, flatNodes, isVGrouping, [], 0, expansions, expansionDefault);
|
|
return flatNodes;
|
|
}
|
|
function flattenNodes(complexNodes, res, isVGrouping, rowSpans, depth, expansions, expansionDefault) {
|
|
for (var i = 0; i < complexNodes.length; i += 1) {
|
|
var complexNode = complexNodes[i];
|
|
var group = complexNode.group;
|
|
if (group) {
|
|
if (isVGrouping) {
|
|
var firstRowIndex = res.length;
|
|
var rowSpanIndex = rowSpans.length;
|
|
flattenNodes(complexNode.children, res, isVGrouping, rowSpans.concat(0), depth, expansions, expansionDefault);
|
|
if (firstRowIndex < res.length) {
|
|
var firstRow = res[firstRowIndex];
|
|
var firstRowSpans = firstRow.rowSpans = firstRow.rowSpans.slice();
|
|
firstRowSpans[rowSpanIndex] = res.length - firstRowIndex;
|
|
}
|
|
}
|
|
else {
|
|
var id = group.spec.field + ':' + group.value;
|
|
var isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
|
|
res.push({ id: id, group: group, isExpanded: isExpanded });
|
|
if (isExpanded) {
|
|
flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
|
|
}
|
|
}
|
|
}
|
|
else if (complexNode.resource) {
|
|
var id = complexNode.resource.id;
|
|
var isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
|
|
res.push({
|
|
id: id,
|
|
rowSpans: rowSpans,
|
|
depth: depth,
|
|
isExpanded: isExpanded,
|
|
hasChildren: Boolean(complexNode.children.length),
|
|
resource: complexNode.resource,
|
|
resourceFields: complexNode.resourceFields,
|
|
});
|
|
if (isExpanded) {
|
|
flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
|
|
}
|
|
}
|
|
}
|
|
}
|
|
function buildHierarchy(resourceStore, maxDepth, groupSpecs, orderSpecs) {
|
|
var resourceNodes = buildResourceNodes(resourceStore, orderSpecs);
|
|
var builtNodes = [];
|
|
for (var resourceId in resourceNodes) {
|
|
var resourceNode = resourceNodes[resourceId];
|
|
if (!resourceNode.resource.parentId) {
|
|
insertResourceNode(resourceNode, builtNodes, groupSpecs, 0, maxDepth, orderSpecs);
|
|
}
|
|
}
|
|
return builtNodes;
|
|
}
|
|
function buildResourceNodes(resourceStore, orderSpecs) {
|
|
var nodeHash = {};
|
|
for (var resourceId in resourceStore) {
|
|
var resource = resourceStore[resourceId];
|
|
nodeHash[resourceId] = {
|
|
resource: resource,
|
|
resourceFields: buildResourceFields(resource),
|
|
children: [],
|
|
};
|
|
}
|
|
for (var resourceId in resourceStore) {
|
|
var resource = resourceStore[resourceId];
|
|
if (resource.parentId) {
|
|
var parentNode = nodeHash[resource.parentId];
|
|
if (parentNode) {
|
|
insertResourceNodeInSiblings(nodeHash[resourceId], parentNode.children, orderSpecs);
|
|
}
|
|
}
|
|
}
|
|
return nodeHash;
|
|
}
|
|
function insertResourceNode(resourceNode, nodes, groupSpecs, depth, maxDepth, orderSpecs) {
|
|
if (groupSpecs.length && (maxDepth === -1 || depth <= maxDepth)) {
|
|
var groupNode = ensureGroupNodes(resourceNode, nodes, groupSpecs[0]);
|
|
insertResourceNode(resourceNode, groupNode.children, groupSpecs.slice(1), depth + 1, maxDepth, orderSpecs);
|
|
}
|
|
else {
|
|
insertResourceNodeInSiblings(resourceNode, nodes, orderSpecs);
|
|
}
|
|
}
|
|
function ensureGroupNodes(resourceNode, nodes, groupSpec) {
|
|
var groupValue = resourceNode.resourceFields[groupSpec.field];
|
|
var groupNode;
|
|
var newGroupIndex;
|
|
// find an existing group that matches, or determine the position for a new group
|
|
if (groupSpec.order) {
|
|
for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
|
|
var node = nodes[newGroupIndex];
|
|
if (node.group) {
|
|
var cmp = flexibleCompare(groupValue, node.group.value) * groupSpec.order;
|
|
if (cmp === 0) {
|
|
groupNode = node;
|
|
break;
|
|
}
|
|
else if (cmp < 0) {
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
}
|
|
else { // the groups are unordered
|
|
for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
|
|
var node = nodes[newGroupIndex];
|
|
if (node.group && groupValue === node.group.value) {
|
|
groupNode = node;
|
|
break;
|
|
}
|
|
}
|
|
}
|
|
if (!groupNode) {
|
|
groupNode = {
|
|
group: {
|
|
value: groupValue,
|
|
spec: groupSpec,
|
|
},
|
|
children: [],
|
|
};
|
|
nodes.splice(newGroupIndex, 0, groupNode);
|
|
}
|
|
return groupNode;
|
|
}
|
|
function insertResourceNodeInSiblings(resourceNode, siblings, orderSpecs) {
|
|
var i;
|
|
for (i = 0; i < siblings.length; i += 1) {
|
|
var cmp = compareByFieldSpecs(siblings[i].resourceFields, resourceNode.resourceFields, orderSpecs); // TODO: pass in ResourceApi?
|
|
if (cmp > 0) { // went 1 past. insert at i
|
|
break;
|
|
}
|
|
}
|
|
siblings.splice(i, 0, resourceNode);
|
|
}
|
|
function buildResourceFields(resource) {
|
|
var obj = __assign(__assign(__assign({}, resource.extendedProps), resource.ui), resource);
|
|
delete obj.ui;
|
|
delete obj.extendedProps;
|
|
return obj;
|
|
}
|
|
function isGroupsEqual(group0, group1) {
|
|
return group0.spec === group1.spec && group0.value === group1.value;
|
|
}
|
|
|
|
var resourceCommonPlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
],
|
|
reducers: [
|
|
reduceResources,
|
|
],
|
|
isLoadingFuncs: [
|
|
function (state) { return state.resourceSource && state.resourceSource.isFetching; },
|
|
],
|
|
eventRefiners: EVENT_REFINERS,
|
|
eventDefMemberAdders: [generateEventDefResourceMembers],
|
|
isDraggableTransformers: [transformIsDraggable],
|
|
eventDragMutationMassagers: [massageEventDragMutation],
|
|
eventDefMutationAppliers: [applyEventDefMutation],
|
|
dateSelectionTransformers: [transformDateSelectionJoin],
|
|
datePointTransforms: [transformDatePoint],
|
|
dateSpanTransforms: [transformDateSpan],
|
|
viewPropsTransformers: [ResourceDataAdder, ResourceEventConfigAdder],
|
|
isPropsValid: isPropsValidWithResources,
|
|
externalDefTransforms: [transformExternalDef],
|
|
eventDropTransformers: [transformEventDrop],
|
|
optionChangeHandlers: optionChangeHandlers,
|
|
optionRefiners: OPTION_REFINERS,
|
|
listenerRefiners: LISTENER_REFINERS,
|
|
propSetHandlers: { resourceStore: handleResourceStore },
|
|
});
|
|
|
|
var ResourceDayTableJoiner = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTableJoiner, _super);
|
|
function ResourceDayTableJoiner() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceDayTableJoiner.prototype.transformSeg = function (seg, resourceDayTableModel, resourceI) {
|
|
var colRanges = resourceDayTableModel.computeColRanges(seg.firstCol, seg.lastCol, resourceI);
|
|
return colRanges.map(function (colRange) { return (__assign(__assign(__assign({}, seg), colRange), { isStart: seg.isStart && colRange.isStart, isEnd: seg.isEnd && colRange.isEnd })); });
|
|
};
|
|
return ResourceDayTableJoiner;
|
|
}(VResourceJoiner));
|
|
|
|
var ResourceDayTable = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTable, _super);
|
|
function ResourceDayTable() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.splitter = new VResourceSplitter();
|
|
_this.slicers = {};
|
|
_this.joiner = new ResourceDayTableJoiner();
|
|
_this.tableRef = createRef();
|
|
_this.isHitComboAllowed = function (hit0, hit1) {
|
|
var allowAcrossResources = _this.props.resourceDayTableModel.dayTableModel.colCnt === 1;
|
|
return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceDayTable.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var resourceDayTableModel = props.resourceDayTableModel, nextDayThreshold = props.nextDayThreshold, dateProfile = props.dateProfile;
|
|
var splitProps = this.splitter.splitProps(props);
|
|
this.slicers = mapHash(splitProps, function (split, resourceId) { return _this.slicers[resourceId] || new DayTableSlicer(); });
|
|
var slicedProps = mapHash(this.slicers, function (slicer, resourceId) { return slicer.sliceProps(splitProps[resourceId], dateProfile, nextDayThreshold, context, resourceDayTableModel.dayTableModel); });
|
|
return (createElement(Table, __assign({ forPrint: props.forPrint, ref: this.tableRef }, this.joiner.joinProps(slicedProps, resourceDayTableModel), { cells: resourceDayTableModel.cells, dateProfile: dateProfile, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, isHitComboAllowed: this.isHitComboAllowed })));
|
|
};
|
|
return ResourceDayTable;
|
|
}(DateComponent));
|
|
|
|
var ResourceDayTableView = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTableView, _super);
|
|
function ResourceDayTableView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.flattenResources = memoize(flattenResources);
|
|
_this.buildResourceDayTableModel = memoize(buildResourceDayTableModel);
|
|
_this.headerRef = createRef();
|
|
_this.tableRef = createRef();
|
|
return _this;
|
|
}
|
|
ResourceDayTableView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
|
|
var resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
|
|
var resourceDayTableModel = this.buildResourceDayTableModel(props.dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
|
|
var headerContent = options.dayHeaders && (createElement(ResourceDayHeader, { ref: this.headerRef, resources: resources, dateProfile: props.dateProfile, dates: resourceDayTableModel.dayTableModel.headerDates, datesRepDistinctDays: true }));
|
|
var bodyContent = function (contentArg) { return (createElement(ResourceDayTable, { ref: _this.tableRef, dateProfile: props.dateProfile, resourceDayTableModel: resourceDayTableModel, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint })); };
|
|
return options.dayMinWidth
|
|
? this.renderHScrollLayout(headerContent, bodyContent, resourceDayTableModel.colCnt, options.dayMinWidth)
|
|
: this.renderSimpleLayout(headerContent, bodyContent);
|
|
};
|
|
return ResourceDayTableView;
|
|
}(TableView));
|
|
function buildResourceDayTableModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
|
|
var dayTable = buildDayTableModel(dateProfile, dateProfileGenerator);
|
|
return datesAboveResources ?
|
|
new DayResourceTableModel(dayTable, resources, context) :
|
|
new ResourceDayTableModel(dayTable, resources, context);
|
|
}
|
|
|
|
var resourceDayGridPlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
resourceCommonPlugin,
|
|
dayGridPlugin,
|
|
],
|
|
initialView: 'resourceDayGridDay',
|
|
views: {
|
|
resourceDayGrid: {
|
|
type: 'dayGrid',
|
|
component: ResourceDayTableView,
|
|
needsResourceData: true,
|
|
},
|
|
resourceDayGridDay: {
|
|
type: 'resourceDayGrid',
|
|
duration: { days: 1 },
|
|
},
|
|
resourceDayGridWeek: {
|
|
type: 'resourceDayGrid',
|
|
duration: { weeks: 1 },
|
|
},
|
|
resourceDayGridMonth: {
|
|
type: 'resourceDayGrid',
|
|
duration: { months: 1 },
|
|
// TODO: wish we didn't have to C&P from dayGrid's file
|
|
monthMode: true,
|
|
fixedWeekCount: true,
|
|
},
|
|
},
|
|
});
|
|
|
|
var ResourceDayTimeColsJoiner = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTimeColsJoiner, _super);
|
|
function ResourceDayTimeColsJoiner() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceDayTimeColsJoiner.prototype.transformSeg = function (seg, resourceDayTable, resourceI) {
|
|
return [
|
|
__assign(__assign({}, seg), { col: resourceDayTable.computeCol(seg.col, resourceI) }),
|
|
];
|
|
};
|
|
return ResourceDayTimeColsJoiner;
|
|
}(VResourceJoiner));
|
|
|
|
var ResourceDayTimeCols = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTimeCols, _super);
|
|
function ResourceDayTimeCols() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.buildDayRanges = memoize(buildDayRanges);
|
|
_this.splitter = new VResourceSplitter();
|
|
_this.slicers = {};
|
|
_this.joiner = new ResourceDayTimeColsJoiner();
|
|
_this.timeColsRef = createRef();
|
|
_this.isHitComboAllowed = function (hit0, hit1) {
|
|
var allowAcrossResources = _this.dayRanges.length === 1;
|
|
return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceDayTimeCols.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var dateEnv = context.dateEnv, options = context.options;
|
|
var dateProfile = props.dateProfile, resourceDayTableModel = props.resourceDayTableModel;
|
|
var dayRanges = this.dayRanges = this.buildDayRanges(resourceDayTableModel.dayTableModel, dateProfile, dateEnv);
|
|
var splitProps = this.splitter.splitProps(props);
|
|
this.slicers = mapHash(splitProps, function (split, resourceId) { return _this.slicers[resourceId] || new DayTimeColsSlicer(); });
|
|
var slicedProps = mapHash(this.slicers, function (slicer, resourceId) { return slicer.sliceProps(splitProps[resourceId], dateProfile, null, context, dayRanges); });
|
|
return ( // TODO: would move this further down hierarchy, but sliceNowDate needs it
|
|
createElement(NowTimer, { unit: options.nowIndicator ? 'minute' : 'day' }, function (nowDate, todayRange) { return (createElement(TimeCols, __assign({ ref: _this.timeColsRef }, _this.joiner.joinProps(slicedProps, resourceDayTableModel), { dateProfile: dateProfile, axis: props.axis, slotDuration: props.slotDuration, slatMetas: props.slatMetas, cells: resourceDayTableModel.cells[0], tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, clientWidth: props.clientWidth, clientHeight: props.clientHeight, expandRows: props.expandRows, nowDate: nowDate, nowIndicatorSegs: options.nowIndicator && _this.buildNowIndicatorSegs(nowDate), todayRange: todayRange, onScrollTopRequest: props.onScrollTopRequest, forPrint: props.forPrint, onSlatCoords: props.onSlatCoords, isHitComboAllowed: _this.isHitComboAllowed }))); }));
|
|
};
|
|
ResourceDayTimeCols.prototype.buildNowIndicatorSegs = function (date) {
|
|
var nonResourceSegs = this.slicers[''].sliceNowDate(date, this.context, this.dayRanges);
|
|
return this.joiner.expandSegs(this.props.resourceDayTableModel, nonResourceSegs);
|
|
};
|
|
return ResourceDayTimeCols;
|
|
}(DateComponent));
|
|
|
|
var ResourceDayTimeColsView = /** @class */ (function (_super) {
|
|
__extends(ResourceDayTimeColsView, _super);
|
|
function ResourceDayTimeColsView() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.flattenResources = memoize(flattenResources);
|
|
_this.buildResourceTimeColsModel = memoize(buildResourceTimeColsModel);
|
|
_this.buildSlatMetas = memoize(buildSlatMetas);
|
|
return _this;
|
|
}
|
|
ResourceDayTimeColsView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options, dateEnv = context.dateEnv;
|
|
var dateProfile = props.dateProfile;
|
|
var splitProps = this.allDaySplitter.splitProps(props);
|
|
var resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
|
|
var resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
|
|
var resourceDayTableModel = this.buildResourceTimeColsModel(dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
|
|
var slatMetas = this.buildSlatMetas(dateProfile.slotMinTime, dateProfile.slotMaxTime, options.slotLabelInterval, options.slotDuration, dateEnv);
|
|
var dayMinWidth = options.dayMinWidth;
|
|
var hasAttachedAxis = !dayMinWidth;
|
|
var hasDetachedAxis = dayMinWidth;
|
|
var headerContent = options.dayHeaders && (createElement(ResourceDayHeader, { resources: resources, dates: resourceDayTableModel.dayTableModel.headerDates, dateProfile: dateProfile, datesRepDistinctDays: true, renderIntro: hasAttachedAxis ? this.renderHeadAxis : null }));
|
|
var allDayContent = (options.allDaySlot !== false) && (function (contentArg) { return (createElement(ResourceDayTable, __assign({}, splitProps.allDay, { dateProfile: dateProfile, resourceDayTableModel: resourceDayTableModel, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, renderRowIntro: hasAttachedAxis ? _this.renderTableRowAxis : null, showWeekNumbers: false, expandRows: false, headerAlignElRef: _this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }, _this.getAllDayMaxEventProps()))); });
|
|
var timeGridContent = function (contentArg) { return (createElement(ResourceDayTimeCols, __assign({}, splitProps.timed, { dateProfile: dateProfile, axis: hasAttachedAxis, slotDuration: options.slotDuration, slatMetas: slatMetas, resourceDayTableModel: resourceDayTableModel, tableColGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, onSlatCoords: _this.handleSlatCoords, expandRows: contentArg.expandRows, forPrint: props.forPrint, onScrollTopRequest: _this.handleScrollTopRequest }))); };
|
|
return hasDetachedAxis
|
|
? this.renderHScrollLayout(headerContent, allDayContent, timeGridContent, resourceDayTableModel.colCnt, dayMinWidth, slatMetas, this.state.slatCoords)
|
|
: this.renderSimpleLayout(headerContent, allDayContent, timeGridContent);
|
|
};
|
|
return ResourceDayTimeColsView;
|
|
}(TimeColsView));
|
|
function buildResourceTimeColsModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
|
|
var dayTable = buildTimeColsModel(dateProfile, dateProfileGenerator);
|
|
return datesAboveResources ?
|
|
new DayResourceTableModel(dayTable, resources, context) :
|
|
new ResourceDayTableModel(dayTable, resources, context);
|
|
}
|
|
|
|
var resourceTimeGridPlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
resourceCommonPlugin,
|
|
timeGridPlugin,
|
|
],
|
|
initialView: 'resourceTimeGridDay',
|
|
views: {
|
|
resourceTimeGrid: {
|
|
type: 'timeGrid',
|
|
component: ResourceDayTimeColsView,
|
|
needsResourceData: true,
|
|
},
|
|
resourceTimeGridDay: {
|
|
type: 'resourceTimeGrid',
|
|
duration: { days: 1 },
|
|
},
|
|
resourceTimeGridWeek: {
|
|
type: 'resourceTimeGrid',
|
|
duration: { weeks: 1 },
|
|
},
|
|
},
|
|
});
|
|
|
|
/*
|
|
Renders the DOM responsible for the subrow expander area,
|
|
as well as the space before it (used to align expanders of similar depths)
|
|
*/
|
|
function ExpanderIcon(_a) {
|
|
var depth = _a.depth, hasChildren = _a.hasChildren, isExpanded = _a.isExpanded, onExpanderClick = _a.onExpanderClick;
|
|
var nodes = [];
|
|
for (var i = 0; i < depth; i += 1) {
|
|
nodes.push(createElement("span", { className: "fc-icon" }));
|
|
}
|
|
var iconClassNames = ['fc-icon'];
|
|
if (hasChildren) {
|
|
if (isExpanded) {
|
|
iconClassNames.push('fc-icon-minus-square');
|
|
}
|
|
else {
|
|
iconClassNames.push('fc-icon-plus-square');
|
|
}
|
|
}
|
|
nodes.push(createElement("span", { className: 'fc-datagrid-expander' + (hasChildren ? '' : ' fc-datagrid-expander-placeholder'), onClick: onExpanderClick },
|
|
createElement("span", { className: iconClassNames.join(' ') })));
|
|
return createElement.apply(void 0, __spreadArray([Fragment, {}], nodes));
|
|
}
|
|
|
|
function refineHookProps$1(raw) {
|
|
return {
|
|
resource: new ResourceApi(raw.context, raw.resource),
|
|
fieldValue: raw.fieldValue,
|
|
view: raw.context.viewApi,
|
|
};
|
|
}
|
|
|
|
var SpreadsheetIndividualCellInner = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetIndividualCellInner, _super);
|
|
function SpreadsheetIndividualCellInner() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
SpreadsheetIndividualCellInner.prototype.render = function () {
|
|
var props = this.props;
|
|
return (createElement(ContentHook, { hookProps: props.hookProps, content: props.colSpec.cellContent, defaultContent: renderResourceInner }, function (innerElRef, innerContent) { return (createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent)); }));
|
|
};
|
|
return SpreadsheetIndividualCellInner;
|
|
}(BaseComponent));
|
|
function renderResourceInner(hookProps) {
|
|
return hookProps.fieldValue || createElement(Fragment, null, "\u00A0");
|
|
}
|
|
|
|
// worth making a PureComponent? (because of innerHeight)
|
|
var SpreadsheetIndividualCell = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetIndividualCell, _super);
|
|
function SpreadsheetIndividualCell() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.refineHookProps = memoizeObjArg(refineHookProps$1);
|
|
_this.normalizeClassNames = buildClassNameNormalizer();
|
|
_this.onExpanderClick = function (ev) {
|
|
var props = _this.props;
|
|
if (props.hasChildren) {
|
|
_this.context.dispatch({
|
|
type: 'SET_RESOURCE_ENTITY_EXPANDED',
|
|
id: props.resource.id,
|
|
isExpanded: !props.isExpanded,
|
|
});
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
SpreadsheetIndividualCell.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var colSpec = props.colSpec;
|
|
var hookProps = this.refineHookProps({
|
|
resource: props.resource,
|
|
fieldValue: props.fieldValue,
|
|
context: context,
|
|
});
|
|
var customClassNames = this.normalizeClassNames(colSpec.cellClassNames, hookProps);
|
|
return (createElement(MountHook, { hookProps: hookProps, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, function (rootElRef) { return (createElement("td", { ref: rootElRef, role: "gridcell", "data-resource-id": props.resource.id, className: [
|
|
'fc-datagrid-cell',
|
|
'fc-resource',
|
|
].concat(customClassNames).join(' ') },
|
|
createElement("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
|
|
createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
|
|
colSpec.isMain && (createElement(ExpanderIcon, { depth: props.depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, onExpanderClick: _this.onExpanderClick })),
|
|
createElement(SpreadsheetIndividualCellInner, { hookProps: hookProps, colSpec: colSpec }))))); }));
|
|
};
|
|
return SpreadsheetIndividualCell;
|
|
}(BaseComponent));
|
|
|
|
// for VERTICAL cell grouping, in spreadsheet area
|
|
var SpreadsheetGroupCell = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetGroupCell, _super);
|
|
function SpreadsheetGroupCell() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
SpreadsheetGroupCell.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var colSpec = props.colSpec;
|
|
var hookProps = {
|
|
groupValue: props.fieldValue,
|
|
view: context.viewApi,
|
|
};
|
|
// a grouped cell. no data that is specific to this specific resource
|
|
// `colSpec` is for the group. a GroupSpec :(
|
|
return (createElement(RenderHook, { hookProps: hookProps, classNames: colSpec.cellClassNames, content: colSpec.cellContent, defaultContent: renderGroupInner, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (
|
|
// TODO: make data-attr with group value?
|
|
createElement("td", { ref: rootElRef, role: "gridcell", rowSpan: props.rowSpan, className: ['fc-datagrid-cell', 'fc-resource-group'].concat(classNames).join(' ') },
|
|
createElement("div", { className: "fc-datagrid-cell-frame fc-datagrid-cell-frame-liquid" },
|
|
createElement("div", { className: "fc-datagrid-cell-cushion fc-sticky", ref: innerElRef }, innerContent)))); }));
|
|
};
|
|
return SpreadsheetGroupCell;
|
|
}(BaseComponent));
|
|
function renderGroupInner(hookProps) {
|
|
return hookProps.groupValue || createElement(Fragment, null, "\u00A0");
|
|
}
|
|
|
|
var SpreadsheetRow = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetRow, _super);
|
|
function SpreadsheetRow() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
SpreadsheetRow.prototype.render = function () {
|
|
var props = this.props;
|
|
var resource = props.resource, rowSpans = props.rowSpans, depth = props.depth;
|
|
var resourceFields = buildResourceFields(resource); // slightly inefficient. already done up the call stack
|
|
return (createElement("tr", { role: "row" }, props.colSpecs.map(function (colSpec, i) {
|
|
var rowSpan = rowSpans[i];
|
|
if (rowSpan === 0) { // not responsible for group-based rows. VRowGroup is
|
|
return null;
|
|
}
|
|
if (rowSpan == null) {
|
|
rowSpan = 1;
|
|
}
|
|
var fieldValue = colSpec.field ? resourceFields[colSpec.field] :
|
|
(resource.title || getPublicId(resource.id));
|
|
if (rowSpan > 1) {
|
|
return (createElement(SpreadsheetGroupCell, { key: i, colSpec: colSpec, fieldValue: fieldValue, rowSpan: rowSpan }));
|
|
}
|
|
return (createElement(SpreadsheetIndividualCell, { key: i, colSpec: colSpec, resource: resource, fieldValue: fieldValue, depth: depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, innerHeight: props.innerHeight }));
|
|
})));
|
|
};
|
|
return SpreadsheetRow;
|
|
}(BaseComponent));
|
|
SpreadsheetRow.addPropsEquality({
|
|
rowSpans: isArraysEqual,
|
|
});
|
|
|
|
// for HORIZONTAL cell grouping, in spreadsheet area
|
|
var SpreadsheetGroupRow = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetGroupRow, _super);
|
|
function SpreadsheetGroupRow() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.innerInnerRef = createRef();
|
|
_this.onExpanderClick = function () {
|
|
var props = _this.props;
|
|
_this.context.dispatch({
|
|
type: 'SET_RESOURCE_ENTITY_EXPANDED',
|
|
id: props.id,
|
|
isExpanded: !props.isExpanded,
|
|
});
|
|
};
|
|
return _this;
|
|
}
|
|
SpreadsheetGroupRow.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var hookProps = { groupValue: props.group.value, view: context.viewApi };
|
|
var spec = props.group.spec;
|
|
return (createElement("tr", { role: "row" },
|
|
createElement(RenderHook, { hookProps: hookProps, classNames: spec.labelClassNames, content: spec.labelContent, defaultContent: renderCellInner, didMount: spec.labelDidMount, willUnmount: spec.labelWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef,
|
|
// ARIA TODO: not really a columnheader
|
|
// extremely tedious to make this aria-compliant,
|
|
// to assign multiple headers to each cell
|
|
// https://www.w3.org/WAI/tutorials/tables/multi-level/
|
|
role: "columnheader", scope: "colgroup", colSpan: props.spreadsheetColCnt, className: [
|
|
'fc-datagrid-cell',
|
|
'fc-resource-group',
|
|
context.theme.getClass('tableCellShaded'),
|
|
].concat(classNames).join(' ') },
|
|
createElement("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
|
|
createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner", ref: _this.innerInnerRef },
|
|
createElement(ExpanderIcon, { depth: 0, hasChildren: true, isExpanded: props.isExpanded, onExpanderClick: _this.onExpanderClick }),
|
|
createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent))))); })));
|
|
};
|
|
return SpreadsheetGroupRow;
|
|
}(BaseComponent));
|
|
SpreadsheetGroupRow.addPropsEquality({
|
|
group: isGroupsEqual,
|
|
});
|
|
function renderCellInner(hookProps) {
|
|
return hookProps.groupValue || createElement(Fragment, null, "\u00A0");
|
|
}
|
|
|
|
var SPREADSHEET_COL_MIN_WIDTH = 20;
|
|
var SpreadsheetHeader = /** @class */ (function (_super) {
|
|
__extends(SpreadsheetHeader, _super);
|
|
function SpreadsheetHeader() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.resizerElRefs = new RefMap(_this._handleColResizerEl.bind(_this));
|
|
_this.colDraggings = {};
|
|
return _this;
|
|
}
|
|
SpreadsheetHeader.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this.props, colSpecs = _a.colSpecs, superHeaderRendering = _a.superHeaderRendering, rowInnerHeights = _a.rowInnerHeights;
|
|
var hookProps = { view: this.context.viewApi };
|
|
var rowNodes = [];
|
|
rowInnerHeights = rowInnerHeights.slice(); // copy, because we're gonna pop
|
|
if (superHeaderRendering) {
|
|
var rowInnerHeight_1 = rowInnerHeights.shift();
|
|
rowNodes.push(createElement("tr", { key: "row-super", role: "row" },
|
|
createElement(RenderHook, { hookProps: hookProps, classNames: superHeaderRendering.headerClassNames, content: superHeaderRendering.headerContent, didMount: superHeaderRendering.headerDidMount, willUnmount: superHeaderRendering.headerWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef, role: "columnheader", scope: "colgroup", colSpan: colSpecs.length, className: [
|
|
'fc-datagrid-cell',
|
|
'fc-datagrid-cell-super',
|
|
].concat(classNames).join(' ') },
|
|
createElement("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight_1 } },
|
|
createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner", ref: innerElRef }, innerContent)))); })));
|
|
}
|
|
var rowInnerHeight = rowInnerHeights.shift();
|
|
rowNodes.push(createElement("tr", { key: "row", role: "row" }, colSpecs.map(function (colSpec, i) {
|
|
var isLastCol = i === (colSpecs.length - 1);
|
|
// need empty inner div for abs positioning for resizer
|
|
return (createElement(RenderHook, { key: i, hookProps: hookProps, classNames: colSpec.headerClassNames, content: colSpec.headerContent, didMount: colSpec.headerDidMount, willUnmount: colSpec.headerWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("th", { ref: rootElRef, role: "columnheader", className: ['fc-datagrid-cell'].concat(classNames).join(' ') },
|
|
createElement("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight } },
|
|
createElement("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
|
|
colSpec.isMain && (createElement("span", { className: "fc-datagrid-expander fc-datagrid-expander-placeholder" },
|
|
createElement("span", { className: "fc-icon" }))),
|
|
createElement("span", { className: "fc-datagrid-cell-main", ref: innerElRef }, innerContent)),
|
|
!isLastCol &&
|
|
createElement("div", { className: "fc-datagrid-cell-resizer", ref: _this.resizerElRefs.createRef(i) })))); }));
|
|
})));
|
|
return (createElement(Fragment, null, rowNodes));
|
|
};
|
|
SpreadsheetHeader.prototype._handleColResizerEl = function (resizerEl, index) {
|
|
var colDraggings = this.colDraggings;
|
|
if (!resizerEl) {
|
|
var dragging = colDraggings[index];
|
|
if (dragging) {
|
|
dragging.destroy();
|
|
delete colDraggings[index];
|
|
}
|
|
}
|
|
else {
|
|
var dragging = this.initColResizing(resizerEl, parseInt(index, 10));
|
|
if (dragging) {
|
|
colDraggings[index] = dragging;
|
|
}
|
|
}
|
|
};
|
|
SpreadsheetHeader.prototype.initColResizing = function (resizerEl, index) {
|
|
var _a = this.context, pluginHooks = _a.pluginHooks, isRtl = _a.isRtl;
|
|
var onColWidthChange = this.props.onColWidthChange;
|
|
var ElementDraggingImpl = pluginHooks.elementDraggingImpl;
|
|
if (ElementDraggingImpl) {
|
|
var dragging = new ElementDraggingImpl(resizerEl);
|
|
var startWidth_1; // of just the single column
|
|
var currentWidths_1; // of all columns
|
|
dragging.emitter.on('dragstart', function () {
|
|
var allCells = findElements(elementClosest(resizerEl, 'tr'), 'th');
|
|
currentWidths_1 = allCells.map(function (cellEl) { return (cellEl.getBoundingClientRect().width); });
|
|
startWidth_1 = currentWidths_1[index];
|
|
});
|
|
dragging.emitter.on('dragmove', function (pev) {
|
|
currentWidths_1[index] = Math.max(startWidth_1 + pev.deltaX * (isRtl ? -1 : 1), SPREADSHEET_COL_MIN_WIDTH);
|
|
if (onColWidthChange) {
|
|
onColWidthChange(currentWidths_1.slice()); // send a copy since currentWidths continues to be mutated
|
|
}
|
|
});
|
|
dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
|
|
return dragging;
|
|
}
|
|
return null;
|
|
};
|
|
return SpreadsheetHeader;
|
|
}(BaseComponent));
|
|
|
|
var ResourceTimelineLaneMisc = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineLaneMisc, _super);
|
|
function ResourceTimelineLaneMisc() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceTimelineLaneMisc.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var hookProps = { resource: new ResourceApi(context, props.resource) }; // just easier to make directly
|
|
return (createElement(ContentHook, { hookProps: hookProps, content: context.options.resourceLaneContent }, function (innerElRef, innerContent) { return (innerContent && // TODO: test how this would interfere with height
|
|
createElement("div", { className: "fc-timeline-lane-misc", ref: innerElRef }, innerContent)); }));
|
|
};
|
|
return ResourceTimelineLaneMisc;
|
|
}(BaseComponent));
|
|
|
|
var ResourceTimelineLane = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineLane, _super);
|
|
function ResourceTimelineLane() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.refineHookProps = memoizeObjArg(refineHookProps);
|
|
_this.normalizeClassNames = buildClassNameNormalizer();
|
|
_this.handleHeightChange = function (innerEl, isStable) {
|
|
if (_this.props.onHeightChange) {
|
|
_this.props.onHeightChange(
|
|
// would want to use own <tr> ref, but not guaranteed to be ready when this fires
|
|
elementClosest(innerEl, 'tr'), isStable);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceTimelineLane.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var options = context.options;
|
|
var hookProps = this.refineHookProps({ resource: props.resource, context: context });
|
|
var customClassNames = this.normalizeClassNames(options.resourceLaneClassNames, hookProps);
|
|
return (createElement("tr", { ref: props.elRef },
|
|
createElement(MountHook, { hookProps: hookProps, didMount: options.resourceLaneDidMount, willUnmount: options.resourceLaneWillUnmount }, function (rootElRef) { return (createElement("td", { ref: rootElRef, className: ['fc-timeline-lane', 'fc-resource'].concat(customClassNames).join(' '), "data-resource-id": props.resource.id },
|
|
createElement("div", { className: "fc-timeline-lane-frame", style: { height: props.innerHeight } },
|
|
createElement(ResourceTimelineLaneMisc, { resource: props.resource }),
|
|
createElement(TimelineLane, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: props.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: props.timelineCoords, onHeightChange: _this.handleHeightChange, resourceId: props.resource.id })))); }))); // important NOT to do liquid-height. dont want to shrink height smaller than content
|
|
};
|
|
return ResourceTimelineLane;
|
|
}(BaseComponent));
|
|
function refineHookProps(raw) {
|
|
return {
|
|
resource: new ResourceApi(raw.context, raw.resource),
|
|
};
|
|
}
|
|
|
|
/*
|
|
parallels the SpreadsheetGroupRow
|
|
*/
|
|
var DividerRow = /** @class */ (function (_super) {
|
|
__extends(DividerRow, _super);
|
|
function DividerRow() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
DividerRow.prototype.render = function () {
|
|
var _this = this;
|
|
var props = this.props;
|
|
var renderingHooks = this.props.renderingHooks;
|
|
var hookProps = { groupValue: props.groupValue, view: this.context.viewApi };
|
|
return (createElement("tr", { ref: props.elRef },
|
|
createElement(RenderHook, { hookProps: hookProps, classNames: renderingHooks.laneClassNames, content: renderingHooks.laneContent, didMount: renderingHooks.laneDidMount, willUnmount: renderingHooks.laneWillUnmount }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("td", { ref: rootElRef, className: [
|
|
'fc-timeline-lane',
|
|
'fc-resource-group',
|
|
_this.context.theme.getClass('tableCellShaded'),
|
|
].concat(classNames).join(' ') },
|
|
createElement("div", { style: { height: props.innerHeight }, ref: innerElRef }, innerContent))); })));
|
|
};
|
|
return DividerRow;
|
|
}(BaseComponent));
|
|
|
|
var ResourceTimelineLanesBody = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineLanesBody, _super);
|
|
function ResourceTimelineLanesBody() {
|
|
return _super !== null && _super.apply(this, arguments) || this;
|
|
}
|
|
ResourceTimelineLanesBody.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
var rowElRefs = props.rowElRefs, innerHeights = props.innerHeights;
|
|
return (createElement("tbody", null, props.rowNodes.map(function (node, index) {
|
|
if (node.group) {
|
|
return (createElement(DividerRow, { key: node.id, elRef: rowElRefs.createRef(node.id), groupValue: node.group.value, renderingHooks: node.group.spec, innerHeight: innerHeights[index] || '' }));
|
|
}
|
|
if (node.resource) {
|
|
var resource = node.resource;
|
|
return (createElement(ResourceTimelineLane, __assign({ key: node.id, elRef: rowElRefs.createRef(node.id) }, props.splitProps[resource.id], { resource: resource, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: context.options.nextDayThreshold, businessHours: resource.businessHours || props.fallbackBusinessHours, innerHeight: innerHeights[index] || '', timelineCoords: props.slatCoords, onHeightChange: props.onRowHeightChange })));
|
|
}
|
|
return null;
|
|
})));
|
|
};
|
|
return ResourceTimelineLanesBody;
|
|
}(BaseComponent));
|
|
|
|
var ResourceTimelineLanes = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineLanes, _super);
|
|
function ResourceTimelineLanes() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.rootElRef = createRef();
|
|
_this.rowElRefs = new RefMap();
|
|
return _this;
|
|
}
|
|
ResourceTimelineLanes.prototype.render = function () {
|
|
var _a = this, props = _a.props, context = _a.context;
|
|
return (createElement("table", { ref: this.rootElRef, "aria-hidden": true, className: 'fc-scrollgrid-sync-table ' + context.theme.getClass('table'), style: {
|
|
minWidth: props.tableMinWidth,
|
|
width: props.clientWidth,
|
|
height: props.minHeight,
|
|
} },
|
|
createElement(ResourceTimelineLanesBody, { rowElRefs: this.rowElRefs, rowNodes: props.rowNodes, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, splitProps: props.splitProps, fallbackBusinessHours: props.fallbackBusinessHours, slatCoords: props.slatCoords, innerHeights: props.innerHeights, onRowHeightChange: props.onRowHeightChange })));
|
|
};
|
|
ResourceTimelineLanes.prototype.componentDidMount = function () {
|
|
this.updateCoords();
|
|
};
|
|
ResourceTimelineLanes.prototype.componentDidUpdate = function () {
|
|
this.updateCoords();
|
|
};
|
|
ResourceTimelineLanes.prototype.componentWillUnmount = function () {
|
|
if (this.props.onRowCoords) {
|
|
this.props.onRowCoords(null);
|
|
}
|
|
};
|
|
ResourceTimelineLanes.prototype.updateCoords = function () {
|
|
var props = this.props;
|
|
if (props.onRowCoords && props.clientWidth !== null) { // a populated clientWidth means sizing has stabilized
|
|
this.props.onRowCoords(new PositionCache(this.rootElRef.current, collectRowEls(this.rowElRefs.currentMap, props.rowNodes), false, true));
|
|
}
|
|
};
|
|
return ResourceTimelineLanes;
|
|
}(BaseComponent));
|
|
function collectRowEls(elMap, rowNodes) {
|
|
return rowNodes.map(function (rowNode) { return elMap[rowNode.id]; });
|
|
}
|
|
|
|
var ResourceTimelineGrid = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineGrid, _super);
|
|
function ResourceTimelineGrid() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.computeHasResourceBusinessHours = memoize(computeHasResourceBusinessHours);
|
|
_this.resourceSplitter = new ResourceSplitter(); // doesn't let it do businessHours tho
|
|
_this.bgSlicer = new TimelineLaneSlicer();
|
|
_this.slatsRef = createRef(); // needed for Hit creation :(
|
|
_this.state = {
|
|
slatCoords: null,
|
|
};
|
|
_this.handleEl = function (el) {
|
|
if (el) {
|
|
_this.context.registerInteractiveComponent(_this, { el: el });
|
|
}
|
|
else {
|
|
_this.context.unregisterInteractiveComponent(_this);
|
|
}
|
|
};
|
|
_this.handleSlatCoords = function (slatCoords) {
|
|
_this.setState({ slatCoords: slatCoords });
|
|
if (_this.props.onSlatCoords) {
|
|
_this.props.onSlatCoords(slatCoords);
|
|
}
|
|
};
|
|
_this.handleRowCoords = function (rowCoords) {
|
|
_this.rowCoords = rowCoords;
|
|
if (_this.props.onRowCoords) {
|
|
_this.props.onRowCoords(rowCoords);
|
|
}
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceTimelineGrid.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var dateProfile = props.dateProfile, tDateProfile = props.tDateProfile;
|
|
var timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
|
|
var hasResourceBusinessHours = this.computeHasResourceBusinessHours(props.rowNodes);
|
|
var splitProps = this.resourceSplitter.splitProps(props);
|
|
var bgLaneProps = splitProps[''];
|
|
var bgSlicedProps = this.bgSlicer.sliceProps(bgLaneProps, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't need to pass in the rest of these args...
|
|
dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
|
|
// WORKAROUND: make ignore slatCoords when out of sync with dateProfile
|
|
var slatCoords = state.slatCoords && state.slatCoords.dateProfile === props.dateProfile ? state.slatCoords : null;
|
|
return (createElement("div", { ref: this.handleEl, className: [
|
|
'fc-timeline-body',
|
|
props.expandRows ? 'fc-timeline-body-expandrows' : '',
|
|
].join(' '), style: { minWidth: props.tableMinWidth } },
|
|
createElement(NowTimer, { unit: timerUnit }, function (nowDate, todayRange) { return (createElement(Fragment, null,
|
|
createElement(TimelineSlats, { ref: _this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: _this.handleSlatCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
|
|
createElement(TimelineLaneBg, { businessHourSegs: hasResourceBusinessHours ? null : bgSlicedProps.businessHourSegs, bgEventSegs: bgSlicedProps.bgEventSegs, timelineCoords: slatCoords,
|
|
// empty array will result in unnecessary rerenders?
|
|
eventResizeSegs: (bgSlicedProps.eventResize ? bgSlicedProps.eventResize.segs : []), dateSelectionSegs: bgSlicedProps.dateSelectionSegs, nowDate: nowDate, todayRange: todayRange }),
|
|
createElement(ResourceTimelineLanes, { rowNodes: props.rowNodes, dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, splitProps: splitProps, fallbackBusinessHours: hasResourceBusinessHours ? props.businessHours : null, clientWidth: props.clientWidth, minHeight: props.expandRows ? props.clientHeight : '', tableMinWidth: props.tableMinWidth, innerHeights: props.rowInnerHeights, slatCoords: slatCoords, onRowCoords: _this.handleRowCoords, onRowHeightChange: props.onRowHeightChange }),
|
|
(context.options.nowIndicator && slatCoords && slatCoords.isDateInRange(nowDate)) && (createElement("div", { className: "fc-timeline-now-indicator-container" },
|
|
createElement(NowIndicatorRoot, { isAxis: false, date: nowDate }, function (rootElRef, classNames, innerElRef, innerContent) { return (createElement("div", { ref: rootElRef, className: ['fc-timeline-now-indicator-line'].concat(classNames).join(' '), style: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl) }, innerContent)); }))))); })));
|
|
};
|
|
// Hit System
|
|
// ------------------------------------------------------------------------------------------
|
|
ResourceTimelineGrid.prototype.queryHit = function (positionLeft, positionTop) {
|
|
var rowCoords = this.rowCoords;
|
|
var rowIndex = rowCoords.topToIndex(positionTop);
|
|
if (rowIndex != null) {
|
|
var resource = this.props.rowNodes[rowIndex].resource;
|
|
if (resource) { // not a group
|
|
var slatHit = this.slatsRef.current.positionToHit(positionLeft);
|
|
if (slatHit) {
|
|
return {
|
|
dateProfile: this.props.dateProfile,
|
|
dateSpan: {
|
|
range: slatHit.dateSpan.range,
|
|
allDay: slatHit.dateSpan.allDay,
|
|
resourceId: resource.id,
|
|
},
|
|
rect: {
|
|
left: slatHit.left,
|
|
right: slatHit.right,
|
|
top: rowCoords.tops[rowIndex],
|
|
bottom: rowCoords.bottoms[rowIndex],
|
|
},
|
|
dayEl: slatHit.dayEl,
|
|
layer: 0,
|
|
};
|
|
}
|
|
}
|
|
}
|
|
return null;
|
|
};
|
|
return ResourceTimelineGrid;
|
|
}(DateComponent));
|
|
function computeHasResourceBusinessHours(rowNodes) {
|
|
for (var _i = 0, rowNodes_1 = rowNodes; _i < rowNodes_1.length; _i++) {
|
|
var node = rowNodes_1[_i];
|
|
var resource = node.resource;
|
|
if (resource && resource.businessHours) {
|
|
return true;
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
|
|
var MIN_RESOURCE_AREA_WIDTH = 30; // definitely bigger than scrollbars
|
|
// RENAME?
|
|
var ResourceTimelineViewLayout = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineViewLayout, _super);
|
|
function ResourceTimelineViewLayout() {
|
|
var _this = _super !== null && _super.apply(this, arguments) || this;
|
|
_this.scrollGridRef = createRef();
|
|
_this.timeBodyScrollerElRef = createRef();
|
|
_this.spreadsheetHeaderChunkElRef = createRef();
|
|
_this.rootElRef = createRef();
|
|
_this.ensureScrollGridResizeId = 0;
|
|
_this.state = {
|
|
resourceAreaWidthOverride: null,
|
|
};
|
|
/*
|
|
ghetto debounce. don't race with ScrollGrid's resizing delay. solves #6140
|
|
*/
|
|
_this.ensureScrollGridResize = function () {
|
|
if (_this.ensureScrollGridResizeId) {
|
|
clearTimeout(_this.ensureScrollGridResizeId);
|
|
}
|
|
_this.ensureScrollGridResizeId = setTimeout(function () {
|
|
_this.scrollGridRef.current.handleSizing(false);
|
|
}, config.SCROLLGRID_RESIZE_INTERVAL + 1);
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceTimelineViewLayout.prototype.render = function () {
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options;
|
|
var stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
|
|
var stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
|
|
var sections = [
|
|
{
|
|
type: 'header',
|
|
key: 'header',
|
|
syncRowHeights: true,
|
|
isSticky: stickyHeaderDates,
|
|
chunks: [
|
|
{
|
|
key: 'datagrid',
|
|
elRef: this.spreadsheetHeaderChunkElRef,
|
|
// TODO: allow the content to specify this. have general-purpose 'content' with obj with keys
|
|
tableClassName: 'fc-datagrid-header',
|
|
rowContent: props.spreadsheetHeaderRows,
|
|
},
|
|
{
|
|
key: 'divider',
|
|
outerContent: (createElement("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
|
|
},
|
|
{
|
|
key: 'timeline',
|
|
content: props.timeHeaderContent,
|
|
},
|
|
],
|
|
},
|
|
{
|
|
type: 'body',
|
|
key: 'body',
|
|
syncRowHeights: true,
|
|
liquid: true,
|
|
expandRows: Boolean(options.expandRows),
|
|
chunks: [
|
|
{
|
|
key: 'datagrid',
|
|
tableClassName: 'fc-datagrid-body',
|
|
rowContent: props.spreadsheetBodyRows,
|
|
},
|
|
{
|
|
key: 'divider',
|
|
outerContent: (createElement("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
|
|
},
|
|
{
|
|
key: 'timeline',
|
|
scrollerElRef: this.timeBodyScrollerElRef,
|
|
content: props.timeBodyContent,
|
|
},
|
|
],
|
|
},
|
|
];
|
|
if (stickyFooterScrollbar) {
|
|
sections.push({
|
|
type: 'footer',
|
|
key: 'footer',
|
|
isSticky: true,
|
|
chunks: [
|
|
{
|
|
key: 'datagrid',
|
|
content: renderScrollShim,
|
|
},
|
|
{
|
|
key: 'divider',
|
|
outerContent: (createElement("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
|
|
},
|
|
{
|
|
key: 'timeline',
|
|
content: renderScrollShim,
|
|
},
|
|
],
|
|
});
|
|
}
|
|
var resourceAreaWidth = state.resourceAreaWidthOverride != null
|
|
? state.resourceAreaWidthOverride
|
|
: options.resourceAreaWidth;
|
|
return (createElement(ScrollGrid, { ref: this.scrollGridRef, elRef: this.rootElRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
|
|
{ cols: props.spreadsheetCols, width: resourceAreaWidth },
|
|
{ cols: [] },
|
|
{ cols: props.timeCols },
|
|
], sections: sections }));
|
|
};
|
|
ResourceTimelineViewLayout.prototype.forceTimeScroll = function (left) {
|
|
var scrollGrid = this.scrollGridRef.current;
|
|
scrollGrid.forceScrollLeft(2, left); // 2 = the time area
|
|
};
|
|
ResourceTimelineViewLayout.prototype.forceResourceScroll = function (top) {
|
|
var scrollGrid = this.scrollGridRef.current;
|
|
scrollGrid.forceScrollTop(1, top); // 1 = the body
|
|
};
|
|
ResourceTimelineViewLayout.prototype.getResourceScroll = function () {
|
|
var timeBodyScrollerEl = this.timeBodyScrollerElRef.current;
|
|
return timeBodyScrollerEl.scrollTop;
|
|
};
|
|
// Resource Area Resizing
|
|
// ------------------------------------------------------------------------------------------
|
|
// NOTE: a callback Ref for the resizer was firing multiple times with same elements (Preact)
|
|
// that's why we use spreadsheetResizerElRef instead
|
|
ResourceTimelineViewLayout.prototype.componentDidMount = function () {
|
|
this.initSpreadsheetResizing();
|
|
};
|
|
ResourceTimelineViewLayout.prototype.componentWillUnmount = function () {
|
|
this.destroySpreadsheetResizing();
|
|
};
|
|
ResourceTimelineViewLayout.prototype.initSpreadsheetResizing = function () {
|
|
var _this = this;
|
|
var _a = this.context, isRtl = _a.isRtl, pluginHooks = _a.pluginHooks;
|
|
var ElementDraggingImpl = pluginHooks.elementDraggingImpl;
|
|
var spreadsheetHeadEl = this.spreadsheetHeaderChunkElRef.current;
|
|
if (ElementDraggingImpl) {
|
|
var rootEl_1 = this.rootElRef.current;
|
|
var dragging = this.spreadsheetResizerDragging = new ElementDraggingImpl(rootEl_1, '.fc-resource-timeline-divider');
|
|
var dragStartWidth_1;
|
|
var viewWidth_1;
|
|
dragging.emitter.on('dragstart', function () {
|
|
dragStartWidth_1 = spreadsheetHeadEl.getBoundingClientRect().width;
|
|
viewWidth_1 = rootEl_1.getBoundingClientRect().width;
|
|
});
|
|
dragging.emitter.on('dragmove', function (pev) {
|
|
var newWidth = dragStartWidth_1 + pev.deltaX * (isRtl ? -1 : 1);
|
|
newWidth = Math.max(newWidth, MIN_RESOURCE_AREA_WIDTH);
|
|
newWidth = Math.min(newWidth, viewWidth_1 - MIN_RESOURCE_AREA_WIDTH);
|
|
// scrollgrid will ignore resize requests if there are too many :|
|
|
_this.setState({
|
|
resourceAreaWidthOverride: newWidth,
|
|
}, _this.ensureScrollGridResize);
|
|
});
|
|
dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
|
|
}
|
|
};
|
|
ResourceTimelineViewLayout.prototype.destroySpreadsheetResizing = function () {
|
|
if (this.spreadsheetResizerDragging) {
|
|
this.spreadsheetResizerDragging.destroy();
|
|
}
|
|
};
|
|
return ResourceTimelineViewLayout;
|
|
}(BaseComponent));
|
|
|
|
var ResourceTimelineView = /** @class */ (function (_super) {
|
|
__extends(ResourceTimelineView, _super);
|
|
function ResourceTimelineView(props, context) {
|
|
var _this = _super.call(this, props, context) || this;
|
|
_this.processColOptions = memoize(processColOptions);
|
|
_this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
|
|
_this.hasNesting = memoize(hasNesting);
|
|
_this.buildRowNodes = memoize(buildRowNodes);
|
|
_this.layoutRef = createRef();
|
|
_this.rowNodes = [];
|
|
_this.renderedRowNodes = [];
|
|
_this.buildRowIndex = memoize(buildRowIndex);
|
|
_this.handleSlatCoords = function (slatCoords) {
|
|
_this.setState({ slatCoords: slatCoords });
|
|
};
|
|
_this.handleRowCoords = function (rowCoords) {
|
|
_this.rowCoords = rowCoords;
|
|
_this.scrollResponder.update(false); // TODO: could eliminate this if rowCoords lived in state
|
|
};
|
|
_this.handleMaxCushionWidth = function (slotCushionMaxWidth) {
|
|
_this.setState({
|
|
slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
|
|
});
|
|
};
|
|
// Scrolling
|
|
// ------------------------------------------------------------------------------------------------------------------
|
|
// this is useful for scrolling prev/next dates while resource is scrolled down
|
|
_this.handleScrollLeftRequest = function (scrollLeft) {
|
|
var layout = _this.layoutRef.current;
|
|
layout.forceTimeScroll(scrollLeft);
|
|
};
|
|
_this.handleScrollRequest = function (request) {
|
|
var rowCoords = _this.rowCoords;
|
|
var layout = _this.layoutRef.current;
|
|
var rowId = request.rowId || request.resourceId;
|
|
if (rowCoords) {
|
|
if (rowId) {
|
|
var rowIdToIndex = _this.buildRowIndex(_this.renderedRowNodes);
|
|
var index = rowIdToIndex[rowId];
|
|
if (index != null) {
|
|
var scrollTop = (request.fromBottom != null ?
|
|
rowCoords.bottoms[index] - request.fromBottom : // pixels from bottom edge
|
|
rowCoords.tops[index] // just use top edge
|
|
);
|
|
layout.forceResourceScroll(scrollTop);
|
|
}
|
|
}
|
|
return true;
|
|
}
|
|
return null;
|
|
};
|
|
// Resource INDIVIDUAL-Column Area Resizing
|
|
// ------------------------------------------------------------------------------------------
|
|
_this.handleColWidthChange = function (colWidths) {
|
|
_this.setState({
|
|
spreadsheetColWidths: colWidths,
|
|
});
|
|
};
|
|
_this.state = {
|
|
resourceAreaWidth: context.options.resourceAreaWidth,
|
|
spreadsheetColWidths: [],
|
|
};
|
|
return _this;
|
|
}
|
|
ResourceTimelineView.prototype.render = function () {
|
|
var _this = this;
|
|
var _a = this, props = _a.props, state = _a.state, context = _a.context;
|
|
var options = context.options, viewSpec = context.viewSpec;
|
|
var _b = this.processColOptions(context.options), superHeaderRendering = _b.superHeaderRendering, groupSpecs = _b.groupSpecs, orderSpecs = _b.orderSpecs, isVGrouping = _b.isVGrouping, colSpecs = _b.colSpecs;
|
|
var tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
|
|
var rowNodes = this.rowNodes = this.buildRowNodes(props.resourceStore, groupSpecs, orderSpecs, isVGrouping, props.resourceEntityExpansions, options.resourcesInitiallyExpanded);
|
|
var extraClassNames = [
|
|
'fc-resource-timeline',
|
|
this.hasNesting(rowNodes) ? '' : 'fc-resource-timeline-flat',
|
|
'fc-timeline',
|
|
options.eventOverlap === false ? 'fc-timeline-overlap-disabled' : 'fc-timeline-overlap-enabled',
|
|
];
|
|
var slotMinWidth = options.slotMinWidth;
|
|
var slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
|
|
return (createElement(ViewRoot, { viewSpec: viewSpec }, function (rootElRef, classNames) { return (createElement("div", { ref: rootElRef, className: extraClassNames.concat(classNames).join(' ') },
|
|
createElement(ResourceTimelineViewLayout, { ref: _this.layoutRef, forPrint: props.forPrint, isHeightAuto: props.isHeightAuto, spreadsheetCols: buildSpreadsheetCols(colSpecs, state.spreadsheetColWidths, ''), spreadsheetHeaderRows: function (contentArg) { return (createElement(SpreadsheetHeader // TODO: rename to SpreadsheetHeaderRows
|
|
, { superHeaderRendering: superHeaderRendering, colSpecs: colSpecs, onColWidthChange: _this.handleColWidthChange, rowInnerHeights: contentArg.rowSyncHeights })); }, spreadsheetBodyRows: function (contentArg) { return (createElement(Fragment, null, _this.renderSpreadsheetRows(rowNodes, colSpecs, contentArg.rowSyncHeights))); }, timeCols: slatCols, timeHeaderContent: function (contentArg) { return (createElement(TimelineHeader, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, dateProfile: props.dateProfile, tDateProfile: tDateProfile, slatCoords: state.slatCoords, rowInnerHeights: contentArg.rowSyncHeights, onMaxCushionWidth: slotMinWidth ? null : _this.handleMaxCushionWidth })); }, timeBodyContent: function (contentArg) { return (createElement(ResourceTimelineGrid, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, expandRows: contentArg.expandRows, tDateProfile: tDateProfile, rowNodes: rowNodes, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, resourceStore: props.resourceStore, nextDayThreshold: context.options.nextDayThreshold, rowInnerHeights: contentArg.rowSyncHeights, onSlatCoords: _this.handleSlatCoords, onRowCoords: _this.handleRowCoords, onScrollLeftRequest: _this.handleScrollLeftRequest, onRowHeightChange: contentArg.reportRowHeightChange })); } }))); }));
|
|
};
|
|
ResourceTimelineView.prototype.renderSpreadsheetRows = function (nodes, colSpecs, rowSyncHeights) {
|
|
return nodes.map(function (node, index) {
|
|
if (node.group) {
|
|
return (createElement(SpreadsheetGroupRow, { key: node.id, id: node.id, spreadsheetColCnt: colSpecs.length, isExpanded: node.isExpanded, group: node.group, innerHeight: rowSyncHeights[index] || '' }));
|
|
}
|
|
if (node.resource) {
|
|
return (createElement(SpreadsheetRow, { key: node.id, colSpecs: colSpecs, rowSpans: node.rowSpans, depth: node.depth, isExpanded: node.isExpanded, hasChildren: node.hasChildren, resource: node.resource, innerHeight: rowSyncHeights[index] || '' }));
|
|
}
|
|
return null;
|
|
});
|
|
};
|
|
ResourceTimelineView.prototype.componentDidMount = function () {
|
|
this.renderedRowNodes = this.rowNodes;
|
|
this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
|
|
};
|
|
ResourceTimelineView.prototype.getSnapshotBeforeUpdate = function () {
|
|
if (!this.props.forPrint) { // because print-view is always zero?
|
|
return { resourceScroll: this.queryResourceScroll() };
|
|
}
|
|
return {};
|
|
};
|
|
ResourceTimelineView.prototype.componentDidUpdate = function (prevProps, prevState, snapshot) {
|
|
this.renderedRowNodes = this.rowNodes;
|
|
this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
|
|
if (snapshot.resourceScroll) {
|
|
this.handleScrollRequest(snapshot.resourceScroll); // TODO: this gets triggered too often
|
|
}
|
|
};
|
|
ResourceTimelineView.prototype.componentWillUnmount = function () {
|
|
this.scrollResponder.detach();
|
|
};
|
|
ResourceTimelineView.prototype.computeFallbackSlotMinWidth = function (tDateProfile) {
|
|
return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
|
|
};
|
|
ResourceTimelineView.prototype.queryResourceScroll = function () {
|
|
var _a = this, rowCoords = _a.rowCoords, renderedRowNodes = _a.renderedRowNodes;
|
|
if (rowCoords) {
|
|
var layout = this.layoutRef.current;
|
|
var trBottoms = rowCoords.bottoms;
|
|
var scrollTop = layout.getResourceScroll();
|
|
var scroll_1 = {};
|
|
for (var i = 0; i < trBottoms.length; i += 1) {
|
|
var rowNode = renderedRowNodes[i];
|
|
var elBottom = trBottoms[i] - scrollTop; // from the top of the scroller
|
|
if (elBottom > 0) {
|
|
scroll_1.rowId = rowNode.id;
|
|
scroll_1.fromBottom = elBottom;
|
|
break;
|
|
}
|
|
}
|
|
return scroll_1;
|
|
}
|
|
return null;
|
|
};
|
|
return ResourceTimelineView;
|
|
}(BaseComponent));
|
|
ResourceTimelineView.addStateEquality({
|
|
spreadsheetColWidths: isArraysEqual,
|
|
});
|
|
function buildRowIndex(rowNodes) {
|
|
var rowIdToIndex = {};
|
|
for (var i = 0; i < rowNodes.length; i += 1) {
|
|
rowIdToIndex[rowNodes[i].id] = i;
|
|
}
|
|
return rowIdToIndex;
|
|
}
|
|
function buildSpreadsheetCols(colSpecs, forcedWidths, fallbackWidth) {
|
|
if (fallbackWidth === void 0) { fallbackWidth = ''; }
|
|
return colSpecs.map(function (colSpec, i) { return ({
|
|
className: colSpec.isMain ? 'fc-main-col' : '',
|
|
width: forcedWidths[i] || colSpec.width || fallbackWidth,
|
|
}); });
|
|
}
|
|
function hasNesting(nodes) {
|
|
for (var _i = 0, nodes_1 = nodes; _i < nodes_1.length; _i++) {
|
|
var node = nodes_1[_i];
|
|
if (node.group) {
|
|
return true;
|
|
}
|
|
if (node.resource) {
|
|
if (node.hasChildren) {
|
|
return true;
|
|
}
|
|
}
|
|
}
|
|
return false;
|
|
}
|
|
function processColOptions(options) {
|
|
var allColSpecs = options.resourceAreaColumns || [];
|
|
var superHeaderRendering = null;
|
|
if (!allColSpecs.length) {
|
|
allColSpecs.push({
|
|
headerClassNames: options.resourceAreaHeaderClassNames,
|
|
headerContent: options.resourceAreaHeaderContent || 'Resources',
|
|
headerDidMount: options.resourceAreaHeaderDidMount,
|
|
headerWillUnmount: options.resourceAreaHeaderWillUnmount,
|
|
});
|
|
}
|
|
else if (options.resourceAreaHeaderContent) { // weird way to determine if content
|
|
superHeaderRendering = {
|
|
headerClassNames: options.resourceAreaHeaderClassNames,
|
|
headerContent: options.resourceAreaHeaderContent,
|
|
headerDidMount: options.resourceAreaHeaderDidMount,
|
|
headerWillUnmount: options.resourceAreaHeaderWillUnmount,
|
|
};
|
|
}
|
|
var plainColSpecs = [];
|
|
var groupColSpecs = []; // part of the colSpecs, but filtered out in order to put first
|
|
var groupSpecs = [];
|
|
var isVGrouping = false;
|
|
for (var _i = 0, allColSpecs_1 = allColSpecs; _i < allColSpecs_1.length; _i++) {
|
|
var colSpec = allColSpecs_1[_i];
|
|
if (colSpec.group) {
|
|
groupColSpecs.push(__assign(__assign({}, colSpec), { cellClassNames: colSpec.cellClassNames || options.resourceGroupLabelClassNames, cellContent: colSpec.cellContent || options.resourceGroupLabelContent, cellDidMount: colSpec.cellDidMount || options.resourceGroupLabelDidMount, cellWillUnmount: colSpec.cellWillUnmount || options.resourceGroupLaneWillUnmount }));
|
|
}
|
|
else {
|
|
plainColSpecs.push(colSpec);
|
|
}
|
|
}
|
|
// BAD: mutates a user-supplied option
|
|
var mainColSpec = plainColSpecs[0];
|
|
mainColSpec.isMain = true;
|
|
mainColSpec.cellClassNames = mainColSpec.cellClassNames || options.resourceLabelClassNames;
|
|
mainColSpec.cellContent = mainColSpec.cellContent || options.resourceLabelContent;
|
|
mainColSpec.cellDidMount = mainColSpec.cellDidMount || options.resourceLabelDidMount;
|
|
mainColSpec.cellWillUnmount = mainColSpec.cellWillUnmount || options.resourceLabelWillUnmount;
|
|
if (groupColSpecs.length) {
|
|
groupSpecs = groupColSpecs;
|
|
isVGrouping = true;
|
|
}
|
|
else {
|
|
var hGroupField = options.resourceGroupField;
|
|
if (hGroupField) {
|
|
groupSpecs.push({
|
|
field: hGroupField,
|
|
labelClassNames: options.resourceGroupLabelClassNames,
|
|
labelContent: options.resourceGroupLabelContent,
|
|
labelDidMount: options.resourceGroupLabelDidMount,
|
|
labelWillUnmount: options.resourceGroupLabelWillUnmount,
|
|
laneClassNames: options.resourceGroupLaneClassNames,
|
|
laneContent: options.resourceGroupLaneContent,
|
|
laneDidMount: options.resourceGroupLaneDidMount,
|
|
laneWillUnmount: options.resourceGroupLaneWillUnmount,
|
|
});
|
|
}
|
|
}
|
|
var allOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
|
|
var plainOrderSpecs = [];
|
|
for (var _a = 0, allOrderSpecs_1 = allOrderSpecs; _a < allOrderSpecs_1.length; _a++) {
|
|
var orderSpec = allOrderSpecs_1[_a];
|
|
var isGroup = false;
|
|
for (var _b = 0, groupSpecs_1 = groupSpecs; _b < groupSpecs_1.length; _b++) {
|
|
var groupSpec = groupSpecs_1[_b];
|
|
if (groupSpec.field === orderSpec.field) {
|
|
groupSpec.order = orderSpec.order; // -1, 0, 1
|
|
isGroup = true;
|
|
break;
|
|
}
|
|
}
|
|
if (!isGroup) {
|
|
plainOrderSpecs.push(orderSpec);
|
|
}
|
|
}
|
|
return {
|
|
superHeaderRendering: superHeaderRendering,
|
|
isVGrouping: isVGrouping,
|
|
groupSpecs: groupSpecs,
|
|
colSpecs: groupColSpecs.concat(plainColSpecs),
|
|
orderSpecs: plainOrderSpecs,
|
|
};
|
|
}
|
|
|
|
var resourceTimelinePlugin = createPlugin({
|
|
deps: [
|
|
premiumCommonPlugin,
|
|
resourceCommonPlugin,
|
|
timelinePlugin,
|
|
],
|
|
initialView: 'resourceTimelineDay',
|
|
views: {
|
|
resourceTimeline: {
|
|
type: 'timeline',
|
|
component: ResourceTimelineView,
|
|
needsResourceData: true,
|
|
resourceAreaWidth: '30%',
|
|
resourcesInitiallyExpanded: true,
|
|
eventResizableFromStart: true, // TODO: not DRY with this same setting in the main timeline config
|
|
},
|
|
resourceTimelineDay: {
|
|
type: 'resourceTimeline',
|
|
duration: { days: 1 },
|
|
},
|
|
resourceTimelineWeek: {
|
|
type: 'resourceTimeline',
|
|
duration: { weeks: 1 },
|
|
},
|
|
resourceTimelineMonth: {
|
|
type: 'resourceTimeline',
|
|
duration: { months: 1 },
|
|
},
|
|
resourceTimelineYear: {
|
|
type: 'resourceTimeline',
|
|
duration: { years: 1 },
|
|
},
|
|
},
|
|
});
|
|
|
|
globalPlugins.push(interactionPlugin, dayGridPlugin, timeGridPlugin, listPlugin, plugin$1, plugin, googleCalendarPlugin, scrollGridPlugin, adaptivePlugin, timelinePlugin, resourceCommonPlugin, resourceDayGridPlugin, resourceTimeGridPlugin, resourceTimelinePlugin);
|
|
|
|
exports.AbstractResourceDayTableModel = AbstractResourceDayTableModel;
|
|
exports.BASE_OPTION_DEFAULTS = BASE_OPTION_DEFAULTS;
|
|
exports.BASE_OPTION_REFINERS = BASE_OPTION_REFINERS;
|
|
exports.BaseComponent = BaseComponent;
|
|
exports.BgEvent = BgEvent;
|
|
exports.BootstrapTheme = BootstrapTheme$1;
|
|
exports.Calendar = Calendar;
|
|
exports.CalendarApi = CalendarApi;
|
|
exports.CalendarContent = CalendarContent;
|
|
exports.CalendarDataManager = CalendarDataManager;
|
|
exports.CalendarDataProvider = CalendarDataProvider;
|
|
exports.CalendarRoot = CalendarRoot;
|
|
exports.Component = Component;
|
|
exports.ContentHook = ContentHook;
|
|
exports.CustomContentRenderContext = CustomContentRenderContext;
|
|
exports.DEFAULT_RESOURCE_ORDER = DEFAULT_RESOURCE_ORDER;
|
|
exports.DateComponent = DateComponent;
|
|
exports.DateEnv = DateEnv;
|
|
exports.DateProfileGenerator = DateProfileGenerator;
|
|
exports.DayCellContent = DayCellContent;
|
|
exports.DayCellRoot = DayCellRoot;
|
|
exports.DayGridView = DayTableView;
|
|
exports.DayHeader = DayHeader;
|
|
exports.DayResourceTableModel = DayResourceTableModel;
|
|
exports.DaySeriesModel = DaySeriesModel;
|
|
exports.DayTable = DayTable;
|
|
exports.DayTableModel = DayTableModel;
|
|
exports.DayTableSlicer = DayTableSlicer;
|
|
exports.DayTimeCols = DayTimeCols;
|
|
exports.DayTimeColsSlicer = DayTimeColsSlicer;
|
|
exports.DayTimeColsView = DayTimeColsView;
|
|
exports.DelayedRunner = DelayedRunner;
|
|
exports.Draggable = ExternalDraggable;
|
|
exports.ElementDragging = ElementDragging;
|
|
exports.ElementScrollController = ElementScrollController;
|
|
exports.Emitter = Emitter;
|
|
exports.EventApi = EventApi;
|
|
exports.EventRoot = EventRoot;
|
|
exports.EventSourceApi = EventSourceApi;
|
|
exports.FeaturefulElementDragging = FeaturefulElementDragging;
|
|
exports.Fragment = Fragment;
|
|
exports.Interaction = Interaction;
|
|
exports.ListView = ListView;
|
|
exports.MoreLinkRoot = MoreLinkRoot;
|
|
exports.MountHook = MountHook;
|
|
exports.NamedTimeZoneImpl = NamedTimeZoneImpl;
|
|
exports.NowIndicatorRoot = NowIndicatorRoot;
|
|
exports.NowTimer = NowTimer;
|
|
exports.PointerDragging = PointerDragging;
|
|
exports.PositionCache = PositionCache;
|
|
exports.RefMap = RefMap;
|
|
exports.RenderHook = RenderHook;
|
|
exports.ResourceApi = ResourceApi;
|
|
exports.ResourceDayHeader = ResourceDayHeader;
|
|
exports.ResourceDayTable = ResourceDayTable;
|
|
exports.ResourceDayTableModel = ResourceDayTableModel;
|
|
exports.ResourceDayTableView = ResourceDayTableView;
|
|
exports.ResourceDayTimeCols = ResourceDayTimeCols;
|
|
exports.ResourceDayTimeColsView = ResourceDayTimeColsView;
|
|
exports.ResourceLabelRoot = ResourceLabelRoot;
|
|
exports.ResourceSplitter = ResourceSplitter;
|
|
exports.ResourceTimelineLane = ResourceTimelineLane;
|
|
exports.ResourceTimelineView = ResourceTimelineView;
|
|
exports.ScrollController = ScrollController;
|
|
exports.ScrollGrid = ScrollGrid;
|
|
exports.ScrollResponder = ScrollResponder;
|
|
exports.Scroller = Scroller;
|
|
exports.SegHierarchy = SegHierarchy;
|
|
exports.SimpleScrollGrid = SimpleScrollGrid;
|
|
exports.Slicer = Slicer;
|
|
exports.Splitter = Splitter;
|
|
exports.SpreadsheetRow = SpreadsheetRow;
|
|
exports.StandardEvent = StandardEvent;
|
|
exports.Table = Table;
|
|
exports.TableDateCell = TableDateCell;
|
|
exports.TableDowCell = TableDowCell;
|
|
exports.TableView = TableView;
|
|
exports.Theme = Theme;
|
|
exports.ThirdPartyDraggable = ThirdPartyDraggable;
|
|
exports.TimeCols = TimeCols;
|
|
exports.TimeColsSlatsCoords = TimeColsSlatsCoords;
|
|
exports.TimeColsView = TimeColsView;
|
|
exports.TimelineCoords = TimelineCoords;
|
|
exports.TimelineHeader = TimelineHeader;
|
|
exports.TimelineHeaderRows = TimelineHeaderRows;
|
|
exports.TimelineLane = TimelineLane;
|
|
exports.TimelineLaneBg = TimelineLaneBg;
|
|
exports.TimelineLaneSlicer = TimelineLaneSlicer;
|
|
exports.TimelineSlats = TimelineSlats;
|
|
exports.TimelineView = TimelineView;
|
|
exports.VResourceJoiner = VResourceJoiner;
|
|
exports.VResourceSplitter = VResourceSplitter;
|
|
exports.ViewApi = ViewApi;
|
|
exports.ViewContextType = ViewContextType;
|
|
exports.ViewRoot = ViewRoot;
|
|
exports.WeekNumberRoot = WeekNumberRoot;
|
|
exports.WindowScrollController = WindowScrollController;
|
|
exports.addDays = addDays;
|
|
exports.addDurations = addDurations;
|
|
exports.addMs = addMs;
|
|
exports.addWeeks = addWeeks;
|
|
exports.allowContextMenu = allowContextMenu;
|
|
exports.allowSelection = allowSelection;
|
|
exports.applyMutationToEventStore = applyMutationToEventStore;
|
|
exports.applyStyle = applyStyle;
|
|
exports.applyStyleProp = applyStyleProp;
|
|
exports.asCleanDays = asCleanDays;
|
|
exports.asRoughMinutes = asRoughMinutes;
|
|
exports.asRoughMs = asRoughMs;
|
|
exports.asRoughSeconds = asRoughSeconds;
|
|
exports.binarySearch = binarySearch;
|
|
exports.buildClassNameNormalizer = buildClassNameNormalizer;
|
|
exports.buildDayRanges = buildDayRanges;
|
|
exports.buildDayTableModel = buildDayTableModel;
|
|
exports.buildEntryKey = buildEntryKey;
|
|
exports.buildEventApis = buildEventApis;
|
|
exports.buildEventRangeKey = buildEventRangeKey;
|
|
exports.buildHashFromArray = buildHashFromArray;
|
|
exports.buildIsoString = buildIsoString;
|
|
exports.buildNavLinkAttrs = buildNavLinkAttrs;
|
|
exports.buildResourceFields = buildResourceFields;
|
|
exports.buildRowNodes = buildRowNodes;
|
|
exports.buildSegCompareObj = buildSegCompareObj;
|
|
exports.buildSegTimeText = buildSegTimeText;
|
|
exports.buildSlatCols = buildSlatCols;
|
|
exports.buildSlatMetas = buildSlatMetas;
|
|
exports.buildTimeColsModel = buildTimeColsModel;
|
|
exports.buildTimelineDateProfile = buildTimelineDateProfile;
|
|
exports.collectFromHash = collectFromHash;
|
|
exports.combineEventUis = combineEventUis;
|
|
exports.compareByFieldSpec = compareByFieldSpec;
|
|
exports.compareByFieldSpecs = compareByFieldSpecs;
|
|
exports.compareNumbers = compareNumbers;
|
|
exports.compareObjs = compareObjs;
|
|
exports.computeEarliestSegStart = computeEarliestSegStart;
|
|
exports.computeEdges = computeEdges;
|
|
exports.computeFallbackHeaderFormat = computeFallbackHeaderFormat;
|
|
exports.computeHeightAndMargins = computeHeightAndMargins;
|
|
exports.computeInnerRect = computeInnerRect;
|
|
exports.computeRect = computeRect;
|
|
exports.computeSegDraggable = computeSegDraggable;
|
|
exports.computeSegEndResizable = computeSegEndResizable;
|
|
exports.computeSegStartResizable = computeSegStartResizable;
|
|
exports.computeShrinkWidth = computeShrinkWidth;
|
|
exports.computeSmallestCellWidth = computeSmallestCellWidth;
|
|
exports.computeVisibleDayRange = computeVisibleDayRange;
|
|
exports.config = config;
|
|
exports.constrainPoint = constrainPoint;
|
|
exports.coordToCss = coordToCss;
|
|
exports.coordsToCss = coordsToCss;
|
|
exports.createAriaClickAttrs = createAriaClickAttrs;
|
|
exports.createContext = createContext;
|
|
exports.createDuration = createDuration;
|
|
exports.createElement = createElement;
|
|
exports.createEmptyEventStore = createEmptyEventStore;
|
|
exports.createEventInstance = createEventInstance;
|
|
exports.createEventUi = createEventUi;
|
|
exports.createFormatter = createFormatter;
|
|
exports.createPlugin = createPlugin;
|
|
exports.createPortal = createPortal;
|
|
exports.createRef = createRef;
|
|
exports.diffDates = diffDates;
|
|
exports.diffDayAndTime = diffDayAndTime;
|
|
exports.diffDays = diffDays;
|
|
exports.diffPoints = diffPoints;
|
|
exports.diffWeeks = diffWeeks;
|
|
exports.diffWholeDays = diffWholeDays;
|
|
exports.diffWholeWeeks = diffWholeWeeks;
|
|
exports.disableCursor = disableCursor;
|
|
exports.elementClosest = elementClosest;
|
|
exports.elementMatches = elementMatches;
|
|
exports.enableCursor = enableCursor;
|
|
exports.eventTupleToStore = eventTupleToStore;
|
|
exports.filterEventStoreDefs = filterEventStoreDefs;
|
|
exports.filterHash = filterHash;
|
|
exports.findDirectChildren = findDirectChildren;
|
|
exports.findElements = findElements;
|
|
exports.flattenResources = flattenResources;
|
|
exports.flexibleCompare = flexibleCompare;
|
|
exports.flushSync = flushSync;
|
|
exports.formatDate = formatDate;
|
|
exports.formatDayString = formatDayString;
|
|
exports.formatIsoTimeString = formatIsoTimeString;
|
|
exports.formatRange = formatRange;
|
|
exports.getAllowYScrolling = getAllowYScrolling;
|
|
exports.getCanVGrowWithinCell = getCanVGrowWithinCell;
|
|
exports.getClippingParents = getClippingParents;
|
|
exports.getDateMeta = getDateMeta;
|
|
exports.getDayClassNames = getDayClassNames;
|
|
exports.getDefaultEventEnd = getDefaultEventEnd;
|
|
exports.getElRoot = getElRoot;
|
|
exports.getElSeg = getElSeg;
|
|
exports.getEntrySpanEnd = getEntrySpanEnd;
|
|
exports.getEventClassNames = getEventClassNames;
|
|
exports.getEventTargetViaRoot = getEventTargetViaRoot;
|
|
exports.getIsRtlScrollbarOnLeft = getIsRtlScrollbarOnLeft;
|
|
exports.getPublicId = getPublicId;
|
|
exports.getRectCenter = getRectCenter;
|
|
exports.getRelevantEvents = getRelevantEvents;
|
|
exports.getScrollGridClassNames = getScrollGridClassNames;
|
|
exports.getScrollbarWidths = getScrollbarWidths;
|
|
exports.getSectionClassNames = getSectionClassNames;
|
|
exports.getSectionHasLiquidHeight = getSectionHasLiquidHeight;
|
|
exports.getSegAnchorAttrs = getSegAnchorAttrs;
|
|
exports.getSegMeta = getSegMeta;
|
|
exports.getSlotClassNames = getSlotClassNames;
|
|
exports.getStickyFooterScrollbar = getStickyFooterScrollbar;
|
|
exports.getStickyHeaderDates = getStickyHeaderDates;
|
|
exports.getUnequalProps = getUnequalProps;
|
|
exports.getUniqueDomId = getUniqueDomId;
|
|
exports.globalLocales = globalLocales;
|
|
exports.globalPlugins = globalPlugins;
|
|
exports.greatestDurationDenominator = greatestDurationDenominator;
|
|
exports.groupIntersectingEntries = groupIntersectingEntries;
|
|
exports.guid = guid;
|
|
exports.hasBgRendering = hasBgRendering;
|
|
exports.hasShrinkWidth = hasShrinkWidth;
|
|
exports.identity = identity;
|
|
exports.interactionSettingsStore = interactionSettingsStore;
|
|
exports.interactionSettingsToStore = interactionSettingsToStore;
|
|
exports.intersectRanges = intersectRanges;
|
|
exports.intersectRects = intersectRects;
|
|
exports.intersectSpans = intersectSpans;
|
|
exports.isArraysEqual = isArraysEqual;
|
|
exports.isColPropsEqual = isColPropsEqual;
|
|
exports.isDateSelectionValid = isDateSelectionValid;
|
|
exports.isDateSpansEqual = isDateSpansEqual;
|
|
exports.isGroupsEqual = isGroupsEqual;
|
|
exports.isInt = isInt;
|
|
exports.isInteractionValid = isInteractionValid;
|
|
exports.isMultiDayRange = isMultiDayRange;
|
|
exports.isPropsEqual = isPropsEqual;
|
|
exports.isPropsValid = isPropsValid;
|
|
exports.isValidDate = isValidDate$1;
|
|
exports.joinSpans = joinSpans;
|
|
exports.listenBySelector = listenBySelector;
|
|
exports.mapHash = mapHash;
|
|
exports.memoize = memoize;
|
|
exports.memoizeArraylike = memoizeArraylike;
|
|
exports.memoizeHashlike = memoizeHashlike;
|
|
exports.memoizeObjArg = memoizeObjArg;
|
|
exports.mergeEventStores = mergeEventStores;
|
|
exports.multiplyDuration = multiplyDuration;
|
|
exports.padStart = padStart;
|
|
exports.parseBusinessHours = parseBusinessHours;
|
|
exports.parseClassNames = parseClassNames;
|
|
exports.parseDragMeta = parseDragMeta;
|
|
exports.parseEventDef = parseEventDef;
|
|
exports.parseFieldSpecs = parseFieldSpecs;
|
|
exports.parseMarker = parse;
|
|
exports.pointInsideRect = pointInsideRect;
|
|
exports.preventContextMenu = preventContextMenu;
|
|
exports.preventDefault = preventDefault;
|
|
exports.preventSelection = preventSelection;
|
|
exports.rangeContainsMarker = rangeContainsMarker;
|
|
exports.rangeContainsRange = rangeContainsRange;
|
|
exports.rangesEqual = rangesEqual;
|
|
exports.rangesIntersect = rangesIntersect;
|
|
exports.refineEventDef = refineEventDef;
|
|
exports.refineProps = refineProps;
|
|
exports.removeElement = removeElement;
|
|
exports.removeExact = removeExact;
|
|
exports.render = render;
|
|
exports.renderChunkContent = renderChunkContent;
|
|
exports.renderFill = renderFill;
|
|
exports.renderMicroColGroup = renderMicroColGroup;
|
|
exports.renderScrollShim = renderScrollShim;
|
|
exports.requestJson = requestJson;
|
|
exports.sanitizeShrinkWidth = sanitizeShrinkWidth;
|
|
exports.setElSeg = setElSeg;
|
|
exports.setRef = setRef;
|
|
exports.setScrollFromLeftEdge = setScrollFromLeftEdge;
|
|
exports.sliceEventStore = sliceEventStore;
|
|
exports.sliceEvents = sliceEvents;
|
|
exports.sortEventSegs = sortEventSegs;
|
|
exports.startOfDay = startOfDay;
|
|
exports.translateRect = translateRect;
|
|
exports.triggerDateSelect = triggerDateSelect;
|
|
exports.unmountComponentAtNode = unmountComponentAtNode;
|
|
exports.unpromisify = unpromisify;
|
|
exports.version = version;
|
|
exports.whenTransitionDone = whenTransitionDone;
|
|
exports.wholeDivideDurations = wholeDivideDurations;
|
|
|
|
Object.defineProperty(exports, '__esModule', { value: true });
|
|
|
|
return exports;
|
|
|
|
}({}));
|